From e2d873e6f06c6d4539302653d63540ba0b6f5e48 Mon Sep 17 00:00:00 2001
From: Richard Worth <rdworth@gmail.com>
Date: Thu, 17 Sep 2009 10:39:12 +0000
Subject: renamed all ui.*.js files to jquery.ui.*.js, all effects.*.js files
 to jquery.effects.*.js per announcement and discussion here
 http://groups.google.com/group/jquery-ui-dev/msg/d565a0c56e0cb935

---
 build/build.xml                                    |    2 +-
 build/build/style.xsl                              |    6 +-
 demos/accordion/collapsible.html                   |    4 +-
 demos/accordion/custom-icons.html                  |    4 +-
 demos/accordion/default.html                       |    4 +-
 demos/accordion/fillspace.html                     |    6 +-
 demos/accordion/mouseover.html                     |    4 +-
 demos/accordion/no-auto-height.html                |    4 +-
 demos/accordion/sortable.html                      |    6 +-
 demos/addClass/default.html                        |    2 +-
 demos/animate/default.html                         |    2 +-
 demos/datepicker/alt-field.html                    |    4 +-
 demos/datepicker/buttonbar.html                    |    4 +-
 demos/datepicker/date-formats.html                 |    4 +-
 demos/datepicker/default.html                      |    4 +-
 demos/datepicker/dropdown-month-year.html          |    4 +-
 demos/datepicker/event-search.html                 |    4 +-
 demos/datepicker/icon-trigger.html                 |    4 +-
 demos/datepicker/inline.html                       |    4 +-
 demos/datepicker/localization.html                 |   96 +-
 demos/datepicker/min-max.html                      |    4 +-
 demos/datepicker/multiple-calendars.html           |    4 +-
 demos/datepicker/other-months.html                 |    4 +-
 demos/datepicker/show-week.html                    |    4 +-
 demos/dialog/animated.html                         |   18 +-
 demos/dialog/default.html                          |   12 +-
 demos/dialog/modal-confirmation.html               |   12 +-
 demos/dialog/modal-form.html                       |   14 +-
 demos/dialog/modal-message.html                    |   12 +-
 demos/dialog/modal.html                            |   12 +-
 demos/draggable/constrain-movement.html            |    4 +-
 demos/draggable/cursor-style.html                  |    4 +-
 demos/draggable/default.html                       |    4 +-
 demos/draggable/delay-start.html                   |    4 +-
 demos/draggable/events.html                        |    4 +-
 demos/draggable/handle.html                        |    4 +-
 demos/draggable/revert.html                        |    4 +-
 demos/draggable/scroll.html                        |    4 +-
 demos/draggable/snap-to.html                       |    4 +-
 demos/draggable/sortable.html                      |    6 +-
 demos/draggable/visual-feedback.html               |    4 +-
 demos/droppable/accepted-elements.html             |    6 +-
 demos/droppable/default.html                       |    6 +-
 demos/droppable/photo-manager.html                 |   10 +-
 demos/droppable/propagation.html                   |    6 +-
 demos/droppable/revert.html                        |    6 +-
 demos/droppable/visual-feedback.html               |    6 +-
 demos/effect/default.html                          |   26 +-
 demos/effect/easing.html                           |    2 +-
 demos/hide/default.html                            |   26 +-
 demos/index.html                                   |  146 +-
 demos/position/cycler.html                         |    6 +-
 demos/position/default.html                        |    6 +-
 demos/progressbar/animated.html                    |    4 +-
 demos/progressbar/default.html                     |    4 +-
 demos/progressbar/resize.html                      |    6 +-
 demos/removeClass/default.html                     |    2 +-
 demos/resizable/animate.html                       |    4 +-
 demos/resizable/aspect-ratio.html                  |    4 +-
 demos/resizable/constrain-area.html                |    4 +-
 demos/resizable/default.html                       |    4 +-
 demos/resizable/delay-start.html                   |    4 +-
 demos/resizable/helper.html                        |    4 +-
 demos/resizable/max-min.html                       |    4 +-
 demos/resizable/snap-to-grid.html                  |    4 +-
 demos/resizable/synchronous-resize.html            |    4 +-
 demos/resizable/textarea.html                      |    4 +-
 demos/resizable/visual-feedback.html               |    4 +-
 demos/selectable/default.html                      |    4 +-
 demos/selectable/display-grid.html                 |    4 +-
 demos/selectable/serialize.html                    |    4 +-
 demos/show/default.html                            |   26 +-
 demos/slider/colorpicker.html                      |    4 +-
 demos/slider/default.html                          |    4 +-
 demos/slider/hotelrooms.html                       |    4 +-
 demos/slider/multiple-vertical.html                |    4 +-
 demos/slider/range-vertical.html                   |    4 +-
 demos/slider/range.html                            |    4 +-
 demos/slider/rangemax.html                         |    4 +-
 demos/slider/rangemin.html                         |    4 +-
 demos/slider/side-scroll.html                      |    4 +-
 demos/slider/slider-vertical.html                  |    4 +-
 demos/slider/steps.html                            |    4 +-
 demos/slider/tabs.html                             |    6 +-
 demos/sortable/connect-lists-through-tabs.html     |    8 +-
 demos/sortable/connect-lists.html                  |    4 +-
 demos/sortable/default.html                        |    4 +-
 demos/sortable/delay-start.html                    |    4 +-
 demos/sortable/display-grid.html                   |    4 +-
 demos/sortable/empty-lists.html                    |    4 +-
 demos/sortable/items.html                          |    4 +-
 demos/sortable/placeholder.html                    |    4 +-
 demos/sortable/portlets.html                       |    4 +-
 demos/switchClass/default.html                     |    2 +-
 demos/tabs/ajax.html                               |    4 +-
 demos/tabs/bottom.html                             |    4 +-
 demos/tabs/collapsible.html                        |    4 +-
 demos/tabs/default.html                            |    4 +-
 demos/tabs/manipulation.html                       |    6 +-
 demos/tabs/mouseover.html                          |    4 +-
 demos/tabs/sortable.html                           |    6 +-
 demos/tabs/vertical.html                           |    4 +-
 demos/toggle/default.html                          |   26 +-
 demos/toggleClass/default.html                     |    2 +-
 tests/unit/accordion/accordion.html                |    4 +-
 tests/unit/all.html                                |   24 +-
 tests/unit/all_2.html                              |   24 +-
 tests/unit/core/core.html                          |    2 +-
 tests/unit/datepicker/datepicker.html              |    8 +-
 tests/unit/defaults.html                           |   24 +-
 tests/unit/dialog/dialog.html                      |   12 +-
 tests/unit/draggable/draggable.html                |    4 +-
 tests/unit/droppable/droppable.html                |    6 +-
 tests/unit/index.html                              |   24 +-
 tests/unit/position/position.html                  |    2 +-
 tests/unit/progressbar/progressbar.html            |    4 +-
 tests/unit/resizable/resizable.html                |    4 +-
 tests/unit/selectable/selectable.html              |    4 +-
 tests/unit/slider/slider.html                      |    4 +-
 tests/unit/sortable/sortable.html                  |    4 +-
 tests/unit/tabs/tabs.html                          |    4 +-
 tests/visual/accordion/accordion.html              |    4 +-
 tests/visual/accordion/accordion_dl.html           |    4 +-
 .../visual/accordion/accordion_method_destroy.html |    4 +-
 .../visual/accordion/accordion_method_disable.html |    4 +-
 .../accordion_option_animated_bounceslide.html     |    6 +-
 .../accordion_option_animated_easeslide.html       |    6 +-
 .../accordion/accordion_option_animated_false.html |    4 +-
 .../accordion/accordion_option_animated_slide.html |    4 +-
 .../accordion/accordion_option_animated_true.html  |    4 +-
 .../accordion_option_autoHeight_false.html         |    4 +-
 .../accordion_option_autoHeight_true.html          |    4 +-
 .../accordion/accordion_option_fillSpace_true.html |    4 +-
 .../accordion_option_navigation_true.html          |    6 +-
 tests/visual/accordion/accordion_ticket_4322.html  |    4 +-
 tests/visual/accordion/accordion_ticket_4331.html  |    4 +-
 tests/visual/accordion/accordion_ticket_4444.html  |    4 +-
 tests/visual/accordion/accordion_ul.html           |    4 +-
 tests/visual/accordion/default.html                |    4 +-
 tests/visual/all.html                              |   24 +-
 .../animate/animate_backgroundColor_hex.html       |    2 +-
 .../animate/animate_backgroundColor_rgb.html       |    2 +-
 tests/visual/animate/animate_color_hex.html        |    2 +-
 tests/visual/animate/animate_color_rgb.html        |    2 +-
 tests/visual/compound/accordion_tabs.html          |    6 +-
 tests/visual/compound/datepicker_dialog.html       |    6 +-
 tests/visual/compound/draggable_accordion.html     |    6 +-
 tests/visual/compound/tabs_tabs.html               |    6 +-
 tests/visual/datepicker/datepicker.html            |    4 +-
 .../visual/datepicker/datepicker_ticket_4240.html  |    4 +-
 tests/visual/datepicker/default.html               |    4 +-
 tests/visual/datepicker/multimonth.html            |    4 +-
 tests/visual/datepicker/viewport.html              |    4 +-
 tests/visual/dialog/default.html                   |   12 +-
 tests/visual/dialog/dialog.html                    |   12 +-
 .../dialog/dialog_on_page_with_large_dom.html      |   12 +-
 .../dialog/dialog_on_page_with_scrollbars.html     |   12 +-
 .../dialog/dialog_option_closeOnEscape_false.html  |   12 +-
 .../dialog/dialog_option_closeOnEscape_true.html   |   12 +-
 tests/visual/dialog/dialog_option_modal_false.html |   12 +-
 tests/visual/dialog/dialog_option_modal_true.html  |   12 +-
 tests/visual/dialog/dialog_ticket_4826.html        |   12 +-
 tests/visual/draggable/default.html                |    4 +-
 tests/visual/draggable/draggable.html              |    4 +-
 tests/visual/draggable/draggable.scroll.html       |    6 +-
 .../draggable_option_containment_array.html        |    4 +-
 .../draggable_option_cursorAt_object.html          |    4 +-
 .../draggable_option_handle_selector.html          |    4 +-
 .../draggable_option_iframeFix_false.html          |    4 +-
 .../draggable_option_iframeFix_selector.html       |    4 +-
 .../draggable/draggable_option_iframeFix_true.html |    4 +-
 tests/visual/droppable/default.html                |    6 +-
 tests/visual/droppable/droppable.html              |    6 +-
 .../droppable/droppable_option_accept_default.html |    6 +-
 .../droppable_option_accept_function.html          |    6 +-
 .../droppable_option_accept_selector.html          |    6 +-
 tests/visual/droppable/droppable_ticket_4087.html  |    6 +-
 tests/visual/droppable/droppable_ticket_4088.html  |    6 +-
 tests/visual/effects.all.html                      |   26 +-
 tests/visual/progressbar/default.html              |    4 +-
 tests/visual/progressbar/progressbar.html          |    4 +-
 tests/visual/resizable/default.html                |    4 +-
 tests/visual/resizable/resizable.html              |    4 +-
 .../resizable_option_aspectRatio_0.5.html          |    4 +-
 .../resizable_option_aspectRatio_1.0.html          |    4 +-
 .../resizable_option_aspectRatio_1.5.html          |    4 +-
 ..._option_aspectRatio_preserve_maxHeight_150.html |    4 +-
 ...e_option_aspectRatio_preserve_maxWidth_150.html |    4 +-
 ...e_option_aspectRatio_preserve_minHeight_50.html |    4 +-
 ...le_option_aspectRatio_preserve_minWidth_50.html |    4 +-
 ...able_option_aspectRatio_preserve_w100xh100.html |    4 +-
 ...zable_option_aspectRatio_preserve_w100xh50.html |    4 +-
 ...zable_option_aspectRatio_preserve_w50xh100.html |    4 +-
 tests/visual/resizable/resizable_ticket_3053.html  |    4 +-
 tests/visual/resizable/resizable_ticket_4199.html  |    4 +-
 tests/visual/resizable/resizable_ticket_4217.html  |    4 +-
 tests/visual/selectable/default.html               |    4 +-
 tests/visual/selectable/selectable.html            |    4 +-
 .../visual/selectable/selectable_ticket_4341.html  |    4 +-
 tests/visual/slider/default.html                   |    4 +-
 tests/visual/slider/default_vertical.html          |    4 +-
 tests/visual/slider/slider.html                    |    4 +-
 tests/visual/slider/slider_horizontal.html         |    4 +-
 tests/visual/slider/slider_horizontal_range.html   |    4 +-
 .../visual/slider/slider_horizontal_range_max.html |    4 +-
 .../visual/slider/slider_horizontal_range_min.html |    4 +-
 .../slider_in_container_with_scrollbars.html       |    4 +-
 tests/visual/slider/slider_method_destroy.html     |    4 +-
 tests/visual/slider/slider_method_disable.html     |    4 +-
 .../visual/slider/slider_option_animate_false.html |    4 +-
 .../visual/slider/slider_option_animate_true.html  |    4 +-
 tests/visual/slider/slider_option_max_3.html       |    4 +-
 tests/visual/slider/slider_option_max_30.html      |    4 +-
 tests/visual/slider/slider_option_max_300.html     |    4 +-
 tests/visual/slider/slider_option_min_-3.html      |    4 +-
 tests/visual/slider/slider_option_min_-30.html     |    4 +-
 tests/visual/slider/slider_option_min_-300.html    |    4 +-
 .../slider_option_orientation_horizontal.html      |    4 +-
 .../slider/slider_option_orientation_vertical.html |    4 +-
 tests/visual/slider/slider_option_range_false.html |    4 +-
 tests/visual/slider/slider_option_range_max.html   |    4 +-
 tests/visual/slider/slider_option_range_min.html   |    4 +-
 tests/visual/slider/slider_option_range_true.html  |    4 +-
 tests/visual/slider/slider_option_step_25.html     |    4 +-
 tests/visual/slider/slider_option_step_5.html      |    4 +-
 tests/visual/slider/slider_option_value_3.html     |    4 +-
 tests/visual/slider/slider_option_value_30.html    |    4 +-
 .../slider/slider_option_values_25_50_75.html      |    4 +-
 .../visual/slider/slider_option_values_25_75.html  |    4 +-
 tests/visual/slider/slider_option_values_50.html   |    4 +-
 tests/visual/slider/slider_ticket_3736.html        |    4 +-
 tests/visual/slider/slider_ticket_3762.html        |    4 +-
 tests/visual/slider/slider_ticket_4385.html        |    4 +-
 tests/visual/slider/slider_vertical.html           |    4 +-
 tests/visual/slider/slider_vertical_range.html     |    4 +-
 tests/visual/slider/slider_vertical_range_max.html |    4 +-
 tests/visual/slider/slider_vertical_range_min.html |    4 +-
 tests/visual/sortable/default.html                 |    4 +-
 tests/visual/sortable/sortable.html                |    4 +-
 tests/visual/sortable/sortable_massive_scale.html  |    6 +-
 .../sortable/sortable_option_revert_false.html     |    4 +-
 .../sortable/sortable_option_revert_true.html      |    4 +-
 tests/visual/sortable/sortable_ticket_4551.html    |    4 +-
 tests/visual/tabs/default.html                     |    4 +-
 tests/visual/tabs/tabs.html                        |    4 +-
 ui/effects.blind.js                                |   49 -
 ui/effects.bounce.js                               |   78 -
 ui/effects.clip.js                                 |   54 -
 ui/effects.core.js                                 |  581 -------
 ui/effects.drop.js                                 |   50 -
 ui/effects.explode.js                              |   79 -
 ui/effects.fold.js                                 |   56 -
 ui/effects.highlight.js                            |   50 -
 ui/effects.pulsate.js                              |   56 -
 ui/effects.scale.js                                |  178 ---
 ui/effects.shake.js                                |   57 -
 ui/effects.slide.js                                |   50 -
 ui/effects.transfer.js                             |   45 -
 ui/i18n/jquery.ui.datepicker-ar.js                 |   24 +
 ui/i18n/jquery.ui.datepicker-az.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-bg.js                 |   24 +
 ui/i18n/jquery.ui.datepicker-ca.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-cs.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-da.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-de.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-el.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-eo.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-es.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-et.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-eu.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-fa.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-fi.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-fr-CH.js              |   23 +
 ui/i18n/jquery.ui.datepicker-fr.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-he.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-hr.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-hu.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-hy.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-id.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-is.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-it.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-ja.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-ko.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-lt.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-lv.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-ms.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-nl.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-no.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-pl.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-pt-BR.js              |   23 +
 ui/i18n/jquery.ui.datepicker-ro.js                 |   26 +
 ui/i18n/jquery.ui.datepicker-ru.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-sk.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-sl.js                 |   24 +
 ui/i18n/jquery.ui.datepicker-sq.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-sr-SR.js              |   23 +
 ui/i18n/jquery.ui.datepicker-sr.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-sv.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-th.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-tr.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-uk.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-vi.js                 |   23 +
 ui/i18n/jquery.ui.datepicker-zh-CN.js              |   23 +
 ui/i18n/jquery.ui.datepicker-zh-TW.js              |   23 +
 ui/i18n/ui.datepicker-ar.js                        |   24 -
 ui/i18n/ui.datepicker-az.js                        |   23 -
 ui/i18n/ui.datepicker-bg.js                        |   24 -
 ui/i18n/ui.datepicker-ca.js                        |   23 -
 ui/i18n/ui.datepicker-cs.js                        |   23 -
 ui/i18n/ui.datepicker-da.js                        |   23 -
 ui/i18n/ui.datepicker-de.js                        |   23 -
 ui/i18n/ui.datepicker-el.js                        |   23 -
 ui/i18n/ui.datepicker-eo.js                        |   23 -
 ui/i18n/ui.datepicker-es.js                        |   23 -
 ui/i18n/ui.datepicker-et.js                        |   23 -
 ui/i18n/ui.datepicker-eu.js                        |   23 -
 ui/i18n/ui.datepicker-fa.js                        |   23 -
 ui/i18n/ui.datepicker-fi.js                        |   23 -
 ui/i18n/ui.datepicker-fr-CH.js                     |   23 -
 ui/i18n/ui.datepicker-fr.js                        |   23 -
 ui/i18n/ui.datepicker-he.js                        |   23 -
 ui/i18n/ui.datepicker-hr.js                        |   23 -
 ui/i18n/ui.datepicker-hu.js                        |   23 -
 ui/i18n/ui.datepicker-hy.js                        |   23 -
 ui/i18n/ui.datepicker-id.js                        |   23 -
 ui/i18n/ui.datepicker-is.js                        |   23 -
 ui/i18n/ui.datepicker-it.js                        |   23 -
 ui/i18n/ui.datepicker-ja.js                        |   23 -
 ui/i18n/ui.datepicker-ko.js                        |   23 -
 ui/i18n/ui.datepicker-lt.js                        |   23 -
 ui/i18n/ui.datepicker-lv.js                        |   23 -
 ui/i18n/ui.datepicker-ms.js                        |   23 -
 ui/i18n/ui.datepicker-nl.js                        |   23 -
 ui/i18n/ui.datepicker-no.js                        |   23 -
 ui/i18n/ui.datepicker-pl.js                        |   23 -
 ui/i18n/ui.datepicker-pt-BR.js                     |   23 -
 ui/i18n/ui.datepicker-ro.js                        |   26 -
 ui/i18n/ui.datepicker-ru.js                        |   23 -
 ui/i18n/ui.datepicker-sk.js                        |   23 -
 ui/i18n/ui.datepicker-sl.js                        |   24 -
 ui/i18n/ui.datepicker-sq.js                        |   23 -
 ui/i18n/ui.datepicker-sr-SR.js                     |   23 -
 ui/i18n/ui.datepicker-sr.js                        |   23 -
 ui/i18n/ui.datepicker-sv.js                        |   23 -
 ui/i18n/ui.datepicker-th.js                        |   23 -
 ui/i18n/ui.datepicker-tr.js                        |   23 -
 ui/i18n/ui.datepicker-uk.js                        |   23 -
 ui/i18n/ui.datepicker-vi.js                        |   23 -
 ui/i18n/ui.datepicker-zh-CN.js                     |   23 -
 ui/i18n/ui.datepicker-zh-TW.js                     |   23 -
 ui/jquery.effects.blind.js                         |   49 +
 ui/jquery.effects.bounce.js                        |   78 +
 ui/jquery.effects.clip.js                          |   54 +
 ui/jquery.effects.core.js                          |  581 +++++++
 ui/jquery.effects.drop.js                          |   50 +
 ui/jquery.effects.explode.js                       |   79 +
 ui/jquery.effects.fold.js                          |   56 +
 ui/jquery.effects.highlight.js                     |   50 +
 ui/jquery.effects.pulsate.js                       |   56 +
 ui/jquery.effects.scale.js                         |  178 +++
 ui/jquery.effects.shake.js                         |   57 +
 ui/jquery.effects.slide.js                         |   50 +
 ui/jquery.effects.transfer.js                      |   45 +
 ui/jquery.ui.accordion.js                          |  510 ++++++
 ui/jquery.ui.core.js                               |  552 +++++++
 ui/jquery.ui.datepicker.js                         | 1684 ++++++++++++++++++++
 ui/jquery.ui.dialog.js                             |  690 ++++++++
 ui/jquery.ui.draggable.js                          |  784 +++++++++
 ui/jquery.ui.droppable.js                          |  284 ++++
 ui/jquery.ui.position.js                           |  227 +++
 ui/jquery.ui.progressbar.js                        |  119 ++
 ui/jquery.ui.resizable.js                          |  798 ++++++++++
 ui/jquery.ui.selectable.js                         |  257 +++
 ui/jquery.ui.slider.js                             |  559 +++++++
 ui/jquery.ui.sortable.js                           | 1050 ++++++++++++
 ui/jquery.ui.stackfix.js                           |   40 +
 ui/jquery.ui.tabs.js                               |  708 ++++++++
 ui/ui.accordion.js                                 |  510 ------
 ui/ui.core.js                                      |  552 -------
 ui/ui.datepicker.js                                | 1684 --------------------
 ui/ui.dialog.js                                    |  690 --------
 ui/ui.draggable.js                                 |  784 ---------
 ui/ui.droppable.js                                 |  284 ----
 ui/ui.position.js                                  |  227 ---
 ui/ui.progressbar.js                               |  119 --
 ui/ui.resizable.js                                 |  798 ----------
 ui/ui.selectable.js                                |  257 ---
 ui/ui.slider.js                                    |  559 -------
 ui/ui.sortable.js                                  | 1050 ------------
 ui/ui.stackfix.js                                  |   40 -
 ui/ui.tabs.js                                      |  708 --------
 391 files changed, 11515 insertions(+), 11515 deletions(-)
 delete mode 100644 ui/effects.blind.js
 delete mode 100644 ui/effects.bounce.js
 delete mode 100644 ui/effects.clip.js
 delete mode 100644 ui/effects.core.js
 delete mode 100644 ui/effects.drop.js
 delete mode 100644 ui/effects.explode.js
 delete mode 100644 ui/effects.fold.js
 delete mode 100644 ui/effects.highlight.js
 delete mode 100644 ui/effects.pulsate.js
 delete mode 100644 ui/effects.scale.js
 delete mode 100644 ui/effects.shake.js
 delete mode 100644 ui/effects.slide.js
 delete mode 100644 ui/effects.transfer.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ar.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-az.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-bg.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ca.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-cs.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-da.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-de.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-el.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-eo.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-es.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-et.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-eu.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-fa.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-fi.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-fr-CH.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-fr.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-he.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-hr.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-hu.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-hy.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-id.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-is.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-it.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ja.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ko.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-lt.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-lv.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ms.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-nl.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-no.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-pl.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-pt-BR.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ro.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-ru.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sk.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sl.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sq.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sr-SR.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sr.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-sv.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-th.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-tr.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-uk.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-vi.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-zh-CN.js
 create mode 100644 ui/i18n/jquery.ui.datepicker-zh-TW.js
 delete mode 100644 ui/i18n/ui.datepicker-ar.js
 delete mode 100644 ui/i18n/ui.datepicker-az.js
 delete mode 100644 ui/i18n/ui.datepicker-bg.js
 delete mode 100644 ui/i18n/ui.datepicker-ca.js
 delete mode 100644 ui/i18n/ui.datepicker-cs.js
 delete mode 100644 ui/i18n/ui.datepicker-da.js
 delete mode 100644 ui/i18n/ui.datepicker-de.js
 delete mode 100644 ui/i18n/ui.datepicker-el.js
 delete mode 100644 ui/i18n/ui.datepicker-eo.js
 delete mode 100644 ui/i18n/ui.datepicker-es.js
 delete mode 100644 ui/i18n/ui.datepicker-et.js
 delete mode 100644 ui/i18n/ui.datepicker-eu.js
 delete mode 100644 ui/i18n/ui.datepicker-fa.js
 delete mode 100644 ui/i18n/ui.datepicker-fi.js
 delete mode 100644 ui/i18n/ui.datepicker-fr-CH.js
 delete mode 100644 ui/i18n/ui.datepicker-fr.js
 delete mode 100644 ui/i18n/ui.datepicker-he.js
 delete mode 100644 ui/i18n/ui.datepicker-hr.js
 delete mode 100644 ui/i18n/ui.datepicker-hu.js
 delete mode 100644 ui/i18n/ui.datepicker-hy.js
 delete mode 100644 ui/i18n/ui.datepicker-id.js
 delete mode 100644 ui/i18n/ui.datepicker-is.js
 delete mode 100644 ui/i18n/ui.datepicker-it.js
 delete mode 100644 ui/i18n/ui.datepicker-ja.js
 delete mode 100644 ui/i18n/ui.datepicker-ko.js
 delete mode 100644 ui/i18n/ui.datepicker-lt.js
 delete mode 100644 ui/i18n/ui.datepicker-lv.js
 delete mode 100644 ui/i18n/ui.datepicker-ms.js
 delete mode 100644 ui/i18n/ui.datepicker-nl.js
 delete mode 100644 ui/i18n/ui.datepicker-no.js
 delete mode 100644 ui/i18n/ui.datepicker-pl.js
 delete mode 100644 ui/i18n/ui.datepicker-pt-BR.js
 delete mode 100644 ui/i18n/ui.datepicker-ro.js
 delete mode 100644 ui/i18n/ui.datepicker-ru.js
 delete mode 100644 ui/i18n/ui.datepicker-sk.js
 delete mode 100644 ui/i18n/ui.datepicker-sl.js
 delete mode 100644 ui/i18n/ui.datepicker-sq.js
 delete mode 100644 ui/i18n/ui.datepicker-sr-SR.js
 delete mode 100644 ui/i18n/ui.datepicker-sr.js
 delete mode 100644 ui/i18n/ui.datepicker-sv.js
 delete mode 100644 ui/i18n/ui.datepicker-th.js
 delete mode 100644 ui/i18n/ui.datepicker-tr.js
 delete mode 100644 ui/i18n/ui.datepicker-uk.js
 delete mode 100644 ui/i18n/ui.datepicker-vi.js
 delete mode 100644 ui/i18n/ui.datepicker-zh-CN.js
 delete mode 100644 ui/i18n/ui.datepicker-zh-TW.js
 create mode 100644 ui/jquery.effects.blind.js
 create mode 100644 ui/jquery.effects.bounce.js
 create mode 100644 ui/jquery.effects.clip.js
 create mode 100644 ui/jquery.effects.core.js
 create mode 100644 ui/jquery.effects.drop.js
 create mode 100644 ui/jquery.effects.explode.js
 create mode 100644 ui/jquery.effects.fold.js
 create mode 100644 ui/jquery.effects.highlight.js
 create mode 100644 ui/jquery.effects.pulsate.js
 create mode 100644 ui/jquery.effects.scale.js
 create mode 100644 ui/jquery.effects.shake.js
 create mode 100644 ui/jquery.effects.slide.js
 create mode 100644 ui/jquery.effects.transfer.js
 create mode 100644 ui/jquery.ui.accordion.js
 create mode 100644 ui/jquery.ui.core.js
 create mode 100644 ui/jquery.ui.datepicker.js
 create mode 100644 ui/jquery.ui.dialog.js
 create mode 100644 ui/jquery.ui.draggable.js
 create mode 100644 ui/jquery.ui.droppable.js
 create mode 100644 ui/jquery.ui.position.js
 create mode 100644 ui/jquery.ui.progressbar.js
 create mode 100644 ui/jquery.ui.resizable.js
 create mode 100644 ui/jquery.ui.selectable.js
 create mode 100644 ui/jquery.ui.slider.js
 create mode 100644 ui/jquery.ui.sortable.js
 create mode 100644 ui/jquery.ui.stackfix.js
 create mode 100644 ui/jquery.ui.tabs.js
 delete mode 100644 ui/ui.accordion.js
 delete mode 100644 ui/ui.core.js
 delete mode 100644 ui/ui.datepicker.js
 delete mode 100644 ui/ui.dialog.js
 delete mode 100644 ui/ui.draggable.js
 delete mode 100644 ui/ui.droppable.js
 delete mode 100644 ui/ui.position.js
 delete mode 100644 ui/ui.progressbar.js
 delete mode 100644 ui/ui.resizable.js
 delete mode 100644 ui/ui.selectable.js
 delete mode 100644 ui/ui.slider.js
 delete mode 100644 ui/ui.sortable.js
 delete mode 100644 ui/ui.stackfix.js
 delete mode 100644 ui/ui.tabs.js

diff --git a/build/build.xml b/build/build.xml
index daa0c077d..f77e4046a 100644
--- a/build/build.xml
+++ b/build/build.xml
@@ -33,7 +33,7 @@
 	<property name="concatenated" value="jquery-ui" />
 	<property name="concatenated.i18n" value="jquery-ui-i18n" />
 
-	<property name="core.files" value="ui.core.js, ui.draggable.js, ui.droppable.js, ui.resizable.js, ui.selectable.js, ui.sortable.js, effects.core.js" />
+	<property name="core.files" value="jquery.ui.core.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.effects.core.js" />
 
 	<property description="YUI Compressor" name="yui-jar" value="${build.dir}/yuicompressor-2.4.2.jar" />
 	
diff --git a/build/build/style.xsl b/build/build/style.xsl
index 146409344..32daeed94 100644
--- a/build/build/style.xsl
+++ b/build/build/style.xsl
@@ -105,9 +105,9 @@
 				<div id="docs-overview-sidebar">
 					<h4>Dependencies:</h4>
 					<ul>							
-						<li><a href="#">ui.core.js</a></li>
-						<li><a href="#">ui.draggable.js <span>(Optional)</span></a></li>
-						<li><a href="#">ui.resizable.js <span>(Optional)</span></a></li>
+						<li><a href="#">jquery.ui.core.js</a></li>
+						<li><a href="#">jquery.ui.draggable.js <span>(Optional)</span></a></li>
+						<li><a href="#">jquery.ui.resizable.js <span>(Optional)</span></a></li>
 					</ul>
 				</div>
 				<div id="docs-overview-main">
diff --git a/demos/accordion/collapsible.html b/demos/accordion/collapsible.html
index 381d5fea3..8f4784367 100644
--- a/demos/accordion/collapsible.html
+++ b/demos/accordion/collapsible.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion - Collapse content</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/custom-icons.html b/demos/accordion/custom-icons.html
index 914ba32cd..1ff4d4bd2 100644
--- a/demos/accordion/custom-icons.html
+++ b/demos/accordion/custom-icons.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion - Customize icons</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/default.html b/demos/accordion/default.html
index 9493b266d..843e122ca 100644
--- a/demos/accordion/default.html
+++ b/demos/accordion/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/fillspace.html b/demos/accordion/fillspace.html
index 3523d006e..5576d3475 100644
--- a/demos/accordion/fillspace.html
+++ b/demos/accordion/fillspace.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Accordion - Fill space</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/mouseover.html b/demos/accordion/mouseover.html
index 2181649ca..c2a2d0e52 100644
--- a/demos/accordion/mouseover.html
+++ b/demos/accordion/mouseover.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion - Open on mouseover</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/no-auto-height.html b/demos/accordion/no-auto-height.html
index b76c8d9cc..d56b3adeb 100644
--- a/demos/accordion/no-auto-height.html
+++ b/demos/accordion/no-auto-height.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion - No Auto Height</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/accordion/sortable.html b/demos/accordion/sortable.html
index 82e119bb4..91e2df5d7 100644
--- a/demos/accordion/sortable.html
+++ b/demos/accordion/sortable.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Accordion - Sortable</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/addClass/default.html b/demos/addClass/default.html
index eae24b926..3b3560e14 100644
--- a/demos/addClass/default.html
+++ b/demos/addClass/default.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - addClass Demo</title>
 	<link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/ui/effects.core.js"></script>
+	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/demos/demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/demos/animate/default.html b/demos/animate/default.html
index a01f08ad7..4dcd1b080 100644
--- a/demos/animate/default.html
+++ b/demos/animate/default.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - Animate Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/demos/datepicker/alt-field.html b/demos/datepicker/alt-field.html
index 372e2bf2c..dc94c8d80 100644
--- a/demos/datepicker/alt-field.html
+++ b/demos/datepicker/alt-field.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Populate alternate field</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/buttonbar.html b/demos/datepicker/buttonbar.html
index eeea08a5d..3a945fa44 100644
--- a/demos/datepicker/buttonbar.html
+++ b/demos/datepicker/buttonbar.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Display button bar</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/date-formats.html b/demos/datepicker/date-formats.html
index 6150a04f5..b4cc80b26 100644
--- a/demos/datepicker/date-formats.html
+++ b/demos/datepicker/date-formats.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Format date</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/default.html b/demos/datepicker/default.html
index 368e0bc39..e4748cd80 100644
--- a/demos/datepicker/default.html
+++ b/demos/datepicker/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/dropdown-month-year.html b/demos/datepicker/dropdown-month-year.html
index c16931009..46b55d38a 100644
--- a/demos/datepicker/dropdown-month-year.html
+++ b/demos/datepicker/dropdown-month-year.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Display month &amp; year menus</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/event-search.html b/demos/datepicker/event-search.html
index 0e71100a5..53482c600 100644
--- a/demos/datepicker/event-search.html
+++ b/demos/datepicker/event-search.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Display multiple months</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/icon-trigger.html b/demos/datepicker/icon-trigger.html
index f66c4fc30..7aba0ecc7 100644
--- a/demos/datepicker/icon-trigger.html
+++ b/demos/datepicker/icon-trigger.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Icon trigger</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/inline.html b/demos/datepicker/inline.html
index 2d5ad757f..dfee2c4b6 100644
--- a/demos/datepicker/inline.html
+++ b/demos/datepicker/inline.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Display inline</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/localization.html b/demos/datepicker/localization.html
index 49aacaa01..1e87c6ac0 100644
--- a/demos/datepicker/localization.html
+++ b/demos/datepicker/localization.html
@@ -4,54 +4,54 @@
 	<title>jQuery UI Datepicker - Localize calendar</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ar.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-az.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-bg.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ca.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-cs.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-da.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-de.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-el.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-eo.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-es.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-et.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-eu.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-fa.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-fi.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-fr.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-fr-CH.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-he.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-hr.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-hu.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-hy.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-id.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-is.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-it.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ja.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ko.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-lt.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-lv.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ms.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-nl.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-no.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-pl.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-pt-BR.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ro.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-ru.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sk.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sl.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sq.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sr.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sr-SR.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-sv.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-th.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-tr.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-uk.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-vi.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-zh-CN.js"></script>
-	<script type="text/javascript" src="../../ui/i18n/ui.datepicker-zh-TW.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ar.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-az.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-bg.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ca.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-cs.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-da.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-de.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-el.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-eo.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-es.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-et.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-eu.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fa.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fi.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-fr-CH.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-he.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hr.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hu.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-hy.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-id.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-is.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-it.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ja.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ko.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-lt.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-lv.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ms.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-nl.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-no.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-pl.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-pt-BR.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ro.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-ru.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sk.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sl.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sq.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sr.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sr-SR.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-sv.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-th.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-tr.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-uk.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-vi.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-zh-CN.js"></script>
+	<script type="text/javascript" src="../../ui/i18n/jquery.ui.datepicker-zh-TW.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/min-max.html b/demos/datepicker/min-max.html
index 06a177634..9a2e45874 100644
--- a/demos/datepicker/min-max.html
+++ b/demos/datepicker/min-max.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Restrict date range</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/multiple-calendars.html b/demos/datepicker/multiple-calendars.html
index 86e55a06e..2ef8a8b1e 100644
--- a/demos/datepicker/multiple-calendars.html
+++ b/demos/datepicker/multiple-calendars.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Display multiple months</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/other-months.html b/demos/datepicker/other-months.html
index f555f3f98..3f570b923 100644
--- a/demos/datepicker/other-months.html
+++ b/demos/datepicker/other-months.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Dates in other months</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/datepicker/show-week.html b/demos/datepicker/show-week.html
index d14c72225..233fc3b8b 100644
--- a/demos/datepicker/show-week.html
+++ b/demos/datepicker/show-week.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Datepicker - Show week of the year</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/dialog/animated.html b/demos/dialog/animated.html
index bf0d74efc..2845a4b9a 100644
--- a/demos/dialog/animated.html
+++ b/demos/dialog/animated.html
@@ -4,15 +4,15 @@
 	<title>jQuery UI Dialog - Animation</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$.ui.dialog.defaults.stackfix = true;
diff --git a/demos/dialog/default.html b/demos/dialog/default.html
index f59ee2d13..bf673f799 100644
--- a/demos/dialog/default.html
+++ b/demos/dialog/default.html
@@ -4,12 +4,12 @@
 	<title>jQuery UI Dialog - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$.ui.dialog.defaults.stackfix = true;
diff --git a/demos/dialog/modal-confirmation.html b/demos/dialog/modal-confirmation.html
index 6a4b10d22..5dff755e2 100644
--- a/demos/dialog/modal-confirmation.html
+++ b/demos/dialog/modal-confirmation.html
@@ -4,12 +4,12 @@
 	<title>jQuery UI Dialog - Modal confirmation</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/dialog/modal-form.html b/demos/dialog/modal-form.html
index 5ef208952..7b49019b6 100644
--- a/demos/dialog/modal-form.html
+++ b/demos/dialog/modal-form.html
@@ -4,13 +4,13 @@
 	<title>jQuery UI Dialog - Modal form</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		body { font-size: 62.5%; }
diff --git a/demos/dialog/modal-message.html b/demos/dialog/modal-message.html
index 24282589f..54d577b60 100644
--- a/demos/dialog/modal-message.html
+++ b/demos/dialog/modal-message.html
@@ -4,12 +4,12 @@
 	<title>jQuery UI Dialog - Modal message</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/dialog/modal.html b/demos/dialog/modal.html
index fd4a7ba1f..4fe01fe03 100644
--- a/demos/dialog/modal.html
+++ b/demos/dialog/modal.html
@@ -4,12 +4,12 @@
 	<title>jQuery UI Dialog - Basic modal</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/draggable/constrain-movement.html b/demos/draggable/constrain-movement.html
index 73496bb64..30c81f5e6 100644
--- a/demos/draggable/constrain-movement.html
+++ b/demos/draggable/constrain-movement.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Constrain movement</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	.draggable { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/cursor-style.html b/demos/draggable/cursor-style.html
index 14b3b2915..95364e1db 100644
--- a/demos/draggable/cursor-style.html
+++ b/demos/draggable/cursor-style.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Cursor style</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/default.html b/demos/draggable/default.html
index 344accc40..b1bb57a33 100644
--- a/demos/draggable/default.html
+++ b/demos/draggable/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/draggable/delay-start.html b/demos/draggable/delay-start.html
index 6f49d17a8..f19c270e5 100644
--- a/demos/draggable/delay-start.html
+++ b/demos/draggable/delay-start.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Delay start</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2 { width: 120px; height: 120px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/events.html b/demos/draggable/events.html
index ca13a9f87..aa2c1b755 100644
--- a/demos/draggable/events.html
+++ b/demos/draggable/events.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Events</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#draggable { width: 16em; padding: 0 1em; }
diff --git a/demos/draggable/handle.html b/demos/draggable/handle.html
index 8433a1e88..7ec5f9322 100644
--- a/demos/draggable/handle.html
+++ b/demos/draggable/handle.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Handles</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/revert.html b/demos/draggable/revert.html
index 84336407e..f5d4e3eec 100644
--- a/demos/draggable/revert.html
+++ b/demos/draggable/revert.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Revert position</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/scroll.html b/demos/draggable/scroll.html
index 201ce9c30..2fd0e66fb 100644
--- a/demos/draggable/scroll.html
+++ b/demos/draggable/scroll.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Auto-scroll</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2, #draggable3 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/draggable/snap-to.html b/demos/draggable/snap-to.html
index 43c0585c1..82b2b918d 100644
--- a/demos/draggable/snap-to.html
+++ b/demos/draggable/snap-to.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Snap to element or grid</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	.draggable { width: 90px; height: 80px; padding: 5px; float: left; margin: 0 10px 10px 0; font-size: .9em; }
diff --git a/demos/draggable/sortable.html b/demos/draggable/sortable.html
index 940471afe..5d2fa9461 100644
--- a/demos/draggable/sortable.html
+++ b/demos/draggable/sortable.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Draggable + Sortable</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	.demo ul { list-style-type: none; margin: 0; padding: 0; margin-bottom: 10px; }
diff --git a/demos/draggable/visual-feedback.html b/demos/draggable/visual-feedback.html
index 25c42fdad..9f8f03745 100644
--- a/demos/draggable/visual-feedback.html
+++ b/demos/draggable/visual-feedback.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable - Visual feedback</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2, #draggable3, #set div { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 0 10px 10px 0; }
diff --git a/demos/droppable/accepted-elements.html b/demos/droppable/accepted-elements.html
index 3a12baa5c..94bef2dcc 100644
--- a/demos/droppable/accepted-elements.html
+++ b/demos/droppable/accepted-elements.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable - Accept Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; }
diff --git a/demos/droppable/default.html b/demos/droppable/default.html
index 03fdace1d..e90f1afe2 100644
--- a/demos/droppable/default.html
+++ b/demos/droppable/default.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable - Default Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
diff --git a/demos/droppable/photo-manager.html b/demos/droppable/photo-manager.html
index 868085afc..c6ed853bd 100644
--- a/demos/droppable/photo-manager.html
+++ b/demos/droppable/photo-manager.html
@@ -4,11 +4,11 @@
 		<title>jQuery UI Droppable - Simple photo manager</title>
 		<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 		<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-		<script type="text/javascript" src="../../ui/ui.core.js"></script>
-		<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-		<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-		<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-		<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+		<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+		<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+		<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+		<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+		<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 		<link type="text/css" href="../demos.css" rel="stylesheet" />
 		<style type="text/css">
 			#gallery { float: left; width: 65%; min-height: 12em; } * html #gallery { height: 12em; } /* IE6 */
diff --git a/demos/droppable/propagation.html b/demos/droppable/propagation.html
index e9c502665..4ea0354cb 100644
--- a/demos/droppable/propagation.html
+++ b/demos/droppable/propagation.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable - Prevent propagation</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable { width: 100px; height: 40px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
diff --git a/demos/droppable/revert.html b/demos/droppable/revert.html
index 01fea57a4..c10387a2f 100644
--- a/demos/droppable/revert.html
+++ b/demos/droppable/revert.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable - Revert draggable position</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2 { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
diff --git a/demos/droppable/visual-feedback.html b/demos/droppable/visual-feedback.html
index 8f7e929c1..af811a4d8 100644
--- a/demos/droppable/visual-feedback.html
+++ b/demos/droppable/visual-feedback.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable - Visual feedback</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable, #draggable2 { width: 90px; height: 90px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; }
diff --git a/demos/effect/default.html b/demos/effect/default.html
index 4187080cd..80272aac9 100644
--- a/demos/effect/default.html
+++ b/demos/effect/default.html
@@ -4,19 +4,19 @@
 	<title>jQuery UI Effects - Effect Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../../ui/effects.transfer.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/demos/effect/easing.html b/demos/effect/easing.html
index 856877e46..8add1ea2c 100644
--- a/demos/effect/easing.html
+++ b/demos/effect/easing.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - Effect Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.graph {
diff --git a/demos/hide/default.html b/demos/hide/default.html
index a4a5ff285..a75bbcb0c 100644
--- a/demos/hide/default.html
+++ b/demos/hide/default.html
@@ -4,19 +4,19 @@
 	<title>jQuery UI Effects - Hide Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../../ui/effects.transfer.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; }
diff --git a/demos/index.html b/demos/index.html
index 8b5eb3f5d..cb42ace36 100644
--- a/demos/index.html
+++ b/demos/index.html
@@ -6,79 +6,79 @@
 	<link type="text/css" href="../themes/base/ui.all.css" rel="stylesheet" />
 	<link type="text/css" href="demos.css" rel="stylesheet" />
 	<script type="text/javascript" src="../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../ui/ui.tabs.js"></script>
-	<script type="text/javascript" src="../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../ui/effects.transfer.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ar.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-az.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-bg.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ca.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-cs.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-da.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-de.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-el.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-eo.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-es.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-et.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-eu.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-fa.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-fi.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-fr.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-fr-CH.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-he.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-hr.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-hu.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-hy.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-id.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-is.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-it.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ja.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ko.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-lt.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-lv.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ms.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-nl.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-no.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-pl.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-pt-BR.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ro.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-ru.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sk.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sl.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sq.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sr.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sr-SR.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-sv.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-th.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-tr.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-uk.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-vi.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-zh-CN.js"></script>
-	<script type="text/javascript" src="../ui/i18n/ui.datepicker-zh-TW.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../ui/jquery.ui.tabs.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../ui/jquery.effects.transfer.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ar.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-az.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-bg.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ca.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-cs.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-da.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-de.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-el.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-eo.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-es.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-et.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-eu.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fa.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fi.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-fr-CH.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-he.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hr.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hu.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-hy.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-id.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-is.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-it.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ja.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ko.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-lt.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-lv.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ms.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-nl.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-no.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-pl.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-pt-BR.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ro.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-ru.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sk.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sl.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sq.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sr.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sr-SR.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-sv.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-th.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-tr.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-uk.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-vi.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-zh-CN.js"></script>
+	<script type="text/javascript" src="../ui/i18n/jquery.ui.datepicker-zh-TW.js"></script>
 	<script type="text/javascript">
 	jQuery(function($) {
 		
diff --git a/demos/position/cycler.html b/demos/position/cycler.html
index 9bf90d9cc..867273424 100644
--- a/demos/position/cycler.html
+++ b/demos/position/cycler.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Position - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
     
     <style type="text/css">
diff --git a/demos/position/default.html b/demos/position/default.html
index 81fe41a1c..ceefe7c08 100644
--- a/demos/position/default.html
+++ b/demos/position/default.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Position - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.position.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.position.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
     
     <style type="text/css">
diff --git a/demos/progressbar/animated.html b/demos/progressbar/animated.html
index db013d924..127a0517a 100644
--- a/demos/progressbar/animated.html
+++ b/demos/progressbar/animated.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Progressbar - Animated</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.ui-progressbar-value { background-image: url(images/pbar-ani.gif); }
diff --git a/demos/progressbar/default.html b/demos/progressbar/default.html
index a06e6bf10..2743f0d3c 100644
--- a/demos/progressbar/default.html
+++ b/demos/progressbar/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Progressbar - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/progressbar/resize.html b/demos/progressbar/resize.html
index d1c53afed..f15f213fc 100644
--- a/demos/progressbar/resize.html
+++ b/demos/progressbar/resize.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Progressbar - Resizable</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/removeClass/default.html b/demos/removeClass/default.html
index 83a8b8963..1027211f2 100644
--- a/demos/removeClass/default.html
+++ b/demos/removeClass/default.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - removeClass Demo</title>
 	<link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/ui/effects.core.js"></script>
+	<script type="text/javascript" src="http://jquery-ui.googlecode.com/svn/trunk/ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="http://jquery-ui.googlecode.com/svn/trunk/demos/demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/demos/resizable/animate.html b/demos/resizable/animate.html
index 9af154818..8eb991a3e 100644
--- a/demos/resizable/animate.html
+++ b/demos/resizable/animate.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Animate</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/resizable/aspect-ratio.html b/demos/resizable/aspect-ratio.html
index 56edad4e4..7ca93e5bc 100644
--- a/demos/resizable/aspect-ratio.html
+++ b/demos/resizable/aspect-ratio.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Preserve aspect ratio</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 160px; height: 90px; padding: 0.5em; }
diff --git a/demos/resizable/constrain-area.html b/demos/resizable/constrain-area.html
index e1a912277..bd2755f86 100644
--- a/demos/resizable/constrain-area.html
+++ b/demos/resizable/constrain-area.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Constrain resize area</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#container { width: 300px; height: 300px; }
diff --git a/demos/resizable/default.html b/demos/resizable/default.html
index 0b77b341a..90aebdab0 100644
--- a/demos/resizable/default.html
+++ b/demos/resizable/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/resizable/delay-start.html b/demos/resizable/delay-start.html
index df20f8ed6..5252f516e 100644
--- a/demos/resizable/delay-start.html
+++ b/demos/resizable/delay-start.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Delay start</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable, #resizable2 { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/resizable/helper.html b/demos/resizable/helper.html
index 49c46e73e..acb9ea1c1 100644
--- a/demos/resizable/helper.html
+++ b/demos/resizable/helper.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Helper</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/resizable/max-min.html b/demos/resizable/max-min.html
index d29e4d7ef..087b5bde3 100644
--- a/demos/resizable/max-min.html
+++ b/demos/resizable/max-min.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Maximum / minimum size</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 200px; height: 150px; padding: 5px; }
diff --git a/demos/resizable/snap-to-grid.html b/demos/resizable/snap-to-grid.html
index f2adcc6bb..b1fe3a0fe 100644
--- a/demos/resizable/snap-to-grid.html
+++ b/demos/resizable/snap-to-grid.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Snap to grid</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/resizable/synchronous-resize.html b/demos/resizable/synchronous-resize.html
index bd5de824c..fd77687ca 100644
--- a/demos/resizable/synchronous-resize.html
+++ b/demos/resizable/synchronous-resize.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Synchronous resize</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { background-position: top left; }
diff --git a/demos/resizable/textarea.html b/demos/resizable/textarea.html
index 4374bc4fc..0d77a9b1f 100644
--- a/demos/resizable/textarea.html
+++ b/demos/resizable/textarea.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Textarea</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.ui-resizable-se {
diff --git a/demos/resizable/visual-feedback.html b/demos/resizable/visual-feedback.html
index c3edf9ad5..66088aca5 100644
--- a/demos/resizable/visual-feedback.html
+++ b/demos/resizable/visual-feedback.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable - Visual feedback</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#resizable { width: 150px; height: 150px; padding: 0.5em; }
diff --git a/demos/selectable/default.html b/demos/selectable/default.html
index 6a81f2bd7..d53b5d571 100644
--- a/demos/selectable/default.html
+++ b/demos/selectable/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Selectable - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	
 	<style type="text/css">
diff --git a/demos/selectable/display-grid.html b/demos/selectable/display-grid.html
index 3843c77b9..3fc48bf72 100644
--- a/demos/selectable/display-grid.html
+++ b/demos/selectable/display-grid.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Selectable - Display as grid</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	
 	<style type="text/css">
diff --git a/demos/selectable/serialize.html b/demos/selectable/serialize.html
index 0e201fa6a..32c530876 100644
--- a/demos/selectable/serialize.html
+++ b/demos/selectable/serialize.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Selectable - Serialize</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	
 	<style type="text/css">
diff --git a/demos/show/default.html b/demos/show/default.html
index 7c70526ab..d45b0971a 100644
--- a/demos/show/default.html
+++ b/demos/show/default.html
@@ -4,19 +4,19 @@
 	<title>jQuery UI Effects - Show Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../../ui/effects.transfer.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; }
diff --git a/demos/slider/colorpicker.html b/demos/slider/colorpicker.html
index 0f7c264af..ddd4c6a2b 100644
--- a/demos/slider/colorpicker.html
+++ b/demos/slider/colorpicker.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Colorpicker</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#red, #green, #blue {
diff --git a/demos/slider/default.html b/demos/slider/default.html
index da92869a3..f6bfbcdbe 100644
--- a/demos/slider/default.html
+++ b/demos/slider/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/hotelrooms.html b/demos/slider/hotelrooms.html
index 93fc12b5a..04c938c96 100644
--- a/demos/slider/hotelrooms.html
+++ b/demos/slider/hotelrooms.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Range with fixed minimum</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/multiple-vertical.html b/demos/slider/multiple-vertical.html
index 48258ccc9..5947d045e 100644
--- a/demos/slider/multiple-vertical.html
+++ b/demos/slider/multiple-vertical.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Multiple sliders</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; }
diff --git a/demos/slider/range-vertical.html b/demos/slider/range-vertical.html
index ad595114e..66ad34ea7 100644
--- a/demos/slider/range-vertical.html
+++ b/demos/slider/range-vertical.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Vertical range slider</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/range.html b/demos/slider/range.html
index 7c595e0b3..c2dd33324 100644
--- a/demos/slider/range.html
+++ b/demos/slider/range.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Range slider</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/rangemax.html b/demos/slider/rangemax.html
index db266dba3..f5a2be346 100644
--- a/demos/slider/rangemax.html
+++ b/demos/slider/rangemax.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Range with fixed maximum</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/rangemin.html b/demos/slider/rangemin.html
index 4eebade2c..1766b2c6d 100644
--- a/demos/slider/rangemin.html
+++ b/demos/slider/rangemin.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Range with fixed minimum</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/side-scroll.html b/demos/slider/side-scroll.html
index 5357eb18c..b621e8e6a 100644
--- a/demos/slider/side-scroll.html
+++ b/demos/slider/side-scroll.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Slider scrollbar</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; }
diff --git a/demos/slider/slider-vertical.html b/demos/slider/slider-vertical.html
index 7731a4b95..c42c0f0a9 100644
--- a/demos/slider/slider-vertical.html
+++ b/demos/slider/slider-vertical.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Vertical slider</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/steps.html b/demos/slider/steps.html
index f29b73465..9623160a7 100644
--- a/demos/slider/steps.html
+++ b/demos/slider/steps.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider - Snap to increments</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; };
diff --git a/demos/slider/tabs.html b/demos/slider/tabs.html
index b17d38a9d..6201e49e5 100644
--- a/demos/slider/tabs.html
+++ b/demos/slider/tabs.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Slider - Snap to increments</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#demo-frame > div.demo { padding: 10px !important; }
diff --git a/demos/sortable/connect-lists-through-tabs.html b/demos/sortable/connect-lists-through-tabs.html
index 481c5065d..07c85fcbb 100644
--- a/demos/sortable/connect-lists-through-tabs.html
+++ b/demos/sortable/connect-lists-through-tabs.html
@@ -4,10 +4,10 @@
 	<title>jQuery UI Sortable - Connect lists with Tabs</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; }
diff --git a/demos/sortable/connect-lists.html b/demos/sortable/connect-lists.html
index 639f0e9f9..c7b165e73 100644
--- a/demos/sortable/connect-lists.html
+++ b/demos/sortable/connect-lists.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Connect lists</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; }
diff --git a/demos/sortable/default.html b/demos/sortable/default.html
index 6df9ec13b..779421bf5 100644
--- a/demos/sortable/default.html
+++ b/demos/sortable/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
diff --git a/demos/sortable/delay-start.html b/demos/sortable/delay-start.html
index 636b7437b..722136d4c 100644
--- a/demos/sortable/delay-start.html
+++ b/demos/sortable/delay-start.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Delay start</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; margin-bottom: 15px;zoom: 1; }
diff --git a/demos/sortable/display-grid.html b/demos/sortable/display-grid.html
index e10cd9960..80829d6d7 100644
--- a/demos/sortable/display-grid.html
+++ b/demos/sortable/display-grid.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Display as grid</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable { list-style-type: none; margin: 0; padding: 0; }
diff --git a/demos/sortable/empty-lists.html b/demos/sortable/empty-lists.html
index 1886b8e00..986fc1dba 100644
--- a/demos/sortable/empty-lists.html
+++ b/demos/sortable/empty-lists.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Handle empty lists</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable1, #sortable2, #sortable3 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; background: #eee; padding: 5px; width: 143px;}
diff --git a/demos/sortable/items.html b/demos/sortable/items.html
index 093631f23..e1457b0a6 100644
--- a/demos/sortable/items.html
+++ b/demos/sortable/items.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Include / exclude items</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; zoom: 1; }
diff --git a/demos/sortable/placeholder.html b/demos/sortable/placeholder.html
index 565eb0bff..94b3c5cab 100644
--- a/demos/sortable/placeholder.html
+++ b/demos/sortable/placeholder.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Drop placeholder</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
diff --git a/demos/sortable/portlets.html b/demos/sortable/portlets.html
index 5430989c6..4494fa673 100644
--- a/demos/sortable/portlets.html
+++ b/demos/sortable/portlets.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable - Portlets</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	.column { width: 170px; float: left; padding-bottom: 100px; }
diff --git a/demos/switchClass/default.html b/demos/switchClass/default.html
index 09b48c9dc..0e2f58224 100644
--- a/demos/switchClass/default.html
+++ b/demos/switchClass/default.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - switchClass Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/demos/tabs/ajax.html b/demos/tabs/ajax.html
index ecbc2c591..724c52bb6 100644
--- a/demos/tabs/ajax.html
+++ b/demos/tabs/ajax.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Content via Ajax</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/bottom.html b/demos/tabs/bottom.html
index 8232da292..73d8d40ea 100644
--- a/demos/tabs/bottom.html
+++ b/demos/tabs/bottom.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Tabs at bottom</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/collapsible.html b/demos/tabs/collapsible.html
index eab85afa4..6ea5813d0 100644
--- a/demos/tabs/collapsible.html
+++ b/demos/tabs/collapsible.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Collapse content</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/default.html b/demos/tabs/default.html
index 6048bc94e..380bbbe25 100644
--- a/demos/tabs/default.html
+++ b/demos/tabs/default.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Default functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/manipulation.html b/demos/tabs/manipulation.html
index d1f6fe2a2..d4cac8689 100644
--- a/demos/tabs/manipulation.html
+++ b/demos/tabs/manipulation.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Tabs - Simple manipulation</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		#dialog label, #dialog input { display:block; }
diff --git a/demos/tabs/mouseover.html b/demos/tabs/mouseover.html
index 3232e1fd8..c24bb0529 100644
--- a/demos/tabs/mouseover.html
+++ b/demos/tabs/mouseover.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Open on mouseover</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/sortable.html b/demos/tabs/sortable.html
index 1b0d458bd..61d249633 100644
--- a/demos/tabs/sortable.html
+++ b/demos/tabs/sortable.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Tabs - Sortable</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/tabs/vertical.html b/demos/tabs/vertical.html
index 56001c374..b94893b5e 100644
--- a/demos/tabs/vertical.html
+++ b/demos/tabs/vertical.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs - Vertical Tabs functionality</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<script type="text/javascript">
 	$(function() {
diff --git a/demos/toggle/default.html b/demos/toggle/default.html
index ffb464b36..6342f1543 100644
--- a/demos/toggle/default.html
+++ b/demos/toggle/default.html
@@ -4,19 +4,19 @@
 	<title>jQuery UI Effects - Toggle Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../../ui/effects.transfer.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; }
diff --git a/demos/toggleClass/default.html b/demos/toggleClass/default.html
index 0bcfe2e76..74a9fed4b 100644
--- a/demos/toggleClass/default.html
+++ b/demos/toggleClass/default.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Effects - toggleClass Demo</title>
 	<link type="text/css" href="../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 		.toggler { width: 500px; height: 200px; position: relative;}
diff --git a/tests/unit/accordion/accordion.html b/tests/unit/accordion/accordion.html
index dd4785544..d2e6c3c2b 100644
--- a/tests/unit/accordion/accordion.html
+++ b/tests/unit/accordion/accordion.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Accordion Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/all.html b/tests/unit/all.html
index b2d75e3d2..ec4d56eb7 100644
--- a/tests/unit/all.html
+++ b/tests/unit/all.html
@@ -5,18 +5,18 @@
 	<link rel="stylesheet" href="testsuite.css" type="text/css">
 
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 
 	<script type="text/javascript" src="../../external/testrunner-r6574.js"></script>
 	<script type="text/javascript" src="../../external/jquery.cookie-r6165.js"></script>
diff --git a/tests/unit/all_2.html b/tests/unit/all_2.html
index 9ef1b1906..70f383b85 100644
--- a/tests/unit/all_2.html
+++ b/tests/unit/all_2.html
@@ -5,7 +5,7 @@
 	<link rel="stylesheet" href="testsuite.css" type="text/css">
 
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
 
 	<script type="text/javascript">
 	var components = ["accordion","datepicker","dialog","draggable","progressbar","resizable","selectable","slider","sortable","tabs"];
@@ -39,17 +39,17 @@
 
 	</script>
 
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 
 	<script type="text/javascript" src="../../external/testrunner-r6574.js"></script>
 	<script type="text/javascript" src="../../external/jquery.cookie-r6165.js"></script>
diff --git a/tests/unit/core/core.html b/tests/unit/core/core.html
index db231e802..73d0c382a 100644
--- a/tests/unit/core/core.html
+++ b/tests/unit/core/core.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Core Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/datepicker/datepicker.html b/tests/unit/datepicker/datepicker.html
index 13083f9e2..5ba5f046d 100644
--- a/tests/unit/datepicker/datepicker.html
+++ b/tests/unit/datepicker/datepicker.html
@@ -6,10 +6,10 @@
 	<link   type="text/css"       href="../../../themes/base/ui.base.css" rel="stylesheet" />
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../../ui/i18n/ui.datepicker-fr.js"></script>
-	<script type="text/javascript" src="../../../ui/i18n/ui.datepicker-he.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/i18n/jquery.ui.datepicker-fr.js"></script>
+	<script type="text/javascript" src="../../../ui/i18n/jquery.ui.datepicker-he.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/defaults.html b/tests/unit/defaults.html
index d9afd0ed4..85b9f8265 100644
--- a/tests/unit/defaults.html
+++ b/tests/unit/defaults.html
@@ -4,18 +4,18 @@
 	<title>jQuery UI Defaults</title>
 
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 
 	<link   type="text/css"       href="testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="testsuite.js"></script>
diff --git a/tests/unit/dialog/dialog.html b/tests/unit/dialog/dialog.html
index fe8908a76..f21db56c5 100644
--- a/tests/unit/dialog/dialog.html
+++ b/tests/unit/dialog/dialog.html
@@ -4,12 +4,12 @@
 	<title>jQuery UI Dialog Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/draggable/draggable.html b/tests/unit/draggable/draggable.html
index 01a5ebe8f..da761a10f 100644
--- a/tests/unit/draggable/draggable.html
+++ b/tests/unit/draggable/draggable.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Draggable Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/droppable/droppable.html b/tests/unit/droppable/droppable.html
index c549c4645..916fd460a 100644
--- a/tests/unit/droppable/droppable.html
+++ b/tests/unit/droppable/droppable.html
@@ -4,9 +4,9 @@
 	<title>jQuery UI Droppable Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/index.html b/tests/unit/index.html
index e5d3b3798..3da0dd757 100644
--- a/tests/unit/index.html
+++ b/tests/unit/index.html
@@ -7,18 +7,18 @@
 	<link   type="text/css"       href="testsuite.css" rel="stylesheet" />
 
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 
 	<script type="text/javascript" src="../../external/jquery.cookie-r6165.js"></script>
 	<script type="text/javascript" src="../jquery.simulate.js"></script>
diff --git a/tests/unit/position/position.html b/tests/unit/position/position.html
index 3f09ae32e..ce46f2377 100644
--- a/tests/unit/position/position.html
+++ b/tests/unit/position/position.html
@@ -4,7 +4,7 @@
 	<title>jQuery UI Position Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/progressbar/progressbar.html b/tests/unit/progressbar/progressbar.html
index e168c6ae3..8cf661ed4 100644
--- a/tests/unit/progressbar/progressbar.html
+++ b/tests/unit/progressbar/progressbar.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Progressbar Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.progressbar.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/resizable/resizable.html b/tests/unit/resizable/resizable.html
index 0be2f8543..3fb4a4ce8 100644
--- a/tests/unit/resizable/resizable.html
+++ b/tests/unit/resizable/resizable.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Resizable Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/selectable/selectable.html b/tests/unit/selectable/selectable.html
index 93881ea75..7084ac7e5 100644
--- a/tests/unit/selectable/selectable.html
+++ b/tests/unit/selectable/selectable.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Selectable Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.selectable.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/slider/slider.html b/tests/unit/slider/slider.html
index 9d3d06032..ae9e6d0b0 100644
--- a/tests/unit/slider/slider.html
+++ b/tests/unit/slider/slider.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Slider Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/sortable/sortable.html b/tests/unit/sortable/sortable.html
index c85cd1bde..51174e99b 100644
--- a/tests/unit/sortable/sortable.html
+++ b/tests/unit/sortable/sortable.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Sortable Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/unit/tabs/tabs.html b/tests/unit/tabs/tabs.html
index 0baf6ce5a..a886d305e 100644
--- a/tests/unit/tabs/tabs.html
+++ b/tests/unit/tabs/tabs.html
@@ -4,8 +4,8 @@
 	<title>jQuery UI Tabs Test Suite</title>
 
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.tabs.js"></script>
 
 	<link   type="text/css"       href="../testsuite.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../external/testrunner-r6574.js"></script>
diff --git a/tests/visual/accordion/accordion.html b/tests/visual/accordion/accordion.html
index f499f5aa2..6bfebf736 100644
--- a/tests/visual/accordion/accordion.html
+++ b/tests/visual/accordion/accordion.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion();
diff --git a/tests/visual/accordion/accordion_dl.html b/tests/visual/accordion/accordion_dl.html
index 4514af4d7..c19d420f1 100644
--- a/tests/visual/accordion/accordion_dl.html
+++ b/tests/visual/accordion/accordion_dl.html
@@ -6,8 +6,8 @@
 	<link rel="stylesheet" href="../../../themes/base/ui.base.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.theme.css" type="text/css" title="ui-theme" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("dl").accordion()
diff --git a/tests/visual/accordion/accordion_method_destroy.html b/tests/visual/accordion/accordion_method_destroy.html
index 075f0d561..8c6018f98 100644
--- a/tests/visual/accordion/accordion_method_destroy.html
+++ b/tests/visual/accordion/accordion_method_destroy.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion().accordion("destroy");
diff --git a/tests/visual/accordion/accordion_method_disable.html b/tests/visual/accordion/accordion_method_disable.html
index 42d387c03..c6143da24 100644
--- a/tests/visual/accordion/accordion_method_disable.html
+++ b/tests/visual/accordion/accordion_method_disable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion().accordion("disable");
diff --git a/tests/visual/accordion/accordion_option_animated_bounceslide.html b/tests/visual/accordion/accordion_option_animated_bounceslide.html
index d9d2c8ddd..60f34e28d 100644
--- a/tests/visual/accordion/accordion_option_animated_bounceslide.html
+++ b/tests/visual/accordion/accordion_option_animated_bounceslide.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_animated_easeslide.html b/tests/visual/accordion/accordion_option_animated_easeslide.html
index 958c48299..36036666e 100644
--- a/tests/visual/accordion/accordion_option_animated_easeslide.html
+++ b/tests/visual/accordion/accordion_option_animated_easeslide.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_animated_false.html b/tests/visual/accordion/accordion_option_animated_false.html
index 89b709fca..a4e2460d7 100644
--- a/tests/visual/accordion/accordion_option_animated_false.html
+++ b/tests/visual/accordion/accordion_option_animated_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_animated_slide.html b/tests/visual/accordion/accordion_option_animated_slide.html
index 1c0cda251..fab823466 100644
--- a/tests/visual/accordion/accordion_option_animated_slide.html
+++ b/tests/visual/accordion/accordion_option_animated_slide.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_animated_true.html b/tests/visual/accordion/accordion_option_animated_true.html
index beec4ea95..2e60c0577 100644
--- a/tests/visual/accordion/accordion_option_animated_true.html
+++ b/tests/visual/accordion/accordion_option_animated_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_autoHeight_false.html b/tests/visual/accordion/accordion_option_autoHeight_false.html
index 7dbd9e825..785fdb097 100644
--- a/tests/visual/accordion/accordion_option_autoHeight_false.html
+++ b/tests/visual/accordion/accordion_option_autoHeight_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_autoHeight_true.html b/tests/visual/accordion/accordion_option_autoHeight_true.html
index 14089a8bb..bb95d57c1 100644
--- a/tests/visual/accordion/accordion_option_autoHeight_true.html
+++ b/tests/visual/accordion/accordion_option_autoHeight_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_fillSpace_true.html b/tests/visual/accordion/accordion_option_fillSpace_true.html
index 477457adf..2fa197148 100644
--- a/tests/visual/accordion/accordion_option_fillSpace_true.html
+++ b/tests/visual/accordion/accordion_option_fillSpace_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_option_navigation_true.html b/tests/visual/accordion/accordion_option_navigation_true.html
index d26c2e760..2be145c01 100644
--- a/tests/visual/accordion/accordion_option_navigation_true.html
+++ b/tests/visual/accordion/accordion_option_navigation_true.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_ticket_4322.html b/tests/visual/accordion/accordion_ticket_4322.html
index b42803590..07c3561d6 100644
--- a/tests/visual/accordion/accordion_ticket_4322.html
+++ b/tests/visual/accordion/accordion_ticket_4322.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<style>
 		p {margin: .5em 0;}
 	</style>
diff --git a/tests/visual/accordion/accordion_ticket_4331.html b/tests/visual/accordion/accordion_ticket_4331.html
index f498a3ee7..1c8130f45 100644
--- a/tests/visual/accordion/accordion_ticket_4331.html
+++ b/tests/visual/accordion/accordion_ticket_4331.html
@@ -4,8 +4,8 @@
 	<title>Accordion Visual Test : Accordion ticket #4331</title>
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion();
diff --git a/tests/visual/accordion/accordion_ticket_4444.html b/tests/visual/accordion/accordion_ticket_4444.html
index 778af73bd..c200e3d21 100644
--- a/tests/visual/accordion/accordion_ticket_4444.html
+++ b/tests/visual/accordion/accordion_ticket_4444.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({
diff --git a/tests/visual/accordion/accordion_ul.html b/tests/visual/accordion/accordion_ul.html
index b652a7165..b7cc678e8 100644
--- a/tests/visual/accordion/accordion_ul.html
+++ b/tests/visual/accordion/accordion_ul.html
@@ -6,8 +6,8 @@
         <link rel="stylesheet" href="../../../themes/base/ui.base.css" type="text/css" />
         <link rel="stylesheet" href="../../../themes/base/ui.theme.css" type="text/css" title="ui-theme" />
         <script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-        <script type="text/javascript" src="../../../ui/ui.core.js"></script>
-        <script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+        <script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+        <script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
         <script type="text/javascript">
             $(function(){
                 $("#accordion").accordion()
diff --git a/tests/visual/accordion/default.html b/tests/visual/accordion/default.html
index eca5f8ed4..9ee1fee6f 100644
--- a/tests/visual/accordion/default.html
+++ b/tests/visual/accordion/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion();
diff --git a/tests/visual/all.html b/tests/visual/all.html
index b99eb4346..0aecd6fd0 100644
--- a/tests/visual/all.html
+++ b/tests/visual/all.html
@@ -5,18 +5,18 @@
 	<link rel="stylesheet" href="all.css" type="text/css">
 	<link rel="stylesheet" href="../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../ui/ui.dialog.js"></script>
-	<script type="text/javascript" src="../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.droppable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.progressbar.js"></script>
-	<script type="text/javascript" src="../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.selectable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.slider.js"></script>
-	<script type="text/javascript" src="../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.dialog.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.droppable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.selectable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.slider.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.ui.tabs.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#accordion").accordion({ header: "h3" });
diff --git a/tests/visual/animate/animate_backgroundColor_hex.html b/tests/visual/animate/animate_backgroundColor_hex.html
index 55c5ba8e6..e4f01b892 100644
--- a/tests/visual/animate/animate_backgroundColor_hex.html
+++ b/tests/visual/animate/animate_backgroundColor_hex.html
@@ -5,7 +5,7 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	function hexFromRGB (r, g, b) {
 		var hex = [
diff --git a/tests/visual/animate/animate_backgroundColor_rgb.html b/tests/visual/animate/animate_backgroundColor_rgb.html
index 8419d1113..c951472a9 100644
--- a/tests/visual/animate/animate_backgroundColor_rgb.html
+++ b/tests/visual/animate/animate_backgroundColor_rgb.html
@@ -5,7 +5,7 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	function randomColorRGB() {
 		return 'rgb('
diff --git a/tests/visual/animate/animate_color_hex.html b/tests/visual/animate/animate_color_hex.html
index decce8c9c..fda95b7d7 100644
--- a/tests/visual/animate/animate_color_hex.html
+++ b/tests/visual/animate/animate_color_hex.html
@@ -5,7 +5,7 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	function hexFromRGB (r, g, b) {
 		var hex = [
diff --git a/tests/visual/animate/animate_color_rgb.html b/tests/visual/animate/animate_color_rgb.html
index 10904ac6c..8c4c30583 100644
--- a/tests/visual/animate/animate_color_rgb.html
+++ b/tests/visual/animate/animate_color_rgb.html
@@ -5,7 +5,7 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/effects.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.effects.core.js"></script>
 	<script type="text/javascript">
 	function randomColorRGB() {
 		return 'rgb('
diff --git a/tests/visual/compound/accordion_tabs.html b/tests/visual/compound/accordion_tabs.html
index 81b9e4d71..279b32335 100644
--- a/tests/visual/compound/accordion_tabs.html
+++ b/tests/visual/compound/accordion_tabs.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.tabs.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#tabs').tabs();
diff --git a/tests/visual/compound/datepicker_dialog.html b/tests/visual/compound/datepicker_dialog.html
index a34babc63..f03027525 100644
--- a/tests/visual/compound/datepicker_dialog.html
+++ b/tests/visual/compound/datepicker_dialog.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#datepicker').datepicker();
diff --git a/tests/visual/compound/draggable_accordion.html b/tests/visual/compound/draggable_accordion.html
index ba04e9729..98fdc6af8 100644
--- a/tests/visual/compound/draggable_accordion.html
+++ b/tests/visual/compound/draggable_accordion.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#accordion').accordion();
diff --git a/tests/visual/compound/tabs_tabs.html b/tests/visual/compound/tabs_tabs.html
index 5d70a5cf5..2d4657d63 100644
--- a/tests/visual/compound/tabs_tabs.html
+++ b/tests/visual/compound/tabs_tabs.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.accordion.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.accordion.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.tabs.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#tabs, #tabs-a, #tabs-b').tabs();
diff --git a/tests/visual/datepicker/datepicker.html b/tests/visual/datepicker/datepicker.html
index a18974a71..0027f209e 100644
--- a/tests/visual/datepicker/datepicker.html
+++ b/tests/visual/datepicker/datepicker.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		// simple datepicker
diff --git a/tests/visual/datepicker/datepicker_ticket_4240.html b/tests/visual/datepicker/datepicker_ticket_4240.html
index 95492ffd0..a8f60909a 100644
--- a/tests/visual/datepicker/datepicker_ticket_4240.html
+++ b/tests/visual/datepicker/datepicker_ticket_4240.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#destroystart").click(function() {
diff --git a/tests/visual/datepicker/default.html b/tests/visual/datepicker/default.html
index 7082c969c..077c867b5 100644
--- a/tests/visual/datepicker/default.html
+++ b/tests/visual/datepicker/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#datepicker').datepicker();
diff --git a/tests/visual/datepicker/multimonth.html b/tests/visual/datepicker/multimonth.html
index 9aeb7c330..39a2b7114 100644
--- a/tests/visual/datepicker/multimonth.html
+++ b/tests/visual/datepicker/multimonth.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$('#datepicker').datepicker({numberOfMonths: [4,3], showButtonPanel: true });
diff --git a/tests/visual/datepicker/viewport.html b/tests/visual/datepicker/viewport.html
index 419d57032..68e17bad0 100644
--- a/tests/visual/datepicker/viewport.html
+++ b/tests/visual/datepicker/viewport.html
@@ -16,8 +16,8 @@ tr.rule-above td {
 </style>
 <link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 <script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-<script type="text/javascript" src="../../../ui/ui.datepicker.js"></script>
+<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+<script type="text/javascript" src="../../../ui/jquery.ui.datepicker.js"></script>
 <style type="text/css">
 label.error {
 	color: #ff4c00;
diff --git a/tests/visual/dialog/default.html b/tests/visual/dialog/default.html
index e466dff9d..fb6772ff8 100644
--- a/tests/visual/dialog/default.html
+++ b/tests/visual/dialog/default.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog();
diff --git a/tests/visual/dialog/dialog.html b/tests/visual/dialog/dialog.html
index f638fca41..ac8c4f4b1 100644
--- a/tests/visual/dialog/dialog.html
+++ b/tests/visual/dialog/dialog.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		// Simple Dialog
diff --git a/tests/visual/dialog/dialog_on_page_with_large_dom.html b/tests/visual/dialog/dialog_on_page_with_large_dom.html
index 3c7075c60..983b756ad 100644
--- a/tests/visual/dialog/dialog_on_page_with_large_dom.html
+++ b/tests/visual/dialog/dialog_on_page_with_large_dom.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog({
diff --git a/tests/visual/dialog/dialog_on_page_with_scrollbars.html b/tests/visual/dialog/dialog_on_page_with_scrollbars.html
index ffc44726c..bab85b7bd 100644
--- a/tests/visual/dialog/dialog_on_page_with_scrollbars.html
+++ b/tests/visual/dialog/dialog_on_page_with_scrollbars.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog();
diff --git a/tests/visual/dialog/dialog_option_closeOnEscape_false.html b/tests/visual/dialog/dialog_option_closeOnEscape_false.html
index 90d7c2c2c..a9f898ca3 100644
--- a/tests/visual/dialog/dialog_option_closeOnEscape_false.html
+++ b/tests/visual/dialog/dialog_option_closeOnEscape_false.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog({
diff --git a/tests/visual/dialog/dialog_option_closeOnEscape_true.html b/tests/visual/dialog/dialog_option_closeOnEscape_true.html
index f3882d9da..116d7b0b0 100644
--- a/tests/visual/dialog/dialog_option_closeOnEscape_true.html
+++ b/tests/visual/dialog/dialog_option_closeOnEscape_true.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog({
diff --git a/tests/visual/dialog/dialog_option_modal_false.html b/tests/visual/dialog/dialog_option_modal_false.html
index 0bfc3ecc3..f89894c9f 100644
--- a/tests/visual/dialog/dialog_option_modal_false.html
+++ b/tests/visual/dialog/dialog_option_modal_false.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog({
diff --git a/tests/visual/dialog/dialog_option_modal_true.html b/tests/visual/dialog/dialog_option_modal_true.html
index c1f7ecc9f..84f6ee0b9 100644
--- a/tests/visual/dialog/dialog_option_modal_true.html
+++ b/tests/visual/dialog/dialog_option_modal_true.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#dialog").dialog({
diff --git a/tests/visual/dialog/dialog_ticket_4826.html b/tests/visual/dialog/dialog_ticket_4826.html
index 267e862f7..4dbd56543 100644
--- a/tests/visual/dialog/dialog_ticket_4826.html
+++ b/tests/visual/dialog/dialog_ticket_4826.html
@@ -5,12 +5,12 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.position.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.stackfix.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.dialog.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.position.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.stackfix.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.dialog.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		
diff --git a/tests/visual/draggable/default.html b/tests/visual/draggable/default.html
index 925631fa9..cad44f2ba 100644
--- a/tests/visual/draggable/default.html
+++ b/tests/visual/draggable/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").draggable();
diff --git a/tests/visual/draggable/draggable.html b/tests/visual/draggable/draggable.html
index 224640f2a..d68eaec06 100644
--- a/tests/visual/draggable/draggable.html
+++ b/tests/visual/draggable/draggable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable();
diff --git a/tests/visual/draggable/draggable.scroll.html b/tests/visual/draggable/draggable.scroll.html
index a72786054..fdc6fed3a 100644
--- a/tests/visual/draggable/draggable.scroll.html
+++ b/tests/visual/draggable/draggable.scroll.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<style type="text/css">
 		.draggable {
 			width:100px;
diff --git a/tests/visual/draggable/draggable_option_containment_array.html b/tests/visual/draggable/draggable_option_containment_array.html
index 724a6bf3a..2b777a9e0 100644
--- a/tests/visual/draggable/draggable_option_containment_array.html
+++ b/tests/visual/draggable/draggable_option_containment_array.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/draggable/draggable_option_cursorAt_object.html b/tests/visual/draggable/draggable_option_cursorAt_object.html
index 6cd41e828..bc8a31a90 100644
--- a/tests/visual/draggable/draggable_option_cursorAt_object.html
+++ b/tests/visual/draggable/draggable_option_cursorAt_object.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/draggable/draggable_option_handle_selector.html b/tests/visual/draggable/draggable_option_handle_selector.html
index 1c1e70886..83bc90a01 100644
--- a/tests/visual/draggable/draggable_option_handle_selector.html
+++ b/tests/visual/draggable/draggable_option_handle_selector.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/draggable/draggable_option_iframeFix_false.html b/tests/visual/draggable/draggable_option_iframeFix_false.html
index 6e84192e6..2a3610ca8 100644
--- a/tests/visual/draggable/draggable_option_iframeFix_false.html
+++ b/tests/visual/draggable/draggable_option_iframeFix_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/draggable/draggable_option_iframeFix_selector.html b/tests/visual/draggable/draggable_option_iframeFix_selector.html
index b1aba44d1..831284536 100644
--- a/tests/visual/draggable/draggable_option_iframeFix_selector.html
+++ b/tests/visual/draggable/draggable_option_iframeFix_selector.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/draggable/draggable_option_iframeFix_true.html b/tests/visual/draggable/draggable_option_iframeFix_true.html
index 4e44f91b4..bb5170de6 100644
--- a/tests/visual/draggable/draggable_option_iframeFix_true.html
+++ b/tests/visual/draggable/draggable_option_iframeFix_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggable").draggable({
diff --git a/tests/visual/droppable/default.html b/tests/visual/droppable/default.html
index 1afc1acfa..c56b25c4d 100644
--- a/tests/visual/droppable/default.html
+++ b/tests/visual/droppable/default.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").droppable();
diff --git a/tests/visual/droppable/droppable.html b/tests/visual/droppable/droppable.html
index f1728d3ea..2bb70ec13 100644
--- a/tests/visual/droppable/droppable.html
+++ b/tests/visual/droppable/droppable.html
@@ -5,9 +5,9 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#droppable").droppable();
diff --git a/tests/visual/droppable/droppable_option_accept_default.html b/tests/visual/droppable/droppable_option_accept_default.html
index b16fd6d9d..01bad871d 100644
--- a/tests/visual/droppable/droppable_option_accept_default.html
+++ b/tests/visual/droppable/droppable_option_accept_default.html
@@ -6,9 +6,9 @@
 	<link rel="stylesheet" href="droppable.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggables *").draggable({
diff --git a/tests/visual/droppable/droppable_option_accept_function.html b/tests/visual/droppable/droppable_option_accept_function.html
index d3e15b5af..9852b888c 100644
--- a/tests/visual/droppable/droppable_option_accept_function.html
+++ b/tests/visual/droppable/droppable_option_accept_function.html
@@ -6,9 +6,9 @@
 	<link rel="stylesheet" href="droppable.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggables *").draggable({
diff --git a/tests/visual/droppable/droppable_option_accept_selector.html b/tests/visual/droppable/droppable_option_accept_selector.html
index 688215fed..f747330e6 100644
--- a/tests/visual/droppable/droppable_option_accept_selector.html
+++ b/tests/visual/droppable/droppable_option_accept_selector.html
@@ -6,9 +6,9 @@
 	<link rel="stylesheet" href="droppable.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#draggables *").draggable({
diff --git a/tests/visual/droppable/droppable_ticket_4087.html b/tests/visual/droppable/droppable_ticket_4087.html
index 57a991e77..4e0b5fb11 100644
--- a/tests/visual/droppable/droppable_ticket_4087.html
+++ b/tests/visual/droppable/droppable_ticket_4087.html
@@ -4,9 +4,9 @@
 	<title>Droppable Visual Test - Droppable ticket 4087</title>
 	<link type="text/css" href="../../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#draggable { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px; }
diff --git a/tests/visual/droppable/droppable_ticket_4088.html b/tests/visual/droppable/droppable_ticket_4088.html
index 89fdfa1e2..28287fadc 100644
--- a/tests/visual/droppable/droppable_ticket_4088.html
+++ b/tests/visual/droppable/droppable_ticket_4088.html
@@ -4,9 +4,9 @@
 	<title>Droppable Visual Test - Droppable ticket 4088</title>
 	<link type="text/css" href="../../../themes/base/ui.all.css" rel="stylesheet" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.droppable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.droppable.js"></script>
 	<link type="text/css" href="../demos.css" rel="stylesheet" />
 	<style type="text/css">
 	#sortable { list-style-type: none; margin: 0; padding: 0; width: 60%; }
diff --git a/tests/visual/effects.all.html b/tests/visual/effects.all.html
index f99947867..be1ea8dc5 100644
--- a/tests/visual/effects.all.html
+++ b/tests/visual/effects.all.html
@@ -4,19 +4,19 @@
 	<title>jQuery UI Effects Test Suite</title>
 	<link rel="stylesheet" href="effects.all.css" type="text/css" />
 	<script type="text/javascript" src="../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../ui/effects.core.js"></script>
-	<script type="text/javascript" src="../../ui/effects.blind.js"></script>
-	<script type="text/javascript" src="../../ui/effects.bounce.js"></script>
-	<script type="text/javascript" src="../../ui/effects.clip.js"></script>
-	<script type="text/javascript" src="../../ui/effects.drop.js"></script>
-	<script type="text/javascript" src="../../ui/effects.explode.js"></script>
-	<script type="text/javascript" src="../../ui/effects.fold.js"></script>
-	<script type="text/javascript" src="../../ui/effects.highlight.js"></script>
-	<script type="text/javascript" src="../../ui/effects.pulsate.js"></script>
-	<script type="text/javascript" src="../../ui/effects.scale.js"></script>
-	<script type="text/javascript" src="../../ui/effects.shake.js"></script>
-	<script type="text/javascript" src="../../ui/effects.slide.js"></script>
-	<script type="text/javascript" src="../../ui/effects.transfer.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.core.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.blind.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.bounce.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.clip.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.drop.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.explode.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.fold.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.highlight.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.pulsate.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.scale.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.shake.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.slide.js"></script>
+	<script type="text/javascript" src="../../ui/jquery.effects.transfer.js"></script>
 	<script type="text/javascript" src="effects.all.js"></script>
 </head>
 <body>
diff --git a/tests/visual/progressbar/default.html b/tests/visual/progressbar/default.html
index 326e8922a..acd63cf69 100644
--- a/tests/visual/progressbar/default.html
+++ b/tests/visual/progressbar/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.progressbar.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#progressbar").progressbar();
diff --git a/tests/visual/progressbar/progressbar.html b/tests/visual/progressbar/progressbar.html
index b3309e053..d79bef687 100644
--- a/tests/visual/progressbar/progressbar.html
+++ b/tests/visual/progressbar/progressbar.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.progressbar.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.progressbar.js"></script>
 	<script type="text/javascript">
 		$(function() {
 			$("#progressbar").progressbar({ value: 37 });
diff --git a/tests/visual/resizable/default.html b/tests/visual/resizable/default.html
index 9a122f6b1..f93190198 100644
--- a/tests/visual/resizable/default.html
+++ b/tests/visual/resizable/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable();
diff --git a/tests/visual/resizable/resizable.html b/tests/visual/resizable/resizable.html
index 1063d926a..0b946529e 100644
--- a/tests/visual/resizable/resizable.html
+++ b/tests/visual/resizable/resizable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable();
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_0.5.html b/tests/visual/resizable/resizable_option_aspectRatio_0.5.html
index a2b8989f7..59f732d79 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_0.5.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_0.5.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_1.0.html b/tests/visual/resizable/resizable_option_aspectRatio_1.0.html
index ceb464ec0..a821550af 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_1.0.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_1.0.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_1.5.html b/tests/visual/resizable/resizable_option_aspectRatio_1.5.html
index 18a796750..2b7be71ca 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_1.5.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_1.5.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxHeight_150.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxHeight_150.html
index 6b0b8a7a9..8cd900894 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxHeight_150.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxHeight_150.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxWidth_150.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxWidth_150.html
index 0d3e519d5..2e922ceb0 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxWidth_150.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_maxWidth_150.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_minHeight_50.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_minHeight_50.html
index a324e2945..abbf6fd84 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_minHeight_50.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_minHeight_50.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_minWidth_50.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_minWidth_50.html
index 5cd6c2f92..3c5b21cf4 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_minWidth_50.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_minWidth_50.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh100.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh100.html
index dbc3670b0..e461671d2 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh100.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh100.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh50.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh50.html
index 5a553f540..b8a8268ba 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh50.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w100xh50.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w50xh100.html b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w50xh100.html
index 775c1f821..d7e6cace1 100644
--- a/tests/visual/resizable/resizable_option_aspectRatio_preserve_w50xh100.html
+++ b/tests/visual/resizable/resizable_option_aspectRatio_preserve_w50xh100.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_ticket_3053.html b/tests/visual/resizable/resizable_ticket_3053.html
index 9ceb21f21..541d8fb01 100644
--- a/tests/visual/resizable/resizable_ticket_3053.html
+++ b/tests/visual/resizable/resizable_ticket_3053.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_ticket_4199.html b/tests/visual/resizable/resizable_ticket_4199.html
index 8cd7c3d40..50c038eda 100644
--- a/tests/visual/resizable/resizable_ticket_4199.html
+++ b/tests/visual/resizable/resizable_ticket_4199.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/resizable/resizable_ticket_4217.html b/tests/visual/resizable/resizable_ticket_4217.html
index 18fd8eb64..b600bc063 100644
--- a/tests/visual/resizable/resizable_ticket_4217.html
+++ b/tests/visual/resizable/resizable_ticket_4217.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.resizable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.resizable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#resizable").resizable({
diff --git a/tests/visual/selectable/default.html b/tests/visual/selectable/default.html
index e22738306..1d0d06ef0 100644
--- a/tests/visual/selectable/default.html
+++ b/tests/visual/selectable/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.selectable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#selectable").selectable();
diff --git a/tests/visual/selectable/selectable.html b/tests/visual/selectable/selectable.html
index 546bb0d72..995fa1ae5 100644
--- a/tests/visual/selectable/selectable.html
+++ b/tests/visual/selectable/selectable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.selectable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#selectable").selectable();
diff --git a/tests/visual/selectable/selectable_ticket_4341.html b/tests/visual/selectable/selectable_ticket_4341.html
index 75b795aff..c763fa998 100644
--- a/tests/visual/selectable/selectable_ticket_4341.html
+++ b/tests/visual/selectable/selectable_ticket_4341.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.selectable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.selectable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#selectable").selectable({
diff --git a/tests/visual/slider/default.html b/tests/visual/slider/default.html
index dc57608b7..37059c155 100644
--- a/tests/visual/slider/default.html
+++ b/tests/visual/slider/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider();
diff --git a/tests/visual/slider/default_vertical.html b/tests/visual/slider/default_vertical.html
index e0e5618be..8cceb981b 100644
--- a/tests/visual/slider/default_vertical.html
+++ b/tests/visual/slider/default_vertical.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider.html b/tests/visual/slider/slider.html
index 0e76034a6..c54be6b43 100644
--- a/tests/visual/slider/slider.html
+++ b/tests/visual/slider/slider.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider1").slider();
diff --git a/tests/visual/slider/slider_horizontal.html b/tests/visual/slider/slider_horizontal.html
index fb6fe1027..64ac203fb 100644
--- a/tests/visual/slider/slider_horizontal.html
+++ b/tests/visual/slider/slider_horizontal.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_horizontal_range.html b/tests/visual/slider/slider_horizontal_range.html
index 182e27a1a..07c293f99 100644
--- a/tests/visual/slider/slider_horizontal_range.html
+++ b/tests/visual/slider/slider_horizontal_range.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_horizontal_range_max.html b/tests/visual/slider/slider_horizontal_range_max.html
index 68fd374a4..260d722af 100644
--- a/tests/visual/slider/slider_horizontal_range_max.html
+++ b/tests/visual/slider/slider_horizontal_range_max.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_horizontal_range_min.html b/tests/visual/slider/slider_horizontal_range_min.html
index cbf2d7f36..c67989dc9 100644
--- a/tests/visual/slider/slider_horizontal_range_min.html
+++ b/tests/visual/slider/slider_horizontal_range_min.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_in_container_with_scrollbars.html b/tests/visual/slider/slider_in_container_with_scrollbars.html
index f933eeda3..50b7d3d66 100644
--- a/tests/visual/slider/slider_in_container_with_scrollbars.html
+++ b/tests/visual/slider/slider_in_container_with_scrollbars.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({ value: 50 });
diff --git a/tests/visual/slider/slider_method_destroy.html b/tests/visual/slider/slider_method_destroy.html
index 4d827cf6a..e612d5abb 100644
--- a/tests/visual/slider/slider_method_destroy.html
+++ b/tests/visual/slider/slider_method_destroy.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_method_disable.html b/tests/visual/slider/slider_method_disable.html
index 1bc6ef59c..9549fcf08 100644
--- a/tests/visual/slider/slider_method_disable.html
+++ b/tests/visual/slider/slider_method_disable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_animate_false.html b/tests/visual/slider/slider_option_animate_false.html
index ac1f195fc..ff384fc18 100644
--- a/tests/visual/slider/slider_option_animate_false.html
+++ b/tests/visual/slider/slider_option_animate_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_animate_true.html b/tests/visual/slider/slider_option_animate_true.html
index 476b9581a..40bbb55b6 100644
--- a/tests/visual/slider/slider_option_animate_true.html
+++ b/tests/visual/slider/slider_option_animate_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_max_3.html b/tests/visual/slider/slider_option_max_3.html
index d6fc81250..672d25929 100644
--- a/tests/visual/slider/slider_option_max_3.html
+++ b/tests/visual/slider/slider_option_max_3.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_max_30.html b/tests/visual/slider/slider_option_max_30.html
index e638bbc74..a845415fb 100644
--- a/tests/visual/slider/slider_option_max_30.html
+++ b/tests/visual/slider/slider_option_max_30.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_max_300.html b/tests/visual/slider/slider_option_max_300.html
index 64b71ce6a..b85459fa0 100644
--- a/tests/visual/slider/slider_option_max_300.html
+++ b/tests/visual/slider/slider_option_max_300.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_min_-3.html b/tests/visual/slider/slider_option_min_-3.html
index 3868192f9..ce2f08397 100644
--- a/tests/visual/slider/slider_option_min_-3.html
+++ b/tests/visual/slider/slider_option_min_-3.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_min_-30.html b/tests/visual/slider/slider_option_min_-30.html
index acd0c935e..b5adac9ae 100644
--- a/tests/visual/slider/slider_option_min_-30.html
+++ b/tests/visual/slider/slider_option_min_-30.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_min_-300.html b/tests/visual/slider/slider_option_min_-300.html
index af440acde..196d9bb62 100644
--- a/tests/visual/slider/slider_option_min_-300.html
+++ b/tests/visual/slider/slider_option_min_-300.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_orientation_horizontal.html b/tests/visual/slider/slider_option_orientation_horizontal.html
index 69c8f0305..6611e8e9c 100644
--- a/tests/visual/slider/slider_option_orientation_horizontal.html
+++ b/tests/visual/slider/slider_option_orientation_horizontal.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_orientation_vertical.html b/tests/visual/slider/slider_option_orientation_vertical.html
index e8390417d..fbbc15ba9 100644
--- a/tests/visual/slider/slider_option_orientation_vertical.html
+++ b/tests/visual/slider/slider_option_orientation_vertical.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_range_false.html b/tests/visual/slider/slider_option_range_false.html
index 9cf2a523e..77a2e5408 100644
--- a/tests/visual/slider/slider_option_range_false.html
+++ b/tests/visual/slider/slider_option_range_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_range_max.html b/tests/visual/slider/slider_option_range_max.html
index f78c79af1..ca2cc542e 100644
--- a/tests/visual/slider/slider_option_range_max.html
+++ b/tests/visual/slider/slider_option_range_max.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_range_min.html b/tests/visual/slider/slider_option_range_min.html
index 3af2c6f87..e1af917b2 100644
--- a/tests/visual/slider/slider_option_range_min.html
+++ b/tests/visual/slider/slider_option_range_min.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_range_true.html b/tests/visual/slider/slider_option_range_true.html
index 230cedd51..54741bd41 100644
--- a/tests/visual/slider/slider_option_range_true.html
+++ b/tests/visual/slider/slider_option_range_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_step_25.html b/tests/visual/slider/slider_option_step_25.html
index f92d13ea6..b50f6a324 100644
--- a/tests/visual/slider/slider_option_step_25.html
+++ b/tests/visual/slider/slider_option_step_25.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_step_5.html b/tests/visual/slider/slider_option_step_5.html
index bdecb3aba..d34f24c5f 100644
--- a/tests/visual/slider/slider_option_step_5.html
+++ b/tests/visual/slider/slider_option_step_5.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_value_3.html b/tests/visual/slider/slider_option_value_3.html
index 52e6a9d2a..625ca7593 100644
--- a/tests/visual/slider/slider_option_value_3.html
+++ b/tests/visual/slider/slider_option_value_3.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_value_30.html b/tests/visual/slider/slider_option_value_30.html
index 80e6c041e..eb0b86c3d 100644
--- a/tests/visual/slider/slider_option_value_30.html
+++ b/tests/visual/slider/slider_option_value_30.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_values_25_50_75.html b/tests/visual/slider/slider_option_values_25_50_75.html
index f5cb5021d..ad10165c8 100644
--- a/tests/visual/slider/slider_option_values_25_50_75.html
+++ b/tests/visual/slider/slider_option_values_25_50_75.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_values_25_75.html b/tests/visual/slider/slider_option_values_25_75.html
index c47a6320d..4bc4a1c8a 100644
--- a/tests/visual/slider/slider_option_values_25_75.html
+++ b/tests/visual/slider/slider_option_values_25_75.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_option_values_50.html b/tests/visual/slider/slider_option_values_50.html
index 193fda94a..dbe011b07 100644
--- a/tests/visual/slider/slider_option_values_50.html
+++ b/tests/visual/slider/slider_option_values_50.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_ticket_3736.html b/tests/visual/slider/slider_ticket_3736.html
index 5560edcec..e178a551b 100644
--- a/tests/visual/slider/slider_ticket_3736.html
+++ b/tests/visual/slider/slider_ticket_3736.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_ticket_3762.html b/tests/visual/slider/slider_ticket_3762.html
index 9eee9c227..c0712219a 100644
--- a/tests/visual/slider/slider_ticket_3762.html
+++ b/tests/visual/slider/slider_ticket_3762.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({ values: [5,0], range: true});
diff --git a/tests/visual/slider/slider_ticket_4385.html b/tests/visual/slider/slider_ticket_4385.html
index 7a7456abb..b60d39807 100644
--- a/tests/visual/slider/slider_ticket_4385.html
+++ b/tests/visual/slider/slider_ticket_4385.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#slider").slider({
diff --git a/tests/visual/slider/slider_vertical.html b/tests/visual/slider/slider_vertical.html
index 5ec02be21..b38e932db 100644
--- a/tests/visual/slider/slider_vertical.html
+++ b/tests/visual/slider/slider_vertical.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_vertical_range.html b/tests/visual/slider/slider_vertical_range.html
index d59fd5f57..96f856423 100644
--- a/tests/visual/slider/slider_vertical_range.html
+++ b/tests/visual/slider/slider_vertical_range.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_vertical_range_max.html b/tests/visual/slider/slider_vertical_range_max.html
index d68eae585..feb4ab52e 100644
--- a/tests/visual/slider/slider_vertical_range_max.html
+++ b/tests/visual/slider/slider_vertical_range_max.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/slider/slider_vertical_range_min.html b/tests/visual/slider/slider_vertical_range_min.html
index 5ce2c2a4d..b3c274223 100644
--- a/tests/visual/slider/slider_vertical_range_min.html
+++ b/tests/visual/slider/slider_vertical_range_min.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.slider.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.slider.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").slider({
diff --git a/tests/visual/sortable/default.html b/tests/visual/sortable/default.html
index 0af09ffd4..78c36c5e4 100644
--- a/tests/visual/sortable/default.html
+++ b/tests/visual/sortable/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("body").children(":first").sortable();
diff --git a/tests/visual/sortable/sortable.html b/tests/visual/sortable/sortable.html
index 039ebe80a..069fb3624 100644
--- a/tests/visual/sortable/sortable.html
+++ b/tests/visual/sortable/sortable.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#sortable").sortable();
diff --git a/tests/visual/sortable/sortable_massive_scale.html b/tests/visual/sortable/sortable_massive_scale.html
index 47a02bc9a..3c5a8acaa 100644
--- a/tests/visual/sortable/sortable_massive_scale.html
+++ b/tests/visual/sortable/sortable_massive_scale.html
@@ -4,9 +4,9 @@
 	<title>Sortable Massive Scale Test</title>
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.draggable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.draggable.js"></script>
 	<style>
 		ul {
 			list-style: none;
diff --git a/tests/visual/sortable/sortable_option_revert_false.html b/tests/visual/sortable/sortable_option_revert_false.html
index fe6c4d3e8..2ade1c9a9 100644
--- a/tests/visual/sortable/sortable_option_revert_false.html
+++ b/tests/visual/sortable/sortable_option_revert_false.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#sortable").sortable({
diff --git a/tests/visual/sortable/sortable_option_revert_true.html b/tests/visual/sortable/sortable_option_revert_true.html
index bb3cb24e5..37f4a733b 100644
--- a/tests/visual/sortable/sortable_option_revert_true.html
+++ b/tests/visual/sortable/sortable_option_revert_true.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css" />
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#sortable").sortable({
diff --git a/tests/visual/sortable/sortable_ticket_4551.html b/tests/visual/sortable/sortable_ticket_4551.html
index ba61e244a..9f83d3908 100644
--- a/tests/visual/sortable/sortable_ticket_4551.html
+++ b/tests/visual/sortable/sortable_ticket_4551.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.sortable.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.sortable.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#first, #second").sortable({
diff --git a/tests/visual/tabs/default.html b/tests/visual/tabs/default.html
index 8257517fe..57f31b278 100644
--- a/tests/visual/tabs/default.html
+++ b/tests/visual/tabs/default.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../visual.css" type="text/css" />
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.tabs.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#tabs").tabs();
diff --git a/tests/visual/tabs/tabs.html b/tests/visual/tabs/tabs.html
index 40036b975..02b11475b 100644
--- a/tests/visual/tabs/tabs.html
+++ b/tests/visual/tabs/tabs.html
@@ -5,8 +5,8 @@
 	<link rel="stylesheet" href="../all.css" type="text/css">
 	<link rel="stylesheet" href="../../../themes/base/ui.all.css" type="text/css">
 	<script type="text/javascript" src="../../../jquery-1.3.2.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.core.js"></script>
-	<script type="text/javascript" src="../../../ui/ui.tabs.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.core.js"></script>
+	<script type="text/javascript" src="../../../ui/jquery.ui.tabs.js"></script>
 	<script type="text/javascript">
 	$(function() {
 		$("#tabs").tabs();
diff --git a/ui/effects.blind.js b/ui/effects.blind.js
deleted file mode 100644
index d8338eae0..000000000
--- a/ui/effects.blind.js
+++ /dev/null
@@ -1,49 +0,0 @@
-/*
- * jQuery UI Effects Blind @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Blind
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.blind = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
-		var direction = o.options.direction || 'vertical'; // Default direction
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
-		var ref = (direction == 'vertical') ? 'height' : 'width';
-		var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
-		if(mode == 'show') wrapper.css(ref, 0); // Shift
-
-		// Animation
-		var animation = {};
-		animation[ref] = mode == 'show' ? distance : 0;
-
-		// Animate
-		wrapper.animate(animation, o.duration, o.options.easing, function() {
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(el[0], arguments); // Callback
-			el.dequeue();
-		});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.bounce.js b/ui/effects.bounce.js
deleted file mode 100644
index e84ec48c6..000000000
--- a/ui/effects.bounce.js
+++ /dev/null
@@ -1,78 +0,0 @@
-/*
- * jQuery UI Effects Bounce @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Bounce
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.bounce = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
-		var direction = o.options.direction || 'up'; // Default direction
-		var distance = o.options.distance || 20; // Default distance
-		var times = o.options.times || 5; // Default # of times
-		var speed = o.duration || 250; // Default speed per bounce
-		if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		$.effects.createWrapper(el); // Create Wrapper
-		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
-		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
-		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-		if (mode == 'hide') distance = distance / (times * 2);
-		if (mode != 'hide') times--;
-
-		// Animate
-		if (mode == 'show') { // Show Bounce
-			var animation = {opacity: 1};
-			animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
-			el.animate(animation, speed / 2, o.options.easing);
-			distance = distance / 2;
-			times--;
-		};
-		for (var i = 0; i < times; i++) { // Bounces
-			var animation1 = {}, animation2 = {};
-			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
-			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
-			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
-			distance = (mode == 'hide') ? distance * 2 : distance / 2;
-		};
-		if (mode == 'hide') { // Last Bounce
-			var animation = {opacity: 0};
-			animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
-			el.animate(animation, speed / 2, o.options.easing, function(){
-				el.hide(); // Hide
-				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-				if(o.callback) o.callback.apply(this, arguments); // Callback
-			});
-		} else {
-			var animation1 = {}, animation2 = {};
-			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
-			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
-			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
-				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-				if(o.callback) o.callback.apply(this, arguments); // Callback
-			});
-		};
-		el.queue('fx', function() { el.dequeue(); });
-		el.dequeue();
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.clip.js b/ui/effects.clip.js
deleted file mode 100644
index d5d2afefb..000000000
--- a/ui/effects.clip.js
+++ /dev/null
@@ -1,54 +0,0 @@
-/*
- * jQuery UI Effects Clip @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Clip
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.clip = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left','height','width'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
-		var direction = o.options.direction || 'vertical'; // Default direction
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
-		var animate = el[0].tagName == 'IMG' ? wrapper : el;
-		var ref = {
-			size: (direction == 'vertical') ? 'height' : 'width',
-			position: (direction == 'vertical') ? 'top' : 'left'
-		};
-		var distance = (direction == 'vertical') ? animate.height() : animate.width();
-		if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
-
-		// Animation
-		var animation = {};
-		animation[ref.size] = mode == 'show' ? distance : 0;
-		animation[ref.position] = mode == 'show' ? 0 : distance / 2;
-
-		// Animate
-		animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(el[0], arguments); // Callback
-			el.dequeue();
-		}});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.core.js b/ui/effects.core.js
deleted file mode 100644
index e41d71441..000000000
--- a/ui/effects.core.js
+++ /dev/null
@@ -1,581 +0,0 @@
-/*
- * jQuery UI Effects @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/
- */
-;jQuery.effects || (function($) {
-
-$.effects = {
-	version: "@VERSION",
-
-	// Saves a set of properties in a data storage
-	save: function(element, set) {
-		for(var i=0; i < set.length; i++) {
-			if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
-		}
-	},
-
-	// Restores a set of previously saved properties from a data storage
-	restore: function(element, set) {
-		for(var i=0; i < set.length; i++) {
-			if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
-		}
-	},
-
-	setMode: function(el, mode) {
-		if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
-		return mode;
-	},
-
-	getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
-		// this should be a little more flexible in the future to handle a string & hash
-		var y, x;
-		switch (origin[0]) {
-			case 'top': y = 0; break;
-			case 'middle': y = 0.5; break;
-			case 'bottom': y = 1; break;
-			default: y = origin[0] / original.height;
-		};
-		switch (origin[1]) {
-			case 'left': x = 0; break;
-			case 'center': x = 0.5; break;
-			case 'right': x = 1; break;
-			default: x = origin[1] / original.width;
-		};
-		return {x: x, y: y};
-	},
-
-	// Wraps the element around a wrapper that copies position properties
-	createWrapper: function(element) {
-
-		//if the element is already wrapped, return it
-		if (element.parent().is('.ui-effects-wrapper'))
-			return element.parent();
-
-		//Cache width,height and float properties of the element, and create a wrapper around it
-		var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
-		element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
-		var wrapper = element.parent();
-
-		//Transfer the positioning of the element to the wrapper
-		if (element.css('position') == 'static') {
-			wrapper.css({ position: 'relative' });
-			element.css({ position: 'relative'} );
-		} else {
-			var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
-			var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
-			wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
-			element.css({position: 'relative', top: 0, left: 0 });
-		}
-
-		wrapper.css(props);
-		return wrapper;
-	},
-
-	removeWrapper: function(element) {
-		if (element.parent().is('.ui-effects-wrapper'))
-			return element.parent().replaceWith(element);
-		return element;
-	},
-
-	setTransition: function(element, list, factor, value) {
-		value = value || {};
-		$.each(list, function(i, x){
-			unit = element.cssUnit(x);
-			if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
-		});
-		return value;
-	},
-
-	//Base function to animate from one class to another in a seamless transition
-	animateClass: function(value, duration, easing, callback) {
-
-		var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
-		var ea = (typeof easing == "string" ? easing : null);
-
-		return this.each(function() {
-
-			var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
-			if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
-			if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
-
-			//Let's get a style offset
-			var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
-			if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
-			var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
-			if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
-
-			// The main function to form the object for animation
-			for(var n in newStyle) {
-				if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
-				&& n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
-				&& n.indexOf("scrollbar") == -1 /* No scrollbar properties - causes problems in IE */
-				&& newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
-				&& (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
-				&& (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
-				) offset[n] = newStyle[n];
-			}
-
-			that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
-				// Change style attribute back to original. For stupid IE, we need to clear the damn object.
-				if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
-				if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
-				if(cb) cb.apply(this, arguments);
-			});
-
-		});
-	}
-};
-
-
-function _normalizeArguments(effect, options, speed, callback) {
-	// shift params for method overloading
-	if (typeof effect == 'object') {
-		callback = options;
-		speed = null;
-		options = effect;
-		effect = options.effect;
-	}
-	if ($.isFunction(options)) {
-		callback = options;
-		speed = null;
-		options = {};
-	}
-	if (typeof options == 'number') {
-		callback = speed;
-		speed = options;
-		options = {};
-	}
-
-	options = options || {};
-
-	speed = speed || options.duration;
-	speed = $.fx.off ? 0 : typeof speed == 'number'
-		? speed : $.fx.speeds[speed] || $.fx.speeds._default;
-
-	callback = callback || options.complete;
-
-	return [effect, options, speed, callback];
-}
-
-$.fn.extend({
-	effect: function(effect, options, speed, callback) {
-		var args = _normalizeArguments.apply(this, arguments),
-			// TODO: make effects takes actual parameters instead of a hash
-			args2 = {
-				options: args[1],
-				duration: args[2],
-				callback: args[3]
-			},
-			effectMethod = $.effects[effect];
-		
-		return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
-	},
-
-	_show: $.fn.show,
-	show: function(speed) {
-		if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
-			return this._show.apply(this, arguments);
-		} else {
-			var args = _normalizeArguments.apply(this, arguments);
-			args[1].mode = 'show';
-			return this.effect.apply(this, args);
-		}
-	},
-
-	_hide: $.fn.hide,
-	hide: function(speed) {
-		if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
-			return this._hide.apply(this, arguments);
-		} else {
-			var args = _normalizeArguments.apply(this, arguments);
-			args[1].mode = 'hide';
-			return this.effect.apply(this, args);
-		}
-	},
-
-	// jQuery core overloads toggle and create _toggle
-	__toggle: $.fn.toggle,
-	toggle: function(speed) {
-		if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
-			typeof speed == 'boolean' || $.isFunction(speed)) {
-			return this.__toggle.apply(this, arguments);
-		} else {
-			var args = _normalizeArguments.apply(this, arguments);
-			args[1].mode = 'toggle';
-			return this.effect.apply(this, args);
-		}
-	},
-
-	_addClass: $.fn.addClass,
-	addClass: function(classNames, speed, easing, callback) {
-		return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
-	},
-
-	_removeClass: $.fn.removeClass,
-	removeClass: function(classNames,speed,easing,callback) {
-		return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
-	},
-
-	_toggleClass: $.fn.toggleClass,
-	toggleClass: function(classNames, force, speed, easing, callback) {
-		if ( typeof force == "boolean" || force === undefined ) {
-			if ( !speed ) {
-				// without speed parameter;
-				return this._toggleClass(classNames, force);
-			} else {
-				return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
-			}
-		} else {
-			// without switch parameter;
-			return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
-		}
-	},
-
-	switchClass: function(remove,add,speed,easing,callback) {
-		return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
-	},
-
-	// helper functions
-	cssUnit: function(key) {
-		var style = this.css(key), val = [];
-		$.each( ['em','px','%','pt'], function(i, unit){
-			if(style.indexOf(unit) > 0)
-				val = [parseFloat(style), unit];
-		});
-		return val;
-	}
-});
-
-
-// override the animation for color styles
-$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
-	'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
-function(i, attr) {
-	$.fx.step[attr] = function(fx) {
-		if (fx.state === 0) {
-			fx.start = getColor(fx.elem, attr);
-			fx.end = getRGB(fx.end);
-		}
-
-		fx.elem.style[attr] = 'rgb(' +
-			Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
-			Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
-			Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
-	};
-});
-
-// Color Conversion functions from highlightFade
-// By Blair Mitchelmore
-// http://jquery.offput.ca/highlightFade/
-
-// Parse strings looking for color tuples [255,255,255]
-function getRGB(color) {
-		var result;
-
-		// Check if we're already dealing with an array of colors
-		if ( color && color.constructor == Array && color.length == 3 )
-				return color;
-
-		// Look for rgb(num,num,num)
-		if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
-				return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
-
-		// Look for rgb(num%,num%,num%)
-		if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
-				return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
-
-		// Look for #a0b1c2
-		if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
-				return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
-
-		// Look for #fff
-		if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
-				return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
-
-		// Look for rgba(0, 0, 0, 0) == transparent in Safari 3
-		if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
-				return colors['transparent'];
-
-		// Otherwise, we're most likely dealing with a named color
-		return colors[$.trim(color).toLowerCase()];
-}
-
-function getColor(elem, attr) {
-		var color;
-
-		do {
-				color = $.curCSS(elem, attr);
-
-				// Keep going until we find an element that has color, or we hit the body
-				if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
-						break;
-
-				attr = "backgroundColor";
-		} while ( elem = elem.parentNode );
-
-		return getRGB(color);
-};
-
-// Some named colors to work with
-// From Interface by Stefan Petre
-// http://interface.eyecon.ro/
-
-var colors = {
-	aqua:[0,255,255],
-	azure:[240,255,255],
-	beige:[245,245,220],
-	black:[0,0,0],
-	blue:[0,0,255],
-	brown:[165,42,42],
-	cyan:[0,255,255],
-	darkblue:[0,0,139],
-	darkcyan:[0,139,139],
-	darkgrey:[169,169,169],
-	darkgreen:[0,100,0],
-	darkkhaki:[189,183,107],
-	darkmagenta:[139,0,139],
-	darkolivegreen:[85,107,47],
-	darkorange:[255,140,0],
-	darkorchid:[153,50,204],
-	darkred:[139,0,0],
-	darksalmon:[233,150,122],
-	darkviolet:[148,0,211],
-	fuchsia:[255,0,255],
-	gold:[255,215,0],
-	green:[0,128,0],
-	indigo:[75,0,130],
-	khaki:[240,230,140],
-	lightblue:[173,216,230],
-	lightcyan:[224,255,255],
-	lightgreen:[144,238,144],
-	lightgrey:[211,211,211],
-	lightpink:[255,182,193],
-	lightyellow:[255,255,224],
-	lime:[0,255,0],
-	magenta:[255,0,255],
-	maroon:[128,0,0],
-	navy:[0,0,128],
-	olive:[128,128,0],
-	orange:[255,165,0],
-	pink:[255,192,203],
-	purple:[128,0,128],
-	violet:[128,0,128],
-	red:[255,0,0],
-	silver:[192,192,192],
-	white:[255,255,255],
-	yellow:[255,255,0],
-	transparent: [255,255,255]
-};
-
-/*
- * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
- *
- * Uses the built in easing capabilities added In jQuery 1.1
- * to offer multiple easing options
- *
- * TERMS OF USE - jQuery Easing
- *
- * Open source under the BSD License.
- *
- * Copyright 2008 George McGinley Smith
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
-*/
-
-// t: current time, b: begInnIng value, c: change In value, d: duration
-$.easing.jswing = $.easing.swing;
-
-$.extend($.easing,
-{
-	def: 'easeOutQuad',
-	swing: function (x, t, b, c, d) {
-		//alert($.easing.default);
-		return $.easing[$.easing.def](x, t, b, c, d);
-	},
-	easeInQuad: function (x, t, b, c, d) {
-		return c*(t/=d)*t + b;
-	},
-	easeOutQuad: function (x, t, b, c, d) {
-		return -c *(t/=d)*(t-2) + b;
-	},
-	easeInOutQuad: function (x, t, b, c, d) {
-		if ((t/=d/2) < 1) return c/2*t*t + b;
-		return -c/2 * ((--t)*(t-2) - 1) + b;
-	},
-	easeInCubic: function (x, t, b, c, d) {
-		return c*(t/=d)*t*t + b;
-	},
-	easeOutCubic: function (x, t, b, c, d) {
-		return c*((t=t/d-1)*t*t + 1) + b;
-	},
-	easeInOutCubic: function (x, t, b, c, d) {
-		if ((t/=d/2) < 1) return c/2*t*t*t + b;
-		return c/2*((t-=2)*t*t + 2) + b;
-	},
-	easeInQuart: function (x, t, b, c, d) {
-		return c*(t/=d)*t*t*t + b;
-	},
-	easeOutQuart: function (x, t, b, c, d) {
-		return -c * ((t=t/d-1)*t*t*t - 1) + b;
-	},
-	easeInOutQuart: function (x, t, b, c, d) {
-		if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
-		return -c/2 * ((t-=2)*t*t*t - 2) + b;
-	},
-	easeInQuint: function (x, t, b, c, d) {
-		return c*(t/=d)*t*t*t*t + b;
-	},
-	easeOutQuint: function (x, t, b, c, d) {
-		return c*((t=t/d-1)*t*t*t*t + 1) + b;
-	},
-	easeInOutQuint: function (x, t, b, c, d) {
-		if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
-		return c/2*((t-=2)*t*t*t*t + 2) + b;
-	},
-	easeInSine: function (x, t, b, c, d) {
-		return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
-	},
-	easeOutSine: function (x, t, b, c, d) {
-		return c * Math.sin(t/d * (Math.PI/2)) + b;
-	},
-	easeInOutSine: function (x, t, b, c, d) {
-		return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
-	},
-	easeInExpo: function (x, t, b, c, d) {
-		return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
-	},
-	easeOutExpo: function (x, t, b, c, d) {
-		return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
-	},
-	easeInOutExpo: function (x, t, b, c, d) {
-		if (t==0) return b;
-		if (t==d) return b+c;
-		if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
-		return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
-	},
-	easeInCirc: function (x, t, b, c, d) {
-		return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
-	},
-	easeOutCirc: function (x, t, b, c, d) {
-		return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
-	},
-	easeInOutCirc: function (x, t, b, c, d) {
-		if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
-		return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
-	},
-	easeInElastic: function (x, t, b, c, d) {
-		var s=1.70158;var p=0;var a=c;
-		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
-		if (a < Math.abs(c)) { a=c; var s=p/4; }
-		else var s = p/(2*Math.PI) * Math.asin (c/a);
-		return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
-	},
-	easeOutElastic: function (x, t, b, c, d) {
-		var s=1.70158;var p=0;var a=c;
-		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
-		if (a < Math.abs(c)) { a=c; var s=p/4; }
-		else var s = p/(2*Math.PI) * Math.asin (c/a);
-		return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
-	},
-	easeInOutElastic: function (x, t, b, c, d) {
-		var s=1.70158;var p=0;var a=c;
-		if (t==0) return b;  if ((t/=d/2)==2) return b+c;  if (!p) p=d*(.3*1.5);
-		if (a < Math.abs(c)) { a=c; var s=p/4; }
-		else var s = p/(2*Math.PI) * Math.asin (c/a);
-		if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
-		return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
-	},
-	easeInBack: function (x, t, b, c, d, s) {
-		if (s == undefined) s = 1.70158;
-		return c*(t/=d)*t*((s+1)*t - s) + b;
-	},
-	easeOutBack: function (x, t, b, c, d, s) {
-		if (s == undefined) s = 1.70158;
-		return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
-	},
-	easeInOutBack: function (x, t, b, c, d, s) {
-		if (s == undefined) s = 1.70158;
-		if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
-		return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
-	},
-	easeInBounce: function (x, t, b, c, d) {
-		return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
-	},
-	easeOutBounce: function (x, t, b, c, d) {
-		if ((t/=d) < (1/2.75)) {
-			return c*(7.5625*t*t) + b;
-		} else if (t < (2/2.75)) {
-			return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
-		} else if (t < (2.5/2.75)) {
-			return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
-		} else {
-			return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
-		}
-	},
-	easeInOutBounce: function (x, t, b, c, d) {
-		if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
-		return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
-	}
-});
-
-/*
- *
- * TERMS OF USE - EASING EQUATIONS
- *
- * Open source under the BSD License.
- *
- * Copyright 2001 Robert Penner
- * All rights reserved.
- *
- * Redistribution and use in source and binary forms, with or without modification,
- * are permitted provided that the following conditions are met:
- *
- * Redistributions of source code must retain the above copyright notice, this list of
- * conditions and the following disclaimer.
- * Redistributions in binary form must reproduce the above copyright notice, this list
- * of conditions and the following disclaimer in the documentation and/or other materials
- * provided with the distribution.
- *
- * Neither the name of the author nor the names of contributors may be used to endorse
- * or promote products derived from this software without specific prior written permission.
- *
- * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
- * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
- * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
- * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
- * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
- * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
- * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
- * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
- * OF THE POSSIBILITY OF SUCH DAMAGE.
- *
- */
-
-})(jQuery);
diff --git a/ui/effects.drop.js b/ui/effects.drop.js
deleted file mode 100644
index faf1ee909..000000000
--- a/ui/effects.drop.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/*
- * jQuery UI Effects Drop @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Drop
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.drop = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left','opacity'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
-		var direction = o.options.direction || 'left'; // Default Direction
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		$.effects.createWrapper(el); // Create Wrapper
-		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
-		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
-		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
-
-		// Animation
-		var animation = {opacity: mode == 'show' ? 1 : 0};
-		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
-		// Animate
-		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(this, arguments); // Callback
-			el.dequeue();
-		}});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.explode.js b/ui/effects.explode.js
deleted file mode 100644
index 2796c3d01..000000000
--- a/ui/effects.explode.js
+++ /dev/null
@@ -1,79 +0,0 @@
-/*
- * jQuery UI Effects Explode @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Explode
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.explode = function(o) {
-
-	return this.queue(function() {
-
-	var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-	var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
-
-	o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
-	var el = $(this).show().css('visibility', 'hidden');
-	var offset = el.offset();
-
-	//Substract the margins - not fixing the problem yet.
-	offset.top -= parseInt(el.css("marginTop"),10) || 0;
-	offset.left -= parseInt(el.css("marginLeft"),10) || 0;
-
-	var width = el.outerWidth(true);
-	var height = el.outerHeight(true);
-
-	for(var i=0;i<rows;i++) { // =
-		for(var j=0;j<cells;j++) { // ||
-			el
-				.clone()
-				.appendTo('body')
-				.wrap('<div></div>')
-				.css({
-					position: 'absolute',
-					visibility: 'visible',
-					left: -j*(width/cells),
-					top: -i*(height/rows)
-				})
-				.parent()
-				.addClass('ui-effects-explode')
-				.css({
-					position: 'absolute',
-					overflow: 'hidden',
-					width: width/cells,
-					height: height/rows,
-					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
-					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
-					opacity: o.options.mode == 'show' ? 0 : 1
-				}).animate({
-					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
-					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
-					opacity: o.options.mode == 'show' ? 1 : 0
-				}, o.duration || 500);
-		}
-	}
-
-	// Set a timeout, to call the callback approx. when the other animations have finished
-	setTimeout(function() {
-
-		o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
-				if(o.callback) o.callback.apply(el[0]); // Callback
-				el.dequeue();
-
-				$('div.ui-effects-explode').remove();
-
-	}, o.duration || 500);
-
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.fold.js b/ui/effects.fold.js
deleted file mode 100644
index 0e06186e7..000000000
--- a/ui/effects.fold.js
+++ /dev/null
@@ -1,56 +0,0 @@
-/*
- * jQuery UI Effects Fold @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Fold
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.fold = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
-		var size = o.options.size || 15; // Default fold size
-		var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
-		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
-		var widthFirst = ((mode == 'show') != horizFirst);
-		var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
-		var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
-		var percent = /([0-9]+)%/.exec(size);
-		if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
-		if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
-
-		// Animation
-		var animation1 = {}, animation2 = {};
-		animation1[ref[0]] = mode == 'show' ? distance[0] : size;
-		animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
-
-		// Animate
-		wrapper.animate(animation1, duration, o.options.easing)
-		.animate(animation2, duration, o.options.easing, function() {
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(el[0], arguments); // Callback
-			el.dequeue();
-		});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.highlight.js b/ui/effects.highlight.js
deleted file mode 100644
index ebc958243..000000000
--- a/ui/effects.highlight.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/*
- * jQuery UI Effects Highlight @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Highlight
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.highlight = function(o) {
-	return this.queue(function() {
-		var elem = $(this),
-			props = ['backgroundImage', 'backgroundColor', 'opacity'],
-			mode = $.effects.setMode(elem, o.options.mode || 'show'),
-			animation = {
-				backgroundColor: elem.css('backgroundColor')
-			};
-
-		if (mode == 'hide') {
-			animation.opacity = 0;
-		}
-
-		$.effects.save(elem, props);
-		elem
-			.show()
-			.css({
-				backgroundImage: 'none',
-				backgroundColor: o.options.color || '#ffff99'
-			})
-			.animate(animation, {
-				queue: false,
-				duration: o.duration,
-				easing: o.options.easing,
-				complete: function() {
-					(mode == 'hide' && elem.hide());
-					$.effects.restore(elem, props);
-					(mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
-					(o.callback && o.callback.apply(this, arguments));
-					elem.dequeue();
-				}
-			});
-	});
-};
-
-})(jQuery);
diff --git a/ui/effects.pulsate.js b/ui/effects.pulsate.js
deleted file mode 100644
index 6478b9142..000000000
--- a/ui/effects.pulsate.js
+++ /dev/null
@@ -1,56 +0,0 @@
-/*
- * jQuery UI Effects Pulsate @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Pulsate
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.pulsate = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this);
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
-		var times = o.options.times || 5; // Default # of times
-		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
-
-		// Adjust
-		if (mode == 'hide') times--;
-		if (el.is(':hidden')) { // Show fadeIn
-			el.css('opacity', 0);
-			el.show(); // Show
-			el.animate({opacity: 1}, duration, o.options.easing);
-			times = times-2;
-		}
-
-		// Animate
-		for (var i = 0; i < times; i++) { // Pulsate
-			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
-		};
-		if (mode == 'hide') { // Last Pulse
-			el.animate({opacity: 0}, duration, o.options.easing, function(){
-				el.hide(); // Hide
-				if(o.callback) o.callback.apply(this, arguments); // Callback
-			});
-		} else {
-			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
-				if(o.callback) o.callback.apply(this, arguments); // Callback
-			});
-		};
-		el.queue('fx', function() { el.dequeue(); });
-		el.dequeue();
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.scale.js b/ui/effects.scale.js
deleted file mode 100644
index 3b5a02ca4..000000000
--- a/ui/effects.scale.js
+++ /dev/null
@@ -1,178 +0,0 @@
-/*
- * jQuery UI Effects Scale @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Scale
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.puff = function(o) {
-	return this.queue(function() {
-		var elem = $(this),
-			mode = $.effects.setMode(elem, o.options.mode || 'hide'),
-			percent = parseInt(o.options.percent, 10) || 150,
-			factor = percent / 100,
-			original = { height: elem.height(), width: elem.width() };
-
-		$.extend(o.options, {
-			fade: true,
-			mode: mode,
-			percent: mode == 'hide' ? percent : 100,
-			from: mode == 'hide'
-				? original
-				: {
-					height: original.height * factor,
-					width: original.width * factor
-				}
-		});
-
-		elem.effect('scale', o.options, o.duration, o.callback);
-		elem.dequeue();
-	});
-};
-
-$.effects.scale = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this);
-
-		// Set options
-		var options = $.extend(true, {}, o.options);
-		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
-		var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
-		var direction = o.options.direction || 'both'; // Set default axis
-		var origin = o.options.origin; // The origin of the scaling
-		if (mode != 'effect') { // Set default origin and restore for show/hide
-			options.origin = origin || ['middle','center'];
-			options.restore = true;
-		}
-		var original = {height: el.height(), width: el.width()}; // Save original
-		el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
-
-		// Adjust
-		var factor = { // Set scaling factor
-			y: direction != 'horizontal' ? (percent / 100) : 1,
-			x: direction != 'vertical' ? (percent / 100) : 1
-		};
-		el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
-
-		if (o.options.fade) { // Fade option to support puff
-			if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
-			if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
-		};
-
-		// Animation
-		options.from = el.from; options.to = el.to; options.mode = mode;
-
-		// Animate
-		el.effect('size', options, o.duration, o.callback);
-		el.dequeue();
-	});
-
-};
-
-$.effects.size = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
-		var props1 = ['position','top','left','overflow','opacity']; // Always restore
-		var props2 = ['width','height','overflow']; // Copy for children
-		var cProps = ['fontSize'];
-		var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
-		var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
-		var restore = o.options.restore || false; // Default restore
-		var scale = o.options.scale || 'both'; // Default scale mode
-		var origin = o.options.origin; // The origin of the sizing
-		var original = {height: el.height(), width: el.width()}; // Save original
-		el.from = o.options.from || original; // Default from state
-		el.to = o.options.to || original; // Default to state
-		// Adjust
-		if (origin) { // Calculate baseline shifts
-			var baseline = $.effects.getBaseline(origin, original);
-			el.from.top = (original.height - el.from.height) * baseline.y;
-			el.from.left = (original.width - el.from.width) * baseline.x;
-			el.to.top = (original.height - el.to.height) * baseline.y;
-			el.to.left = (original.width - el.to.width) * baseline.x;
-		};
-		var factor = { // Set scaling factor
-			from: {y: el.from.height / original.height, x: el.from.width / original.width},
-			to: {y: el.to.height / original.height, x: el.to.width / original.width}
-		};
-		if (scale == 'box' || scale == 'both') { // Scale the css box
-			if (factor.from.y != factor.to.y) { // Vertical props scaling
-				props = props.concat(vProps);
-				el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
-				el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
-			};
-			if (factor.from.x != factor.to.x) { // Horizontal props scaling
-				props = props.concat(hProps);
-				el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
-				el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
-			};
-		};
-		if (scale == 'content' || scale == 'both') { // Scale the content
-			if (factor.from.y != factor.to.y) { // Vertical props scaling
-				props = props.concat(cProps);
-				el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
-				el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
-			};
-		};
-		$.effects.save(el, restore ? props : props1); el.show(); // Save & Show
-		$.effects.createWrapper(el); // Create Wrapper
-		el.css('overflow','hidden').css(el.from); // Shift
-
-		// Animate
-		if (scale == 'content' || scale == 'both') { // Scale the children
-			vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
-			hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
-			props2 = props.concat(vProps).concat(hProps); // Concat
-			el.find("*[width]").each(function(){
-				child = $(this);
-				if (restore) $.effects.save(child, props2);
-				var c_original = {height: child.height(), width: child.width()}; // Save original
-				child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
-				child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
-				if (factor.from.y != factor.to.y) { // Vertical props scaling
-					child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
-					child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
-				};
-				if (factor.from.x != factor.to.x) { // Horizontal props scaling
-					child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
-					child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
-				};
-				child.css(child.from); // Shift children
-				child.animate(child.to, o.duration, o.options.easing, function(){
-					if (restore) $.effects.restore(child, props2); // Restore children
-				}); // Animate children
-			});
-		};
-
-		// Animate
-		el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
-			if (el.to.opacity === 0) {
-				el.css('opacity', el.from.opacity);
-			}
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(this, arguments); // Callback
-			el.dequeue();
-		}});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.shake.js b/ui/effects.shake.js
deleted file mode 100644
index 55460fe68..000000000
--- a/ui/effects.shake.js
+++ /dev/null
@@ -1,57 +0,0 @@
-/*
- * jQuery UI Effects Shake @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Shake
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.shake = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
-		var direction = o.options.direction || 'left'; // Default direction
-		var distance = o.options.distance || 20; // Default distance
-		var times = o.options.times || 3; // Default # of times
-		var speed = o.duration || o.options.duration || 140; // Default speed per shake
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		$.effects.createWrapper(el); // Create Wrapper
-		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
-		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-
-		// Animation
-		var animation = {}, animation1 = {}, animation2 = {};
-		animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
-		animation1[ref] = (motion == 'pos' ? '+=' : '-=')  + distance * 2;
-		animation2[ref] = (motion == 'pos' ? '-=' : '+=')  + distance * 2;
-
-		// Animate
-		el.animate(animation, speed, o.options.easing);
-		for (var i = 1; i < times; i++) { // Shakes
-			el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
-		};
-		el.animate(animation1, speed, o.options.easing).
-		animate(animation, speed / 2, o.options.easing, function(){ // Last shake
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(this, arguments); // Callback
-		});
-		el.queue('fx', function() { el.dequeue(); });
-		el.dequeue();
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.slide.js b/ui/effects.slide.js
deleted file mode 100644
index b1a432e2d..000000000
--- a/ui/effects.slide.js
+++ /dev/null
@@ -1,50 +0,0 @@
-/*
- * jQuery UI Effects Slide @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Slide
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.slide = function(o) {
-
-	return this.queue(function() {
-
-		// Create element
-		var el = $(this), props = ['position','top','left'];
-
-		// Set options
-		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
-		var direction = o.options.direction || 'left'; // Default Direction
-
-		// Adjust
-		$.effects.save(el, props); el.show(); // Save & Show
-		$.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
-		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
-		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
-		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
-		if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
-
-		// Animation
-		var animation = {};
-		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
-
-		// Animate
-		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
-			if(mode == 'hide') el.hide(); // Hide
-			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
-			if(o.callback) o.callback.apply(this, arguments); // Callback
-			el.dequeue();
-		}});
-
-	});
-
-};
-
-})(jQuery);
diff --git a/ui/effects.transfer.js b/ui/effects.transfer.js
deleted file mode 100644
index f616a02ba..000000000
--- a/ui/effects.transfer.js
+++ /dev/null
@@ -1,45 +0,0 @@
-/*
- * jQuery UI Effects Transfer @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Effects/Transfer
- *
- * Depends:
- *	effects.core.js
- */
-(function($) {
-
-$.effects.transfer = function(o) {
-	return this.queue(function() {
-		var elem = $(this),
-			target = $(o.options.to),
-			endPosition = target.offset(),
-			animation = {
-				top: endPosition.top,
-				left: endPosition.left,
-				height: target.innerHeight(),
-				width: target.innerWidth()
-			},
-			startPosition = elem.offset(),
-			transfer = $('<div class="ui-effects-transfer"></div>')
-				.appendTo(document.body)
-				.addClass(o.options.className)
-				.css({
-					top: startPosition.top,
-					left: startPosition.left,
-					height: elem.innerHeight(),
-					width: elem.innerWidth(),
-					position: 'absolute'
-				})
-				.animate(animation, o.duration, o.options.easing, function() {
-					transfer.remove();
-					(o.callback && o.callback.apply(elem[0], arguments));
-					elem.dequeue();
-				});
-	});
-};
-
-})(jQuery);
diff --git a/ui/i18n/jquery.ui.datepicker-ar.js b/ui/i18n/jquery.ui.datepicker-ar.js
new file mode 100644
index 000000000..c799b48d8
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ar.js
@@ -0,0 +1,24 @@
+/* Arabic Translation for jQuery UI date picker plugin. */
+/* Khaled Al Horani -- koko.dw@gmail.com */
+/* خالد الحوراني -- koko.dw@gmail.com */
+/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name �براير - يناير and there isn't any Arabic roots for these months */
+jQuery(function($){
+	$.datepicker.regional['ar'] = {
+		closeText: 'إغلاق',
+		prevText: '&#x3c;السابق',
+		nextText: 'التالي&#x3e;',
+		currentText: 'اليوم',
+		monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
+		'تموز', 'آب', 'أيلول',	'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
+		monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+		dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
+		dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+		dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
+		weekHeader: 'أسبوع',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+  		isRTL: true,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ar']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-az.js b/ui/i18n/jquery.ui.datepicker-az.js
new file mode 100644
index 000000000..b5434057b
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-az.js
@@ -0,0 +1,23 @@
+/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Jamil Najafov (necefov33@gmail.com). */
+jQuery(function($) {
+	$.datepicker.regional['az'] = {
+		closeText: 'BaÄŸla',
+		prevText: '&#x3c;Geri',
+		nextText: 'İrəli&#x3e;',
+		currentText: 'Bugün',
+		monthNames: ['Yanvar','Fevral','Mart','Aprel','May','Ä°yun',
+		'Ä°yul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
+		monthNamesShort: ['Yan','Fev','Mar','Apr','May','Ä°yun',
+		'Ä°yul','Avq','Sen','Okt','Noy','Dek'],
+		dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
+		dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
+		dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
+		weekHeader: 'Hf',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['az']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-bg.js b/ui/i18n/jquery.ui.datepicker-bg.js
new file mode 100644
index 000000000..b5113f781
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-bg.js
@@ -0,0 +1,24 @@
+/* Bulgarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Stoyan Kyosev (http://svest.org). */
+jQuery(function($){
+    $.datepicker.regional['bg'] = {
+        closeText: 'затвори',
+        prevText: '&#x3c;назад',
+        nextText: 'напред&#x3e;',
+		nextBigText: '&#x3e;&#x3e;',
+        currentText: 'дне�',
+        monthNames: ['Януари','Февруари','Март','�прил','Май','Юни',
+        'Юли','�вгу�т','Септември','Октомври','�оември','Декември'],
+        monthNamesShort: ['Яну','Фев','Мар','�пр','Май','Юни',
+        'Юли','�вг','Сеп','Окт','�ов','Дек'],
+        dayNames: ['�едел�','Понеделник','Вторник','Ср�да','Четвъртък','Петък','Събота'],
+        dayNamesShort: ['�ед','Пон','Вто','Ср�','Чет','Пет','Съб'],
+        dayNamesMin: ['�е','По','Вт','Ср','Че','Пе','Съ'],
+		weekHeader: 'Wk',
+        dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+        isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+    $.datepicker.setDefaults($.datepicker.regional['bg']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-ca.js b/ui/i18n/jquery.ui.datepicker-ca.js
new file mode 100644
index 000000000..b128e699e
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ca.js
@@ -0,0 +1,23 @@
+/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
+/* Writers: (joan.leon@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['ca'] = {
+		closeText: 'Tancar',
+		prevText: '&#x3c;Ant',
+		nextText: 'Seg&#x3e;',
+		currentText: 'Avui',
+		monthNames: ['Gener','Febrer','Mar&ccedil;','Abril','Maig','Juny',
+		'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
+		monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
+		'Jul','Ago','Set','Oct','Nov','Des'],
+		dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
+		dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
+		dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ca']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-cs.js b/ui/i18n/jquery.ui.datepicker-cs.js
new file mode 100644
index 000000000..c3c07ea67
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-cs.js
@@ -0,0 +1,23 @@
+/* Czech initialisation for the jQuery UI date picker plugin. */
+/* Written by Tomas Muller (tomas@tomas-muller.net). */
+jQuery(function($){
+	$.datepicker.regional['cs'] = {
+		closeText: 'Zavřít',
+		prevText: '&#x3c;Dříve',
+		nextText: 'Později&#x3e;',
+		currentText: 'Nyní',
+		monthNames: ['leden','únor','březen','duben','květen','�erven',
+        '�ervenec','srpen','září','říjen','listopad','prosinec'],
+		monthNamesShort: ['led','úno','bře','dub','kvě','�er',
+		'�vc','srp','zář','říj','lis','pro'],
+		dayNames: ['neděle', 'pondělí', 'úterý', 'středa', '�tvrtek', 'pátek', 'sobota'],
+		dayNamesShort: ['ne', 'po', 'út', 'st', '�t', 'pá', 'so'],
+		dayNamesMin: ['ne','po','út','st','�t','pá','so'],
+		weekHeader: 'Týd',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['cs']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-da.js b/ui/i18n/jquery.ui.datepicker-da.js
new file mode 100644
index 000000000..8ab7c339d
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-da.js
@@ -0,0 +1,23 @@
+/* Danish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jan Christensen ( deletestuff@gmail.com). */
+jQuery(function($){
+    $.datepicker.regional['da'] = {
+		closeText: 'Luk',
+        prevText: '&#x3c;Forrige',
+		nextText: 'Næste&#x3e;',
+		currentText: 'Idag',
+        monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
+        'Juli','August','September','Oktober','November','December'],
+        monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+        'Jul','Aug','Sep','Okt','Nov','Dec'],
+		dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+		dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+		dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+		weekHeader: 'Uge',
+        dateFormat: 'dd-mm-yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+    $.datepicker.setDefaults($.datepicker.regional['da']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-de.js b/ui/i18n/jquery.ui.datepicker-de.js
new file mode 100644
index 000000000..ac2d516aa
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-de.js
@@ -0,0 +1,23 @@
+/* German initialisation for the jQuery UI date picker plugin. */
+/* Written by Milian Wolff (mail@milianw.de). */
+jQuery(function($){
+	$.datepicker.regional['de'] = {
+		closeText: 'schließen',
+		prevText: '&#x3c;zurück',
+		nextText: 'Vor&#x3e;',
+		currentText: 'heute',
+		monthNames: ['Januar','Februar','März','April','Mai','Juni',
+		'Juli','August','September','Oktober','November','Dezember'],
+		monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
+		'Jul','Aug','Sep','Okt','Nov','Dez'],
+		dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
+		dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+		dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
+		weekHeader: 'Wo',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['de']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-el.js b/ui/i18n/jquery.ui.datepicker-el.js
new file mode 100644
index 000000000..9542769d9
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-el.js
@@ -0,0 +1,23 @@
+/* Greek (el) initialisation for the jQuery UI date picker plugin. */
+/* Written by Alex Cicovic (http://www.alexcicovic.com) */
+jQuery(function($){
+	$.datepicker.regional['el'] = {
+		closeText: 'Κλείσιμο',
+		prevText: 'Π�οηγο�μενος',
+		nextText: 'Επόμενος',
+		currentText: 'Τ�έχων Μήνας',
+		monthNames: ['Ιανουά�ιος','Φεβ�ουά�ιος','Μά�τιος','Απ�ίλιος','Μάιος','Ιο�νιος',
+		'Ιο�λιος','Α�γουστος','Σεπτέμβ�ιος','Οκτώβ�ιος','�οέμβ�ιος','Δεκέμβ�ιος'],
+		monthNamesShort: ['Ιαν','Φεβ','Μα�','Απ�','Μαι','Ιουν',
+		'Ιουλ','Αυγ','Σεπ','Οκτ','�οε','Δεκ'],
+		dayNames: ['Κυ�ιακή','Δευτέ�α','Τ�ίτη','Τετά�τη','Πέμπτη','Πα�ασκευή','Σάββατο'],
+		dayNamesShort: ['Κυ�','Δευ','Τ�ι','Τετ','Πεμ','Πα�','Σαβ'],
+		dayNamesMin: ['Κυ','Δε','Τ�','Τε','Πε','Πα','Σα'],
+		weekHeader: 'Εβδ',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['el']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-eo.js b/ui/i18n/jquery.ui.datepicker-eo.js
new file mode 100644
index 000000000..ba5715687
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-eo.js
@@ -0,0 +1,23 @@
+/* Esperanto initialisation for the jQuery UI date picker plugin. */
+/* Written by Olivier M. (olivierweb@ifrance.com). */
+jQuery(function($){
+	$.datepicker.regional['eo'] = {
+		closeText: 'Fermi',
+		prevText: '&lt;Anta',
+		nextText: 'Sekv&gt;',
+		currentText: 'Nuna',
+		monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
+		'Julio','AÅ­gusto','Septembro','Oktobro','Novembro','Decembro'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+		'Jul','AÅ­g','Sep','Okt','Nov','Dec'],
+		dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
+		dayNamesShort: ['Dim','Lun','Mar','Mer','Ä´aÅ­','Ven','Sab'],
+		dayNamesMin: ['Di','Lu','Ma','Me','Ä´a','Ve','Sa'],
+		weekHeader: 'Sb',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['eo']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-es.js b/ui/i18n/jquery.ui.datepicker-es.js
new file mode 100644
index 000000000..a02133de3
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-es.js
@@ -0,0 +1,23 @@
+/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
+/* Traducido por Vester (xvester@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['es'] = {
+		closeText: 'Cerrar',
+		prevText: '&#x3c;Ant',
+		nextText: 'Sig&#x3e;',
+		currentText: 'Hoy',
+		monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
+		'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
+		monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
+		'Jul','Ago','Sep','Oct','Nov','Dic'],
+		dayNames: ['Domingo','Lunes','Martes','Mi&eacute;rcoles','Jueves','Viernes','S&aacute;bado'],
+		dayNamesShort: ['Dom','Lun','Mar','Mi&eacute;','Juv','Vie','S&aacute;b'],
+		dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','S&aacute;'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['es']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-et.js b/ui/i18n/jquery.ui.datepicker-et.js
new file mode 100644
index 000000000..f97311f31
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-et.js
@@ -0,0 +1,23 @@
+/* Estonian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
+jQuery(function($){
+	$.datepicker.regional['et'] = {
+		closeText: 'Sulge',
+		prevText: 'Eelnev',
+		nextText: 'Järgnev',
+		currentText: 'Täna',
+		monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
+		'Juuli','August','September','Oktoober','November','Detsember'],
+		monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
+		'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
+		dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
+		dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
+		dayNamesMin: ['P','E','T','K','N','R','L'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['et']);
+}); 
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-eu.js b/ui/i18n/jquery.ui.datepicker-eu.js
new file mode 100644
index 000000000..1d7609a24
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-eu.js
@@ -0,0 +1,23 @@
+/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
+/* Karrikas-ek itzulia (karrikas@karrikas.com) */
+jQuery(function($){
+	$.datepicker.regional['eu'] = {
+		closeText: 'Egina',
+		prevText: '&#x3c;Aur',
+		nextText: 'Hur&#x3e;',
+		currentText: 'Gaur',
+		monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
+		'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
+		monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
+		'Uzt','Abu','Ira','Urr','Aza','Abe'],
+		dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
+		dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
+		dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
+		weekHeader: 'Wk',
+		dateFormat: 'yy/mm/dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['eu']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-fa.js b/ui/i18n/jquery.ui.datepicker-fa.js
new file mode 100644
index 000000000..adb3709fe
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-fa.js
@@ -0,0 +1,23 @@
+/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
+/* Javad Mowlanezhad -- jmowla@gmail.com */
+/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
+jQuery(function($) {
+	$.datepicker.regional['fa'] = {
+		closeText: 'بستن',
+		prevText: '&#x3c;قبلي',
+		nextText: 'بعدي&#x3e;',
+		currentText: 'امروز',
+		monthNames: ['�روردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
+		'مهر','آبان','آذر','دي','بهمن','اس�ند'],
+		monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
+		dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
+		dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
+		dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
+		weekHeader: 'ه�',
+		dateFormat: 'yy/mm/dd',
+		firstDay: 6,
+		isRTL: true,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['fa']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-fi.js b/ui/i18n/jquery.ui.datepicker-fi.js
new file mode 100644
index 000000000..e1f25fd84
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-fi.js
@@ -0,0 +1,23 @@
+/* Finnish initialisation for the jQuery UI date picker plugin. */
+/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
+jQuery(function($){
+    $.datepicker.regional['fi'] = {
+		closeText: 'Sulje',
+		prevText: '&laquo;Edellinen',
+		nextText: 'Seuraava&raquo;',
+		currentText: 'T&auml;n&auml;&auml;n',
+        monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kes&auml;kuu',
+        'Hein&auml;kuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
+        monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kes&auml;',
+        'Hein&auml;','Elo','Syys','Loka','Marras','Joulu'],
+		dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
+		dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
+		dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
+		weekHeader: 'Vk',
+        dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+    $.datepicker.setDefaults($.datepicker.regional['fi']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-fr-CH.js b/ui/i18n/jquery.ui.datepicker-fr-CH.js
new file mode 100644
index 000000000..9b7234375
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-fr-CH.js
@@ -0,0 +1,23 @@
+/* Swiss-French initialisation for the jQuery UI date picker plugin. */
+/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
+jQuery(function($){
+	$.datepicker.regional['fr-CH'] = {
+		closeText: 'Fermer',
+		prevText: '&#x3c;Préc',
+		nextText: 'Suiv&#x3e;',
+		currentText: 'Courant',
+		monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+		'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+		monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+		'Jul','Aoû','Sep','Oct','Nov','Déc'],
+		dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+		dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+		dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['fr-CH']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-fr.js b/ui/i18n/jquery.ui.datepicker-fr.js
new file mode 100644
index 000000000..134bda65d
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-fr.js
@@ -0,0 +1,23 @@
+/* French initialisation for the jQuery UI date picker plugin. */
+/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
+jQuery(function($){
+	$.datepicker.regional['fr'] = {
+		closeText: 'Fermer',
+		prevText: '&#x3c;Préc',
+		nextText: 'Suiv&#x3e;',
+		currentText: 'Courant',
+		monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
+		'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
+		monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
+		'Jul','Aoû','Sep','Oct','Nov','Déc'],
+		dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
+		dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
+		dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['fr']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-he.js b/ui/i18n/jquery.ui.datepicker-he.js
new file mode 100644
index 000000000..3b3dc387f
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-he.js
@@ -0,0 +1,23 @@
+/* Hebrew initialisation for the UI Datepicker extension. */
+/* Written by Amir Hardon (ahardon at gmail dot com). */
+jQuery(function($){
+	$.datepicker.regional['he'] = {
+		closeText: 'סגור',
+		prevText: '&#x3c;הקוד�',
+		nextText: 'הב�&#x3e;',
+		currentText: 'היו�',
+		monthNames: ['ינו�ר','פברו�ר','מרץ','�פריל','מ�י','יוני',
+		'יולי','�וגוסט','ספטמבר','�וקטובר','נובמבר','דצמבר'],
+		monthNamesShort: ['1','2','3','4','5','6',
+		'7','8','9','10','11','12'],
+		dayNames: ['ר�שון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
+		dayNamesShort: ['�\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+		dayNamesMin: ['�\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
+		weekHeader: 'Wk',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: true,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['he']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-hr.js b/ui/i18n/jquery.ui.datepicker-hr.js
new file mode 100644
index 000000000..0285c1aa9
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-hr.js
@@ -0,0 +1,23 @@
+/* Croatian i18n for the jQuery UI date picker plugin. */
+/* Written by Vjekoslav Nesek. */
+jQuery(function($){
+	$.datepicker.regional['hr'] = {
+		closeText: 'Zatvori',
+		prevText: '&#x3c;',
+		nextText: '&#x3e;',
+		currentText: 'Danas',
+		monthNames: ['Sije�anj','Velja�a','Ožujak','Travanj','Svibanj','Lipanj',
+		'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
+		monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
+		'Srp','Kol','Ruj','Lis','Stu','Pro'],
+		dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
+		dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
+		dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+		weekHeader: 'Tje',
+		dateFormat: 'dd.mm.yy.',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['hr']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-hu.js b/ui/i18n/jquery.ui.datepicker-hu.js
new file mode 100644
index 000000000..249e7b0ef
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-hu.js
@@ -0,0 +1,23 @@
+/* Hungarian initialisation for the jQuery UI date picker plugin. */
+/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
+jQuery(function($){
+	$.datepicker.regional['hu'] = {
+		closeText: 'bezárás',
+		prevText: '&laquo;&nbsp;vissza',
+		nextText: 'előre&nbsp;&raquo;',
+		currentText: 'ma',
+		monthNames: ['Január', 'Február', 'Március', '�prilis', 'Május', 'Június',
+		'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
+		monthNamesShort: ['Jan', 'Feb', 'Már', '�pr', 'Máj', 'Jún',
+		'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
+		dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
+		dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
+		dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
+		weekHeader: 'Hé',
+		dateFormat: 'yy-mm-dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['hu']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-hy.js b/ui/i18n/jquery.ui.datepicker-hy.js
new file mode 100644
index 000000000..c6cc1946c
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-hy.js
@@ -0,0 +1,23 @@
+/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
+jQuery(function($){
+	$.datepicker.regional['hy'] = {
+		closeText: 'Õ“Õ¡Õ¯Õ¥Õ¬',
+		prevText: '&#x3c;Õ†Õ¡Õ­.',
+		nextText: 'Õ€Õ¡Õ».&#x3e;',
+		currentText: 'Ô±ÕµÕ½Ö…Ö€',
+		monthNames: ['Õ€Õ¸Ö‚Õ¶Õ¾Õ¡Ö€','Õ“Õ¥Õ¿Ö€Õ¾Õ¡Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€Õ«Õ¬','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+		'Õ€Õ¸Ö‚Õ¬Õ«Õ½','Õ•Õ£Õ¸Õ½Õ¿Õ¸Õ½','Õ�Õ¥ÕºÕ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ€Õ¸Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ†Õ¸ÕµÕ¥Õ´Õ¢Õ¥Ö€','Ô´Õ¥Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€'],
+		monthNamesShort: ['Õ€Õ¸Ö‚Õ¶Õ¾','Õ“Õ¥Õ¿Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
+		'Õ€Õ¸Ö‚Õ¬','Õ•Õ£Õ½','Õ�Õ¥Õº','Õ€Õ¸Õ¯','Õ†Õ¸Õµ','Ô´Õ¥Õ¯'],
+		dayNames: ['Õ¯Õ«Ö€Õ¡Õ¯Õ«','Õ¥Õ¯Õ¸Ö‚Õ·Õ¡Õ¢Õ©Õ«','Õ¥Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ¹Õ¸Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ°Õ«Õ¶Õ£Õ·Õ¡Õ¢Õ©Õ«','Õ¸Ö‚Ö€Õ¢Õ¡Õ©','Õ·Õ¡Õ¢Õ¡Õ©'],
+		dayNamesShort: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+		dayNamesMin: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
+		weekHeader: 'Õ‡Ô²Õ�',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['hy']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-id.js b/ui/i18n/jquery.ui.datepicker-id.js
new file mode 100644
index 000000000..c626fbb7b
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-id.js
@@ -0,0 +1,23 @@
+/* Indonesian initialisation for the jQuery UI date picker plugin. */
+/* Written by Deden Fathurahman (dedenf@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['id'] = {
+		closeText: 'Tutup',
+		prevText: '&#x3c;mundur',
+		nextText: 'maju&#x3e;',
+		currentText: 'hari ini',
+		monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
+		'Juli','Agustus','September','Oktober','Nopember','Desember'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
+		'Jul','Agus','Sep','Okt','Nop','Des'],
+		dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
+		dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
+		dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
+		weekHeader: 'Mg',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['id']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-is.js b/ui/i18n/jquery.ui.datepicker-is.js
new file mode 100644
index 000000000..c53235a49
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-is.js
@@ -0,0 +1,23 @@
+/* Icelandic initialisation for the jQuery UI date picker plugin. */
+/* Written by Haukur H. Thorsson (haukur@eskill.is). */
+jQuery(function($){
+	$.datepicker.regional['is'] = {
+		closeText: 'Loka',
+		prevText: '&#x3c; Fyrri',
+		nextText: 'N&aelig;sti &#x3e;',
+		currentText: '&Iacute; dag',
+		monthNames: ['Jan&uacute;ar','Febr&uacute;ar','Mars','Apr&iacute;l','Ma&iacute','J&uacute;n&iacute;',
+		'J&uacute;l&iacute;','&Aacute;g&uacute;st','September','Okt&oacute;ber','N&oacute;vember','Desember'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Ma&iacute;','J&uacute;n',
+		'J&uacute;l','&Aacute;g&uacute;','Sep','Okt','N&oacute;v','Des'],
+		dayNames: ['Sunnudagur','M&aacute;nudagur','&THORN;ri&eth;judagur','Mi&eth;vikudagur','Fimmtudagur','F&ouml;studagur','Laugardagur'],
+		dayNamesShort: ['Sun','M&aacute;n','&THORN;ri','Mi&eth;','Fim','F&ouml;s','Lau'],
+		dayNamesMin: ['Su','M&aacute;','&THORN;r','Mi','Fi','F&ouml;','La'],
+		weekHeader: 'Vika',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['is']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-it.js b/ui/i18n/jquery.ui.datepicker-it.js
new file mode 100644
index 000000000..59da2df67
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-it.js
@@ -0,0 +1,23 @@
+/* Italian initialisation for the jQuery UI date picker plugin. */
+/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['it'] = {
+		closeText: 'Chiudi',
+		prevText: '&#x3c;Prec',
+		nextText: 'Succ&#x3e;',
+		currentText: 'Oggi',
+		monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
+			'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
+		monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
+			'Lug','Ago','Set','Ott','Nov','Dic'],
+		dayNames: ['Domenica','Luned&#236','Marted&#236','Mercoled&#236','Gioved&#236','Venerd&#236','Sabato'],
+		dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
+		dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['it']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-ja.js b/ui/i18n/jquery.ui.datepicker-ja.js
new file mode 100644
index 000000000..79cd827c7
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ja.js
@@ -0,0 +1,23 @@
+/* Japanese initialisation for the jQuery UI date picker plugin. */
+/* Written by Kentaro SATO (kentaro@ranvis.com). */
+jQuery(function($){
+	$.datepicker.regional['ja'] = {
+		closeText: '閉�る',
+		prevText: '&#x3c;�',
+		nextText: '次&#x3e;',
+		currentText: '今日',
+		monthNames: ['1月','2月','3月','4月','5月','6月',
+		'7月','8月','9月','10月','11月','12月'],
+		monthNamesShort: ['1月','2月','3月','4月','5月','6月',
+		'7月','8月','9月','10月','11月','12月'],
+		dayNames: ['日曜日','月曜日','�曜日','水曜日','木曜日','金曜日','土曜日'],
+		dayNamesShort: ['日','月','�','水','木','金','土'],
+		dayNamesMin: ['日','月','�','水','木','金','土'],
+		weekHeader: '週',
+		dateFormat: 'yy/mm/dd',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: true,
+		yearSuffix: 'å¹´'};
+	$.datepicker.setDefaults($.datepicker.regional['ja']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-ko.js b/ui/i18n/jquery.ui.datepicker-ko.js
new file mode 100644
index 000000000..5b3531652
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ko.js
@@ -0,0 +1,23 @@
+/* Korean initialisation for the jQuery calendar extension. */
+/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['ko'] = {
+		closeText: '닫기',
+		prevText: '�전달',
+		nextText: '다�달',
+		currentText: '오늘',
+		monthNames: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+		'7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+		monthNamesShort: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
+		'7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
+		dayNames: ['�','월','화','수','목','금','토'],
+		dayNamesShort: ['�','월','화','수','목','금','토'],
+		dayNamesMin: ['�','월','화','수','목','금','토'],
+		weekHeader: 'Wk',
+		dateFormat: 'yy-mm-dd',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: 'ë…„'};
+	$.datepicker.setDefaults($.datepicker.regional['ko']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-lt.js b/ui/i18n/jquery.ui.datepicker-lt.js
new file mode 100644
index 000000000..67d5119ca
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-lt.js
@@ -0,0 +1,23 @@
+/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas@avalon.lt> */
+jQuery(function($){
+	$.datepicker.regional['lt'] = {
+		closeText: 'Uždaryti',
+		prevText: '&#x3c;Atgal',
+		nextText: 'Pirmyn&#x3e;',
+		currentText: 'Å iandien',
+		monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
+		'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
+		monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
+		'Lie','Rugp','Rugs','Spa','Lap','Gru'],
+		dayNames: ['sekmadienis','pirmadienis','antradienis','tre�iadienis','ketvirtadienis','penktadienis','šeštadienis'],
+		dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
+		dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Å e'],
+		weekHeader: 'Wk',
+		dateFormat: 'yy-mm-dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['lt']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-lv.js b/ui/i18n/jquery.ui.datepicker-lv.js
new file mode 100644
index 000000000..003934e72
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-lv.js
@@ -0,0 +1,23 @@
+/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
+jQuery(function($){
+	$.datepicker.regional['lv'] = {
+		closeText: 'Aizvērt',
+		prevText: 'Iepr',
+		nextText: 'N�ka',
+		currentText: 'Å odien',
+		monthNames: ['Janv�ris','Febru�ris','Marts','Aprīlis','Maijs','Jūnijs',
+		'JÅ«lijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','JÅ«n',
+		'JÅ«l','Aug','Sep','Okt','Nov','Dec'],
+		dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
+		dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
+		dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
+		weekHeader: 'Nav',
+		dateFormat: 'dd-mm-yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['lv']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-ms.js b/ui/i18n/jquery.ui.datepicker-ms.js
new file mode 100644
index 000000000..e953ac04f
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ms.js
@@ -0,0 +1,23 @@
+/* Malaysian initialisation for the jQuery UI date picker plugin. */
+/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
+jQuery(function($){
+	$.datepicker.regional['ms'] = {
+		closeText: 'Tutup',
+		prevText: '&#x3c;Sebelum',
+		nextText: 'Selepas&#x3e;',
+		currentText: 'hari ini',
+		monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
+		'Julai','Ogos','September','Oktober','November','Disember'],
+		monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
+		'Jul','Ogo','Sep','Okt','Nov','Dis'],
+		dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
+		dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
+		dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
+		weekHeader: 'Mg',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ms']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-nl.js b/ui/i18n/jquery.ui.datepicker-nl.js
new file mode 100644
index 000000000..663d6bb26
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-nl.js
@@ -0,0 +1,23 @@
+/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Mathias Bynens <http://mathiasbynens.be/> */
+jQuery(function($){
+	$.datepicker.regional.nl = {
+		closeText: 'Sluiten',
+		prevText: '�',
+		nextText: '→',
+		currentText: 'Vandaag',
+		monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
+		'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
+		monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
+		'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
+		dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
+		dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
+		dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
+		weekHeader: 'Wk',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional.nl);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-no.js b/ui/i18n/jquery.ui.datepicker-no.js
new file mode 100644
index 000000000..12b2356bf
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-no.js
@@ -0,0 +1,23 @@
+/* Norwegian initialisation for the jQuery UI date picker plugin. */
+/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
+jQuery(function($){
+    $.datepicker.regional['no'] = {
+		closeText: 'Lukk',
+        prevText: '&laquo;Forrige',
+		nextText: 'Neste&raquo;',
+		currentText: 'I dag',
+        monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
+        'Juli','August','September','Oktober','November','Desember'],
+        monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
+        'Jul','Aug','Sep','Okt','Nov','Des'],
+		dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
+		dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
+		dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
+		weekHeader: 'Uke',
+        dateFormat: 'yy-mm-dd',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+    $.datepicker.setDefaults($.datepicker.regional['no']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-pl.js b/ui/i18n/jquery.ui.datepicker-pl.js
new file mode 100644
index 000000000..2d2d4d765
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-pl.js
@@ -0,0 +1,23 @@
+/* Polish initialisation for the jQuery UI date picker plugin. */
+/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['pl'] = {
+		closeText: 'Zamknij',
+		prevText: '&#x3c;Poprzedni',
+		nextText: 'Następny&#x3e;',
+		currentText: 'DziÅ›',
+		monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
+		'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
+		monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
+		'Lip','Sie','Wrz','Pa','Lis','Gru'],
+		dayNames: ['Niedziela','Poniedzialek','Wtorek','Åšroda','Czwartek','PiÄ…tek','Sobota'],
+		dayNamesShort: ['Nie','Pn','Wt','Åšr','Czw','Pt','So'],
+		dayNamesMin: ['N','Pn','Wt','Åšr','Cz','Pt','So'],
+		weekHeader: 'Tydz',
+		dateFormat: 'yy-mm-dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['pl']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-pt-BR.js b/ui/i18n/jquery.ui.datepicker-pt-BR.js
new file mode 100644
index 000000000..38818637d
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-pt-BR.js
@@ -0,0 +1,23 @@
+/* Brazilian initialisation for the jQuery UI date picker plugin. */
+/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['pt-BR'] = {
+		closeText: 'Fechar',
+		prevText: '&#x3c;Anterior',
+		nextText: 'Pr&oacute;ximo&#x3e;',
+		currentText: 'Hoje',
+		monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
+		'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
+		monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
+		'Jul','Ago','Set','Out','Nov','Dez'],
+		dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
+		dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+		dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
+		weekHeader: 'Sm',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['pt-BR']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-ro.js b/ui/i18n/jquery.ui.datepicker-ro.js
new file mode 100644
index 000000000..acb2e4499
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ro.js
@@ -0,0 +1,26 @@
+/* Romanian initialisation for the jQuery UI date picker plugin.
+ *
+ * Written by Edmond L. (ll_edmond@walla.com)
+ * and Ionut G. Stan (ionut.g.stan@gmail.com)
+ */
+jQuery(function($){
+	$.datepicker.regional['ro'] = {
+		closeText: 'ÃŽnchide',
+		prevText: '&laquo; Luna precedentă',
+		nextText: 'Luna următoare &raquo;',
+		currentText: 'Azi',
+		monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
+		'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
+		monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
+		'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
+		dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
+		dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
+		dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
+		weekHeader: 'Sapt',
+		dateFormat: 'dd MM yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ro']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-ru.js b/ui/i18n/jquery.ui.datepicker-ru.js
new file mode 100644
index 000000000..b8091f9ec
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-ru.js
@@ -0,0 +1,23 @@
+/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Andrew Stromnov (stromnov@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['ru'] = {
+		closeText: 'Закрыть',
+		prevText: '&#x3c;Пред',
+		nextText: 'След&#x3e;',
+		currentText: 'Сегодн�',
+		monthNames: ['Январь','Февраль','Март','�прель','Май','Июнь',
+		'Июль','�вгу�т','Сент�брь','Окт�брь','�о�брь','Декабрь'],
+		monthNamesShort: ['Янв','Фев','Мар','�пр','Май','Июн',
+		'Июл','�вг','Сен','Окт','�о�','Дек'],
+		dayNames: ['во�кре�енье','понедельник','вторник','�реда','четверг','п�тница','�уббота'],
+		dayNamesShort: ['в�к','пнд','втр','�рд','чтв','птн','�бт'],
+		dayNamesMin: ['В�','Пн','Вт','Ср','Чт','Пт','Сб'],
+		weekHeader: '�е',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['ru']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-sk.js b/ui/i18n/jquery.ui.datepicker-sk.js
new file mode 100644
index 000000000..e8e73e671
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sk.js
@@ -0,0 +1,23 @@
+/* Slovak initialisation for the jQuery UI date picker plugin. */
+/* Written by Vojtech Rinik (vojto@hmm.sk). */
+jQuery(function($){
+	$.datepicker.regional['sk'] = {
+		closeText: 'Zavrieť',
+		prevText: '&#x3c;Predchádzajúci',
+		nextText: 'Nasledujúci&#x3e;',
+		currentText: 'Dnes',
+		monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
+		'Júl','August','September','Október','November','December'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
+		'Júl','Aug','Sep','Okt','Nov','Dec'],
+		dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Å tvrtok','Piatok','Sobota'],
+		dayNamesShort: ['Ned','Pon','Uto','Str','Å tv','Pia','Sob'],
+		dayNamesMin: ['Ne','Po','Ut','St','Å t','Pia','So'],
+		weekHeader: 'Ty',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['sk']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-sl.js b/ui/i18n/jquery.ui.datepicker-sl.js
new file mode 100644
index 000000000..516550192
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sl.js
@@ -0,0 +1,24 @@
+/* Slovenian initialisation for the jQuery UI date picker plugin. */
+/* Written by Jaka Jancar (jaka@kubje.org). */
+/* c = &#x10D;, s = &#x161; z = &#x17E; C = &#x10C; S = &#x160; Z = &#x17D; */
+jQuery(function($){
+	$.datepicker.regional['sl'] = {
+		closeText: 'Zapri',
+		prevText: '&lt;Prej&#x161;nji',
+		nextText: 'Naslednji&gt;',
+		currentText: 'Trenutni',
+		monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
+		'Julij','Avgust','September','Oktober','November','December'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+		'Jul','Avg','Sep','Okt','Nov','Dec'],
+		dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','&#x10C;etrtek','Petek','Sobota'],
+		dayNamesShort: ['Ned','Pon','Tor','Sre','&#x10C;et','Pet','Sob'],
+		dayNamesMin: ['Ne','Po','To','Sr','&#x10C;e','Pe','So'],
+		weekHeader: 'Teden',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['sl']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-sq.js b/ui/i18n/jquery.ui.datepicker-sq.js
new file mode 100644
index 000000000..be84104c0
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sq.js
@@ -0,0 +1,23 @@
+/* Albanian initialisation for the jQuery UI date picker plugin. */
+/* Written by Flakron Bytyqi (flakron@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['sq'] = {
+		closeText: 'mbylle',
+		prevText: '&#x3c;mbrapa',
+		nextText: 'Përpara&#x3e;',
+		currentText: 'sot',
+		monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
+		'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
+		monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
+		'Kor','Gus','Sht','Tet','Nën','Dhj'],
+		dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
+		dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+		dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
+		weekHeader: 'Ja',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['sq']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-sr-SR.js b/ui/i18n/jquery.ui.datepicker-sr-SR.js
new file mode 100644
index 000000000..ac779dd18
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sr-SR.js
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+	$.datepicker.regional['sr-SR'] = {
+		closeText: 'Zatvori',
+		prevText: '&#x3c;',
+		nextText: '&#x3e;',
+		currentText: 'Danas',
+		monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
+		'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
+		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+		'Jul','Avg','Sep','Okt','Nov','Dec'],
+		dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','ÄŒetvrtak','Petak','Subota'],
+		dayNamesShort: ['Ned','Pon','Uto','Sre','ÄŒet','Pet','Sub'],
+		dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
+		weekHeader: 'Sed',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['sr-SR']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-sr.js b/ui/i18n/jquery.ui.datepicker-sr.js
new file mode 100644
index 000000000..b82964859
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sr.js
@@ -0,0 +1,23 @@
+/* Serbian i18n for the jQuery UI date picker plugin. */
+/* Written by Dejan Dimić. */
+jQuery(function($){
+	$.datepicker.regional['sr'] = {
+		closeText: 'Затвори',
+		prevText: '&#x3c;',
+		nextText: '&#x3e;',
+		currentText: 'Дана�',
+		monthNames: ['Јануар','Фебруар','Март','�прил','Мај','Јун',
+		'Јул','�вгу�т','Септембар','Октобар','�овембар','Децембар'],
+		monthNamesShort: ['Јан','Феб','Мар','�пр','Мај','Јун',
+		'Јул','�вг','Сеп','Окт','�ов','Дец'],
+		dayNames: ['�едеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
+		dayNamesShort: ['�ед','Пон','Уто','Сре','Чет','Пет','Суб'],
+		dayNamesMin: ['�е','По','Ут','Ср','Че','Пе','Су'],
+		weekHeader: 'Сед',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['sr']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-sv.js b/ui/i18n/jquery.ui.datepicker-sv.js
new file mode 100644
index 000000000..8236b62b5
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-sv.js
@@ -0,0 +1,23 @@
+/* Swedish initialisation for the jQuery UI date picker plugin. */
+/* Written by Anders Ekdahl ( anders@nomadiz.se). */
+jQuery(function($){
+    $.datepicker.regional['sv'] = {
+		closeText: 'Stäng',
+        prevText: '&laquo;Förra',
+		nextText: 'Nästa&raquo;',
+		currentText: 'Idag',
+        monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
+        'Juli','Augusti','September','Oktober','November','December'],
+        monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
+        'Jul','Aug','Sep','Okt','Nov','Dec'],
+		dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
+		dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
+		dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
+		weekHeader: 'Ve',
+        dateFormat: 'yy-mm-dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+    $.datepicker.setDefaults($.datepicker.regional['sv']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-th.js b/ui/i18n/jquery.ui.datepicker-th.js
new file mode 100644
index 000000000..978500ab1
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-th.js
@@ -0,0 +1,23 @@
+/* Thai initialisation for the jQuery UI date picker plugin. */
+/* Written by pipo (pipo@sixhead.com). */
+jQuery(function($){
+	$.datepicker.regional['th'] = {
+		closeText: 'ปิด',
+		prevText: '&laquo;&nbsp;ย้อน',
+		nextText: 'ถัดไป&nbsp;&raquo;',
+		currentText: 'วันนี้',
+		monthNames: ['ม�ราคม','�ุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
+		'�ร��าคม','สิงหาคม','�ันยายน','ตุลาคม','พฤศจิ�ายน','ธันวาคม'],
+		monthNamesShort: ['ม.ค.','�.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
+		'�.ค.','ส.ค.','�.ย.','ต.ค.','พ.ย.','ธ.ค.'],
+		dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุ�ร์','เสาร์'],
+		dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+		dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
+		weekHeader: 'Wk',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['th']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-tr.js b/ui/i18n/jquery.ui.datepicker-tr.js
new file mode 100644
index 000000000..dedfc7ff9
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-tr.js
@@ -0,0 +1,23 @@
+/* Turkish initialisation for the jQuery UI date picker plugin. */
+/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
+jQuery(function($){
+	$.datepicker.regional['tr'] = {
+		closeText: 'kapat',
+		prevText: '&#x3c;geri',
+		nextText: 'ileri&#x3e',
+		currentText: 'bugün',
+		monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
+		'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
+		monthNamesShort: ['Oca','Åžub','Mar','Nis','May','Haz',
+		'Tem','AÄŸu','Eyl','Eki','Kas','Ara'],
+		dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
+		dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+		dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
+		weekHeader: 'Hf',
+		dateFormat: 'dd.mm.yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['tr']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-uk.js b/ui/i18n/jquery.ui.datepicker-uk.js
new file mode 100644
index 000000000..112b40e7f
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-uk.js
@@ -0,0 +1,23 @@
+/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
+/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['uk'] = {
+		closeText: 'Закрити',
+		prevText: '&#x3c;',
+		nextText: '&#x3e;',
+		currentText: 'Сьогодні',
+		monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
+		'Липень','Серпень','Вере�ень','Жовтень','Ли�топад','Грудень'],
+		monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
+		'Лип','Сер','Вер','Жов','Ли�','Гру'],
+		dayNames: ['неділ�','понеділок','вівторок','�ереда','четвер','п’�тниц�','�убота'],
+		dayNamesShort: ['нед','пнд','вів','�рд','чтв','птн','�бт'],
+		dayNamesMin: ['�д','Пн','Вт','Ср','Чт','Пт','Сб'],
+		weekHeader: '�е',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['uk']);
+});
\ No newline at end of file
diff --git a/ui/i18n/jquery.ui.datepicker-vi.js b/ui/i18n/jquery.ui.datepicker-vi.js
new file mode 100644
index 000000000..fa97af5fa
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-vi.js
@@ -0,0 +1,23 @@
+/* Vietnamese initialisation for the jQuery UI date picker plugin. */
+/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
+jQuery(function($){
+	$.datepicker.regional['vi'] = {
+		closeText: '�óng',
+		prevText: '&#x3c;TrÆ°á»›c',
+		nextText: 'Tiếp&#x3e;',
+		currentText: 'Hôm nay',
+		monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
+		'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mư�i', 'Tháng Mư�i Một', 'Tháng Mư�i Hai'],
+		monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
+		'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
+		dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
+		dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+		dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
+		weekHeader: 'Tu',
+		dateFormat: 'dd/mm/yy',
+		firstDay: 0,
+		isRTL: false,
+		showMonthAfterYear: false,
+		yearSuffix: ''};
+	$.datepicker.setDefaults($.datepicker.regional['vi']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-zh-CN.js b/ui/i18n/jquery.ui.datepicker-zh-CN.js
new file mode 100644
index 000000000..6c4883f53
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-zh-CN.js
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Cloudream (cloudream@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['zh-CN'] = {
+		closeText: '关闭',
+		prevText: '&#x3c;上月',
+		nextText: '下月&#x3e;',
+		currentText: '今天',
+		monthNames: ['一月','二月','三月','四月','五月','六月',
+		'七月','八月','�月','�月','�一月','�二月'],
+		monthNamesShort: ['一','二','三','四','五','六',
+		'七','八','�','�','�一','�二'],
+		dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+		dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+		dayNamesMin: ['日','一','二','三','四','五','六'],
+		weekHeader: '周',
+		dateFormat: 'yy-mm-dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: true,
+		yearSuffix: 'å¹´'};
+	$.datepicker.setDefaults($.datepicker.regional['zh-CN']);
+});
diff --git a/ui/i18n/jquery.ui.datepicker-zh-TW.js b/ui/i18n/jquery.ui.datepicker-zh-TW.js
new file mode 100644
index 000000000..d211573c6
--- /dev/null
+++ b/ui/i18n/jquery.ui.datepicker-zh-TW.js
@@ -0,0 +1,23 @@
+/* Chinese initialisation for the jQuery UI date picker plugin. */
+/* Written by Ressol (ressol@gmail.com). */
+jQuery(function($){
+	$.datepicker.regional['zh-TW'] = {
+		closeText: '關閉',
+		prevText: '&#x3c;上月',
+		nextText: '下月&#x3e;',
+		currentText: '今天',
+		monthNames: ['一月','二月','三月','四月','五月','六月',
+		'七月','八月','�月','�月','�一月','�二月'],
+		monthNamesShort: ['一','二','三','四','五','六',
+		'七','八','�','�','�一','�二'],
+		dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
+		dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
+		dayNamesMin: ['日','一','二','三','四','五','六'],
+		weekHeader: '周',
+		dateFormat: 'yy/mm/dd',
+		firstDay: 1,
+		isRTL: false,
+		showMonthAfterYear: true,
+		yearSuffix: 'å¹´'};
+	$.datepicker.setDefaults($.datepicker.regional['zh-TW']);
+});
diff --git a/ui/i18n/ui.datepicker-ar.js b/ui/i18n/ui.datepicker-ar.js
deleted file mode 100644
index c799b48d8..000000000
--- a/ui/i18n/ui.datepicker-ar.js
+++ /dev/null
@@ -1,24 +0,0 @@
-/* Arabic Translation for jQuery UI date picker plugin. */
-/* Khaled Al Horani -- koko.dw@gmail.com */
-/* خالد الحوراني -- koko.dw@gmail.com */
-/* NOTE: monthNames are the original months names and they are the Arabic names, not the new months name �براير - يناير and there isn't any Arabic roots for these months */
-jQuery(function($){
-	$.datepicker.regional['ar'] = {
-		closeText: 'إغلاق',
-		prevText: '&#x3c;السابق',
-		nextText: 'التالي&#x3e;',
-		currentText: 'اليوم',
-		monthNames: ['كانون الثاني', 'شباط', 'آذار', 'نيسان', 'آذار', 'حزيران',
-		'تموز', 'آب', 'أيلول',	'تشرين الأول', 'تشرين الثاني', 'كانون الأول'],
-		monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
-		dayNames: ['السبت', 'الأحد', 'الاثنين', 'الثلاثاء', 'الأربعاء', 'الخميس', 'الجمعة'],
-		dayNamesShort: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
-		dayNamesMin: ['سبت', 'أحد', 'اثنين', 'ثلاثاء', 'أربعاء', 'خميس', 'جمعة'],
-		weekHeader: 'أسبوع',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-  		isRTL: true,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['ar']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-az.js b/ui/i18n/ui.datepicker-az.js
deleted file mode 100644
index b5434057b..000000000
--- a/ui/i18n/ui.datepicker-az.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Azerbaijani (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Jamil Najafov (necefov33@gmail.com). */
-jQuery(function($) {
-	$.datepicker.regional['az'] = {
-		closeText: 'BaÄŸla',
-		prevText: '&#x3c;Geri',
-		nextText: 'İrəli&#x3e;',
-		currentText: 'Bugün',
-		monthNames: ['Yanvar','Fevral','Mart','Aprel','May','Ä°yun',
-		'Ä°yul','Avqust','Sentyabr','Oktyabr','Noyabr','Dekabr'],
-		monthNamesShort: ['Yan','Fev','Mar','Apr','May','Ä°yun',
-		'Ä°yul','Avq','Sen','Okt','Noy','Dek'],
-		dayNames: ['Bazar','Bazar ertəsi','Çərşənbə axşamı','Çərşənbə','Cümə axşamı','Cümə','Şənbə'],
-		dayNamesShort: ['B','Be','Ça','Ç','Ca','C','Ş'],
-		dayNamesMin: ['B','B','Ç','С','Ç','C','Ş'],
-		weekHeader: 'Hf',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['az']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-bg.js b/ui/i18n/ui.datepicker-bg.js
deleted file mode 100644
index b5113f781..000000000
--- a/ui/i18n/ui.datepicker-bg.js
+++ /dev/null
@@ -1,24 +0,0 @@
-/* Bulgarian initialisation for the jQuery UI date picker plugin. */
-/* Written by Stoyan Kyosev (http://svest.org). */
-jQuery(function($){
-    $.datepicker.regional['bg'] = {
-        closeText: 'затвори',
-        prevText: '&#x3c;назад',
-        nextText: 'напред&#x3e;',
-		nextBigText: '&#x3e;&#x3e;',
-        currentText: 'дне�',
-        monthNames: ['Януари','Февруари','Март','�прил','Май','Юни',
-        'Юли','�вгу�т','Септември','Октомври','�оември','Декември'],
-        monthNamesShort: ['Яну','Фев','Мар','�пр','Май','Юни',
-        'Юли','�вг','Сеп','Окт','�ов','Дек'],
-        dayNames: ['�едел�','Понеделник','Вторник','Ср�да','Четвъртък','Петък','Събота'],
-        dayNamesShort: ['�ед','Пон','Вто','Ср�','Чет','Пет','Съб'],
-        dayNamesMin: ['�е','По','Вт','Ср','Че','Пе','Съ'],
-		weekHeader: 'Wk',
-        dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-        isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-    $.datepicker.setDefaults($.datepicker.regional['bg']);
-});
diff --git a/ui/i18n/ui.datepicker-ca.js b/ui/i18n/ui.datepicker-ca.js
deleted file mode 100644
index b128e699e..000000000
--- a/ui/i18n/ui.datepicker-ca.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Inicialització en català per a l'extenció 'calendar' per jQuery. */
-/* Writers: (joan.leon@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['ca'] = {
-		closeText: 'Tancar',
-		prevText: '&#x3c;Ant',
-		nextText: 'Seg&#x3e;',
-		currentText: 'Avui',
-		monthNames: ['Gener','Febrer','Mar&ccedil;','Abril','Maig','Juny',
-		'Juliol','Agost','Setembre','Octubre','Novembre','Desembre'],
-		monthNamesShort: ['Gen','Feb','Mar','Abr','Mai','Jun',
-		'Jul','Ago','Set','Oct','Nov','Des'],
-		dayNames: ['Diumenge','Dilluns','Dimarts','Dimecres','Dijous','Divendres','Dissabte'],
-		dayNamesShort: ['Dug','Dln','Dmt','Dmc','Djs','Dvn','Dsb'],
-		dayNamesMin: ['Dg','Dl','Dt','Dc','Dj','Dv','Ds'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['ca']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-cs.js b/ui/i18n/ui.datepicker-cs.js
deleted file mode 100644
index c3c07ea67..000000000
--- a/ui/i18n/ui.datepicker-cs.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Czech initialisation for the jQuery UI date picker plugin. */
-/* Written by Tomas Muller (tomas@tomas-muller.net). */
-jQuery(function($){
-	$.datepicker.regional['cs'] = {
-		closeText: 'Zavřít',
-		prevText: '&#x3c;Dříve',
-		nextText: 'Později&#x3e;',
-		currentText: 'Nyní',
-		monthNames: ['leden','únor','březen','duben','květen','�erven',
-        '�ervenec','srpen','září','říjen','listopad','prosinec'],
-		monthNamesShort: ['led','úno','bře','dub','kvě','�er',
-		'�vc','srp','zář','říj','lis','pro'],
-		dayNames: ['neděle', 'pondělí', 'úterý', 'středa', '�tvrtek', 'pátek', 'sobota'],
-		dayNamesShort: ['ne', 'po', 'út', 'st', '�t', 'pá', 'so'],
-		dayNamesMin: ['ne','po','út','st','�t','pá','so'],
-		weekHeader: 'Týd',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['cs']);
-});
diff --git a/ui/i18n/ui.datepicker-da.js b/ui/i18n/ui.datepicker-da.js
deleted file mode 100644
index 8ab7c339d..000000000
--- a/ui/i18n/ui.datepicker-da.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Danish initialisation for the jQuery UI date picker plugin. */
-/* Written by Jan Christensen ( deletestuff@gmail.com). */
-jQuery(function($){
-    $.datepicker.regional['da'] = {
-		closeText: 'Luk',
-        prevText: '&#x3c;Forrige',
-		nextText: 'Næste&#x3e;',
-		currentText: 'Idag',
-        monthNames: ['Januar','Februar','Marts','April','Maj','Juni',
-        'Juli','August','September','Oktober','November','December'],
-        monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
-        'Jul','Aug','Sep','Okt','Nov','Dec'],
-		dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
-		dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
-		dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
-		weekHeader: 'Uge',
-        dateFormat: 'dd-mm-yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-    $.datepicker.setDefaults($.datepicker.regional['da']);
-});
diff --git a/ui/i18n/ui.datepicker-de.js b/ui/i18n/ui.datepicker-de.js
deleted file mode 100644
index ac2d516aa..000000000
--- a/ui/i18n/ui.datepicker-de.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* German initialisation for the jQuery UI date picker plugin. */
-/* Written by Milian Wolff (mail@milianw.de). */
-jQuery(function($){
-	$.datepicker.regional['de'] = {
-		closeText: 'schließen',
-		prevText: '&#x3c;zurück',
-		nextText: 'Vor&#x3e;',
-		currentText: 'heute',
-		monthNames: ['Januar','Februar','März','April','Mai','Juni',
-		'Juli','August','September','Oktober','November','Dezember'],
-		monthNamesShort: ['Jan','Feb','Mär','Apr','Mai','Jun',
-		'Jul','Aug','Sep','Okt','Nov','Dez'],
-		dayNames: ['Sonntag','Montag','Dienstag','Mittwoch','Donnerstag','Freitag','Samstag'],
-		dayNamesShort: ['So','Mo','Di','Mi','Do','Fr','Sa'],
-		dayNamesMin: ['So','Mo','Di','Mi','Do','Fr','Sa'],
-		weekHeader: 'Wo',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['de']);
-});
diff --git a/ui/i18n/ui.datepicker-el.js b/ui/i18n/ui.datepicker-el.js
deleted file mode 100644
index 9542769d9..000000000
--- a/ui/i18n/ui.datepicker-el.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Greek (el) initialisation for the jQuery UI date picker plugin. */
-/* Written by Alex Cicovic (http://www.alexcicovic.com) */
-jQuery(function($){
-	$.datepicker.regional['el'] = {
-		closeText: 'Κλείσιμο',
-		prevText: 'Π�οηγο�μενος',
-		nextText: 'Επόμενος',
-		currentText: 'Τ�έχων Μήνας',
-		monthNames: ['Ιανουά�ιος','Φεβ�ουά�ιος','Μά�τιος','Απ�ίλιος','Μάιος','Ιο�νιος',
-		'Ιο�λιος','Α�γουστος','Σεπτέμβ�ιος','Οκτώβ�ιος','�οέμβ�ιος','Δεκέμβ�ιος'],
-		monthNamesShort: ['Ιαν','Φεβ','Μα�','Απ�','Μαι','Ιουν',
-		'Ιουλ','Αυγ','Σεπ','Οκτ','�οε','Δεκ'],
-		dayNames: ['Κυ�ιακή','Δευτέ�α','Τ�ίτη','Τετά�τη','Πέμπτη','Πα�ασκευή','Σάββατο'],
-		dayNamesShort: ['Κυ�','Δευ','Τ�ι','Τετ','Πεμ','Πα�','Σαβ'],
-		dayNamesMin: ['Κυ','Δε','Τ�','Τε','Πε','Πα','Σα'],
-		weekHeader: 'Εβδ',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['el']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-eo.js b/ui/i18n/ui.datepicker-eo.js
deleted file mode 100644
index ba5715687..000000000
--- a/ui/i18n/ui.datepicker-eo.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Esperanto initialisation for the jQuery UI date picker plugin. */
-/* Written by Olivier M. (olivierweb@ifrance.com). */
-jQuery(function($){
-	$.datepicker.regional['eo'] = {
-		closeText: 'Fermi',
-		prevText: '&lt;Anta',
-		nextText: 'Sekv&gt;',
-		currentText: 'Nuna',
-		monthNames: ['Januaro','Februaro','Marto','Aprilo','Majo','Junio',
-		'Julio','AÅ­gusto','Septembro','Oktobro','Novembro','Decembro'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
-		'Jul','AÅ­g','Sep','Okt','Nov','Dec'],
-		dayNames: ['Dimanĉo','Lundo','Mardo','Merkredo','Ĵaŭdo','Vendredo','Sabato'],
-		dayNamesShort: ['Dim','Lun','Mar','Mer','Ä´aÅ­','Ven','Sab'],
-		dayNamesMin: ['Di','Lu','Ma','Me','Ä´a','Ve','Sa'],
-		weekHeader: 'Sb',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['eo']);
-});
diff --git a/ui/i18n/ui.datepicker-es.js b/ui/i18n/ui.datepicker-es.js
deleted file mode 100644
index a02133de3..000000000
--- a/ui/i18n/ui.datepicker-es.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Inicialización en español para la extensión 'UI date picker' para jQuery. */
-/* Traducido por Vester (xvester@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['es'] = {
-		closeText: 'Cerrar',
-		prevText: '&#x3c;Ant',
-		nextText: 'Sig&#x3e;',
-		currentText: 'Hoy',
-		monthNames: ['Enero','Febrero','Marzo','Abril','Mayo','Junio',
-		'Julio','Agosto','Septiembre','Octubre','Noviembre','Diciembre'],
-		monthNamesShort: ['Ene','Feb','Mar','Abr','May','Jun',
-		'Jul','Ago','Sep','Oct','Nov','Dic'],
-		dayNames: ['Domingo','Lunes','Martes','Mi&eacute;rcoles','Jueves','Viernes','S&aacute;bado'],
-		dayNamesShort: ['Dom','Lun','Mar','Mi&eacute;','Juv','Vie','S&aacute;b'],
-		dayNamesMin: ['Do','Lu','Ma','Mi','Ju','Vi','S&aacute;'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['es']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-et.js b/ui/i18n/ui.datepicker-et.js
deleted file mode 100644
index f97311f31..000000000
--- a/ui/i18n/ui.datepicker-et.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Estonian initialisation for the jQuery UI date picker plugin. */
-/* Written by Mart Sõmermaa (mrts.pydev at gmail com). */
-jQuery(function($){
-	$.datepicker.regional['et'] = {
-		closeText: 'Sulge',
-		prevText: 'Eelnev',
-		nextText: 'Järgnev',
-		currentText: 'Täna',
-		monthNames: ['Jaanuar','Veebruar','Märts','Aprill','Mai','Juuni',
-		'Juuli','August','September','Oktoober','November','Detsember'],
-		monthNamesShort: ['Jaan', 'Veebr', 'Märts', 'Apr', 'Mai', 'Juuni',
-		'Juuli', 'Aug', 'Sept', 'Okt', 'Nov', 'Dets'],
-		dayNames: ['Pühapäev', 'Esmaspäev', 'Teisipäev', 'Kolmapäev', 'Neljapäev', 'Reede', 'Laupäev'],
-		dayNamesShort: ['Pühap', 'Esmasp', 'Teisip', 'Kolmap', 'Neljap', 'Reede', 'Laup'],
-		dayNamesMin: ['P','E','T','K','N','R','L'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['et']);
-}); 
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-eu.js b/ui/i18n/ui.datepicker-eu.js
deleted file mode 100644
index 1d7609a24..000000000
--- a/ui/i18n/ui.datepicker-eu.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Euskarako oinarria 'UI date picker' jquery-ko extentsioarentzat */
-/* Karrikas-ek itzulia (karrikas@karrikas.com) */
-jQuery(function($){
-	$.datepicker.regional['eu'] = {
-		closeText: 'Egina',
-		prevText: '&#x3c;Aur',
-		nextText: 'Hur&#x3e;',
-		currentText: 'Gaur',
-		monthNames: ['Urtarrila','Otsaila','Martxoa','Apirila','Maiatza','Ekaina',
-		'Uztaila','Abuztua','Iraila','Urria','Azaroa','Abendua'],
-		monthNamesShort: ['Urt','Ots','Mar','Api','Mai','Eka',
-		'Uzt','Abu','Ira','Urr','Aza','Abe'],
-		dayNames: ['Igandea','Astelehena','Asteartea','Asteazkena','Osteguna','Ostirala','Larunbata'],
-		dayNamesShort: ['Iga','Ast','Ast','Ast','Ost','Ost','Lar'],
-		dayNamesMin: ['Ig','As','As','As','Os','Os','La'],
-		weekHeader: 'Wk',
-		dateFormat: 'yy/mm/dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['eu']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-fa.js b/ui/i18n/ui.datepicker-fa.js
deleted file mode 100644
index adb3709fe..000000000
--- a/ui/i18n/ui.datepicker-fa.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Persian (Farsi) Translation for the jQuery UI date picker plugin. */
-/* Javad Mowlanezhad -- jmowla@gmail.com */
-/* Jalali calendar should supported soon! (Its implemented but I have to test it) */
-jQuery(function($) {
-	$.datepicker.regional['fa'] = {
-		closeText: 'بستن',
-		prevText: '&#x3c;قبلي',
-		nextText: 'بعدي&#x3e;',
-		currentText: 'امروز',
-		monthNames: ['�روردين','ارديبهشت','خرداد','تير','مرداد','شهريور',
-		'مهر','آبان','آذر','دي','بهمن','اس�ند'],
-		monthNamesShort: ['1','2','3','4','5','6','7','8','9','10','11','12'],
-		dayNames: ['يکشنبه','دوشنبه','سه‌شنبه','چهارشنبه','پنجشنبه','جمعه','شنبه'],
-		dayNamesShort: ['ي','د','س','چ','پ','ج', 'ش'],
-		dayNamesMin: ['ي','د','س','چ','پ','ج', 'ش'],
-		weekHeader: 'ه�',
-		dateFormat: 'yy/mm/dd',
-		firstDay: 6,
-		isRTL: true,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['fa']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-fi.js b/ui/i18n/ui.datepicker-fi.js
deleted file mode 100644
index e1f25fd84..000000000
--- a/ui/i18n/ui.datepicker-fi.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Finnish initialisation for the jQuery UI date picker plugin. */
-/* Written by Harri Kilpi� (harrikilpio@gmail.com). */
-jQuery(function($){
-    $.datepicker.regional['fi'] = {
-		closeText: 'Sulje',
-		prevText: '&laquo;Edellinen',
-		nextText: 'Seuraava&raquo;',
-		currentText: 'T&auml;n&auml;&auml;n',
-        monthNames: ['Tammikuu','Helmikuu','Maaliskuu','Huhtikuu','Toukokuu','Kes&auml;kuu',
-        'Hein&auml;kuu','Elokuu','Syyskuu','Lokakuu','Marraskuu','Joulukuu'],
-        monthNamesShort: ['Tammi','Helmi','Maalis','Huhti','Touko','Kes&auml;',
-        'Hein&auml;','Elo','Syys','Loka','Marras','Joulu'],
-		dayNamesShort: ['Su','Ma','Ti','Ke','To','Pe','Su'],
-		dayNames: ['Sunnuntai','Maanantai','Tiistai','Keskiviikko','Torstai','Perjantai','Lauantai'],
-		dayNamesMin: ['Su','Ma','Ti','Ke','To','Pe','La'],
-		weekHeader: 'Vk',
-        dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-    $.datepicker.setDefaults($.datepicker.regional['fi']);
-});
diff --git a/ui/i18n/ui.datepicker-fr-CH.js b/ui/i18n/ui.datepicker-fr-CH.js
deleted file mode 100644
index 9b7234375..000000000
--- a/ui/i18n/ui.datepicker-fr-CH.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Swiss-French initialisation for the jQuery UI date picker plugin. */
-/* Written Martin Voelkle (martin.voelkle@e-tc.ch). */
-jQuery(function($){
-	$.datepicker.regional['fr-CH'] = {
-		closeText: 'Fermer',
-		prevText: '&#x3c;Préc',
-		nextText: 'Suiv&#x3e;',
-		currentText: 'Courant',
-		monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
-		'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
-		monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
-		'Jul','Aoû','Sep','Oct','Nov','Déc'],
-		dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
-		dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
-		dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['fr-CH']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-fr.js b/ui/i18n/ui.datepicker-fr.js
deleted file mode 100644
index 134bda65d..000000000
--- a/ui/i18n/ui.datepicker-fr.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* French initialisation for the jQuery UI date picker plugin. */
-/* Written by Keith Wood (kbwood{at}iinet.com.au) and Stéphane Nahmani (sholby@sholby.net). */
-jQuery(function($){
-	$.datepicker.regional['fr'] = {
-		closeText: 'Fermer',
-		prevText: '&#x3c;Préc',
-		nextText: 'Suiv&#x3e;',
-		currentText: 'Courant',
-		monthNames: ['Janvier','Février','Mars','Avril','Mai','Juin',
-		'Juillet','Août','Septembre','Octobre','Novembre','Décembre'],
-		monthNamesShort: ['Jan','Fév','Mar','Avr','Mai','Jun',
-		'Jul','Aoû','Sep','Oct','Nov','Déc'],
-		dayNames: ['Dimanche','Lundi','Mardi','Mercredi','Jeudi','Vendredi','Samedi'],
-		dayNamesShort: ['Dim','Lun','Mar','Mer','Jeu','Ven','Sam'],
-		dayNamesMin: ['Di','Lu','Ma','Me','Je','Ve','Sa'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['fr']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-he.js b/ui/i18n/ui.datepicker-he.js
deleted file mode 100644
index 3b3dc387f..000000000
--- a/ui/i18n/ui.datepicker-he.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Hebrew initialisation for the UI Datepicker extension. */
-/* Written by Amir Hardon (ahardon at gmail dot com). */
-jQuery(function($){
-	$.datepicker.regional['he'] = {
-		closeText: 'סגור',
-		prevText: '&#x3c;הקוד�',
-		nextText: 'הב�&#x3e;',
-		currentText: 'היו�',
-		monthNames: ['ינו�ר','פברו�ר','מרץ','�פריל','מ�י','יוני',
-		'יולי','�וגוסט','ספטמבר','�וקטובר','נובמבר','דצמבר'],
-		monthNamesShort: ['1','2','3','4','5','6',
-		'7','8','9','10','11','12'],
-		dayNames: ['ר�שון','שני','שלישי','רביעי','חמישי','שישי','שבת'],
-		dayNamesShort: ['�\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
-		dayNamesMin: ['�\'','ב\'','ג\'','ד\'','ה\'','ו\'','שבת'],
-		weekHeader: 'Wk',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: true,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['he']);
-});
diff --git a/ui/i18n/ui.datepicker-hr.js b/ui/i18n/ui.datepicker-hr.js
deleted file mode 100644
index 0285c1aa9..000000000
--- a/ui/i18n/ui.datepicker-hr.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Croatian i18n for the jQuery UI date picker plugin. */
-/* Written by Vjekoslav Nesek. */
-jQuery(function($){
-	$.datepicker.regional['hr'] = {
-		closeText: 'Zatvori',
-		prevText: '&#x3c;',
-		nextText: '&#x3e;',
-		currentText: 'Danas',
-		monthNames: ['Sije�anj','Velja�a','Ožujak','Travanj','Svibanj','Lipanj',
-		'Srpanj','Kolovoz','Rujan','Listopad','Studeni','Prosinac'],
-		monthNamesShort: ['Sij','Velj','Ožu','Tra','Svi','Lip',
-		'Srp','Kol','Ruj','Lis','Stu','Pro'],
-		dayNames: ['Nedjelja','Ponedjeljak','Utorak','Srijeda','ÄŒetvrtak','Petak','Subota'],
-		dayNamesShort: ['Ned','Pon','Uto','Sri','ÄŒet','Pet','Sub'],
-		dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
-		weekHeader: 'Tje',
-		dateFormat: 'dd.mm.yy.',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['hr']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-hu.js b/ui/i18n/ui.datepicker-hu.js
deleted file mode 100644
index 249e7b0ef..000000000
--- a/ui/i18n/ui.datepicker-hu.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Hungarian initialisation for the jQuery UI date picker plugin. */
-/* Written by Istvan Karaszi (jquery@spam.raszi.hu). */
-jQuery(function($){
-	$.datepicker.regional['hu'] = {
-		closeText: 'bezárás',
-		prevText: '&laquo;&nbsp;vissza',
-		nextText: 'előre&nbsp;&raquo;',
-		currentText: 'ma',
-		monthNames: ['Január', 'Február', 'Március', '�prilis', 'Május', 'Június',
-		'Július', 'Augusztus', 'Szeptember', 'Október', 'November', 'December'],
-		monthNamesShort: ['Jan', 'Feb', 'Már', '�pr', 'Máj', 'Jún',
-		'Júl', 'Aug', 'Szep', 'Okt', 'Nov', 'Dec'],
-		dayNames: ['Vasárnap', 'Hétfö', 'Kedd', 'Szerda', 'Csütörtök', 'Péntek', 'Szombat'],
-		dayNamesShort: ['Vas', 'Hét', 'Ked', 'Sze', 'Csü', 'Pén', 'Szo'],
-		dayNamesMin: ['V', 'H', 'K', 'Sze', 'Cs', 'P', 'Szo'],
-		weekHeader: 'Hé',
-		dateFormat: 'yy-mm-dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['hu']);
-});
diff --git a/ui/i18n/ui.datepicker-hy.js b/ui/i18n/ui.datepicker-hy.js
deleted file mode 100644
index c6cc1946c..000000000
--- a/ui/i18n/ui.datepicker-hy.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Armenian(UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Levon Zakaryan (levon.zakaryan@gmail.com)*/
-jQuery(function($){
-	$.datepicker.regional['hy'] = {
-		closeText: 'Õ“Õ¡Õ¯Õ¥Õ¬',
-		prevText: '&#x3c;Õ†Õ¡Õ­.',
-		nextText: 'Õ€Õ¡Õ».&#x3e;',
-		currentText: 'Ô±ÕµÕ½Ö…Ö€',
-		monthNames: ['Õ€Õ¸Ö‚Õ¶Õ¾Õ¡Ö€','Õ“Õ¥Õ¿Ö€Õ¾Õ¡Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€Õ«Õ¬','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
-		'Õ€Õ¸Ö‚Õ¬Õ«Õ½','Õ•Õ£Õ¸Õ½Õ¿Õ¸Õ½','Õ�Õ¥ÕºÕ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ€Õ¸Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€','Õ†Õ¸ÕµÕ¥Õ´Õ¢Õ¥Ö€','Ô´Õ¥Õ¯Õ¿Õ¥Õ´Õ¢Õ¥Ö€'],
-		monthNamesShort: ['Õ€Õ¸Ö‚Õ¶Õ¾','Õ“Õ¥Õ¿Ö€','Õ„Õ¡Ö€Õ¿','Ô±ÕºÖ€','Õ„Õ¡ÕµÕ«Õ½','Õ€Õ¸Ö‚Õ¶Õ«Õ½',
-		'Õ€Õ¸Ö‚Õ¬','Õ•Õ£Õ½','Õ�Õ¥Õº','Õ€Õ¸Õ¯','Õ†Õ¸Õµ','Ô´Õ¥Õ¯'],
-		dayNames: ['Õ¯Õ«Ö€Õ¡Õ¯Õ«','Õ¥Õ¯Õ¸Ö‚Õ·Õ¡Õ¢Õ©Õ«','Õ¥Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ¹Õ¸Ö€Õ¥Ö„Õ·Õ¡Õ¢Õ©Õ«','Õ°Õ«Õ¶Õ£Õ·Õ¡Õ¢Õ©Õ«','Õ¸Ö‚Ö€Õ¢Õ¡Õ©','Õ·Õ¡Õ¢Õ¡Õ©'],
-		dayNamesShort: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
-		dayNamesMin: ['Õ¯Õ«Ö€','Õ¥Ö€Õ¯','Õ¥Ö€Ö„','Õ¹Ö€Ö„','Õ°Õ¶Õ£','Õ¸Ö‚Ö€Õ¢','Õ·Õ¢Õ©'],
-		weekHeader: 'Õ‡Ô²Õ�',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['hy']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-id.js b/ui/i18n/ui.datepicker-id.js
deleted file mode 100644
index c626fbb7b..000000000
--- a/ui/i18n/ui.datepicker-id.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Indonesian initialisation for the jQuery UI date picker plugin. */
-/* Written by Deden Fathurahman (dedenf@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['id'] = {
-		closeText: 'Tutup',
-		prevText: '&#x3c;mundur',
-		nextText: 'maju&#x3e;',
-		currentText: 'hari ini',
-		monthNames: ['Januari','Februari','Maret','April','Mei','Juni',
-		'Juli','Agustus','September','Oktober','Nopember','Desember'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Mei','Jun',
-		'Jul','Agus','Sep','Okt','Nop','Des'],
-		dayNames: ['Minggu','Senin','Selasa','Rabu','Kamis','Jumat','Sabtu'],
-		dayNamesShort: ['Min','Sen','Sel','Rab','kam','Jum','Sab'],
-		dayNamesMin: ['Mg','Sn','Sl','Rb','Km','jm','Sb'],
-		weekHeader: 'Mg',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['id']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-is.js b/ui/i18n/ui.datepicker-is.js
deleted file mode 100644
index c53235a49..000000000
--- a/ui/i18n/ui.datepicker-is.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Icelandic initialisation for the jQuery UI date picker plugin. */
-/* Written by Haukur H. Thorsson (haukur@eskill.is). */
-jQuery(function($){
-	$.datepicker.regional['is'] = {
-		closeText: 'Loka',
-		prevText: '&#x3c; Fyrri',
-		nextText: 'N&aelig;sti &#x3e;',
-		currentText: '&Iacute; dag',
-		monthNames: ['Jan&uacute;ar','Febr&uacute;ar','Mars','Apr&iacute;l','Ma&iacute','J&uacute;n&iacute;',
-		'J&uacute;l&iacute;','&Aacute;g&uacute;st','September','Okt&oacute;ber','N&oacute;vember','Desember'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Ma&iacute;','J&uacute;n',
-		'J&uacute;l','&Aacute;g&uacute;','Sep','Okt','N&oacute;v','Des'],
-		dayNames: ['Sunnudagur','M&aacute;nudagur','&THORN;ri&eth;judagur','Mi&eth;vikudagur','Fimmtudagur','F&ouml;studagur','Laugardagur'],
-		dayNamesShort: ['Sun','M&aacute;n','&THORN;ri','Mi&eth;','Fim','F&ouml;s','Lau'],
-		dayNamesMin: ['Su','M&aacute;','&THORN;r','Mi','Fi','F&ouml;','La'],
-		weekHeader: 'Vika',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['is']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-it.js b/ui/i18n/ui.datepicker-it.js
deleted file mode 100644
index 59da2df67..000000000
--- a/ui/i18n/ui.datepicker-it.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Italian initialisation for the jQuery UI date picker plugin. */
-/* Written by Antonello Pasella (antonello.pasella@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['it'] = {
-		closeText: 'Chiudi',
-		prevText: '&#x3c;Prec',
-		nextText: 'Succ&#x3e;',
-		currentText: 'Oggi',
-		monthNames: ['Gennaio','Febbraio','Marzo','Aprile','Maggio','Giugno',
-			'Luglio','Agosto','Settembre','Ottobre','Novembre','Dicembre'],
-		monthNamesShort: ['Gen','Feb','Mar','Apr','Mag','Giu',
-			'Lug','Ago','Set','Ott','Nov','Dic'],
-		dayNames: ['Domenica','Luned&#236','Marted&#236','Mercoled&#236','Gioved&#236','Venerd&#236','Sabato'],
-		dayNamesShort: ['Dom','Lun','Mar','Mer','Gio','Ven','Sab'],
-		dayNamesMin: ['Do','Lu','Ma','Me','Gi','Ve','Sa'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['it']);
-});
diff --git a/ui/i18n/ui.datepicker-ja.js b/ui/i18n/ui.datepicker-ja.js
deleted file mode 100644
index 79cd827c7..000000000
--- a/ui/i18n/ui.datepicker-ja.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Japanese initialisation for the jQuery UI date picker plugin. */
-/* Written by Kentaro SATO (kentaro@ranvis.com). */
-jQuery(function($){
-	$.datepicker.regional['ja'] = {
-		closeText: '閉�る',
-		prevText: '&#x3c;�',
-		nextText: '次&#x3e;',
-		currentText: '今日',
-		monthNames: ['1月','2月','3月','4月','5月','6月',
-		'7月','8月','9月','10月','11月','12月'],
-		monthNamesShort: ['1月','2月','3月','4月','5月','6月',
-		'7月','8月','9月','10月','11月','12月'],
-		dayNames: ['日曜日','月曜日','�曜日','水曜日','木曜日','金曜日','土曜日'],
-		dayNamesShort: ['日','月','�','水','木','金','土'],
-		dayNamesMin: ['日','月','�','水','木','金','土'],
-		weekHeader: '週',
-		dateFormat: 'yy/mm/dd',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: true,
-		yearSuffix: 'å¹´'};
-	$.datepicker.setDefaults($.datepicker.regional['ja']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-ko.js b/ui/i18n/ui.datepicker-ko.js
deleted file mode 100644
index 5b3531652..000000000
--- a/ui/i18n/ui.datepicker-ko.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Korean initialisation for the jQuery calendar extension. */
-/* Written by DaeKwon Kang (ncrash.dk@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['ko'] = {
-		closeText: '닫기',
-		prevText: '�전달',
-		nextText: '다�달',
-		currentText: '오늘',
-		monthNames: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
-		'7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
-		monthNamesShort: ['1ì›”(JAN)','2ì›”(FEB)','3ì›”(MAR)','4ì›”(APR)','5ì›”(MAY)','6ì›”(JUN)',
-		'7ì›”(JUL)','8ì›”(AUG)','9ì›”(SEP)','10ì›”(OCT)','11ì›”(NOV)','12ì›”(DEC)'],
-		dayNames: ['�','월','화','수','목','금','토'],
-		dayNamesShort: ['�','월','화','수','목','금','토'],
-		dayNamesMin: ['�','월','화','수','목','금','토'],
-		weekHeader: 'Wk',
-		dateFormat: 'yy-mm-dd',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: 'ë…„'};
-	$.datepicker.setDefaults($.datepicker.regional['ko']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-lt.js b/ui/i18n/ui.datepicker-lt.js
deleted file mode 100644
index 67d5119ca..000000000
--- a/ui/i18n/ui.datepicker-lt.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Lithuanian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* @author Arturas Paleicikas <arturas@avalon.lt> */
-jQuery(function($){
-	$.datepicker.regional['lt'] = {
-		closeText: 'Uždaryti',
-		prevText: '&#x3c;Atgal',
-		nextText: 'Pirmyn&#x3e;',
-		currentText: 'Å iandien',
-		monthNames: ['Sausis','Vasaris','Kovas','Balandis','Gegužė','Birželis',
-		'Liepa','Rugpjūtis','Rugsėjis','Spalis','Lapkritis','Gruodis'],
-		monthNamesShort: ['Sau','Vas','Kov','Bal','Geg','Bir',
-		'Lie','Rugp','Rugs','Spa','Lap','Gru'],
-		dayNames: ['sekmadienis','pirmadienis','antradienis','tre�iadienis','ketvirtadienis','penktadienis','šeštadienis'],
-		dayNamesShort: ['sek','pir','ant','tre','ket','pen','šeš'],
-		dayNamesMin: ['Se','Pr','An','Tr','Ke','Pe','Å e'],
-		weekHeader: 'Wk',
-		dateFormat: 'yy-mm-dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['lt']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-lv.js b/ui/i18n/ui.datepicker-lv.js
deleted file mode 100644
index 003934e72..000000000
--- a/ui/i18n/ui.datepicker-lv.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Latvian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* @author Arturas Paleicikas <arturas.paleicikas@metasite.net> */
-jQuery(function($){
-	$.datepicker.regional['lv'] = {
-		closeText: 'Aizvērt',
-		prevText: 'Iepr',
-		nextText: 'N�ka',
-		currentText: 'Å odien',
-		monthNames: ['Janv�ris','Febru�ris','Marts','Aprīlis','Maijs','Jūnijs',
-		'JÅ«lijs','Augusts','Septembris','Oktobris','Novembris','Decembris'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','JÅ«n',
-		'JÅ«l','Aug','Sep','Okt','Nov','Dec'],
-		dayNames: ['svētdiena','pirmdiena','otrdiena','trešdiena','ceturtdiena','piektdiena','sestdiena'],
-		dayNamesShort: ['svt','prm','otr','tre','ctr','pkt','sst'],
-		dayNamesMin: ['Sv','Pr','Ot','Tr','Ct','Pk','Ss'],
-		weekHeader: 'Nav',
-		dateFormat: 'dd-mm-yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['lv']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-ms.js b/ui/i18n/ui.datepicker-ms.js
deleted file mode 100644
index e953ac04f..000000000
--- a/ui/i18n/ui.datepicker-ms.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Malaysian initialisation for the jQuery UI date picker plugin. */
-/* Written by Mohd Nawawi Mohamad Jamili (nawawi@ronggeng.net). */
-jQuery(function($){
-	$.datepicker.regional['ms'] = {
-		closeText: 'Tutup',
-		prevText: '&#x3c;Sebelum',
-		nextText: 'Selepas&#x3e;',
-		currentText: 'hari ini',
-		monthNames: ['Januari','Februari','Mac','April','Mei','Jun',
-		'Julai','Ogos','September','Oktober','November','Disember'],
-		monthNamesShort: ['Jan','Feb','Mac','Apr','Mei','Jun',
-		'Jul','Ogo','Sep','Okt','Nov','Dis'],
-		dayNames: ['Ahad','Isnin','Selasa','Rabu','Khamis','Jumaat','Sabtu'],
-		dayNamesShort: ['Aha','Isn','Sel','Rab','kha','Jum','Sab'],
-		dayNamesMin: ['Ah','Is','Se','Ra','Kh','Ju','Sa'],
-		weekHeader: 'Mg',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['ms']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-nl.js b/ui/i18n/ui.datepicker-nl.js
deleted file mode 100644
index 663d6bb26..000000000
--- a/ui/i18n/ui.datepicker-nl.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Dutch (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Mathias Bynens <http://mathiasbynens.be/> */
-jQuery(function($){
-	$.datepicker.regional.nl = {
-		closeText: 'Sluiten',
-		prevText: '�',
-		nextText: '→',
-		currentText: 'Vandaag',
-		monthNames: ['januari', 'februari', 'maart', 'april', 'mei', 'juni',
-		'juli', 'augustus', 'september', 'oktober', 'november', 'december'],
-		monthNamesShort: ['jan', 'feb', 'maa', 'apr', 'mei', 'jun',
-		'jul', 'aug', 'sep', 'okt', 'nov', 'dec'],
-		dayNames: ['zondag', 'maandag', 'dinsdag', 'woensdag', 'donderdag', 'vrijdag', 'zaterdag'],
-		dayNamesShort: ['zon', 'maa', 'din', 'woe', 'don', 'vri', 'zat'],
-		dayNamesMin: ['zo', 'ma', 'di', 'wo', 'do', 'vr', 'za'],
-		weekHeader: 'Wk',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional.nl);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-no.js b/ui/i18n/ui.datepicker-no.js
deleted file mode 100644
index 12b2356bf..000000000
--- a/ui/i18n/ui.datepicker-no.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Norwegian initialisation for the jQuery UI date picker plugin. */
-/* Written by Naimdjon Takhirov (naimdjon@gmail.com). */
-jQuery(function($){
-    $.datepicker.regional['no'] = {
-		closeText: 'Lukk',
-        prevText: '&laquo;Forrige',
-		nextText: 'Neste&raquo;',
-		currentText: 'I dag',
-        monthNames: ['Januar','Februar','Mars','April','Mai','Juni',
-        'Juli','August','September','Oktober','November','Desember'],
-        monthNamesShort: ['Jan','Feb','Mar','Apr','Mai','Jun',
-        'Jul','Aug','Sep','Okt','Nov','Des'],
-		dayNamesShort: ['Søn','Man','Tir','Ons','Tor','Fre','Lør'],
-		dayNames: ['Søndag','Mandag','Tirsdag','Onsdag','Torsdag','Fredag','Lørdag'],
-		dayNamesMin: ['Sø','Ma','Ti','On','To','Fr','Lø'],
-		weekHeader: 'Uke',
-        dateFormat: 'yy-mm-dd',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-    $.datepicker.setDefaults($.datepicker.regional['no']);
-});
diff --git a/ui/i18n/ui.datepicker-pl.js b/ui/i18n/ui.datepicker-pl.js
deleted file mode 100644
index 2d2d4d765..000000000
--- a/ui/i18n/ui.datepicker-pl.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Polish initialisation for the jQuery UI date picker plugin. */
-/* Written by Jacek Wysocki (jacek.wysocki@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['pl'] = {
-		closeText: 'Zamknij',
-		prevText: '&#x3c;Poprzedni',
-		nextText: 'Następny&#x3e;',
-		currentText: 'DziÅ›',
-		monthNames: ['Styczeń','Luty','Marzec','Kwiecień','Maj','Czerwiec',
-		'Lipiec','Sierpień','Wrzesień','Październik','Listopad','Grudzień'],
-		monthNamesShort: ['Sty','Lu','Mar','Kw','Maj','Cze',
-		'Lip','Sie','Wrz','Pa','Lis','Gru'],
-		dayNames: ['Niedziela','Poniedzialek','Wtorek','Åšroda','Czwartek','PiÄ…tek','Sobota'],
-		dayNamesShort: ['Nie','Pn','Wt','Åšr','Czw','Pt','So'],
-		dayNamesMin: ['N','Pn','Wt','Åšr','Cz','Pt','So'],
-		weekHeader: 'Tydz',
-		dateFormat: 'yy-mm-dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['pl']);
-});
diff --git a/ui/i18n/ui.datepicker-pt-BR.js b/ui/i18n/ui.datepicker-pt-BR.js
deleted file mode 100644
index 38818637d..000000000
--- a/ui/i18n/ui.datepicker-pt-BR.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Brazilian initialisation for the jQuery UI date picker plugin. */
-/* Written by Leonildo Costa Silva (leocsilva@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['pt-BR'] = {
-		closeText: 'Fechar',
-		prevText: '&#x3c;Anterior',
-		nextText: 'Pr&oacute;ximo&#x3e;',
-		currentText: 'Hoje',
-		monthNames: ['Janeiro','Fevereiro','Mar&ccedil;o','Abril','Maio','Junho',
-		'Julho','Agosto','Setembro','Outubro','Novembro','Dezembro'],
-		monthNamesShort: ['Jan','Fev','Mar','Abr','Mai','Jun',
-		'Jul','Ago','Set','Out','Nov','Dez'],
-		dayNames: ['Domingo','Segunda-feira','Ter&ccedil;a-feira','Quarta-feira','Quinta-feira','Sexta-feira','Sabado'],
-		dayNamesShort: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
-		dayNamesMin: ['Dom','Seg','Ter','Qua','Qui','Sex','Sab'],
-		weekHeader: 'Sm',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['pt-BR']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-ro.js b/ui/i18n/ui.datepicker-ro.js
deleted file mode 100644
index acb2e4499..000000000
--- a/ui/i18n/ui.datepicker-ro.js
+++ /dev/null
@@ -1,26 +0,0 @@
-/* Romanian initialisation for the jQuery UI date picker plugin.
- *
- * Written by Edmond L. (ll_edmond@walla.com)
- * and Ionut G. Stan (ionut.g.stan@gmail.com)
- */
-jQuery(function($){
-	$.datepicker.regional['ro'] = {
-		closeText: 'ÃŽnchide',
-		prevText: '&laquo; Luna precedentă',
-		nextText: 'Luna următoare &raquo;',
-		currentText: 'Azi',
-		monthNames: ['Ianuarie','Februarie','Martie','Aprilie','Mai','Iunie',
-		'Iulie','August','Septembrie','Octombrie','Noiembrie','Decembrie'],
-		monthNamesShort: ['Ian', 'Feb', 'Mar', 'Apr', 'Mai', 'Iun',
-		'Iul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'],
-		dayNames: ['Duminică', 'Luni', 'Marţi', 'Miercuri', 'Joi', 'Vineri', 'Sâmbătă'],
-		dayNamesShort: ['Dum', 'Lun', 'Mar', 'Mie', 'Joi', 'Vin', 'Sâm'],
-		dayNamesMin: ['Du','Lu','Ma','Mi','Jo','Vi','Sâ'],
-		weekHeader: 'Sapt',
-		dateFormat: 'dd MM yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['ro']);
-});
diff --git a/ui/i18n/ui.datepicker-ru.js b/ui/i18n/ui.datepicker-ru.js
deleted file mode 100644
index b8091f9ec..000000000
--- a/ui/i18n/ui.datepicker-ru.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Russian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Andrew Stromnov (stromnov@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['ru'] = {
-		closeText: 'Закрыть',
-		prevText: '&#x3c;Пред',
-		nextText: 'След&#x3e;',
-		currentText: 'Сегодн�',
-		monthNames: ['Январь','Февраль','Март','�прель','Май','Июнь',
-		'Июль','�вгу�т','Сент�брь','Окт�брь','�о�брь','Декабрь'],
-		monthNamesShort: ['Янв','Фев','Мар','�пр','Май','Июн',
-		'Июл','�вг','Сен','Окт','�о�','Дек'],
-		dayNames: ['во�кре�енье','понедельник','вторник','�реда','четверг','п�тница','�уббота'],
-		dayNamesShort: ['в�к','пнд','втр','�рд','чтв','птн','�бт'],
-		dayNamesMin: ['В�','Пн','Вт','Ср','Чт','Пт','Сб'],
-		weekHeader: '�е',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['ru']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-sk.js b/ui/i18n/ui.datepicker-sk.js
deleted file mode 100644
index e8e73e671..000000000
--- a/ui/i18n/ui.datepicker-sk.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Slovak initialisation for the jQuery UI date picker plugin. */
-/* Written by Vojtech Rinik (vojto@hmm.sk). */
-jQuery(function($){
-	$.datepicker.regional['sk'] = {
-		closeText: 'Zavrieť',
-		prevText: '&#x3c;Predchádzajúci',
-		nextText: 'Nasledujúci&#x3e;',
-		currentText: 'Dnes',
-		monthNames: ['Január','Február','Marec','Apríl','Máj','Jún',
-		'Júl','August','September','Október','November','December'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Máj','Jún',
-		'Júl','Aug','Sep','Okt','Nov','Dec'],
-		dayNames: ['Nedel\'a','Pondelok','Utorok','Streda','Å tvrtok','Piatok','Sobota'],
-		dayNamesShort: ['Ned','Pon','Uto','Str','Å tv','Pia','Sob'],
-		dayNamesMin: ['Ne','Po','Ut','St','Å t','Pia','So'],
-		weekHeader: 'Ty',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['sk']);
-});
diff --git a/ui/i18n/ui.datepicker-sl.js b/ui/i18n/ui.datepicker-sl.js
deleted file mode 100644
index 516550192..000000000
--- a/ui/i18n/ui.datepicker-sl.js
+++ /dev/null
@@ -1,24 +0,0 @@
-/* Slovenian initialisation for the jQuery UI date picker plugin. */
-/* Written by Jaka Jancar (jaka@kubje.org). */
-/* c = &#x10D;, s = &#x161; z = &#x17E; C = &#x10C; S = &#x160; Z = &#x17D; */
-jQuery(function($){
-	$.datepicker.regional['sl'] = {
-		closeText: 'Zapri',
-		prevText: '&lt;Prej&#x161;nji',
-		nextText: 'Naslednji&gt;',
-		currentText: 'Trenutni',
-		monthNames: ['Januar','Februar','Marec','April','Maj','Junij',
-		'Julij','Avgust','September','Oktober','November','December'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
-		'Jul','Avg','Sep','Okt','Nov','Dec'],
-		dayNames: ['Nedelja','Ponedeljek','Torek','Sreda','&#x10C;etrtek','Petek','Sobota'],
-		dayNamesShort: ['Ned','Pon','Tor','Sre','&#x10C;et','Pet','Sob'],
-		dayNamesMin: ['Ne','Po','To','Sr','&#x10C;e','Pe','So'],
-		weekHeader: 'Teden',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['sl']);
-});
diff --git a/ui/i18n/ui.datepicker-sq.js b/ui/i18n/ui.datepicker-sq.js
deleted file mode 100644
index be84104c0..000000000
--- a/ui/i18n/ui.datepicker-sq.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Albanian initialisation for the jQuery UI date picker plugin. */
-/* Written by Flakron Bytyqi (flakron@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['sq'] = {
-		closeText: 'mbylle',
-		prevText: '&#x3c;mbrapa',
-		nextText: 'Përpara&#x3e;',
-		currentText: 'sot',
-		monthNames: ['Janar','Shkurt','Mars','Prill','Maj','Qershor',
-		'Korrik','Gusht','Shtator','Tetor','Nëntor','Dhjetor'],
-		monthNamesShort: ['Jan','Shk','Mar','Pri','Maj','Qer',
-		'Kor','Gus','Sht','Tet','Nën','Dhj'],
-		dayNames: ['E Diel','E Hënë','E Martë','E Mërkurë','E Enjte','E Premte','E Shtune'],
-		dayNamesShort: ['Di','Hë','Ma','Më','En','Pr','Sh'],
-		dayNamesMin: ['Di','Hë','Ma','Më','En','Pr','Sh'],
-		weekHeader: 'Ja',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['sq']);
-});
diff --git a/ui/i18n/ui.datepicker-sr-SR.js b/ui/i18n/ui.datepicker-sr-SR.js
deleted file mode 100644
index ac779dd18..000000000
--- a/ui/i18n/ui.datepicker-sr-SR.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Serbian i18n for the jQuery UI date picker plugin. */
-/* Written by Dejan Dimić. */
-jQuery(function($){
-	$.datepicker.regional['sr-SR'] = {
-		closeText: 'Zatvori',
-		prevText: '&#x3c;',
-		nextText: '&#x3e;',
-		currentText: 'Danas',
-		monthNames: ['Januar','Februar','Mart','April','Maj','Jun',
-		'Jul','Avgust','Septembar','Oktobar','Novembar','Decembar'],
-		monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
-		'Jul','Avg','Sep','Okt','Nov','Dec'],
-		dayNames: ['Nedelja','Ponedeljak','Utorak','Sreda','ÄŒetvrtak','Petak','Subota'],
-		dayNamesShort: ['Ned','Pon','Uto','Sre','ÄŒet','Pet','Sub'],
-		dayNamesMin: ['Ne','Po','Ut','Sr','ÄŒe','Pe','Su'],
-		weekHeader: 'Sed',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['sr-SR']);
-});
diff --git a/ui/i18n/ui.datepicker-sr.js b/ui/i18n/ui.datepicker-sr.js
deleted file mode 100644
index b82964859..000000000
--- a/ui/i18n/ui.datepicker-sr.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Serbian i18n for the jQuery UI date picker plugin. */
-/* Written by Dejan Dimić. */
-jQuery(function($){
-	$.datepicker.regional['sr'] = {
-		closeText: 'Затвори',
-		prevText: '&#x3c;',
-		nextText: '&#x3e;',
-		currentText: 'Дана�',
-		monthNames: ['Јануар','Фебруар','Март','�прил','Мај','Јун',
-		'Јул','�вгу�т','Септембар','Октобар','�овембар','Децембар'],
-		monthNamesShort: ['Јан','Феб','Мар','�пр','Мај','Јун',
-		'Јул','�вг','Сеп','Окт','�ов','Дец'],
-		dayNames: ['�едеља','Понедељак','Уторак','Среда','Четвртак','Петак','Субота'],
-		dayNamesShort: ['�ед','Пон','Уто','Сре','Чет','Пет','Суб'],
-		dayNamesMin: ['�е','По','Ут','Ср','Че','Пе','Су'],
-		weekHeader: 'Сед',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['sr']);
-});
diff --git a/ui/i18n/ui.datepicker-sv.js b/ui/i18n/ui.datepicker-sv.js
deleted file mode 100644
index 8236b62b5..000000000
--- a/ui/i18n/ui.datepicker-sv.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Swedish initialisation for the jQuery UI date picker plugin. */
-/* Written by Anders Ekdahl ( anders@nomadiz.se). */
-jQuery(function($){
-    $.datepicker.regional['sv'] = {
-		closeText: 'Stäng',
-        prevText: '&laquo;Förra',
-		nextText: 'Nästa&raquo;',
-		currentText: 'Idag',
-        monthNames: ['Januari','Februari','Mars','April','Maj','Juni',
-        'Juli','Augusti','September','Oktober','November','December'],
-        monthNamesShort: ['Jan','Feb','Mar','Apr','Maj','Jun',
-        'Jul','Aug','Sep','Okt','Nov','Dec'],
-		dayNamesShort: ['Sön','Mån','Tis','Ons','Tor','Fre','Lör'],
-		dayNames: ['Söndag','Måndag','Tisdag','Onsdag','Torsdag','Fredag','Lördag'],
-		dayNamesMin: ['Sö','Må','Ti','On','To','Fr','Lö'],
-		weekHeader: 'Ve',
-        dateFormat: 'yy-mm-dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-    $.datepicker.setDefaults($.datepicker.regional['sv']);
-});
diff --git a/ui/i18n/ui.datepicker-th.js b/ui/i18n/ui.datepicker-th.js
deleted file mode 100644
index 978500ab1..000000000
--- a/ui/i18n/ui.datepicker-th.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Thai initialisation for the jQuery UI date picker plugin. */
-/* Written by pipo (pipo@sixhead.com). */
-jQuery(function($){
-	$.datepicker.regional['th'] = {
-		closeText: 'ปิด',
-		prevText: '&laquo;&nbsp;ย้อน',
-		nextText: 'ถัดไป&nbsp;&raquo;',
-		currentText: 'วันนี้',
-		monthNames: ['ม�ราคม','�ุมภาพันธ์','มีนาคม','เมษายน','พฤษภาคม','มิถุนายน',
-		'�ร��าคม','สิงหาคม','�ันยายน','ตุลาคม','พฤศจิ�ายน','ธันวาคม'],
-		monthNamesShort: ['ม.ค.','�.พ.','มี.ค.','เม.ย.','พ.ค.','มิ.ย.',
-		'�.ค.','ส.ค.','�.ย.','ต.ค.','พ.ย.','ธ.ค.'],
-		dayNames: ['อาทิตย์','จันทร์','อังคาร','พุธ','พฤหัสบดี','ศุ�ร์','เสาร์'],
-		dayNamesShort: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
-		dayNamesMin: ['อา.','จ.','อ.','พ.','พฤ.','ศ.','ส.'],
-		weekHeader: 'Wk',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['th']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-tr.js b/ui/i18n/ui.datepicker-tr.js
deleted file mode 100644
index dedfc7ff9..000000000
--- a/ui/i18n/ui.datepicker-tr.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Turkish initialisation for the jQuery UI date picker plugin. */
-/* Written by Izzet Emre Erkan (kara@karalamalar.net). */
-jQuery(function($){
-	$.datepicker.regional['tr'] = {
-		closeText: 'kapat',
-		prevText: '&#x3c;geri',
-		nextText: 'ileri&#x3e',
-		currentText: 'bugün',
-		monthNames: ['Ocak','Şubat','Mart','Nisan','Mayıs','Haziran',
-		'Temmuz','Ağustos','Eylül','Ekim','Kasım','Aralık'],
-		monthNamesShort: ['Oca','Åžub','Mar','Nis','May','Haz',
-		'Tem','AÄŸu','Eyl','Eki','Kas','Ara'],
-		dayNames: ['Pazar','Pazartesi','Salı','Çarşamba','Perşembe','Cuma','Cumartesi'],
-		dayNamesShort: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
-		dayNamesMin: ['Pz','Pt','Sa','Ça','Pe','Cu','Ct'],
-		weekHeader: 'Hf',
-		dateFormat: 'dd.mm.yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['tr']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-uk.js b/ui/i18n/ui.datepicker-uk.js
deleted file mode 100644
index 112b40e7f..000000000
--- a/ui/i18n/ui.datepicker-uk.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Ukrainian (UTF-8) initialisation for the jQuery UI date picker plugin. */
-/* Written by Maxim Drogobitskiy (maxdao@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['uk'] = {
-		closeText: 'Закрити',
-		prevText: '&#x3c;',
-		nextText: '&#x3e;',
-		currentText: 'Сьогодні',
-		monthNames: ['Січень','Лютий','Березень','Квітень','Травень','Червень',
-		'Липень','Серпень','Вере�ень','Жовтень','Ли�топад','Грудень'],
-		monthNamesShort: ['Січ','Лют','Бер','Кві','Тра','Чер',
-		'Лип','Сер','Вер','Жов','Ли�','Гру'],
-		dayNames: ['неділ�','понеділок','вівторок','�ереда','четвер','п’�тниц�','�убота'],
-		dayNamesShort: ['нед','пнд','вів','�рд','чтв','птн','�бт'],
-		dayNamesMin: ['�д','Пн','Вт','Ср','Чт','Пт','Сб'],
-		weekHeader: '�е',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['uk']);
-});
\ No newline at end of file
diff --git a/ui/i18n/ui.datepicker-vi.js b/ui/i18n/ui.datepicker-vi.js
deleted file mode 100644
index fa97af5fa..000000000
--- a/ui/i18n/ui.datepicker-vi.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Vietnamese initialisation for the jQuery UI date picker plugin. */
-/* Translated by Le Thanh Huy (lthanhhuy@cit.ctu.edu.vn). */
-jQuery(function($){
-	$.datepicker.regional['vi'] = {
-		closeText: '�óng',
-		prevText: '&#x3c;TrÆ°á»›c',
-		nextText: 'Tiếp&#x3e;',
-		currentText: 'Hôm nay',
-		monthNames: ['Tháng Một', 'Tháng Hai', 'Tháng Ba', 'Tháng Tư', 'Tháng Năm', 'Tháng Sáu',
-		'Tháng Bảy', 'Tháng Tám', 'Tháng Chín', 'Tháng Mư�i', 'Tháng Mư�i Một', 'Tháng Mư�i Hai'],
-		monthNamesShort: ['Tháng 1', 'Tháng 2', 'Tháng 3', 'Tháng 4', 'Tháng 5', 'Tháng 6',
-		'Tháng 7', 'Tháng 8', 'Tháng 9', 'Tháng 10', 'Tháng 11', 'Tháng 12'],
-		dayNames: ['Chủ Nhật', 'Thứ Hai', 'Thứ Ba', 'Thứ Tư', 'Thứ Năm', 'Thứ Sáu', 'Thứ Bảy'],
-		dayNamesShort: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
-		dayNamesMin: ['CN', 'T2', 'T3', 'T4', 'T5', 'T6', 'T7'],
-		weekHeader: 'Tu',
-		dateFormat: 'dd/mm/yy',
-		firstDay: 0,
-		isRTL: false,
-		showMonthAfterYear: false,
-		yearSuffix: ''};
-	$.datepicker.setDefaults($.datepicker.regional['vi']);
-});
diff --git a/ui/i18n/ui.datepicker-zh-CN.js b/ui/i18n/ui.datepicker-zh-CN.js
deleted file mode 100644
index 6c4883f53..000000000
--- a/ui/i18n/ui.datepicker-zh-CN.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Chinese initialisation for the jQuery UI date picker plugin. */
-/* Written by Cloudream (cloudream@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['zh-CN'] = {
-		closeText: '关闭',
-		prevText: '&#x3c;上月',
-		nextText: '下月&#x3e;',
-		currentText: '今天',
-		monthNames: ['一月','二月','三月','四月','五月','六月',
-		'七月','八月','�月','�月','�一月','�二月'],
-		monthNamesShort: ['一','二','三','四','五','六',
-		'七','八','�','�','�一','�二'],
-		dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
-		dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
-		dayNamesMin: ['日','一','二','三','四','五','六'],
-		weekHeader: '周',
-		dateFormat: 'yy-mm-dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: true,
-		yearSuffix: 'å¹´'};
-	$.datepicker.setDefaults($.datepicker.regional['zh-CN']);
-});
diff --git a/ui/i18n/ui.datepicker-zh-TW.js b/ui/i18n/ui.datepicker-zh-TW.js
deleted file mode 100644
index d211573c6..000000000
--- a/ui/i18n/ui.datepicker-zh-TW.js
+++ /dev/null
@@ -1,23 +0,0 @@
-/* Chinese initialisation for the jQuery UI date picker plugin. */
-/* Written by Ressol (ressol@gmail.com). */
-jQuery(function($){
-	$.datepicker.regional['zh-TW'] = {
-		closeText: '關閉',
-		prevText: '&#x3c;上月',
-		nextText: '下月&#x3e;',
-		currentText: '今天',
-		monthNames: ['一月','二月','三月','四月','五月','六月',
-		'七月','八月','�月','�月','�一月','�二月'],
-		monthNamesShort: ['一','二','三','四','五','六',
-		'七','八','�','�','�一','�二'],
-		dayNames: ['星期日','星期一','星期二','星期三','星期四','星期五','星期六'],
-		dayNamesShort: ['周日','周一','周二','周三','周四','周五','周六'],
-		dayNamesMin: ['日','一','二','三','四','五','六'],
-		weekHeader: '周',
-		dateFormat: 'yy/mm/dd',
-		firstDay: 1,
-		isRTL: false,
-		showMonthAfterYear: true,
-		yearSuffix: 'å¹´'};
-	$.datepicker.setDefaults($.datepicker.regional['zh-TW']);
-});
diff --git a/ui/jquery.effects.blind.js b/ui/jquery.effects.blind.js
new file mode 100644
index 000000000..ec2ffc4c4
--- /dev/null
+++ b/ui/jquery.effects.blind.js
@@ -0,0 +1,49 @@
+/*
+ * jQuery UI Effects Blind @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Blind
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.blind = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+		var direction = o.options.direction || 'vertical'; // Default direction
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+		var ref = (direction == 'vertical') ? 'height' : 'width';
+		var distance = (direction == 'vertical') ? wrapper.height() : wrapper.width();
+		if(mode == 'show') wrapper.css(ref, 0); // Shift
+
+		// Animation
+		var animation = {};
+		animation[ref] = mode == 'show' ? distance : 0;
+
+		// Animate
+		wrapper.animate(animation, o.duration, o.options.easing, function() {
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(el[0], arguments); // Callback
+			el.dequeue();
+		});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.bounce.js b/ui/jquery.effects.bounce.js
new file mode 100644
index 000000000..617a9d29d
--- /dev/null
+++ b/ui/jquery.effects.bounce.js
@@ -0,0 +1,78 @@
+/*
+ * jQuery UI Effects Bounce @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Bounce
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.bounce = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+		var direction = o.options.direction || 'up'; // Default direction
+		var distance = o.options.distance || 20; // Default distance
+		var times = o.options.times || 5; // Default # of times
+		var speed = o.duration || 250; // Default speed per bounce
+		if (/show|hide/.test(mode)) props.push('opacity'); // Avoid touching opacity to prevent clearType and PNG issues in IE
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		$.effects.createWrapper(el); // Create Wrapper
+		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 3 : el.outerWidth({margin:true}) / 3);
+		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+		if (mode == 'hide') distance = distance / (times * 2);
+		if (mode != 'hide') times--;
+
+		// Animate
+		if (mode == 'show') { // Show Bounce
+			var animation = {opacity: 1};
+			animation[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+			el.animate(animation, speed / 2, o.options.easing);
+			distance = distance / 2;
+			times--;
+		};
+		for (var i = 0; i < times; i++) { // Bounces
+			var animation1 = {}, animation2 = {};
+			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing);
+			distance = (mode == 'hide') ? distance * 2 : distance / 2;
+		};
+		if (mode == 'hide') { // Last Bounce
+			var animation = {opacity: 0};
+			animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
+			el.animate(animation, speed / 2, o.options.easing, function(){
+				el.hide(); // Hide
+				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+				if(o.callback) o.callback.apply(this, arguments); // Callback
+			});
+		} else {
+			var animation1 = {}, animation2 = {};
+			animation1[ref] = (motion == 'pos' ? '-=' : '+=') + distance;
+			animation2[ref] = (motion == 'pos' ? '+=' : '-=') + distance;
+			el.animate(animation1, speed / 2, o.options.easing).animate(animation2, speed / 2, o.options.easing, function(){
+				$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+				if(o.callback) o.callback.apply(this, arguments); // Callback
+			});
+		};
+		el.queue('fx', function() { el.dequeue(); });
+		el.dequeue();
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.clip.js b/ui/jquery.effects.clip.js
new file mode 100644
index 000000000..81e456d24
--- /dev/null
+++ b/ui/jquery.effects.clip.js
@@ -0,0 +1,54 @@
+/*
+ * jQuery UI Effects Clip @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Clip
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.clip = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left','height','width'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+		var direction = o.options.direction || 'vertical'; // Default direction
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+		var animate = el[0].tagName == 'IMG' ? wrapper : el;
+		var ref = {
+			size: (direction == 'vertical') ? 'height' : 'width',
+			position: (direction == 'vertical') ? 'top' : 'left'
+		};
+		var distance = (direction == 'vertical') ? animate.height() : animate.width();
+		if(mode == 'show') { animate.css(ref.size, 0); animate.css(ref.position, distance / 2); } // Shift
+
+		// Animation
+		var animation = {};
+		animation[ref.size] = mode == 'show' ? distance : 0;
+		animation[ref.position] = mode == 'show' ? 0 : distance / 2;
+
+		// Animate
+		animate.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(el[0], arguments); // Callback
+			el.dequeue();
+		}});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.core.js b/ui/jquery.effects.core.js
new file mode 100644
index 000000000..e41d71441
--- /dev/null
+++ b/ui/jquery.effects.core.js
@@ -0,0 +1,581 @@
+/*
+ * jQuery UI Effects @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/
+ */
+;jQuery.effects || (function($) {
+
+$.effects = {
+	version: "@VERSION",
+
+	// Saves a set of properties in a data storage
+	save: function(element, set) {
+		for(var i=0; i < set.length; i++) {
+			if(set[i] !== null) element.data("ec.storage."+set[i], element[0].style[set[i]]);
+		}
+	},
+
+	// Restores a set of previously saved properties from a data storage
+	restore: function(element, set) {
+		for(var i=0; i < set.length; i++) {
+			if(set[i] !== null) element.css(set[i], element.data("ec.storage."+set[i]));
+		}
+	},
+
+	setMode: function(el, mode) {
+		if (mode == 'toggle') mode = el.is(':hidden') ? 'show' : 'hide'; // Set for toggle
+		return mode;
+	},
+
+	getBaseline: function(origin, original) { // Translates a [top,left] array into a baseline value
+		// this should be a little more flexible in the future to handle a string & hash
+		var y, x;
+		switch (origin[0]) {
+			case 'top': y = 0; break;
+			case 'middle': y = 0.5; break;
+			case 'bottom': y = 1; break;
+			default: y = origin[0] / original.height;
+		};
+		switch (origin[1]) {
+			case 'left': x = 0; break;
+			case 'center': x = 0.5; break;
+			case 'right': x = 1; break;
+			default: x = origin[1] / original.width;
+		};
+		return {x: x, y: y};
+	},
+
+	// Wraps the element around a wrapper that copies position properties
+	createWrapper: function(element) {
+
+		//if the element is already wrapped, return it
+		if (element.parent().is('.ui-effects-wrapper'))
+			return element.parent();
+
+		//Cache width,height and float properties of the element, and create a wrapper around it
+		var props = { width: element.outerWidth(true), height: element.outerHeight(true), 'float': element.css('float') };
+		element.wrap('<div class="ui-effects-wrapper" style="font-size:100%;background:transparent;border:none;margin:0;padding:0"></div>');
+		var wrapper = element.parent();
+
+		//Transfer the positioning of the element to the wrapper
+		if (element.css('position') == 'static') {
+			wrapper.css({ position: 'relative' });
+			element.css({ position: 'relative'} );
+		} else {
+			var top = element.css('top'); if(isNaN(parseInt(top,10))) top = 'auto';
+			var left = element.css('left'); if(isNaN(parseInt(left,10))) left = 'auto';
+			wrapper.css({ position: element.css('position'), top: top, left: left, zIndex: element.css('z-index') }).show();
+			element.css({position: 'relative', top: 0, left: 0 });
+		}
+
+		wrapper.css(props);
+		return wrapper;
+	},
+
+	removeWrapper: function(element) {
+		if (element.parent().is('.ui-effects-wrapper'))
+			return element.parent().replaceWith(element);
+		return element;
+	},
+
+	setTransition: function(element, list, factor, value) {
+		value = value || {};
+		$.each(list, function(i, x){
+			unit = element.cssUnit(x);
+			if (unit[0] > 0) value[x] = unit[0] * factor + unit[1];
+		});
+		return value;
+	},
+
+	//Base function to animate from one class to another in a seamless transition
+	animateClass: function(value, duration, easing, callback) {
+
+		var cb = (typeof easing == "function" ? easing : (callback ? callback : null));
+		var ea = (typeof easing == "string" ? easing : null);
+
+		return this.each(function() {
+
+			var offset = {}; var that = $(this); var oldStyleAttr = that.attr("style") || '';
+			if(typeof oldStyleAttr == 'object') oldStyleAttr = oldStyleAttr["cssText"]; /* Stupidly in IE, style is a object.. */
+			if(value.toggle) { that.hasClass(value.toggle) ? value.remove = value.toggle : value.add = value.toggle; }
+
+			//Let's get a style offset
+			var oldStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+			if(value.add) that.addClass(value.add); if(value.remove) that.removeClass(value.remove);
+			var newStyle = $.extend({}, (document.defaultView ? document.defaultView.getComputedStyle(this,null) : this.currentStyle));
+			if(value.add) that.removeClass(value.add); if(value.remove) that.addClass(value.remove);
+
+			// The main function to form the object for animation
+			for(var n in newStyle) {
+				if( typeof newStyle[n] != "function" && newStyle[n] /* No functions and null properties */
+				&& n.indexOf("Moz") == -1 && n.indexOf("length") == -1 /* No mozilla spezific render properties. */
+				&& n.indexOf("scrollbar") == -1 /* No scrollbar properties - causes problems in IE */
+				&& newStyle[n] != oldStyle[n] /* Only values that have changed are used for the animation */
+				&& (n.match(/color/i) || (!n.match(/color/i) && !isNaN(parseInt(newStyle[n],10)))) /* Only things that can be parsed to integers or colors */
+				&& (oldStyle.position != "static" || (oldStyle.position == "static" && !n.match(/left|top|bottom|right/))) /* No need for positions when dealing with static positions */
+				) offset[n] = newStyle[n];
+			}
+
+			that.animate(offset, duration, ea, function() { // Animate the newly constructed offset object
+				// Change style attribute back to original. For stupid IE, we need to clear the damn object.
+				if(typeof $(this).attr("style") == 'object') { $(this).attr("style")["cssText"] = ""; $(this).attr("style")["cssText"] = oldStyleAttr; } else $(this).attr("style", oldStyleAttr);
+				if(value.add) $(this).addClass(value.add); if(value.remove) $(this).removeClass(value.remove);
+				if(cb) cb.apply(this, arguments);
+			});
+
+		});
+	}
+};
+
+
+function _normalizeArguments(effect, options, speed, callback) {
+	// shift params for method overloading
+	if (typeof effect == 'object') {
+		callback = options;
+		speed = null;
+		options = effect;
+		effect = options.effect;
+	}
+	if ($.isFunction(options)) {
+		callback = options;
+		speed = null;
+		options = {};
+	}
+	if (typeof options == 'number') {
+		callback = speed;
+		speed = options;
+		options = {};
+	}
+
+	options = options || {};
+
+	speed = speed || options.duration;
+	speed = $.fx.off ? 0 : typeof speed == 'number'
+		? speed : $.fx.speeds[speed] || $.fx.speeds._default;
+
+	callback = callback || options.complete;
+
+	return [effect, options, speed, callback];
+}
+
+$.fn.extend({
+	effect: function(effect, options, speed, callback) {
+		var args = _normalizeArguments.apply(this, arguments),
+			// TODO: make effects takes actual parameters instead of a hash
+			args2 = {
+				options: args[1],
+				duration: args[2],
+				callback: args[3]
+			},
+			effectMethod = $.effects[effect];
+		
+		return effectMethod && !$.fx.off ? effectMethod.call(this, args2) : this;
+	},
+
+	_show: $.fn.show,
+	show: function(speed) {
+		if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+			return this._show.apply(this, arguments);
+		} else {
+			var args = _normalizeArguments.apply(this, arguments);
+			args[1].mode = 'show';
+			return this.effect.apply(this, args);
+		}
+	},
+
+	_hide: $.fn.hide,
+	hide: function(speed) {
+		if (!speed || typeof speed == 'number' || $.fx.speeds[speed]) {
+			return this._hide.apply(this, arguments);
+		} else {
+			var args = _normalizeArguments.apply(this, arguments);
+			args[1].mode = 'hide';
+			return this.effect.apply(this, args);
+		}
+	},
+
+	// jQuery core overloads toggle and create _toggle
+	__toggle: $.fn.toggle,
+	toggle: function(speed) {
+		if (!speed || typeof speed == 'number' || $.fx.speeds[speed] ||
+			typeof speed == 'boolean' || $.isFunction(speed)) {
+			return this.__toggle.apply(this, arguments);
+		} else {
+			var args = _normalizeArguments.apply(this, arguments);
+			args[1].mode = 'toggle';
+			return this.effect.apply(this, args);
+		}
+	},
+
+	_addClass: $.fn.addClass,
+	addClass: function(classNames, speed, easing, callback) {
+		return speed ? $.effects.animateClass.apply(this, [{ add: classNames },speed,easing,callback]) : this._addClass(classNames);
+	},
+
+	_removeClass: $.fn.removeClass,
+	removeClass: function(classNames,speed,easing,callback) {
+		return speed ? $.effects.animateClass.apply(this, [{ remove: classNames },speed,easing,callback]) : this._removeClass(classNames);
+	},
+
+	_toggleClass: $.fn.toggleClass,
+	toggleClass: function(classNames, force, speed, easing, callback) {
+		if ( typeof force == "boolean" || force === undefined ) {
+			if ( !speed ) {
+				// without speed parameter;
+				return this._toggleClass(classNames, force);
+			} else {
+				return $.effects.animateClass.apply(this, [(force?{add:classNames}:{remove:classNames}),speed,easing,callback]);
+			}
+		} else {
+			// without switch parameter;
+			return $.effects.animateClass.apply(this, [{ toggle: classNames },force,speed,easing]);
+		}
+	},
+
+	switchClass: function(remove,add,speed,easing,callback) {
+		return $.effects.animateClass.apply(this, [{ add: add, remove: remove },speed,easing,callback]);
+	},
+
+	// helper functions
+	cssUnit: function(key) {
+		var style = this.css(key), val = [];
+		$.each( ['em','px','%','pt'], function(i, unit){
+			if(style.indexOf(unit) > 0)
+				val = [parseFloat(style), unit];
+		});
+		return val;
+	}
+});
+
+
+// override the animation for color styles
+$.each(['backgroundColor', 'borderBottomColor', 'borderLeftColor',
+	'borderRightColor', 'borderTopColor', 'color', 'outlineColor'],
+function(i, attr) {
+	$.fx.step[attr] = function(fx) {
+		if (fx.state === 0) {
+			fx.start = getColor(fx.elem, attr);
+			fx.end = getRGB(fx.end);
+		}
+
+		fx.elem.style[attr] = 'rgb(' +
+			Math.max(Math.min(parseInt((fx.pos * (fx.end[0] - fx.start[0])) + fx.start[0], 10), 255), 0) + ',' +
+			Math.max(Math.min(parseInt((fx.pos * (fx.end[1] - fx.start[1])) + fx.start[1], 10), 255), 0) + ',' +
+			Math.max(Math.min(parseInt((fx.pos * (fx.end[2] - fx.start[2])) + fx.start[2], 10), 255), 0) + ')';
+	};
+});
+
+// Color Conversion functions from highlightFade
+// By Blair Mitchelmore
+// http://jquery.offput.ca/highlightFade/
+
+// Parse strings looking for color tuples [255,255,255]
+function getRGB(color) {
+		var result;
+
+		// Check if we're already dealing with an array of colors
+		if ( color && color.constructor == Array && color.length == 3 )
+				return color;
+
+		// Look for rgb(num,num,num)
+		if (result = /rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(color))
+				return [parseInt(result[1],10), parseInt(result[2],10), parseInt(result[3],10)];
+
+		// Look for rgb(num%,num%,num%)
+		if (result = /rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(color))
+				return [parseFloat(result[1])*2.55, parseFloat(result[2])*2.55, parseFloat(result[3])*2.55];
+
+		// Look for #a0b1c2
+		if (result = /#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(color))
+				return [parseInt(result[1],16), parseInt(result[2],16), parseInt(result[3],16)];
+
+		// Look for #fff
+		if (result = /#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(color))
+				return [parseInt(result[1]+result[1],16), parseInt(result[2]+result[2],16), parseInt(result[3]+result[3],16)];
+
+		// Look for rgba(0, 0, 0, 0) == transparent in Safari 3
+		if (result = /rgba\(0, 0, 0, 0\)/.exec(color))
+				return colors['transparent'];
+
+		// Otherwise, we're most likely dealing with a named color
+		return colors[$.trim(color).toLowerCase()];
+}
+
+function getColor(elem, attr) {
+		var color;
+
+		do {
+				color = $.curCSS(elem, attr);
+
+				// Keep going until we find an element that has color, or we hit the body
+				if ( color != '' && color != 'transparent' || $.nodeName(elem, "body") )
+						break;
+
+				attr = "backgroundColor";
+		} while ( elem = elem.parentNode );
+
+		return getRGB(color);
+};
+
+// Some named colors to work with
+// From Interface by Stefan Petre
+// http://interface.eyecon.ro/
+
+var colors = {
+	aqua:[0,255,255],
+	azure:[240,255,255],
+	beige:[245,245,220],
+	black:[0,0,0],
+	blue:[0,0,255],
+	brown:[165,42,42],
+	cyan:[0,255,255],
+	darkblue:[0,0,139],
+	darkcyan:[0,139,139],
+	darkgrey:[169,169,169],
+	darkgreen:[0,100,0],
+	darkkhaki:[189,183,107],
+	darkmagenta:[139,0,139],
+	darkolivegreen:[85,107,47],
+	darkorange:[255,140,0],
+	darkorchid:[153,50,204],
+	darkred:[139,0,0],
+	darksalmon:[233,150,122],
+	darkviolet:[148,0,211],
+	fuchsia:[255,0,255],
+	gold:[255,215,0],
+	green:[0,128,0],
+	indigo:[75,0,130],
+	khaki:[240,230,140],
+	lightblue:[173,216,230],
+	lightcyan:[224,255,255],
+	lightgreen:[144,238,144],
+	lightgrey:[211,211,211],
+	lightpink:[255,182,193],
+	lightyellow:[255,255,224],
+	lime:[0,255,0],
+	magenta:[255,0,255],
+	maroon:[128,0,0],
+	navy:[0,0,128],
+	olive:[128,128,0],
+	orange:[255,165,0],
+	pink:[255,192,203],
+	purple:[128,0,128],
+	violet:[128,0,128],
+	red:[255,0,0],
+	silver:[192,192,192],
+	white:[255,255,255],
+	yellow:[255,255,0],
+	transparent: [255,255,255]
+};
+
+/*
+ * jQuery Easing v1.3 - http://gsgd.co.uk/sandbox/jquery/easing/
+ *
+ * Uses the built in easing capabilities added In jQuery 1.1
+ * to offer multiple easing options
+ *
+ * TERMS OF USE - jQuery Easing
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2008 George McGinley Smith
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+*/
+
+// t: current time, b: begInnIng value, c: change In value, d: duration
+$.easing.jswing = $.easing.swing;
+
+$.extend($.easing,
+{
+	def: 'easeOutQuad',
+	swing: function (x, t, b, c, d) {
+		//alert($.easing.default);
+		return $.easing[$.easing.def](x, t, b, c, d);
+	},
+	easeInQuad: function (x, t, b, c, d) {
+		return c*(t/=d)*t + b;
+	},
+	easeOutQuad: function (x, t, b, c, d) {
+		return -c *(t/=d)*(t-2) + b;
+	},
+	easeInOutQuad: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t + b;
+		return -c/2 * ((--t)*(t-2) - 1) + b;
+	},
+	easeInCubic: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t + b;
+	},
+	easeOutCubic: function (x, t, b, c, d) {
+		return c*((t=t/d-1)*t*t + 1) + b;
+	},
+	easeInOutCubic: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t + b;
+		return c/2*((t-=2)*t*t + 2) + b;
+	},
+	easeInQuart: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t*t + b;
+	},
+	easeOutQuart: function (x, t, b, c, d) {
+		return -c * ((t=t/d-1)*t*t*t - 1) + b;
+	},
+	easeInOutQuart: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t*t + b;
+		return -c/2 * ((t-=2)*t*t*t - 2) + b;
+	},
+	easeInQuint: function (x, t, b, c, d) {
+		return c*(t/=d)*t*t*t*t + b;
+	},
+	easeOutQuint: function (x, t, b, c, d) {
+		return c*((t=t/d-1)*t*t*t*t + 1) + b;
+	},
+	easeInOutQuint: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return c/2*t*t*t*t*t + b;
+		return c/2*((t-=2)*t*t*t*t + 2) + b;
+	},
+	easeInSine: function (x, t, b, c, d) {
+		return -c * Math.cos(t/d * (Math.PI/2)) + c + b;
+	},
+	easeOutSine: function (x, t, b, c, d) {
+		return c * Math.sin(t/d * (Math.PI/2)) + b;
+	},
+	easeInOutSine: function (x, t, b, c, d) {
+		return -c/2 * (Math.cos(Math.PI*t/d) - 1) + b;
+	},
+	easeInExpo: function (x, t, b, c, d) {
+		return (t==0) ? b : c * Math.pow(2, 10 * (t/d - 1)) + b;
+	},
+	easeOutExpo: function (x, t, b, c, d) {
+		return (t==d) ? b+c : c * (-Math.pow(2, -10 * t/d) + 1) + b;
+	},
+	easeInOutExpo: function (x, t, b, c, d) {
+		if (t==0) return b;
+		if (t==d) return b+c;
+		if ((t/=d/2) < 1) return c/2 * Math.pow(2, 10 * (t - 1)) + b;
+		return c/2 * (-Math.pow(2, -10 * --t) + 2) + b;
+	},
+	easeInCirc: function (x, t, b, c, d) {
+		return -c * (Math.sqrt(1 - (t/=d)*t) - 1) + b;
+	},
+	easeOutCirc: function (x, t, b, c, d) {
+		return c * Math.sqrt(1 - (t=t/d-1)*t) + b;
+	},
+	easeInOutCirc: function (x, t, b, c, d) {
+		if ((t/=d/2) < 1) return -c/2 * (Math.sqrt(1 - t*t) - 1) + b;
+		return c/2 * (Math.sqrt(1 - (t-=2)*t) + 1) + b;
+	},
+	easeInElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		return -(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+	},
+	easeOutElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d)==1) return b+c;  if (!p) p=d*.3;
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		return a*Math.pow(2,-10*t) * Math.sin( (t*d-s)*(2*Math.PI)/p ) + c + b;
+	},
+	easeInOutElastic: function (x, t, b, c, d) {
+		var s=1.70158;var p=0;var a=c;
+		if (t==0) return b;  if ((t/=d/2)==2) return b+c;  if (!p) p=d*(.3*1.5);
+		if (a < Math.abs(c)) { a=c; var s=p/4; }
+		else var s = p/(2*Math.PI) * Math.asin (c/a);
+		if (t < 1) return -.5*(a*Math.pow(2,10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )) + b;
+		return a*Math.pow(2,-10*(t-=1)) * Math.sin( (t*d-s)*(2*Math.PI)/p )*.5 + c + b;
+	},
+	easeInBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		return c*(t/=d)*t*((s+1)*t - s) + b;
+	},
+	easeOutBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		return c*((t=t/d-1)*t*((s+1)*t + s) + 1) + b;
+	},
+	easeInOutBack: function (x, t, b, c, d, s) {
+		if (s == undefined) s = 1.70158;
+		if ((t/=d/2) < 1) return c/2*(t*t*(((s*=(1.525))+1)*t - s)) + b;
+		return c/2*((t-=2)*t*(((s*=(1.525))+1)*t + s) + 2) + b;
+	},
+	easeInBounce: function (x, t, b, c, d) {
+		return c - $.easing.easeOutBounce (x, d-t, 0, c, d) + b;
+	},
+	easeOutBounce: function (x, t, b, c, d) {
+		if ((t/=d) < (1/2.75)) {
+			return c*(7.5625*t*t) + b;
+		} else if (t < (2/2.75)) {
+			return c*(7.5625*(t-=(1.5/2.75))*t + .75) + b;
+		} else if (t < (2.5/2.75)) {
+			return c*(7.5625*(t-=(2.25/2.75))*t + .9375) + b;
+		} else {
+			return c*(7.5625*(t-=(2.625/2.75))*t + .984375) + b;
+		}
+	},
+	easeInOutBounce: function (x, t, b, c, d) {
+		if (t < d/2) return $.easing.easeInBounce (x, t*2, 0, c, d) * .5 + b;
+		return $.easing.easeOutBounce (x, t*2-d, 0, c, d) * .5 + c*.5 + b;
+	}
+});
+
+/*
+ *
+ * TERMS OF USE - EASING EQUATIONS
+ *
+ * Open source under the BSD License.
+ *
+ * Copyright 2001 Robert Penner
+ * All rights reserved.
+ *
+ * Redistribution and use in source and binary forms, with or without modification,
+ * are permitted provided that the following conditions are met:
+ *
+ * Redistributions of source code must retain the above copyright notice, this list of
+ * conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright notice, this list
+ * of conditions and the following disclaimer in the documentation and/or other materials
+ * provided with the distribution.
+ *
+ * Neither the name of the author nor the names of contributors may be used to endorse
+ * or promote products derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND ANY
+ * EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE
+ * COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,
+ * EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE
+ * GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED
+ * AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING
+ * NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED
+ * OF THE POSSIBILITY OF SUCH DAMAGE.
+ *
+ */
+
+})(jQuery);
diff --git a/ui/jquery.effects.drop.js b/ui/jquery.effects.drop.js
new file mode 100644
index 000000000..ff46a9d5b
--- /dev/null
+++ b/ui/jquery.effects.drop.js
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Drop @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Drop
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.drop = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left','opacity'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+		var direction = o.options.direction || 'left'; // Default Direction
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		$.effects.createWrapper(el); // Create Wrapper
+		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) / 2 : el.outerWidth({margin:true}) / 2);
+		if (mode == 'show') el.css('opacity', 0).css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+		// Animation
+		var animation = {opacity: mode == 'show' ? 1 : 0};
+		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+		// Animate
+		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(this, arguments); // Callback
+			el.dequeue();
+		}});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.explode.js b/ui/jquery.effects.explode.js
new file mode 100644
index 000000000..5a5935388
--- /dev/null
+++ b/ui/jquery.effects.explode.js
@@ -0,0 +1,79 @@
+/*
+ * jQuery UI Effects Explode @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Explode
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.explode = function(o) {
+
+	return this.queue(function() {
+
+	var rows = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+	var cells = o.options.pieces ? Math.round(Math.sqrt(o.options.pieces)) : 3;
+
+	o.options.mode = o.options.mode == 'toggle' ? ($(this).is(':visible') ? 'hide' : 'show') : o.options.mode;
+	var el = $(this).show().css('visibility', 'hidden');
+	var offset = el.offset();
+
+	//Substract the margins - not fixing the problem yet.
+	offset.top -= parseInt(el.css("marginTop"),10) || 0;
+	offset.left -= parseInt(el.css("marginLeft"),10) || 0;
+
+	var width = el.outerWidth(true);
+	var height = el.outerHeight(true);
+
+	for(var i=0;i<rows;i++) { // =
+		for(var j=0;j<cells;j++) { // ||
+			el
+				.clone()
+				.appendTo('body')
+				.wrap('<div></div>')
+				.css({
+					position: 'absolute',
+					visibility: 'visible',
+					left: -j*(width/cells),
+					top: -i*(height/rows)
+				})
+				.parent()
+				.addClass('ui-effects-explode')
+				.css({
+					position: 'absolute',
+					overflow: 'hidden',
+					width: width/cells,
+					height: height/rows,
+					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? (j-Math.floor(cells/2))*(width/cells) : 0),
+					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? (i-Math.floor(rows/2))*(height/rows) : 0),
+					opacity: o.options.mode == 'show' ? 0 : 1
+				}).animate({
+					left: offset.left + j*(width/cells) + (o.options.mode == 'show' ? 0 : (j-Math.floor(cells/2))*(width/cells)),
+					top: offset.top + i*(height/rows) + (o.options.mode == 'show' ? 0 : (i-Math.floor(rows/2))*(height/rows)),
+					opacity: o.options.mode == 'show' ? 1 : 0
+				}, o.duration || 500);
+		}
+	}
+
+	// Set a timeout, to call the callback approx. when the other animations have finished
+	setTimeout(function() {
+
+		o.options.mode == 'show' ? el.css({ visibility: 'visible' }) : el.css({ visibility: 'visible' }).hide();
+				if(o.callback) o.callback.apply(el[0]); // Callback
+				el.dequeue();
+
+				$('div.ui-effects-explode').remove();
+
+	}, o.duration || 500);
+
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.fold.js b/ui/jquery.effects.fold.js
new file mode 100644
index 000000000..781ac27ee
--- /dev/null
+++ b/ui/jquery.effects.fold.js
@@ -0,0 +1,56 @@
+/*
+ * jQuery UI Effects Fold @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Fold
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.fold = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'hide'); // Set Mode
+		var size = o.options.size || 15; // Default fold size
+		var horizFirst = !(!o.options.horizFirst); // Ensure a boolean value
+		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		var wrapper = $.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+		var widthFirst = ((mode == 'show') != horizFirst);
+		var ref = widthFirst ? ['width', 'height'] : ['height', 'width'];
+		var distance = widthFirst ? [wrapper.width(), wrapper.height()] : [wrapper.height(), wrapper.width()];
+		var percent = /([0-9]+)%/.exec(size);
+		if(percent) size = parseInt(percent[1],10) / 100 * distance[mode == 'hide' ? 0 : 1];
+		if(mode == 'show') wrapper.css(horizFirst ? {height: 0, width: size} : {height: size, width: 0}); // Shift
+
+		// Animation
+		var animation1 = {}, animation2 = {};
+		animation1[ref[0]] = mode == 'show' ? distance[0] : size;
+		animation2[ref[1]] = mode == 'show' ? distance[1] : 0;
+
+		// Animate
+		wrapper.animate(animation1, duration, o.options.easing)
+		.animate(animation2, duration, o.options.easing, function() {
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(el[0], arguments); // Callback
+			el.dequeue();
+		});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.highlight.js b/ui/jquery.effects.highlight.js
new file mode 100644
index 000000000..c637f7a26
--- /dev/null
+++ b/ui/jquery.effects.highlight.js
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Highlight @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Highlight
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.highlight = function(o) {
+	return this.queue(function() {
+		var elem = $(this),
+			props = ['backgroundImage', 'backgroundColor', 'opacity'],
+			mode = $.effects.setMode(elem, o.options.mode || 'show'),
+			animation = {
+				backgroundColor: elem.css('backgroundColor')
+			};
+
+		if (mode == 'hide') {
+			animation.opacity = 0;
+		}
+
+		$.effects.save(elem, props);
+		elem
+			.show()
+			.css({
+				backgroundImage: 'none',
+				backgroundColor: o.options.color || '#ffff99'
+			})
+			.animate(animation, {
+				queue: false,
+				duration: o.duration,
+				easing: o.options.easing,
+				complete: function() {
+					(mode == 'hide' && elem.hide());
+					$.effects.restore(elem, props);
+					(mode == 'show' && !$.support.opacity && this.style.removeAttribute('filter'));
+					(o.callback && o.callback.apply(this, arguments));
+					elem.dequeue();
+				}
+			});
+	});
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.pulsate.js b/ui/jquery.effects.pulsate.js
new file mode 100644
index 000000000..8ce9e529a
--- /dev/null
+++ b/ui/jquery.effects.pulsate.js
@@ -0,0 +1,56 @@
+/*
+ * jQuery UI Effects Pulsate @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Pulsate
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.pulsate = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this);
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+		var times = o.options.times || 5; // Default # of times
+		var duration = o.duration ? o.duration / 2 : $.fx.speeds._default / 2;
+
+		// Adjust
+		if (mode == 'hide') times--;
+		if (el.is(':hidden')) { // Show fadeIn
+			el.css('opacity', 0);
+			el.show(); // Show
+			el.animate({opacity: 1}, duration, o.options.easing);
+			times = times-2;
+		}
+
+		// Animate
+		for (var i = 0; i < times; i++) { // Pulsate
+			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing);
+		};
+		if (mode == 'hide') { // Last Pulse
+			el.animate({opacity: 0}, duration, o.options.easing, function(){
+				el.hide(); // Hide
+				if(o.callback) o.callback.apply(this, arguments); // Callback
+			});
+		} else {
+			el.animate({opacity: 0}, duration, o.options.easing).animate({opacity: 1}, duration, o.options.easing, function(){
+				if(o.callback) o.callback.apply(this, arguments); // Callback
+			});
+		};
+		el.queue('fx', function() { el.dequeue(); });
+		el.dequeue();
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.scale.js b/ui/jquery.effects.scale.js
new file mode 100644
index 000000000..1641c9ac0
--- /dev/null
+++ b/ui/jquery.effects.scale.js
@@ -0,0 +1,178 @@
+/*
+ * jQuery UI Effects Scale @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Scale
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.puff = function(o) {
+	return this.queue(function() {
+		var elem = $(this),
+			mode = $.effects.setMode(elem, o.options.mode || 'hide'),
+			percent = parseInt(o.options.percent, 10) || 150,
+			factor = percent / 100,
+			original = { height: elem.height(), width: elem.width() };
+
+		$.extend(o.options, {
+			fade: true,
+			mode: mode,
+			percent: mode == 'hide' ? percent : 100,
+			from: mode == 'hide'
+				? original
+				: {
+					height: original.height * factor,
+					width: original.width * factor
+				}
+		});
+
+		elem.effect('scale', o.options, o.duration, o.callback);
+		elem.dequeue();
+	});
+};
+
+$.effects.scale = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this);
+
+		// Set options
+		var options = $.extend(true, {}, o.options);
+		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+		var percent = parseInt(o.options.percent,10) || (parseInt(o.options.percent,10) == 0 ? 0 : (mode == 'hide' ? 0 : 100)); // Set default scaling percent
+		var direction = o.options.direction || 'both'; // Set default axis
+		var origin = o.options.origin; // The origin of the scaling
+		if (mode != 'effect') { // Set default origin and restore for show/hide
+			options.origin = origin || ['middle','center'];
+			options.restore = true;
+		}
+		var original = {height: el.height(), width: el.width()}; // Save original
+		el.from = o.options.from || (mode == 'show' ? {height: 0, width: 0} : original); // Default from state
+
+		// Adjust
+		var factor = { // Set scaling factor
+			y: direction != 'horizontal' ? (percent / 100) : 1,
+			x: direction != 'vertical' ? (percent / 100) : 1
+		};
+		el.to = {height: original.height * factor.y, width: original.width * factor.x}; // Set to state
+
+		if (o.options.fade) { // Fade option to support puff
+			if (mode == 'show') {el.from.opacity = 0; el.to.opacity = 1;};
+			if (mode == 'hide') {el.from.opacity = 1; el.to.opacity = 0;};
+		};
+
+		// Animation
+		options.from = el.from; options.to = el.to; options.mode = mode;
+
+		// Animate
+		el.effect('size', options, o.duration, o.callback);
+		el.dequeue();
+	});
+
+};
+
+$.effects.size = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left','width','height','overflow','opacity'];
+		var props1 = ['position','top','left','overflow','opacity']; // Always restore
+		var props2 = ['width','height','overflow']; // Copy for children
+		var cProps = ['fontSize'];
+		var vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'];
+		var hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+		var restore = o.options.restore || false; // Default restore
+		var scale = o.options.scale || 'both'; // Default scale mode
+		var origin = o.options.origin; // The origin of the sizing
+		var original = {height: el.height(), width: el.width()}; // Save original
+		el.from = o.options.from || original; // Default from state
+		el.to = o.options.to || original; // Default to state
+		// Adjust
+		if (origin) { // Calculate baseline shifts
+			var baseline = $.effects.getBaseline(origin, original);
+			el.from.top = (original.height - el.from.height) * baseline.y;
+			el.from.left = (original.width - el.from.width) * baseline.x;
+			el.to.top = (original.height - el.to.height) * baseline.y;
+			el.to.left = (original.width - el.to.width) * baseline.x;
+		};
+		var factor = { // Set scaling factor
+			from: {y: el.from.height / original.height, x: el.from.width / original.width},
+			to: {y: el.to.height / original.height, x: el.to.width / original.width}
+		};
+		if (scale == 'box' || scale == 'both') { // Scale the css box
+			if (factor.from.y != factor.to.y) { // Vertical props scaling
+				props = props.concat(vProps);
+				el.from = $.effects.setTransition(el, vProps, factor.from.y, el.from);
+				el.to = $.effects.setTransition(el, vProps, factor.to.y, el.to);
+			};
+			if (factor.from.x != factor.to.x) { // Horizontal props scaling
+				props = props.concat(hProps);
+				el.from = $.effects.setTransition(el, hProps, factor.from.x, el.from);
+				el.to = $.effects.setTransition(el, hProps, factor.to.x, el.to);
+			};
+		};
+		if (scale == 'content' || scale == 'both') { // Scale the content
+			if (factor.from.y != factor.to.y) { // Vertical props scaling
+				props = props.concat(cProps);
+				el.from = $.effects.setTransition(el, cProps, factor.from.y, el.from);
+				el.to = $.effects.setTransition(el, cProps, factor.to.y, el.to);
+			};
+		};
+		$.effects.save(el, restore ? props : props1); el.show(); // Save & Show
+		$.effects.createWrapper(el); // Create Wrapper
+		el.css('overflow','hidden').css(el.from); // Shift
+
+		// Animate
+		if (scale == 'content' || scale == 'both') { // Scale the children
+			vProps = vProps.concat(['marginTop','marginBottom']).concat(cProps); // Add margins/font-size
+			hProps = hProps.concat(['marginLeft','marginRight']); // Add margins
+			props2 = props.concat(vProps).concat(hProps); // Concat
+			el.find("*[width]").each(function(){
+				child = $(this);
+				if (restore) $.effects.save(child, props2);
+				var c_original = {height: child.height(), width: child.width()}; // Save original
+				child.from = {height: c_original.height * factor.from.y, width: c_original.width * factor.from.x};
+				child.to = {height: c_original.height * factor.to.y, width: c_original.width * factor.to.x};
+				if (factor.from.y != factor.to.y) { // Vertical props scaling
+					child.from = $.effects.setTransition(child, vProps, factor.from.y, child.from);
+					child.to = $.effects.setTransition(child, vProps, factor.to.y, child.to);
+				};
+				if (factor.from.x != factor.to.x) { // Horizontal props scaling
+					child.from = $.effects.setTransition(child, hProps, factor.from.x, child.from);
+					child.to = $.effects.setTransition(child, hProps, factor.to.x, child.to);
+				};
+				child.css(child.from); // Shift children
+				child.animate(child.to, o.duration, o.options.easing, function(){
+					if (restore) $.effects.restore(child, props2); // Restore children
+				}); // Animate children
+			});
+		};
+
+		// Animate
+		el.animate(el.to, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+			if (el.to.opacity === 0) {
+				el.css('opacity', el.from.opacity);
+			}
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, restore ? props : props1); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(this, arguments); // Callback
+			el.dequeue();
+		}});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.shake.js b/ui/jquery.effects.shake.js
new file mode 100644
index 000000000..8da66f133
--- /dev/null
+++ b/ui/jquery.effects.shake.js
@@ -0,0 +1,57 @@
+/*
+ * jQuery UI Effects Shake @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Shake
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.shake = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'effect'); // Set Mode
+		var direction = o.options.direction || 'left'; // Default direction
+		var distance = o.options.distance || 20; // Default distance
+		var times = o.options.times || 3; // Default # of times
+		var speed = o.duration || o.options.duration || 140; // Default speed per shake
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		$.effects.createWrapper(el); // Create Wrapper
+		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+
+		// Animation
+		var animation = {}, animation1 = {}, animation2 = {};
+		animation[ref] = (motion == 'pos' ? '-=' : '+=')  + distance;
+		animation1[ref] = (motion == 'pos' ? '+=' : '-=')  + distance * 2;
+		animation2[ref] = (motion == 'pos' ? '-=' : '+=')  + distance * 2;
+
+		// Animate
+		el.animate(animation, speed, o.options.easing);
+		for (var i = 1; i < times; i++) { // Shakes
+			el.animate(animation1, speed, o.options.easing).animate(animation2, speed, o.options.easing);
+		};
+		el.animate(animation1, speed, o.options.easing).
+		animate(animation, speed / 2, o.options.easing, function(){ // Last shake
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(this, arguments); // Callback
+		});
+		el.queue('fx', function() { el.dequeue(); });
+		el.dequeue();
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.slide.js b/ui/jquery.effects.slide.js
new file mode 100644
index 000000000..9c2bc4c78
--- /dev/null
+++ b/ui/jquery.effects.slide.js
@@ -0,0 +1,50 @@
+/*
+ * jQuery UI Effects Slide @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Slide
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.slide = function(o) {
+
+	return this.queue(function() {
+
+		// Create element
+		var el = $(this), props = ['position','top','left'];
+
+		// Set options
+		var mode = $.effects.setMode(el, o.options.mode || 'show'); // Set Mode
+		var direction = o.options.direction || 'left'; // Default Direction
+
+		// Adjust
+		$.effects.save(el, props); el.show(); // Save & Show
+		$.effects.createWrapper(el).css({overflow:'hidden'}); // Create Wrapper
+		var ref = (direction == 'up' || direction == 'down') ? 'top' : 'left';
+		var motion = (direction == 'up' || direction == 'left') ? 'pos' : 'neg';
+		var distance = o.options.distance || (ref == 'top' ? el.outerHeight({margin:true}) : el.outerWidth({margin:true}));
+		if (mode == 'show') el.css(ref, motion == 'pos' ? -distance : distance); // Shift
+
+		// Animation
+		var animation = {};
+		animation[ref] = (mode == 'show' ? (motion == 'pos' ? '+=' : '-=') : (motion == 'pos' ? '-=' : '+=')) + distance;
+
+		// Animate
+		el.animate(animation, { queue: false, duration: o.duration, easing: o.options.easing, complete: function() {
+			if(mode == 'hide') el.hide(); // Hide
+			$.effects.restore(el, props); $.effects.removeWrapper(el); // Restore
+			if(o.callback) o.callback.apply(this, arguments); // Callback
+			el.dequeue();
+		}});
+
+	});
+
+};
+
+})(jQuery);
diff --git a/ui/jquery.effects.transfer.js b/ui/jquery.effects.transfer.js
new file mode 100644
index 000000000..c2a3eed89
--- /dev/null
+++ b/ui/jquery.effects.transfer.js
@@ -0,0 +1,45 @@
+/*
+ * jQuery UI Effects Transfer @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Effects/Transfer
+ *
+ * Depends:
+ *	jquery.effects.core.js
+ */
+(function($) {
+
+$.effects.transfer = function(o) {
+	return this.queue(function() {
+		var elem = $(this),
+			target = $(o.options.to),
+			endPosition = target.offset(),
+			animation = {
+				top: endPosition.top,
+				left: endPosition.left,
+				height: target.innerHeight(),
+				width: target.innerWidth()
+			},
+			startPosition = elem.offset(),
+			transfer = $('<div class="ui-effects-transfer"></div>')
+				.appendTo(document.body)
+				.addClass(o.options.className)
+				.css({
+					top: startPosition.top,
+					left: startPosition.left,
+					height: elem.innerHeight(),
+					width: elem.innerWidth(),
+					position: 'absolute'
+				})
+				.animate(animation, o.duration, o.options.easing, function() {
+					transfer.remove();
+					(o.callback && o.callback.apply(elem[0], arguments));
+					elem.dequeue();
+				});
+	});
+};
+
+})(jQuery);
diff --git a/ui/jquery.ui.accordion.js b/ui/jquery.ui.accordion.js
new file mode 100644
index 000000000..31c2badb0
--- /dev/null
+++ b/ui/jquery.ui.accordion.js
@@ -0,0 +1,510 @@
+/*
+ * jQuery UI Accordion @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Accordion
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.accordion", {
+
+	_init: function() {
+
+		var o = this.options, self = this;
+		this.running = 0;
+
+		this.element.addClass("ui-accordion ui-widget ui-helper-reset");
+		
+		// in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
+		if (this.element[0].nodeName == "UL") {
+			this.element.children("li").addClass("ui-accordion-li-fix");
+		}
+
+		this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
+			.bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
+			.bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
+			.bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
+			.bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
+
+		this.headers
+			.next()
+				.addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
+
+		if ( o.navigation ) {
+			var current = this.element.find("a").filter(o.navigationFilter);
+			if ( current.length ) {
+				var header = current.closest(".ui-accordion-header");
+				if ( header.length ) {
+					// anchor within header
+					this.active = header;
+				} else {
+					// anchor within content
+					this.active = current.closest(".ui-accordion-content").prev();
+				}
+			}
+		}
+
+		this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
+		this.active.next().addClass('ui-accordion-content-active');
+
+		//Append icon elements
+		this._createIcons();
+
+		// IE7-/Win - Extra vertical space in lists fixed
+		if ($.browser.msie) {
+			this.element.find('a').css('zoom', '1');
+		}
+
+		this.resize();
+
+		//ARIA
+		this.element.attr('role','tablist');
+
+		this.headers
+			.attr('role','tab')
+			.bind('keydown', function(event) { return self._keydown(event); })
+			.next()
+			.attr('role','tabpanel');
+
+		this.headers
+			.not(this.active || "")
+			.attr('aria-expanded','false')
+			.attr("tabIndex", "-1")
+			.next()
+			.hide();
+
+		// make sure at least one header is in the tab order
+		if (!this.active.length) {
+			this.headers.eq(0).attr('tabIndex','0');
+		} else {
+			this.active
+				.attr('aria-expanded','true')
+				.attr('tabIndex', '0');
+		}
+
+		// only need links in taborder for Safari
+		if (!$.browser.safari)
+			this.headers.find('a').attr('tabIndex','-1');
+
+		if (o.event) {
+			this.headers.bind((o.event) + ".accordion", function(event) {
+				self._clickHandler.call(self, event, this);
+				event.preventDefault();
+			});
+		}
+
+	},
+	
+	_createIcons: function() {
+		var o = this.options;
+		if (o.icons) {
+			$("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
+			this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
+			this.element.addClass("ui-accordion-icons");
+		}
+	},
+	
+	_destroyIcons: function() {
+		this.headers.children(".ui-icon").remove();
+		this.element.removeClass("ui-accordion-icons");
+	},
+
+	destroy: function() {
+		var o = this.options;
+
+		this.element
+			.removeClass("ui-accordion ui-widget ui-helper-reset")
+			.removeAttr("role")
+			.unbind('.accordion')
+			.removeData('accordion');
+
+		this.headers
+			.unbind(".accordion")
+			.removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
+			.removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
+
+		this.headers.find("a").removeAttr("tabindex");
+		this._destroyIcons();
+		var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
+		if (o.autoHeight || o.fillHeight) {
+			contents.css("height", "");
+		}
+
+		return this;
+	},
+	
+	_setData: function(key, value) {
+		$.widget.prototype._setData.apply(this, arguments);
+			
+		if (key == "active") {
+			this.activate(value);
+		}
+		if (key == "icons") {
+			this._destroyIcons();
+			if (value) {
+				this._createIcons();
+			}
+		}
+		
+	},
+
+	_keydown: function(event) {
+
+		var o = this.options, keyCode = $.ui.keyCode;
+
+		if (o.disabled || event.altKey || event.ctrlKey)
+			return;
+
+		var length = this.headers.length;
+		var currentIndex = this.headers.index(event.target);
+		var toFocus = false;
+
+		switch(event.keyCode) {
+			case keyCode.RIGHT:
+			case keyCode.DOWN:
+				toFocus = this.headers[(currentIndex + 1) % length];
+				break;
+			case keyCode.LEFT:
+			case keyCode.UP:
+				toFocus = this.headers[(currentIndex - 1 + length) % length];
+				break;
+			case keyCode.SPACE:
+			case keyCode.ENTER:
+				this._clickHandler({ target: event.target }, event.target);
+				event.preventDefault();
+		}
+
+		if (toFocus) {
+			$(event.target).attr('tabIndex','-1');
+			$(toFocus).attr('tabIndex','0');
+			toFocus.focus();
+			return false;
+		}
+
+		return true;
+
+	},
+
+	resize: function() {
+
+		var o = this.options, maxHeight;
+
+		if (o.fillSpace) {
+			
+			if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
+			maxHeight = this.element.parent().height();
+			if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
+	
+			this.headers.each(function() {
+				maxHeight -= $(this).outerHeight(true);
+			});
+
+			this.headers.next().each(function() {
+    		   $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
+			}).css('overflow', 'auto');
+
+		} else if ( o.autoHeight ) {
+			maxHeight = 0;
+			this.headers.next().each(function() {
+				maxHeight = Math.max(maxHeight, $(this).height());
+			}).height(maxHeight);
+		}
+
+		return this;
+	},
+
+	activate: function(index) {
+		// TODO this gets called on init, changing the option without an explicit call for that
+		this.options.active = index;
+		// call clickHandler with custom event
+		var active = this._findActive(index)[0];
+		this._clickHandler({ target: active }, active);
+
+		return this;
+	},
+
+	_findActive: function(selector) {
+		return selector
+			? typeof selector == "number"
+				? this.headers.filter(":eq(" + selector + ")")
+				: this.headers.not(this.headers.not(selector))
+			: selector === false
+				? $([])
+				: this.headers.filter(":eq(0)");
+	},
+
+	// TODO isn't event.target enough? why the seperate target argument?
+	_clickHandler: function(event, target) {
+
+		var o = this.options;
+		if (o.disabled)
+			return;
+
+		// called only when using activate(false) to close all parts programmatically
+		if (!event.target) {
+			if (!o.collapsible)
+				return;
+			this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+				.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+			this.active.next().addClass('ui-accordion-content-active');
+			var toHide = this.active.next(),
+				data = {
+					options: o,
+					newHeader: $([]),
+					oldHeader: o.active,
+					newContent: $([]),
+					oldContent: toHide
+				},
+				toShow = (this.active = $([]));
+			this._toggle(toShow, toHide, data);
+			return;
+		}
+
+		// get the click target
+		var clicked = $(event.currentTarget || target);
+		var clickedIsActive = clicked[0] == this.active[0];
+		
+		// TODO the option is changed, is that correct?
+		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
+		o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
+
+		// if animations are still active, or the active header is the target, ignore click
+		if (this.running || (!o.collapsible && clickedIsActive)) {
+			return;
+		}
+
+		// switch classes
+		this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
+			.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
+		if (!clickedIsActive) {
+			clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
+				.find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
+			clicked.next().addClass('ui-accordion-content-active');
+		}
+
+		// find elements to show and hide
+		var toShow = clicked.next(),
+			toHide = this.active.next(),
+			data = {
+				options: o,
+				newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
+				oldHeader: this.active,
+				newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
+				oldContent: toHide.find('> *')
+			},
+			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
+
+		this.active = clickedIsActive ? $([]) : clicked;
+		this._toggle(toShow, toHide, data, clickedIsActive, down);
+
+		return;
+
+	},
+
+	_toggle: function(toShow, toHide, data, clickedIsActive, down) {
+
+		var o = this.options, self = this;
+
+		this.toShow = toShow;
+		this.toHide = toHide;
+		this.data = data;
+
+		var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
+
+		// trigger changestart event
+		this._trigger("changestart", null, this.data);
+
+		// count elements to animate
+		this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
+
+		if (o.animated) {
+
+			var animOptions = {};
+
+			if ( o.collapsible && clickedIsActive ) {
+				animOptions = {
+					toShow: $([]),
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: o.autoHeight || o.fillSpace
+				};
+			} else {
+				animOptions = {
+					toShow: toShow,
+					toHide: toHide,
+					complete: complete,
+					down: down,
+					autoHeight: o.autoHeight || o.fillSpace
+				};
+			}
+
+			if (!o.proxied) {
+				o.proxied = o.animated;
+			}
+
+			if (!o.proxiedDuration) {
+				o.proxiedDuration = o.duration;
+			}
+
+			o.animated = $.isFunction(o.proxied) ?
+				o.proxied(animOptions) : o.proxied;
+
+			o.duration = $.isFunction(o.proxiedDuration) ?
+				o.proxiedDuration(animOptions) : o.proxiedDuration;
+
+			var animations = $.ui.accordion.animations,
+				duration = o.duration,
+				easing = o.animated;
+
+			if (easing && !animations[easing] && !$.easing[easing]) {
+				easing = 'slide';
+			}
+			if (!animations[easing]) {
+				animations[easing] = function(options) {
+					this.slide(options, {
+						easing: easing,
+						duration: duration || 700
+					});
+				};
+			}
+
+			animations[easing](animOptions);
+
+		} else {
+
+			if (o.collapsible && clickedIsActive) {
+				toShow.toggle();
+			} else {
+				toHide.hide();
+				toShow.show();
+			}
+
+			complete(true);
+
+		}
+
+		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
+		toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
+		toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
+
+	},
+
+	_completed: function(cancel) {
+
+		var o = this.options;
+
+		this.running = cancel ? 0 : --this.running;
+		if (this.running) return;
+
+		if (o.clearStyle) {
+			this.toShow.add(this.toHide).css({
+				height: "",
+				overflow: ""
+			});
+		}
+		
+		// other classes are removed before the animation; this one needs to stay until completed
+		this.toHide.removeClass("ui-accordion-content-active");
+
+		this._trigger('change', null, this.data);
+	}
+
+});
+
+
+$.extend($.ui.accordion, {
+	version: "@VERSION",
+	defaults: {
+		active: 0,
+		animated: 'slide',
+		autoHeight: true,
+		clearStyle: false,
+		collapsible: false,
+		event: "click",
+		fillSpace: false,
+		header: "> li > :first-child,> :not(li):even",
+		icons: {
+			header: "ui-icon-triangle-1-e",
+			headerSelected: "ui-icon-triangle-1-s"
+		},
+		navigation: false,
+		navigationFilter: function() {
+			return this.href.toLowerCase() == location.href.toLowerCase();
+		}
+	},
+	animations: {
+		slide: function(options, additions) {
+			options = $.extend({
+				easing: "swing",
+				duration: 300
+			}, options, additions);
+			if ( !options.toHide.size() ) {
+				options.toShow.animate({height: "show"}, options);
+				return;
+			}
+			if ( !options.toShow.size() ) {
+				options.toHide.animate({height: "hide"}, options);
+				return;
+			}
+			var overflow = options.toShow.css('overflow'),
+				percentDone,
+				showProps = {},
+				hideProps = {},
+				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
+				originalWidth;
+			// fix width before calculating height of hidden element
+			var s = options.toShow;
+			originalWidth = s[0].style.width;
+			s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
+			
+			$.each(fxAttrs, function(i, prop) {
+				hideProps[prop] = 'hide';
+				
+				var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
+				showProps[prop] = {
+					value: parts[1],
+					unit: parts[2] || 'px'
+				};
+			});
+			options.toShow.css({ height: 0, overflow: 'hidden' }).show();
+			options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
+				step: function(now, settings) {
+					// only calculate the percent when animating height
+					// IE gets very inconsistent results when animating elements
+					// with small values, which is common for padding
+					if (settings.prop == 'height') {
+						percentDone = (settings.now - settings.start) / (settings.end - settings.start);
+					}
+					
+					options.toShow[0].style[settings.prop] =
+						(percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
+				},
+				duration: options.duration,
+				easing: options.easing,
+				complete: function() {
+					if ( !options.autoHeight ) {
+						options.toShow.css("height", "");
+					}
+					options.toShow.css("width", originalWidth);
+					options.toShow.css({overflow: overflow});
+					options.complete();
+				}
+			});
+		},
+		bounceslide: function(options) {
+			this.slide(options, {
+				easing: options.down ? "easeOutBounce" : "swing",
+				duration: options.down ? 1000 : 200
+			});
+		}
+	}
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.core.js b/ui/jquery.ui.core.js
new file mode 100644
index 000000000..1b4794485
--- /dev/null
+++ b/ui/jquery.ui.core.js
@@ -0,0 +1,552 @@
+/*
+ * jQuery UI @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI
+ */
+;jQuery.ui || (function($) {
+
+var _remove = $.fn.remove,
+	isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
+
+//Helper functions and ui object
+$.ui = {
+	version: "@VERSION",
+
+	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
+	plugin: {
+		add: function(module, option, set) {
+			var proto = $.ui[module].prototype;
+			for(var i in set) {
+				proto.plugins[i] = proto.plugins[i] || [];
+				proto.plugins[i].push([option, set[i]]);
+			}
+		},
+		call: function(instance, name, args) {
+			var set = instance.plugins[name];
+			if(!set || !instance.element[0].parentNode) { return; }
+
+			for (var i = 0; i < set.length; i++) {
+				if (instance.options[set[i][0]]) {
+					set[i][1].apply(instance.element, args);
+				}
+			}
+		}
+	},
+
+	contains: function(a, b) {
+		return document.compareDocumentPosition
+			? a.compareDocumentPosition(b) & 16
+			: a !== b && a.contains(b);
+	},
+
+	hasScroll: function(el, a) {
+
+		//If overflow is hidden, the element might have extra content, but the user wants to hide it
+		if ($(el).css('overflow') == 'hidden') { return false; }
+
+		var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
+			has = false;
+
+		if (el[scroll] > 0) { return true; }
+
+		// TODO: determine which cases actually cause this to happen
+		// if the element doesn't have the scroll set, see if it's possible to
+		// set the scroll
+		el[scroll] = 1;
+		has = (el[scroll] > 0);
+		el[scroll] = 0;
+		return has;
+	},
+
+	isOverAxis: function(x, reference, size) {
+		//Determines when x coordinate is over "b" element axis
+		return (x > reference) && (x < (reference + size));
+	},
+
+	isOver: function(y, x, top, left, height, width) {
+		//Determines when x, y coordinates is over "b" element
+		return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
+	},
+
+	keyCode: {
+		BACKSPACE: 8,
+		CAPS_LOCK: 20,
+		COMMA: 188,
+		CONTROL: 17,
+		DELETE: 46,
+		DOWN: 40,
+		END: 35,
+		ENTER: 13,
+		ESCAPE: 27,
+		HOME: 36,
+		INSERT: 45,
+		LEFT: 37,
+		NUMPAD_ADD: 107,
+		NUMPAD_DECIMAL: 110,
+		NUMPAD_DIVIDE: 111,
+		NUMPAD_ENTER: 108,
+		NUMPAD_MULTIPLY: 106,
+		NUMPAD_SUBTRACT: 109,
+		PAGE_DOWN: 34,
+		PAGE_UP: 33,
+		PERIOD: 190,
+		RIGHT: 39,
+		SHIFT: 16,
+		SPACE: 32,
+		TAB: 9,
+		UP: 38
+	}
+};
+
+// WAI-ARIA normalization
+if (isFF2) {
+	var attr = $.attr,
+		removeAttr = $.fn.removeAttr,
+		ariaNS = "http://www.w3.org/2005/07/aaa",
+		ariaState = /^aria-/,
+		ariaRole = /^wairole:/;
+
+	$.attr = function(elem, name, value) {
+		var set = value !== undefined;
+
+		return (name == 'role'
+			? (set
+				? attr.call(this, elem, name, "wairole:" + value)
+				: (attr.apply(this, arguments) || "").replace(ariaRole, ""))
+			: (ariaState.test(name)
+				? (set
+					? elem.setAttributeNS(ariaNS,
+						name.replace(ariaState, "aaa:"), value)
+					: attr.call(this, elem, name.replace(ariaState, "aaa:")))
+				: attr.apply(this, arguments)));
+	};
+
+	$.fn.removeAttr = function(name) {
+		return (ariaState.test(name)
+			? this.each(function() {
+				this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
+			}) : removeAttr.call(this, name));
+	};
+}
+
+//jQuery plugins
+$.fn.extend({
+	_focus: $.fn.focus,
+	focus: function(delay, fn) {
+		return typeof delay === 'number'
+			? this.each(function() {
+				var elem = this;
+				setTimeout(function() {
+					$(elem).focus();
+					(fn && fn.call(elem));
+				}, delay);
+			})
+			: this._focus.apply(this, arguments);
+	},
+	
+	remove: function() {
+		// Safari has a native remove event which actually removes DOM elements,
+		// so we have to use triggerHandler instead of trigger (#3037).
+		$("*", this).add(this).each(function() {
+			$(this).triggerHandler("remove");
+		});
+		return _remove.apply(this, arguments );
+	},
+
+	enableSelection: function() {
+		return this
+			.attr('unselectable', 'off')
+			.css('MozUserSelect', '')
+			.unbind('selectstart.ui');
+	},
+
+	disableSelection: function() {
+		return this
+			.attr('unselectable', 'on')
+			.css('MozUserSelect', 'none')
+			.bind('selectstart.ui', function() { return false; });
+	},
+
+	scrollParent: function() {
+		var scrollParent;
+		if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
+			scrollParent = this.parents().filter(function() {
+				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		} else {
+			scrollParent = this.parents().filter(function() {
+				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
+			}).eq(0);
+		}
+
+		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
+	},
+
+	zIndex: function(zIndex) {
+		if (zIndex !== undefined) {
+			return this.css('zIndex', zIndex);
+		}
+
+		var elem = this[0];
+		while (elem && elem.style) {
+			// IE returns 0 when zIndex is not specified
+			// other browsers return an empty string
+			// we ignore the case of nested elements with an explicit value of 0
+			// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
+			if (elem.style.zIndex !== '' && elem.style.zIndex !== 0) {
+				return +elem.style.zIndex;
+			}
+			elem = elem.parentNode;
+		}
+
+		return 0;
+	}
+});
+
+
+//Additional selectors
+$.extend($.expr[':'], {
+	data: function(elem, i, match) {
+		return !!$.data(elem, match[3]);
+	},
+
+	focusable: function(element) {
+		var nodeName = element.nodeName.toLowerCase(),
+			tabIndex = $.attr(element, 'tabindex');
+		return (/input|select|textarea|button|object/.test(nodeName)
+			? !element.disabled
+			: 'a' == nodeName || 'area' == nodeName
+				? element.href || !isNaN(tabIndex)
+				: !isNaN(tabIndex))
+			// the element and all of its ancestors must be visible
+			// the browser may report that the area is hidden
+			&& !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
+	},
+
+	tabbable: function(element) {
+		var tabIndex = $.attr(element, 'tabindex');
+		return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
+	}
+});
+
+
+// $.widget is a factory to create jQuery plugins
+// taking some boilerplate code out of the plugin code
+$.widget = function(name, prototype) {
+	var namespace = name.split(".")[0],
+		fullName;
+	name = name.split(".")[1];
+	fullName = namespace + '-' + name;
+
+	// create selector for plugin
+	$.expr[':'][fullName] = function(elem) {
+		return !!$.data(elem, name);
+	};
+	
+	// create plugin method
+	$.fn[name] = function(options) {
+		var isMethodCall = (typeof options == 'string'),
+			args = Array.prototype.slice.call(arguments, 1),
+			returnValue = this;
+
+		// allow multiple hashes to be passed on init
+		options = !isMethodCall && args.length
+			? $.extend.apply(null, [true, options].concat(args))
+			: options;
+
+		// prevent calls to internal methods
+		if (isMethodCall && options.substring(0, 1) == '_') {
+			return returnValue;
+		}
+
+		(isMethodCall
+			? this.each(function() {
+				var instance = $.data(this, name),
+					methodValue = (instance && $.isFunction(instance[options])
+						? instance[options].apply(instance, args)
+						: instance);
+				if (methodValue !== instance && methodValue !== undefined) {
+					returnValue = methodValue;
+					return false;
+				}
+			})
+			: this.each(function() {
+				($.data(this, name) ||
+					$.data(this, name, new $[namespace][name](this, options))._init());
+			}));
+
+		return returnValue;
+	};
+
+	// create widget constructor
+	$[namespace] = $[namespace] || {};
+	$[namespace][name] = function(element, options) {
+		var self = this;
+
+		this.namespace = namespace;
+		this.widgetName = name;
+		this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
+		this.widgetBaseClass = fullName;
+
+		this.options = $.extend(true, {},
+			$.widget.defaults,
+			$[namespace][name].defaults,
+			$.metadata && $.metadata.get(element)[name],
+			options);
+
+		this.element = $(element)
+			.bind('setData.' + name, function(event, key, value) {
+				if (event.target == element) {
+					return self._setData(key, value);
+				}
+			})
+			.bind('getData.' + name, function(event, key) {
+				if (event.target == element) {
+					return self._getData(key);
+				}
+			})
+			.bind('remove.' + name, function() {
+				return self.destroy();
+			});
+	};
+
+	// add widget prototype
+	$[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
+};
+
+$.widget.prototype = {
+	_init: function() {},
+	destroy: function() {
+		this.element.removeData(this.widgetName)
+			.removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
+			.removeAttr('aria-disabled');
+
+		return this;
+	},
+
+	option: function(key, value) {
+		var options = key,
+			self = this;
+
+		if (typeof key == "string") {
+			if (value === undefined) {
+				return this._getData(key);
+			}
+			options = {};
+			options[key] = value;
+		}
+
+		$.each(options, function(key, value) {
+			self._setData(key, value);
+		});
+
+		return self;
+	},
+	_getData: function(key) {
+		return this.options[key];
+	},
+	_setData: function(key, value) {
+		this.options[key] = value;
+
+		if (key == 'disabled') {
+			this.element
+				[value ? 'addClass' : 'removeClass'](
+					this.widgetBaseClass + '-disabled' + ' ' +
+					this.namespace + '-state-disabled')
+				.attr("aria-disabled", value);
+		}
+	},
+
+	enable: function() {
+		this._setData('disabled', false);
+		return this;
+	},
+	disable: function() {
+		this._setData('disabled', true);
+		return this;
+	},
+
+	_trigger: function(type, event, data) {
+		var callback = this.options[type];
+
+		event = $.Event(event);
+		event.type = (type == this.widgetEventPrefix
+				? type : this.widgetEventPrefix + type).toLowerCase();
+		data = data || {};
+
+		// copy original event properties over to the new event
+		// this would happen if we could call $.event.fix instead of $.Event
+		// but we don't have a way to force an event to be fixed multiple times
+		if (event.originalEvent) {
+			for (var i = $.event.props.length, prop; i;) {
+				prop = $.event.props[--i];
+				event[prop] = event.originalEvent[prop];
+			}
+		}
+
+		this.element.trigger(event, data);
+
+		return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
+			|| event.isDefaultPrevented());
+	}
+};
+
+$.widget.defaults = {
+	disabled: false
+};
+
+
+/** Mouse Interaction Plugin **/
+
+$.ui.mouse = {
+	_mouseInit: function() {
+		var self = this;
+
+		this.element
+			.bind('mousedown.'+this.widgetName, function(event) {
+				return self._mouseDown(event);
+			})
+			.bind('click.'+this.widgetName, function(event) {
+				if(self._preventClickEvent) {
+					self._preventClickEvent = false;
+					event.stopImmediatePropagation();
+					return false;
+				}
+			});
+
+		// Prevent text selection in IE
+		if ($.browser.msie) {
+			this._mouseUnselectable = this.element.attr('unselectable');
+			this.element.attr('unselectable', 'on');
+		}
+
+		this.started = false;
+	},
+
+	// TODO: make sure destroying one instance of mouse doesn't mess with
+	// other instances of mouse
+	_mouseDestroy: function() {
+		this.element.unbind('.'+this.widgetName);
+
+		// Restore text selection in IE
+		($.browser.msie
+			&& this.element.attr('unselectable', this._mouseUnselectable));
+	},
+
+	_mouseDown: function(event) {
+		// don't let more than one widget handle mouseStart
+		// TODO: figure out why we have to use originalEvent
+		event.originalEvent = event.originalEvent || {};
+		if (event.originalEvent.mouseHandled) { return; }
+
+		// we may have missed mouseup (out of window)
+		(this._mouseStarted && this._mouseUp(event));
+
+		this._mouseDownEvent = event;
+
+		var self = this,
+			btnIsLeft = (event.which == 1),
+			elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
+		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
+			return true;
+		}
+
+		this.mouseDelayMet = !this.options.delay;
+		if (!this.mouseDelayMet) {
+			this._mouseDelayTimer = setTimeout(function() {
+				self.mouseDelayMet = true;
+			}, this.options.delay);
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted = (this._mouseStart(event) !== false);
+			if (!this._mouseStarted) {
+				event.preventDefault();
+				return true;
+			}
+		}
+
+		// these delegates are required to keep context
+		this._mouseMoveDelegate = function(event) {
+			return self._mouseMove(event);
+		};
+		this._mouseUpDelegate = function(event) {
+			return self._mouseUp(event);
+		};
+		$(document)
+			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		// preventDefault() is used to prevent the selection of text here -
+		// however, in Safari, this causes select boxes not to be selectable
+		// anymore, so this fix is needed
+		($.browser.safari || event.preventDefault());
+
+		event.originalEvent.mouseHandled = true;
+		return true;
+	},
+
+	_mouseMove: function(event) {
+		// IE mouseup check - mouseup happened when mouse was out of window
+		if ($.browser.msie && !event.button) {
+			return this._mouseUp(event);
+		}
+
+		if (this._mouseStarted) {
+			this._mouseDrag(event);
+			return event.preventDefault();
+		}
+
+		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
+			this._mouseStarted =
+				(this._mouseStart(this._mouseDownEvent, event) !== false);
+			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
+		}
+
+		return !this._mouseStarted;
+	},
+
+	_mouseUp: function(event) {
+		$(document)
+			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
+			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
+
+		if (this._mouseStarted) {
+			this._mouseStarted = false;
+			this._preventClickEvent = (event.target == this._mouseDownEvent.target);
+			this._mouseStop(event);
+		}
+
+		return false;
+	},
+
+	_mouseDistanceMet: function(event) {
+		return (Math.max(
+				Math.abs(this._mouseDownEvent.pageX - event.pageX),
+				Math.abs(this._mouseDownEvent.pageY - event.pageY)
+			) >= this.options.distance
+		);
+	},
+
+	_mouseDelayMet: function(event) {
+		return this.mouseDelayMet;
+	},
+
+	// These are placeholder methods, to be overriden by extending plugin
+	_mouseStart: function(event) {},
+	_mouseDrag: function(event) {},
+	_mouseStop: function(event) {},
+	_mouseCapture: function(event) { return true; }
+};
+
+$.ui.mouse.defaults = {
+	cancel: ':input,option',
+	distance: 1,
+	delay: 0
+};
+
+})(jQuery);
diff --git a/ui/jquery.ui.datepicker.js b/ui/jquery.ui.datepicker.js
new file mode 100644
index 000000000..fa2c701a0
--- /dev/null
+++ b/ui/jquery.ui.datepicker.js
@@ -0,0 +1,1684 @@
+/*
+ * jQuery UI Datepicker @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Datepicker
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+
+(function($) { // hide the namespace
+
+$.extend($.ui, { datepicker: { version: "@VERSION" } });
+
+var PROP_NAME = 'datepicker';
+
+/* Date picker manager.
+   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
+   Settings for (groups of) date pickers are maintained in an instance object,
+   allowing multiple different settings on the same page. */
+
+function Datepicker() {
+	this.debug = false; // Change this to true to start debugging
+	this._curInst = null; // The current instance in use
+	this._keyEvent = false; // If the last event was a key event
+	this._disabledInputs = []; // List of date picker inputs that have been disabled
+	this._datepickerShowing = false; // True if the popup picker is showing , false if not
+	this._inDialog = false; // True if showing within a "dialog", false if not
+	this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
+	this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
+	this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
+	this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
+	this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
+	this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
+	this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
+	this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
+	this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
+	this.regional = []; // Available regional settings, indexed by language code
+	this.regional[''] = { // Default regional settings
+		closeText: 'Done', // Display text for close link
+		prevText: 'Prev', // Display text for previous month link
+		nextText: 'Next', // Display text for next month link
+		currentText: 'Today', // Display text for current month link
+		monthNames: ['January','February','March','April','May','June',
+			'July','August','September','October','November','December'], // Names of months for drop-down and formatting
+		monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
+		dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
+		dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
+		dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
+		weekHeader: 'Wk', // Column header for week of the year
+		dateFormat: 'mm/dd/yy', // See format options on parseDate
+		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
+		isRTL: false, // True if right-to-left language, false if left-to-right
+		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
+		yearSuffix: '' // Additional text to append to the year in the month headers
+	};
+	this._defaults = { // Global defaults for all the date picker instances
+		showOn: 'focus', // 'focus' for popup on focus,
+			// 'button' for trigger button, or 'both' for either
+		showAnim: 'show', // Name of jQuery animation for popup
+		showOptions: {}, // Options for enhanced animations
+		defaultDate: null, // Used when field is blank: actual date,
+			// +/-number for offset from today, null for today
+		appendText: '', // Display text following the input box, e.g. showing the format
+		buttonText: '...', // Text for trigger button
+		buttonImage: '', // URL for trigger button image
+		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
+		hideIfNoPrevNext: false, // True to hide next/previous month links
+			// if not applicable, false to just disable them
+		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
+		gotoCurrent: false, // True if today link goes back to current selection instead
+		changeMonth: false, // True if month can be selected directly, false if only prev/next
+		changeYear: false, // True if year can be selected directly, false if only prev/next
+		yearRange: '-10:+10', // Range of years to display in drop-down,
+			// either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
+		showOtherMonths: false, // True to show dates in other months, false to leave blank
+		selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
+		showWeek: false, // True to show week of the year, false to not show it
+		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
+			// takes a Date and returns the number of the week for it
+		shortYearCutoff: '+10', // Short year values < this are in the current century,
+			// > this are in the previous century,
+			// string value starting with '+' for current year + value
+		minDate: null, // The earliest selectable date, or null for no limit
+		maxDate: null, // The latest selectable date, or null for no limit
+		duration: '_default', // Duration of display/closure
+		beforeShowDay: null, // Function that takes a date and returns an array with
+			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
+			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
+		beforeShow: null, // Function that takes an input field and
+			// returns a set of custom settings for the date picker
+		onSelect: null, // Define a callback function when a date is selected
+		onChangeMonthYear: null, // Define a callback function when the month or year is changed
+		onClose: null, // Define a callback function when the datepicker is closed
+		numberOfMonths: 1, // Number of months to show at a time
+		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
+		stepMonths: 1, // Number of months to step back/forward
+		stepBigMonths: 12, // Number of months to step back/forward for the big links
+		altField: '', // Selector for an alternate field to store selected dates into
+		altFormat: '', // The date format to use for the alternate field
+		constrainInput: true, // The input is constrained by the current date format
+		showButtonPanel: false, // True to show button panel, false to not show it
+		autoSize: false // True to size the input for the date format, false to leave as is
+	};
+	$.extend(this._defaults, this.regional['']);
+	this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
+}
+
+$.extend(Datepicker.prototype, {
+	/* Class name added to elements to indicate already configured with a date picker. */
+	markerClassName: 'hasDatepicker',
+
+	/* Debug logging (if enabled). */
+	log: function () {
+		if (this.debug)
+			console.log.apply('', arguments);
+	},
+
+	/* Override the default settings for all instances of the date picker.
+	   @param  settings  object - the new settings to use as defaults (anonymous object)
+	   @return the manager object */
+	setDefaults: function(settings) {
+		extendRemove(this._defaults, settings || {});
+		return this;
+	},
+
+	/* Attach the date picker to a jQuery selection.
+	   @param  target    element - the target input field or division or span
+	   @param  settings  object - the new settings to use for this date picker instance (anonymous) */
+	_attachDatepicker: function(target, settings) {
+		// check for settings on the control itself - in namespace 'date:'
+		var inlineSettings = null;
+		for (var attrName in this._defaults) {
+			var attrValue = target.getAttribute('date:' + attrName);
+			if (attrValue) {
+				inlineSettings = inlineSettings || {};
+				try {
+					inlineSettings[attrName] = eval(attrValue);
+				} catch (err) {
+					inlineSettings[attrName] = attrValue;
+				}
+			}
+		}
+		var nodeName = target.nodeName.toLowerCase();
+		var inline = (nodeName == 'div' || nodeName == 'span');
+		if (!target.id)
+			target.id = 'dp' + (++this.uuid);
+		var inst = this._newInst($(target), inline);
+		inst.settings = $.extend({}, settings || {}, inlineSettings || {});
+		if (nodeName == 'input') {
+			this._connectDatepicker(target, inst);
+		} else if (inline) {
+			this._inlineDatepicker(target, inst);
+		}
+	},
+
+	/* Create a new instance object. */
+	_newInst: function(target, inline) {
+		var id = target[0].id.replace(/([:\[\]\.\$])/g, '\\\\$1'); // escape jQuery meta chars
+		return {id: id, input: target, // associated target
+			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
+			drawMonth: 0, drawYear: 0, // month being drawn
+			inline: inline, // is datepicker inline or not
+			dpDiv: (!inline ? this.dpDiv : // presentation div
+			$('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
+	},
+
+	/* Attach the date picker to an input field. */
+	_connectDatepicker: function(target, inst) {
+		var input = $(target);
+		inst.append = $([]);
+		inst.trigger = $([]);
+		if (input.hasClass(this.markerClassName))
+			return;
+		var appendText = this._get(inst, 'appendText');
+		var isRTL = this._get(inst, 'isRTL');
+		if (appendText) {
+			inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
+			input[isRTL ? 'before' : 'after'](inst.append);
+		}
+		var showOn = this._get(inst, 'showOn');
+		if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
+			input.focus(this._showDatepicker);
+		if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
+			var buttonText = this._get(inst, 'buttonText');
+			var buttonImage = this._get(inst, 'buttonImage');
+			inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
+				$('<img/>').addClass(this._triggerClass).
+					attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
+				$('<button type="button"></button>').addClass(this._triggerClass).
+					html(buttonImage == '' ? buttonText : $('<img/>').attr(
+					{ src:buttonImage, alt:buttonText, title:buttonText })));
+			input[isRTL ? 'before' : 'after'](inst.trigger);
+			inst.trigger.click(function() {
+				if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
+					$.datepicker._hideDatepicker();
+				else
+					$.datepicker._showDatepicker(target);
+				return false;
+			});
+		}
+		input.addClass(this.markerClassName).keydown(this._doKeyDown).
+			keypress(this._doKeyPress).keyup(this._doKeyUp).
+			bind("setData.datepicker", function(event, key, value) {
+				inst.settings[key] = value;
+			}).bind("getData.datepicker", function(event, key) {
+				return this._get(inst, key);
+			});
+		this._autoSize(inst);
+		$.data(target, PROP_NAME, inst);
+	},
+
+	/* Apply the maximum length for the date format. */
+	_autoSize: function(inst) {
+		if (this._get(inst, 'autoSize') && !inst.inline) {
+			var date = new Date(2009, 12 - 1, 20); // Ensure double digits
+			var dateFormat = this._get(inst, 'dateFormat');
+			if (dateFormat.match(/[DM]/)) {
+				var findMax = function(names) {
+					var max = 0;
+					var maxI = 0;
+					for (var i = 0; i < names.length; i++) {
+						if (names[i].length > max) {
+							max = names[i].length;
+							maxI = i;
+						}
+					}
+					return maxI;
+				};
+				date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
+					'monthNames' : 'monthNamesShort'))));
+				date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
+					'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
+			}
+			inst.input.attr('size', this._formatDate(inst, date).length);
+		}
+	},
+
+	/* Attach an inline date picker to a div. */
+	_inlineDatepicker: function(target, inst) {
+		var divSpan = $(target);
+		if (divSpan.hasClass(this.markerClassName))
+			return;
+		divSpan.addClass(this.markerClassName).append(inst.dpDiv).
+			bind("setData.datepicker", function(event, key, value){
+				inst.settings[key] = value;
+			}).bind("getData.datepicker", function(event, key){
+				return this._get(inst, key);
+			});
+		$.data(target, PROP_NAME, inst);
+		this._setDate(inst, this._getDefaultDate(inst));
+		this._updateDatepicker(inst);
+		this._updateAlternate(inst);
+	},
+
+	/* Pop-up the date picker in a "dialog" box.
+	   @param  input     element - ignored
+	   @param  date      string or Date - the initial date to display
+	   @param  onSelect  function - the function to call when a date is selected
+	   @param  settings  object - update the dialog date picker instance's settings (anonymous object)
+	   @param  pos       int[2] - coordinates for the dialog's position within the screen or
+	                     event - with x/y coordinates or
+	                     leave empty for default (screen centre)
+	   @return the manager object */
+	_dialogDatepicker: function(input, date, onSelect, settings, pos) {
+		var inst = this._dialogInst; // internal instance
+		if (!inst) {
+			var id = 'dp' + (++this.uuid);
+			this._dialogInput = $('<input type="text" id="' + id +
+				'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
+			this._dialogInput.keydown(this._doKeyDown);
+			$('body').append(this._dialogInput);
+			inst = this._dialogInst = this._newInst(this._dialogInput, false);
+			inst.settings = {};
+			$.data(this._dialogInput[0], PROP_NAME, inst);
+		}
+		extendRemove(inst.settings, settings || {});
+		date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
+		this._dialogInput.val(date);
+
+		this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
+		if (!this._pos) {
+			var browserWidth = document.documentElement.clientWidth;
+			var browserHeight = document.documentElement.clientHeight;
+			var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
+			var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
+			this._pos = // should use actual width/height below
+				[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
+		}
+
+		// move input on screen for focus, but hidden behind dialog
+		this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
+		inst.settings.onSelect = onSelect;
+		this._inDialog = true;
+		this.dpDiv.addClass(this._dialogClass);
+		this._showDatepicker(this._dialogInput[0]);
+		if ($.blockUI)
+			$.blockUI(this.dpDiv);
+		$.data(this._dialogInput[0], PROP_NAME, inst);
+		return this;
+	},
+
+	/* Detach a datepicker from its control.
+	   @param  target    element - the target input field or division or span */
+	_destroyDatepicker: function(target) {
+		var $target = $(target);
+		var inst = $.data(target, PROP_NAME);
+		if (!$target.hasClass(this.markerClassName)) {
+			return;
+		}
+		var nodeName = target.nodeName.toLowerCase();
+		$.removeData(target, PROP_NAME);
+		if (nodeName == 'input') {
+			inst.append.remove();
+			inst.trigger.remove();
+			$target.removeClass(this.markerClassName).
+				unbind('focus', this._showDatepicker).
+				unbind('keydown', this._doKeyDown).
+				unbind('keypress', this._doKeyPress).
+				unbind('keyup', this._doKeyUp);
+		} else if (nodeName == 'div' || nodeName == 'span')
+			$target.removeClass(this.markerClassName).empty();
+	},
+
+	/* Enable the date picker to a jQuery selection.
+	   @param  target    element - the target input field or division or span */
+	_enableDatepicker: function(target) {
+		var $target = $(target);
+		var inst = $.data(target, PROP_NAME);
+		if (!$target.hasClass(this.markerClassName)) {
+			return;
+		}
+		var nodeName = target.nodeName.toLowerCase();
+		if (nodeName == 'input') {
+			target.disabled = false;
+			inst.trigger.filter('button').
+				each(function() { this.disabled = false; }).end().
+				filter('img').css({opacity: '1.0', cursor: ''});
+		}
+		else if (nodeName == 'div' || nodeName == 'span') {
+			var inline = $target.children('.' + this._inlineClass);
+			inline.children().removeClass('ui-state-disabled');
+		}
+		this._disabledInputs = $.map(this._disabledInputs,
+			function(value) { return (value == target ? null : value); }); // delete entry
+	},
+
+	/* Disable the date picker to a jQuery selection.
+	   @param  target    element - the target input field or division or span */
+	_disableDatepicker: function(target) {
+		var $target = $(target);
+		var inst = $.data(target, PROP_NAME);
+		if (!$target.hasClass(this.markerClassName)) {
+			return;
+		}
+		var nodeName = target.nodeName.toLowerCase();
+		if (nodeName == 'input') {
+			target.disabled = true;
+			inst.trigger.filter('button').
+				each(function() { this.disabled = true; }).end().
+				filter('img').css({opacity: '0.5', cursor: 'default'});
+		}
+		else if (nodeName == 'div' || nodeName == 'span') {
+			var inline = $target.children('.' + this._inlineClass);
+			inline.children().addClass('ui-state-disabled');
+		}
+		this._disabledInputs = $.map(this._disabledInputs,
+			function(value) { return (value == target ? null : value); }); // delete entry
+		this._disabledInputs[this._disabledInputs.length] = target;
+	},
+
+	/* Is the first field in a jQuery collection disabled as a datepicker?
+	   @param  target    element - the target input field or division or span
+	   @return boolean - true if disabled, false if enabled */
+	_isDisabledDatepicker: function(target) {
+		if (!target) {
+			return false;
+		}
+		for (var i = 0; i < this._disabledInputs.length; i++) {
+			if (this._disabledInputs[i] == target)
+				return true;
+		}
+		return false;
+	},
+
+	/* Retrieve the instance data for the target control.
+	   @param  target  element - the target input field or division or span
+	   @return  object - the associated instance data
+	   @throws  error if a jQuery problem getting data */
+	_getInst: function(target) {
+		try {
+			return $.data(target, PROP_NAME);
+		}
+		catch (err) {
+			throw 'Missing instance data for this datepicker';
+		}
+	},
+
+	/* Update or retrieve the settings for a date picker attached to an input field or division.
+	   @param  target  element - the target input field or division or span
+	   @param  name    object - the new settings to update or
+	                   string - the name of the setting to change or retrieve,
+	                   when retrieving also 'all' for all instance settings or
+	                   'defaults' for all global defaults
+	   @param  value   any - the new value for the setting
+	                   (omit if above is an object or to retrieve a value) */
+	_optionDatepicker: function(target, name, value) {
+		var inst = this._getInst(target);
+		if (arguments.length == 2 && typeof name == 'string') {
+			return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
+				(inst ? (name == 'all' ? $.extend({}, inst.settings) :
+				this._get(inst, name)) : null));
+		}
+		var settings = name || {};
+		if (typeof name == 'string') {
+			settings = {};
+			settings[name] = value;
+		}
+		if (inst) {
+			if (this._curInst == inst) {
+				this._hideDatepicker(null);
+			}
+			var date = this._getDateDatepicker(target);
+			extendRemove(inst.settings, settings);
+			this._autoSize(inst);
+			this._setDateDatepicker(target, date);
+			this._updateDatepicker(inst);
+		}
+	},
+
+	// change method deprecated
+	_changeDatepicker: function(target, name, value) {
+		this._optionDatepicker(target, name, value);
+	},
+
+	/* Redraw the date picker attached to an input field or division.
+	   @param  target  element - the target input field or division or span */
+	_refreshDatepicker: function(target) {
+		var inst = this._getInst(target);
+		if (inst) {
+			this._updateDatepicker(inst);
+		}
+	},
+
+	/* Set the dates for a jQuery selection.
+	   @param  target   element - the target input field or division or span
+	   @param  date     Date - the new date */
+	_setDateDatepicker: function(target, date) {
+		var inst = this._getInst(target);
+		if (inst) {
+			this._setDate(inst, date);
+			this._updateDatepicker(inst);
+			this._updateAlternate(inst);
+		}
+	},
+
+	/* Get the date(s) for the first entry in a jQuery selection.
+	   @param  target  element - the target input field or division or span
+	   @return Date - the current date */
+	_getDateDatepicker: function(target) {
+		var inst = this._getInst(target);
+		if (inst && !inst.inline)
+			this._setDateFromField(inst);
+		return (inst ? this._getDate(inst) : null);
+	},
+
+	/* Handle keystrokes. */
+	_doKeyDown: function(event) {
+		var inst = $.datepicker._getInst(event.target);
+		var handled = true;
+		var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
+		inst._keyEvent = true;
+		if ($.datepicker._datepickerShowing)
+			switch (event.keyCode) {
+				case 9:  $.datepicker._hideDatepicker(null, '');
+						break; // hide on tab out
+				case 13: var sel = $('td.' + $.datepicker._dayOverClass +
+							', td.' + $.datepicker._currentClass, inst.dpDiv);
+						if (sel[0])
+							$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
+						else
+							$.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+						return false; // don't submit the form
+						break; // select the value on enter
+				case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
+						break; // hide on escape
+				case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+							-$.datepicker._get(inst, 'stepBigMonths') :
+							-$.datepicker._get(inst, 'stepMonths')), 'M');
+						break; // previous month/year on page up/+ ctrl
+				case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+							+$.datepicker._get(inst, 'stepBigMonths') :
+							+$.datepicker._get(inst, 'stepMonths')), 'M');
+						break; // next month/year on page down/+ ctrl
+				case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
+						handled = event.ctrlKey || event.metaKey;
+						break; // clear on ctrl or command +end
+				case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
+						handled = event.ctrlKey || event.metaKey;
+						break; // current on ctrl or command +home
+				case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
+						handled = event.ctrlKey || event.metaKey;
+						// -1 day on ctrl or command +left
+						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+									-$.datepicker._get(inst, 'stepBigMonths') :
+									-$.datepicker._get(inst, 'stepMonths')), 'M');
+						// next month/year on alt +left on Mac
+						break;
+				case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
+						handled = event.ctrlKey || event.metaKey;
+						break; // -1 week on ctrl or command +up
+				case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
+						handled = event.ctrlKey || event.metaKey;
+						// +1 day on ctrl or command +right
+						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
+									+$.datepicker._get(inst, 'stepBigMonths') :
+									+$.datepicker._get(inst, 'stepMonths')), 'M');
+						// next month/year on alt +right
+						break;
+				case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
+						handled = event.ctrlKey || event.metaKey;
+						break; // +1 week on ctrl or command +down
+				default: handled = false;
+			}
+		else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
+			$.datepicker._showDatepicker(this);
+		else {
+			handled = false;
+		}
+		if (handled) {
+			event.preventDefault();
+			event.stopPropagation();
+		}
+	},
+
+	/* Filter entered characters - based on date format. */
+	_doKeyPress: function(event) {
+		var inst = $.datepicker._getInst(event.target);
+		if ($.datepicker._get(inst, 'constrainInput')) {
+			var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
+			var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
+			return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
+		}
+	},
+
+	/* Synchronise manual entry and field/alternate field. */
+	_doKeyUp: function(event) {
+		var inst = $.datepicker._getInst(event.target);
+		try {
+			var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+				(inst.input ? inst.input.val() : null),
+				$.datepicker._getFormatConfig(inst));
+			if (date) { // only if valid
+				$.datepicker._setDateFromField(inst);
+				$.datepicker._updateAlternate(inst);
+				$.datepicker._updateDatepicker(inst);
+			}
+		}
+		catch (event) {
+			$.datepicker.log(event);
+		}
+		return true;
+	},
+
+	/* Pop-up the date picker for a given input field.
+	   @param  input  element - the input field attached to the date picker or
+	                  event - if triggered by focus */
+	_showDatepicker: function(input) {
+		input = input.target || input;
+		if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
+			input = $('input', input.parentNode)[0];
+		if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
+			return;
+		var inst = $.datepicker._getInst(input);
+		var beforeShow = $.datepicker._get(inst, 'beforeShow');
+		extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
+		$.datepicker._hideDatepicker(null, '');
+		$.datepicker._lastInput = input;
+		$.datepicker._setDateFromField(inst);
+		if ($.datepicker._inDialog) // hide cursor
+			input.value = '';
+		if (!$.datepicker._pos) { // position below input
+			$.datepicker._pos = $.datepicker._findPos(input);
+			$.datepicker._pos[1] += input.offsetHeight; // add the height
+		}
+		var isFixed = false;
+		$(input).parents().each(function() {
+			isFixed |= $(this).css('position') == 'fixed';
+			return !isFixed;
+		});
+		if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
+			$.datepicker._pos[0] -= document.documentElement.scrollLeft;
+			$.datepicker._pos[1] -= document.documentElement.scrollTop;
+		}
+		var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
+		$.datepicker._pos = null;
+		// determine sizing offscreen
+		inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
+		$.datepicker._updateDatepicker(inst);
+		// fix width for dynamic number of date pickers
+		// and adjust position before showing
+		offset = $.datepicker._checkOffset(inst, offset, isFixed);
+		inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
+			'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
+			left: offset.left + 'px', top: offset.top + 'px'});
+		if (!inst.inline) {
+			var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
+			var duration = $.datepicker._get(inst, 'duration');
+			var postProcess = function() {
+				$.datepicker._datepickerShowing = true;
+				var borders = $.datepicker._getBorders(inst.dpDiv);
+				inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
+					css({left: -borders[0], top: -borders[1],
+						width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
+			};
+			if ($.effects && $.effects[showAnim])
+				inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
+			else
+				inst.dpDiv[showAnim](duration, postProcess);
+			if (duration == '')
+				postProcess();
+			if (inst.input[0].type != 'hidden')
+				inst.input[0].focus();
+			$.datepicker._curInst = inst;
+		}
+	},
+
+	/* Generate the date picker content. */
+	_updateDatepicker: function(inst) {
+		var self = this;
+		var borders = $.datepicker._getBorders(inst.dpDiv);
+		inst.dpDiv.empty().append(this._generateHTML(inst))
+			.find('iframe.ui-datepicker-cover') // IE6- only
+				.css({left: -borders[0], top: -borders[1],
+					width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
+			.end()
+			.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
+				.bind('mouseout', function(){
+					$(this).removeClass('ui-state-hover');
+					if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
+					if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
+				})
+				.bind('mouseover', function(){
+					if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
+						$(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
+						$(this).addClass('ui-state-hover');
+						if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
+						if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
+					}
+				})
+			.end()
+			.find('.' + this._dayOverClass + ' a')
+				.trigger('mouseover')
+			.end();
+		var numMonths = this._getNumberOfMonths(inst);
+		var cols = numMonths[1];
+		var width = 17;
+		if (cols > 1)
+			inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
+		else
+			inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
+		inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
+			'Class']('ui-datepicker-multi');
+		inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
+			'Class']('ui-datepicker-rtl');
+		if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
+			$(inst.input[0]).focus();
+	},
+
+	/* Retrieve the size of left and top borders for an element.
+	   @param  elem  (jQuery object) the element of interest
+	   @return  (number[2]) the left and top borders */
+	_getBorders: function(elem) {
+		var convert = function(value) {
+			return {thin: 1, medium: 2, thick: 3}[value] || value;
+		};
+		return [parseFloat(convert(elem.css('border-left-width'))),
+			parseFloat(convert(elem.css('border-top-width')))];
+	},
+
+	/* Check positioning to remain on screen. */
+	_checkOffset: function(inst, offset, isFixed) {
+		var dpWidth = inst.dpDiv.outerWidth();
+		var dpHeight = inst.dpDiv.outerHeight();
+		var inputWidth = inst.input ? inst.input.outerWidth() : 0;
+		var inputHeight = inst.input ? inst.input.outerHeight() : 0;
+		var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
+		var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
+
+		offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
+		offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
+		offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
+
+		// now check if datepicker is showing outside window viewport - move to a better place if so.
+		offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
+			Math.abs(offset.left + dpWidth - viewWidth) : 0);
+		offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
+			Math.abs(offset.top + dpHeight + inputHeight * 2 - viewHeight) : 0);
+
+		return offset;
+	},
+
+	/* Find an object's position on the screen. */
+	_findPos: function(obj) {
+        while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
+            obj = obj.nextSibling;
+        }
+        var position = $(obj).offset();
+	    return [position.left, position.top];
+	},
+
+	/* Hide the date picker from view.
+	   @param  input  element - the input field attached to the date picker
+	   @param  duration  string - the duration over which to close the date picker */
+	_hideDatepicker: function(input, duration) {
+		var inst = this._curInst;
+		if (!inst || (input && inst != $.data(input, PROP_NAME)))
+			return;
+		if (this._datepickerShowing) {
+			duration = (duration != null ? duration : this._get(inst, 'duration'));
+			var showAnim = this._get(inst, 'showAnim');
+			var postProcess = function() {
+				$.datepicker._tidyDialog(inst);
+			};
+			if (duration != '' && $.effects && $.effects[showAnim])
+				inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
+					duration, postProcess);
+			else
+				inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
+					(showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
+			if (duration == '')
+				this._tidyDialog(inst);
+			var onClose = this._get(inst, 'onClose');
+			if (onClose)
+				onClose.apply((inst.input ? inst.input[0] : null),
+					[(inst.input ? inst.input.val() : ''), inst]);  // trigger custom callback
+			this._datepickerShowing = false;
+			this._lastInput = null;
+			if (this._inDialog) {
+				this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
+				if ($.blockUI) {
+					$.unblockUI();
+					$('body').append(this.dpDiv);
+				}
+			}
+			this._inDialog = false;
+		}
+		this._curInst = null;
+	},
+
+	/* Tidy up after a dialog display. */
+	_tidyDialog: function(inst) {
+		inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
+	},
+
+	/* Close date picker if clicked elsewhere. */
+	_checkExternalClick: function(event) {
+		if (!$.datepicker._curInst)
+			return;
+		var $target = $(event.target);
+		if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
+				!$target.hasClass($.datepicker.markerClassName) &&
+				!$target.hasClass($.datepicker._triggerClass) &&
+				$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
+			$.datepicker._hideDatepicker(null, '');
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustDate: function(id, offset, period) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		if (this._isDisabledDatepicker(target[0])) {
+			return;
+		}
+		this._adjustInstDate(inst, offset +
+			(period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
+			period);
+		this._updateDatepicker(inst);
+	},
+
+	/* Action for current link. */
+	_gotoToday: function(id) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
+			inst.selectedDay = inst.currentDay;
+			inst.drawMonth = inst.selectedMonth = inst.currentMonth;
+			inst.drawYear = inst.selectedYear = inst.currentYear;
+		}
+		else {
+		var date = new Date();
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		}
+		this._notifyChange(inst);
+		this._adjustDate(target);
+	},
+
+	/* Action for selecting a new month/year. */
+	_selectMonthYear: function(id, select, period) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		inst._selectingMonthYear = false;
+		inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
+		inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
+			parseInt(select.options[select.selectedIndex].value,10);
+		this._notifyChange(inst);
+		this._adjustDate(target);
+	},
+
+	/* Restore input focus after not changing month/year. */
+	_clickMonthYear: function(id) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		if (inst.input && inst._selectingMonthYear && !$.browser.msie)
+			inst.input[0].focus();
+		inst._selectingMonthYear = !inst._selectingMonthYear;
+	},
+
+	/* Action for selecting a day. */
+	_selectDay: function(id, month, year, td) {
+		var target = $(id);
+		if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
+			return;
+		}
+		var inst = this._getInst(target[0]);
+		inst.selectedDay = inst.currentDay = $('a', td).html();
+		inst.selectedMonth = inst.currentMonth = month;
+		inst.selectedYear = inst.currentYear = year;
+		this._selectDate(id, this._formatDate(inst,
+			inst.currentDay, inst.currentMonth, inst.currentYear));
+	},
+
+	/* Erase the input field and hide the date picker. */
+	_clearDate: function(id) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		this._selectDate(target, '');
+	},
+
+	/* Update the input field with the selected date. */
+	_selectDate: function(id, dateStr) {
+		var target = $(id);
+		var inst = this._getInst(target[0]);
+		dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
+		if (inst.input)
+			inst.input.val(dateStr);
+		this._updateAlternate(inst);
+		var onSelect = this._get(inst, 'onSelect');
+		if (onSelect)
+			onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);  // trigger custom callback
+		else if (inst.input)
+			inst.input.trigger('change'); // fire the change event
+		if (inst.inline)
+			this._updateDatepicker(inst);
+		else {
+			this._hideDatepicker(null, this._get(inst, 'duration'));
+			this._lastInput = inst.input[0];
+			if (typeof(inst.input[0]) != 'object')
+				inst.input[0].focus(); // restore focus
+			this._lastInput = null;
+		}
+	},
+
+	/* Update any alternate field to synchronise with the main field. */
+	_updateAlternate: function(inst) {
+		var altField = this._get(inst, 'altField');
+		if (altField) { // update alternate field too
+			var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
+			var date = this._getDate(inst);
+			var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
+			$(altField).each(function() { $(this).val(dateStr); });
+		}
+	},
+
+	/* Set as beforeShowDay function to prevent selection of weekends.
+	   @param  date  Date - the date to customise
+	   @return [boolean, string] - is this date selectable?, what is its CSS class? */
+	noWeekends: function(date) {
+		var day = date.getDay();
+		return [(day > 0 && day < 6), ''];
+	},
+
+	/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
+	   @param  date  Date - the date to get the week for
+	   @return  number - the number of the week within the year that contains this date */
+	iso8601Week: function(date) {
+		var checkDate = new Date(date.getTime());
+		// Find Thursday of this week starting on Monday
+		checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
+		var time = checkDate.getTime();
+		checkDate.setMonth(0); // Compare with Jan 1
+		checkDate.setDate(1);
+		return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
+	},
+
+	/* Parse a string value into a date object.
+	   See formatDate below for the possible formats.
+
+	   @param  format    string - the expected format of the date
+	   @param  value     string - the date in the above format
+	   @param  settings  Object - attributes include:
+	                     shortYearCutoff  number - the cutoff year for determining the century (optional)
+	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
+	                     dayNames         string[7] - names of the days from Sunday (optional)
+	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
+	                     monthNames       string[12] - names of the months (optional)
+	   @return  Date - the extracted date value or null if value is blank */
+	parseDate: function (format, value, settings) {
+		if (format == null || value == null)
+			throw 'Invalid arguments';
+		value = (typeof value == 'object' ? value.toString() : value + '');
+		if (value == '')
+			return null;
+		var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
+		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+		var year = -1;
+		var month = -1;
+		var day = -1;
+		var doy = -1;
+		var literal = false;
+		// Check whether a format character is doubled
+		var lookAhead = function(match) {
+			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+			if (matches)
+				iFormat++;
+			return matches;
+		};
+		// Extract a number from the string value
+		var getNumber = function(match) {
+			lookAhead(match);
+			var size = (match == '@' ? 14 : (match == '!' ? 20 :
+				(match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
+			var digits = new RegExp('^\\d{1,' + size + '}');
+			var num = value.substring(iValue).match(digits);
+			if (!num)
+				throw 'Missing number at position ' + iValue;
+			iValue += num[0].length;
+			return parseInt(num[0], 10);
+		};
+		// Extract a name from the string value and convert to an index
+		var getName = function(match, shortNames, longNames) {
+			var names = (lookAhead(match) ? longNames : shortNames);
+			for (var i = 0; i < names.length; i++) {
+				if (value.substr(iValue, names[i].length) == names[i]) {
+					iValue += names[i].length;
+					return i + 1;
+				}
+			}
+			throw 'Unknown name at position ' + iValue;
+		};
+		// Confirm that a literal character matches the string value
+		var checkLiteral = function() {
+			if (value.charAt(iValue) != format.charAt(iFormat))
+				throw 'Unexpected literal at position ' + iValue;
+			iValue++;
+		};
+		var iValue = 0;
+		for (var iFormat = 0; iFormat < format.length; iFormat++) {
+			if (literal)
+				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+					literal = false;
+				else
+					checkLiteral();
+			else
+				switch (format.charAt(iFormat)) {
+					case 'd':
+						day = getNumber('d');
+						break;
+					case 'D':
+						getName('D', dayNamesShort, dayNames);
+						break;
+					case 'o':
+						doy = getNumber('o');
+						break;
+					case 'm':
+						month = getNumber('m');
+						break;
+					case 'M':
+						month = getName('M', monthNamesShort, monthNames);
+						break;
+					case 'y':
+						year = getNumber('y');
+						break;
+					case '@':
+						var date = new Date(getNumber('@'));
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case '!':
+						var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
+						year = date.getFullYear();
+						month = date.getMonth() + 1;
+						day = date.getDate();
+						break;
+					case "'":
+						if (lookAhead("'"))
+							checkLiteral();
+						else
+							literal = true;
+						break;
+					default:
+						checkLiteral();
+				}
+		}
+		if (year == -1)
+			year = new Date().getFullYear();
+		else if (year < 100)
+			year += new Date().getFullYear() - new Date().getFullYear() % 100 +
+				(year <= shortYearCutoff ? 0 : -100);
+		if (doy > -1) {
+			month = 1;
+			day = doy;
+			do {
+				var dim = this._getDaysInMonth(year, month - 1);
+				if (day <= dim)
+					break;
+				month++;
+				day -= dim;
+			} while (true);
+		}
+		var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
+		if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
+			throw 'Invalid date'; // E.g. 31/02/*
+		return date;
+	},
+
+	/* Standard date formats. */
+	ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
+	COOKIE: 'D, dd M yy',
+	ISO_8601: 'yy-mm-dd',
+	RFC_822: 'D, d M y',
+	RFC_850: 'DD, dd-M-y',
+	RFC_1036: 'D, d M y',
+	RFC_1123: 'D, d M yy',
+	RFC_2822: 'D, d M yy',
+	RSS: 'D, d M y', // RFC 822
+	TICKS: '!',
+	TIMESTAMP: '@',
+	W3C: 'yy-mm-dd', // ISO 8601
+
+	_ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
+		Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
+
+	/* Format a date object into a string value.
+	   The format can be combinations of the following:
+	   d  - day of month (no leading zero)
+	   dd - day of month (two digit)
+	   o  - day of year (no leading zeros)
+	   oo - day of year (three digit)
+	   D  - day name short
+	   DD - day name long
+	   m  - month of year (no leading zero)
+	   mm - month of year (two digit)
+	   M  - month name short
+	   MM - month name long
+	   y  - year (two digit)
+	   yy - year (four digit)
+	   @ - Unix timestamp (ms since 01/01/1970)
+	   ! - Windows ticks (100ns since 01/01/0001)
+	   '...' - literal text
+	   '' - single quote
+
+	   @param  format    string - the desired format of the date
+	   @param  date      Date - the date value to format
+	   @param  settings  Object - attributes include:
+	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
+	                     dayNames         string[7] - names of the days from Sunday (optional)
+	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
+	                     monthNames       string[12] - names of the months (optional)
+	   @return  string - the date in the above format */
+	formatDate: function (format, date, settings) {
+		if (!date)
+			return '';
+		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
+		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
+		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
+		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
+		// Check whether a format character is doubled
+		var lookAhead = function(match) {
+			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
+			if (matches)
+				iFormat++;
+			return matches;
+		};
+		// Format a number, with leading zero if necessary
+		var formatNumber = function(match, value, len) {
+			var num = '' + value;
+			if (lookAhead(match))
+				while (num.length < len)
+					num = '0' + num;
+			return num;
+		};
+		// Format a name, short or long as requested
+		var formatName = function(match, value, shortNames, longNames) {
+			return (lookAhead(match) ? longNames[value] : shortNames[value]);
+		};
+		var output = '';
+		var literal = false;
+		if (date)
+			for (var iFormat = 0; iFormat < format.length; iFormat++) {
+				if (literal)
+					if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+						literal = false;
+					else
+						output += format.charAt(iFormat);
+				else
+					switch (format.charAt(iFormat)) {
+						case 'd':
+							output += formatNumber('d', date.getDate(), 2);
+							break;
+						case 'D':
+							output += formatName('D', date.getDay(), dayNamesShort, dayNames);
+							break;
+						case 'o':
+							output += formatNumber('o',
+								(date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
+							break;
+						case 'm':
+							output += formatNumber('m', date.getMonth() + 1, 2);
+							break;
+						case 'M':
+							output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
+							break;
+						case 'y':
+							output += (lookAhead('y') ? date.getFullYear() :
+								(date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
+							break;
+						case '@':
+							output += date.getTime();
+							break;
+						case '!':
+							output += date.getTime() * 10000 + this._ticksTo1970;
+							break;
+						case "'":
+							if (lookAhead("'"))
+								output += "'";
+							else
+								literal = true;
+							break;
+						default:
+							output += format.charAt(iFormat);
+					}
+			}
+		return output;
+	},
+
+	/* Extract all possible characters from the date format. */
+	_possibleChars: function (format) {
+		var chars = '';
+		var literal = false;
+		for (var iFormat = 0; iFormat < format.length; iFormat++)
+			if (literal)
+				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
+					literal = false;
+				else
+					chars += format.charAt(iFormat);
+			else
+				switch (format.charAt(iFormat)) {
+					case 'd': case 'm': case 'y': case '@':
+						chars += '0123456789';
+						break;
+					case 'D': case 'M':
+						return null; // Accept anything
+					case "'":
+						if (lookAhead("'"))
+							chars += "'";
+						else
+							literal = true;
+						break;
+					default:
+						chars += format.charAt(iFormat);
+				}
+		return chars;
+	},
+
+	/* Get a setting value, defaulting if necessary. */
+	_get: function(inst, name) {
+		return inst.settings[name] !== undefined ?
+			inst.settings[name] : this._defaults[name];
+	},
+
+	/* Parse existing date and initialise date picker. */
+	_setDateFromField: function(inst) {
+		var dateFormat = this._get(inst, 'dateFormat');
+		var dates = inst.input ? inst.input.val() : null;
+		var date, defaultDate;
+		date = defaultDate = this._getDefaultDate(inst);
+		var settings = this._getFormatConfig(inst);
+		try {
+			date = this.parseDate(dateFormat, dates, settings) || defaultDate;
+		} catch (event) {
+			this.log(event);
+			date = defaultDate;
+		}
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		inst.currentDay = (dates ? date.getDate() : 0);
+		inst.currentMonth = (dates ? date.getMonth() : 0);
+		inst.currentYear = (dates ? date.getFullYear() : 0);
+		this._adjustInstDate(inst);
+	},
+
+	/* Retrieve the default date shown on opening. */
+	_getDefaultDate: function(inst) {
+		return this._restrictMinMax(inst,
+			this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
+	},
+
+	/* A date may be specified as an exact value or a relative one. */
+	_determineDate: function(inst, date, defaultDate) {
+		var offsetNumeric = function(offset) {
+			var date = new Date();
+			date.setDate(date.getDate() + offset);
+			return date;
+		};
+		var offsetString = function(offset) {
+			try {
+				return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
+					offset, $.datepicker._getFormatConfig(inst));
+			}
+			catch (e) {
+				// Ignore
+			}
+			var date = (offset.toLowerCase().match(/^c/) ?
+				$.datepicker._getDate(inst) : null) || new Date();
+			var year = date.getFullYear();
+			var month = date.getMonth();
+			var day = date.getDate();
+			var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
+			var matches = pattern.exec(offset);
+			while (matches) {
+				switch (matches[2] || 'd') {
+					case 'd' : case 'D' :
+						day += parseInt(matches[1],10); break;
+					case 'w' : case 'W' :
+						day += parseInt(matches[1],10) * 7; break;
+					case 'm' : case 'M' :
+						month += parseInt(matches[1],10);
+						day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+						break;
+					case 'y': case 'Y' :
+						year += parseInt(matches[1],10);
+						day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
+						break;
+				}
+				matches = pattern.exec(offset);
+			}
+			return new Date(year, month, day);
+		};
+		date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
+			(typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
+		date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
+		if (date) {
+			date.setHours(0);
+			date.setMinutes(0);
+			date.setSeconds(0);
+			date.setMilliseconds(0);
+		}
+		return this._daylightSavingAdjust(date);
+	},
+
+	/* Handle switch to/from daylight saving.
+	   Hours may be non-zero on daylight saving cut-over:
+	   > 12 when midnight changeover, but then cannot generate
+	   midnight datetime, so jump to 1AM, otherwise reset.
+	   @param  date  (Date) the date to check
+	   @return  (Date) the corrected date */
+	_daylightSavingAdjust: function(date) {
+		if (!date) return null;
+		date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
+		return date;
+	},
+
+	/* Set the date(s) directly. */
+	_setDate: function(inst, date) {
+		var clear = !(date);
+		var origMonth = inst.selectedMonth;
+		var origYear = inst.selectedYear;
+		date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
+		inst.selectedDay = inst.currentDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
+		if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
+			this._notifyChange(inst);
+		this._adjustInstDate(inst);
+		if (inst.input) {
+			inst.input.val(clear ? '' : this._formatDate(inst));
+		}
+	},
+
+	/* Retrieve the date(s) directly. */
+	_getDate: function(inst) {
+		var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
+			this._daylightSavingAdjust(new Date(
+			inst.currentYear, inst.currentMonth, inst.currentDay)));
+			return startDate;
+	},
+
+	/* Generate the HTML for the current state of the date picker. */
+	_generateHTML: function(inst) {
+		var today = new Date();
+		today = this._daylightSavingAdjust(
+			new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
+		var isRTL = this._get(inst, 'isRTL');
+		var showButtonPanel = this._get(inst, 'showButtonPanel');
+		var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
+		var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
+		var numMonths = this._getNumberOfMonths(inst);
+		var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
+		var stepMonths = this._get(inst, 'stepMonths');
+		var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
+		var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
+			new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+		var minDate = this._getMinMaxDate(inst, 'min');
+		var maxDate = this._getMinMaxDate(inst, 'max');
+		var drawMonth = inst.drawMonth - showCurrentAtPos;
+		var drawYear = inst.drawYear;
+		if (drawMonth < 0) {
+			drawMonth += 12;
+			drawYear--;
+		}
+		if (maxDate) {
+			var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
+				maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
+			maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
+			while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
+				drawMonth--;
+				if (drawMonth < 0) {
+					drawMonth = 11;
+					drawYear--;
+				}
+			}
+		}
+		inst.drawMonth = drawMonth;
+		inst.drawYear = drawYear;
+		var prevText = this._get(inst, 'prevText');
+		prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
+			this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
+			this._getFormatConfig(inst)));
+		var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
+			'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
+			' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
+			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
+		var nextText = this._get(inst, 'nextText');
+		nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
+			this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
+			this._getFormatConfig(inst)));
+		var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
+			'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
+			' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
+			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
+		var currentText = this._get(inst, 'currentText');
+		var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
+		currentText = (!navigationAsDateFormat ? currentText :
+			this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
+		var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
+		var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
+			(this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
+			'>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
+		var firstDay = parseInt(this._get(inst, 'firstDay'),10);
+		firstDay = (isNaN(firstDay) ? 0 : firstDay);
+		var showWeek = this._get(inst, 'showWeek');
+		var dayNames = this._get(inst, 'dayNames');
+		var dayNamesShort = this._get(inst, 'dayNamesShort');
+		var dayNamesMin = this._get(inst, 'dayNamesMin');
+		var monthNames = this._get(inst, 'monthNames');
+		var monthNamesShort = this._get(inst, 'monthNamesShort');
+		var beforeShowDay = this._get(inst, 'beforeShowDay');
+		var showOtherMonths = this._get(inst, 'showOtherMonths');
+		var selectOtherMonths = this._get(inst, 'selectOtherMonths');
+		var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
+		var defaultDate = this._getDefaultDate(inst);
+		var html = '';
+		for (var row = 0; row < numMonths[0]; row++) {
+			var group = '';
+			for (var col = 0; col < numMonths[1]; col++) {
+				var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
+				var cornerClass = ' ui-corner-all';
+				var calender = '';
+				if (isMultiMonth) {
+					calender += '<div class="ui-datepicker-group ui-datepicker-group-';
+					switch (col) {
+						case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
+						case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
+						default: calender += 'middle'; cornerClass = ''; break;
+					}
+					calender += '">';
+				}
+				calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
+					(/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
+					(/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
+					this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
+					row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
+					'</div><table class="ui-datepicker-calendar"><thead>' +
+					'<tr>';
+				var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
+				for (var dow = 0; dow < 7; dow++) { // days of the week
+					var day = (dow + firstDay) % 7;
+					thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
+						'<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
+				}
+				calender += thead + '</tr></thead><tbody>';
+				var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
+				if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
+					inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
+				var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
+				var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
+				var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
+				for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
+					calender += '<tr>';
+					var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
+						this._get(inst, 'calculateWeek')(printDate) + '</td>');
+					for (var dow = 0; dow < 7; dow++) { // create date picker days
+						var daySettings = (beforeShowDay ?
+							beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
+						var otherMonth = (printDate.getMonth() != drawMonth);
+						var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
+							(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
+						tbody += '<td class="' +
+							((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
+							(otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
+							((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
+							(defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
+							// or defaultDate is current printedDate and defaultDate is selectedDate
+							' ' + this._dayOverClass : '') + // highlight selected day
+							(unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') +  // highlight unselectable days
+							(otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
+							(printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
+							(printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
+							((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
+							(unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
+							inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
+							(otherMonth && !showOtherMonths ? '&#xa0;' : // display for other months
+							(unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
+							(printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
+							(printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
+							(otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
+							'" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
+						printDate.setDate(printDate.getDate() + 1);
+						printDate = this._daylightSavingAdjust(printDate);
+					}
+					calender += tbody + '</tr>';
+				}
+				drawMonth++;
+				if (drawMonth > 11) {
+					drawMonth = 0;
+					drawYear++;
+				}
+				calender += '</tbody></table>' + (isMultiMonth ? '</div>' + 
+							((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
+				group += calender;
+			}
+			html += group;
+		}
+		html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
+			'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
+		inst._keyEvent = false;
+		return html;
+	},
+
+	/* Generate the month and year header. */
+	_generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
+			secondary, monthNames, monthNamesShort) {
+		var changeMonth = this._get(inst, 'changeMonth');
+		var changeYear = this._get(inst, 'changeYear');
+		var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
+		var html = '<div class="ui-datepicker-title">';
+		var monthHtml = '';
+		// month selection
+		if (secondary || !changeMonth)
+			monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
+		else {
+			var inMinYear = (minDate && minDate.getFullYear() == drawYear);
+			var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
+			monthHtml += '<select class="ui-datepicker-month" ' +
+				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
+				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+			 	'>';
+			for (var month = 0; month < 12; month++) {
+				if ((!inMinYear || month >= minDate.getMonth()) &&
+						(!inMaxYear || month <= maxDate.getMonth()))
+					monthHtml += '<option value="' + month + '"' +
+						(month == drawMonth ? ' selected="selected"' : '') +
+						'>' + monthNamesShort[month] + '</option>';
+			}
+			monthHtml += '</select>';
+		}
+		if (!showMonthAfterYear)
+			html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? '&#xa0;' : '');
+		// year selection
+		if (secondary || !changeYear)
+			html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
+		else {
+			// determine range of years to display
+			var years = this._get(inst, 'yearRange').split(':');
+			var year = 0;
+			var endYear = 0;
+			if (years.length != 2) {
+				year = drawYear - 10;
+				endYear = drawYear + 10;
+			} else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
+				year = drawYear + parseInt(years[0], 10);
+				endYear = drawYear + parseInt(years[1], 10);
+			} else {
+				year = parseInt(years[0], 10);
+				endYear = parseInt(years[1], 10);
+			}
+			year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
+			endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
+			html += '<select class="ui-datepicker-year" ' +
+				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
+				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
+				'>';
+			for (; year <= endYear; year++) {
+				html += '<option value="' + year + '"' +
+					(year == drawYear ? ' selected="selected"' : '') +
+					'>' + year + '</option>';
+			}
+			html += '</select>';
+		}
+		html += this._get(inst, 'yearSuffix');
+		if (showMonthAfterYear)
+			html += (secondary || changeMonth || changeYear ? '&#xa0;' : '') + monthHtml;
+		html += '</div>'; // Close datepicker_header
+		return html;
+	},
+
+	/* Adjust one of the date sub-fields. */
+	_adjustInstDate: function(inst, offset, period) {
+		var year = inst.drawYear + (period == 'Y' ? offset : 0);
+		var month = inst.drawMonth + (period == 'M' ? offset : 0);
+		var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
+			(period == 'D' ? offset : 0);
+		var date = this._restrictMinMax(inst,
+			this._daylightSavingAdjust(new Date(year, month, day)));
+		inst.selectedDay = date.getDate();
+		inst.drawMonth = inst.selectedMonth = date.getMonth();
+		inst.drawYear = inst.selectedYear = date.getFullYear();
+		if (period == 'M' || period == 'Y')
+			this._notifyChange(inst);
+	},
+
+	/* Ensure a date is within any min/max bounds. */
+	_restrictMinMax: function(inst, date) {
+		var minDate = this._getMinMaxDate(inst, 'min');
+		var maxDate = this._getMinMaxDate(inst, 'max');
+		date = (minDate && date < minDate ? minDate : date);
+		date = (maxDate && date > maxDate ? maxDate : date);
+		return date;
+	},
+
+	/* Notify change of month/year. */
+	_notifyChange: function(inst) {
+		var onChange = this._get(inst, 'onChangeMonthYear');
+		if (onChange)
+			onChange.apply((inst.input ? inst.input[0] : null),
+				[inst.selectedYear, inst.selectedMonth + 1, inst]);
+	},
+
+	/* Determine the number of months to show. */
+	_getNumberOfMonths: function(inst) {
+		var numMonths = this._get(inst, 'numberOfMonths');
+		return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
+	},
+
+	/* Determine the current maximum date - ensure no time components are set. */
+	_getMinMaxDate: function(inst, minMax) {
+		return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
+	},
+
+	/* Find the number of days in a given month. */
+	_getDaysInMonth: function(year, month) {
+		return 32 - new Date(year, month, 32).getDate();
+	},
+
+	/* Find the day of the week of the first of a month. */
+	_getFirstDayOfMonth: function(year, month) {
+		return new Date(year, month, 1).getDay();
+	},
+
+	/* Determines if we should allow a "next/prev" month display change. */
+	_canAdjustMonth: function(inst, offset, curYear, curMonth) {
+		var numMonths = this._getNumberOfMonths(inst);
+		var date = this._daylightSavingAdjust(new Date(curYear,
+			curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
+		if (offset < 0)
+			date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
+		return this._isInRange(inst, date);
+	},
+
+	/* Is the given date in the accepted range? */
+	_isInRange: function(inst, date) {
+		var minDate = this._getMinMaxDate(inst, 'min');
+		var maxDate = this._getMinMaxDate(inst, 'max');
+		return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
+	},
+
+	/* Provide the configuration settings for formatting/parsing. */
+	_getFormatConfig: function(inst) {
+		var shortYearCutoff = this._get(inst, 'shortYearCutoff');
+		shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
+			new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
+		return {shortYearCutoff: shortYearCutoff,
+			dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
+			monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
+	},
+
+	/* Format the given date for display. */
+	_formatDate: function(inst, day, month, year) {
+		if (!day) {
+			inst.currentDay = inst.selectedDay;
+			inst.currentMonth = inst.selectedMonth;
+			inst.currentYear = inst.selectedYear;
+		}
+		var date = (day ? (typeof day == 'object' ? day :
+			this._daylightSavingAdjust(new Date(year, month, day))) :
+			this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
+		return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
+	}
+});
+
+/* jQuery extend now ignores nulls! */
+function extendRemove(target, props) {
+	$.extend(target, props);
+	for (var name in props)
+		if (props[name] == null || props[name] == undefined)
+			target[name] = props[name];
+	return target;
+};
+
+/* Determine whether an object is an array. */
+function isArray(a) {
+	return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
+		(a.constructor && a.constructor.toString().match(/\Array\(\)/))));
+};
+
+/* Invoke the datepicker functionality.
+   @param  options  string - a command, optionally followed by additional parameters or
+                    Object - settings for attaching new datepicker functionality
+   @return  jQuery object */
+$.fn.datepicker = function(options){
+
+	/* Initialise the date picker. */
+	if (!$.datepicker.initialized) {
+		$(document).mousedown($.datepicker._checkExternalClick).
+			find('body').append($.datepicker.dpDiv);
+		$.datepicker.initialized = true;
+	}
+
+	var otherArgs = Array.prototype.slice.call(arguments, 1);
+	if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
+		return $.datepicker['_' + options + 'Datepicker'].
+			apply($.datepicker, [this[0]].concat(otherArgs));
+	if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
+		return $.datepicker['_' + options + 'Datepicker'].
+			apply($.datepicker, [this[0]].concat(otherArgs));
+	return this.each(function() {
+		typeof options == 'string' ?
+			$.datepicker['_' + options + 'Datepicker'].
+				apply($.datepicker, [this].concat(otherArgs)) :
+			$.datepicker._attachDatepicker(this, options);
+	});
+};
+
+$.datepicker = new Datepicker(); // singleton instance
+$.datepicker.initialized = false;
+$.datepicker.uuid = new Date().getTime();
+$.datepicker.version = "@VERSION";
+
+// Workaround for #4055
+// Add another global to avoid noConflict issues with inline event handlers
+window.DP_jQuery = $;
+
+})(jQuery);
diff --git a/ui/jquery.ui.dialog.js b/ui/jquery.ui.dialog.js
new file mode 100644
index 000000000..d03537c31
--- /dev/null
+++ b/ui/jquery.ui.dialog.js
@@ -0,0 +1,690 @@
+/*
+ * jQuery UI Dialog @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.draggable.js
+ *	jquery.ui.position.js
+ *	jquery.ui.resizable.js
+ */
+(function($) {
+
+var setDataSwitch = {
+		maxHeight: "maxHeight.resizable",
+		maxWidth: "maxWidth.resizable",
+		minWidth: "minWidth.resizable"
+	},
+	
+	uiDialogClasses =
+		'ui-dialog ' +
+		'ui-widget ' +
+		'ui-widget-content ' +
+		'ui-corner-all ';
+
+$.widget("ui.dialog", {
+
+	_init: function() {
+		this.originalTitle = this.element.attr('title');
+
+		var self = this,
+			options = self.options,
+
+			title = options.title || self.originalTitle || '&nbsp;',
+			titleId = $.ui.dialog.getTitleId(self.element),
+
+			uiDialog = (self.uiDialog = $('<div></div>'))
+				.appendTo(document.body)
+				.hide()
+				.addClass(uiDialogClasses + options.dialogClass)
+				.css({
+					zIndex: options.zIndex
+				})
+				// setting tabIndex makes the div focusable
+				// setting outline to 0 prevents a border on focus in Mozilla
+				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
+					(options.closeOnEscape && event.keyCode
+						&& event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
+				})
+				.attr({
+					role: 'dialog',
+					'aria-labelledby': titleId
+				})
+				.mousedown(function(event) {
+					self.moveToTop(false, event);
+				}),
+
+			uiDialogContent = self.element
+				.show()
+				.removeAttr('title')
+				.addClass(
+					'ui-dialog-content ' +
+					'ui-widget-content')
+				.appendTo(uiDialog),
+
+			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
+				.addClass(
+					'ui-dialog-titlebar ' +
+					'ui-widget-header ' +
+					'ui-corner-all ' +
+					'ui-helper-clearfix'
+				)
+				.prependTo(uiDialog),
+
+			uiDialogTitlebarClose = $('<a href="#"></a>')
+				.addClass(
+					'ui-dialog-titlebar-close ' +
+					'ui-corner-all'
+				)
+				.attr('role', 'button')
+				.hover(
+					function() {
+						uiDialogTitlebarClose.addClass('ui-state-hover');
+					},
+					function() {
+						uiDialogTitlebarClose.removeClass('ui-state-hover');
+					}
+				)
+				.focus(function() {
+					uiDialogTitlebarClose.addClass('ui-state-focus');
+				})
+				.blur(function() {
+					uiDialogTitlebarClose.removeClass('ui-state-focus');
+				})
+				.mousedown(function(ev) {
+					ev.stopPropagation();
+				})
+				.click(function(event) {
+					self.close(event);
+					return false;
+				})
+				.appendTo(uiDialogTitlebar),
+
+			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
+				.addClass(
+					'ui-icon ' +
+					'ui-icon-closethick'
+				)
+				.text(options.closeText)
+				.appendTo(uiDialogTitlebarClose),
+
+			uiDialogTitle = $('<span></span>')
+				.addClass('ui-dialog-title')
+				.attr('id', titleId)
+				.html(title)
+				.prependTo(uiDialogTitlebar);
+
+		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
+
+		(options.draggable && $.fn.draggable && self._makeDraggable());
+		(options.resizable && $.fn.resizable && self._makeResizable());
+
+		self._createButtons(options.buttons);
+		self._isOpen = false;
+
+		(options.stackfix && $.fn.stackfix && uiDialog.stackfix());
+		(options.autoOpen && self.open());
+	},
+
+	destroy: function() {
+		var self = this;
+		
+		(self.overlay && self.overlay.destroy());
+		self.uiDialog.hide();
+		self.element
+			.unbind('.dialog')
+			.removeData('dialog')
+			.removeClass('ui-dialog-content ui-widget-content')
+			.hide().appendTo('body');
+		self.uiDialog.remove();
+
+		(self.originalTitle && self.element.attr('title', self.originalTitle));
+
+		return self;
+	},
+
+	close: function(event) {
+		var self = this;
+		
+		if (false === self._trigger('beforeClose', event)) {
+			return;
+		}
+
+		(self.overlay && self.overlay.destroy());
+		self.uiDialog.unbind('keypress.ui-dialog');
+
+		(self.options.hide
+			? self.uiDialog.hide(self.options.hide, function() {
+				self._trigger('close', event);
+			})
+			: self.uiDialog.hide() && self._trigger('close', event));
+
+		$.ui.dialog.overlay.resize();
+
+		self._isOpen = false;
+
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		if (self.options.modal) {
+			var maxZ = 0;
+			$('.ui-dialog').each(function() {
+				if (this != self.uiDialog[0]) {
+					maxZ = Math.max(maxZ, $(this).css('z-index'));
+				}
+			});
+			$.ui.dialog.maxZ = maxZ;
+		}
+
+		return self;
+	},
+
+	isOpen: function() {
+		return this._isOpen;
+	},
+
+	// the force parameter allows us to move modal dialogs to their correct
+	// position on open
+	moveToTop: function(force, event) {
+		var self = this,
+			options = self.options;
+		
+		if ((options.modal && !force)
+			|| (!options.stack && !options.modal)) {
+			return self._trigger('focus', event);
+		}
+		
+		if (options.zIndex > $.ui.dialog.maxZ) {
+			$.ui.dialog.maxZ = options.zIndex;
+		}
+		(self.overlay && self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
+
+		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
+		//  http://ui.jquery.com/bugs/ticket/3193
+		var saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
+		self.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
+		self.element.attr(saveScroll);
+		self._trigger('focus', event);
+
+		return self;
+	},
+
+	open: function() {
+		if (this._isOpen) { return; }
+
+		var self = this,
+			options = self.options,
+			uiDialog = self.uiDialog;
+
+		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
+		(uiDialog.next().length && uiDialog.appendTo('body'));
+		self._size();
+		self._position(options.position);
+		uiDialog.show(options.show);
+		self.moveToTop(true);
+
+		// prevent tabbing out of modal dialogs
+		(options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
+			if (event.keyCode != $.ui.keyCode.TAB) {
+				return;
+			}
+
+			var tabbables = $(':tabbable', this),
+				first = tabbables.filter(':first'),
+				last  = tabbables.filter(':last');
+
+			if (event.target == last[0] && !event.shiftKey) {
+				first.focus(1);
+				return false;
+			} else if (event.target == first[0] && event.shiftKey) {
+				last.focus(1);
+				return false;
+			}
+		}));
+
+		// set focus to the first tabbable element in the content area or the first button
+		// if there are no tabbable elements, set focus on the dialog itself
+		$([])
+			.add(uiDialog.find('.ui-dialog-content :tabbable:first'))
+			.add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
+			.add(uiDialog)
+			.filter(':first')
+			.focus();
+
+		self._trigger('open');
+		self._isOpen = true;
+
+		return self;
+	},
+
+	_createButtons: function(buttons) {
+		var self = this,
+			hasButtons = false,
+			uiDialogButtonPane = $('<div></div>')
+				.addClass(
+					'ui-dialog-buttonpane ' +
+					'ui-widget-content ' +
+					'ui-helper-clearfix'
+				);
+
+		// if we already have a button pane, remove it
+		self.uiDialog.find('.ui-dialog-buttonpane').remove();
+
+		(typeof buttons == 'object' && buttons !== null &&
+			$.each(buttons, function() { return !(hasButtons = true); }));
+		if (hasButtons) {
+			$.each(buttons, function(name, fn) {
+				$('<button type="button"></button>')
+					.addClass(
+						'ui-state-default ' +
+						'ui-corner-all'
+					)
+					.text(name)
+					.click(function() { fn.apply(self.element[0], arguments); })
+					.hover(
+						function() {
+							$(this).addClass('ui-state-hover');
+						},
+						function() {
+							$(this).removeClass('ui-state-hover');
+						}
+					)
+					.focus(function() {
+						$(this).addClass('ui-state-focus');
+					})
+					.blur(function() {
+						$(this).removeClass('ui-state-focus');
+					})
+					.appendTo(uiDialogButtonPane);
+			});
+			uiDialogButtonPane.appendTo(self.uiDialog);
+		}
+	},
+
+	_makeDraggable: function() {
+		var self = this,
+			options = self.options,
+			doc = $(document),
+			heightBeforeDrag;
+
+		self.uiDialog.draggable({
+			cancel: '.ui-dialog-content',
+			handle: '.ui-dialog-titlebar',
+			containment: 'document',
+			start: function(event) {
+				heightBeforeDrag = options.height;
+				$(this).height($(this).height()).addClass("ui-dialog-dragging");
+				self._trigger('dragStart', event);
+			},
+			drag: function(event) {
+				self._trigger('drag', event);
+			},
+			stop: function(event, ui) {
+				options.position = [ui.position.left - doc.scrollLeft(),
+					ui.position.top - doc.scrollTop()];
+				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
+				self._trigger('dragStop', event);
+				$.ui.dialog.overlay.resize();
+			}
+		});
+	},
+
+	_makeResizable: function(handles) {
+		handles = (handles === undefined ? this.options.resizable : handles);
+		var self = this,
+			options = self.options,
+			resizeHandles = typeof handles == 'string'
+				? handles
+				: 'n,e,s,w,se,sw,ne,nw';
+
+		self.uiDialog.resizable({
+			cancel: '.ui-dialog-content',
+			containment: 'document',
+			alsoResize: self.element,
+			maxWidth: options.maxWidth,
+			maxHeight: options.maxHeight,
+			minWidth: options.minWidth,
+			minHeight: self._minHeight(),
+			handles: resizeHandles,
+			start: function(event) {
+				$(this).addClass("ui-dialog-resizing");
+				self._trigger('resizeStart', event);
+			},
+			resize: function(event) {
+				self._trigger('resize', event);
+			},
+			stop: function(event) {
+				$(this).removeClass("ui-dialog-resizing");
+				options.height = $(this).height();
+				options.width = $(this).width();
+				self._trigger('resizeStop', event);
+				$.ui.dialog.overlay.resize();
+			}
+		})
+		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
+	},
+
+	_minHeight: function() {
+		var options = this.options;
+
+		return (options.height == 'auto'
+			? options.minHeight
+			: Math.min(options.minHeight, options.height));
+	},
+
+	_position: function(position) {
+		var myAt = [],
+			offset = [0, 0];
+
+		// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
+//		if (typeof position == 'string' || $.isArray(position)) {
+//			myAt = $.isArray(position) ? position : position.split(' ');
+		if (typeof position == 'string' || '0' in position) {
+			myAt = position.split ? position.split(' ') : [position[0], position[1]];
+			if (myAt.length == 1) {
+				myAt[1] = myAt[0];
+			}
+
+			$.each(['left', 'top'], function(i, offsetPosition) {
+				if (+myAt[i] == myAt[i]) {
+					offset[i] = myAt[i];
+					myAt[i] = offsetPosition;
+				}
+			});
+		} else {
+			if ('left' in position) {
+				myAt[0] = 'left';
+				offset[0] = position.left;
+			} else if ('right' in position) {
+				myAt[0] = 'right';
+				offset[0] = -position.right;
+			}
+
+			if ('top' in position) {
+				myAt[1] = 'top';
+				offset[1] = position.top;
+			} else if ('bottom' in position) {
+				myAt[1] = 'bottom';
+				offset[1] = -position.bottom;
+			}
+		}
+
+		this.uiDialog.position({
+			my: myAt.join(' '),
+			at: myAt.join(' '),
+			offset: offset.join(' '),
+			of: window,
+			collision: 'fit'
+		});
+	},
+
+	_setData: function(key, value){
+		var self = this,
+			uiDialog = self.uiDialog,
+			resize = false;
+		
+		(setDataSwitch[key] && uiDialog.data(setDataSwitch[key], value));
+		switch (key) {
+			case "buttons":
+				self._createButtons(value);
+				break;
+			case "closeText":
+				// convert whatever was passed in o a string, for text() to not throw up
+				self.uiDialogTitlebarCloseText.text("" + value);
+				break;
+			case "dialogClass":
+				uiDialog
+					.removeClass(self.options.dialogClass)
+					.addClass(uiDialogClasses + value);
+				break;
+			case "draggable":
+				(value
+					? self._makeDraggable()
+					: uiDialog.draggable('destroy'));
+				break;
+			case "height":
+				resize = true;
+				break;
+			case "minHeight":
+				resize = true;
+				break;
+			case "position":
+				self._position(value);
+				break;
+			case "resizable":
+				var isResizable = uiDialog.is(':data(resizable)');
+
+				// currently resizable, becoming non-resizable
+				(isResizable && !value && uiDialog.resizable('destroy'));
+
+				// currently resizable, changing handles
+				(isResizable && typeof value == 'string' &&
+					uiDialog.resizable('option', 'handles', value));
+
+				// currently non-resizable, becoming resizable
+				(isResizable || (value !== false && self._makeResizable(value)));
+				break;
+			case "title":
+				$(".ui-dialog-title", self.uiDialogTitlebar).html(value || '&nbsp;');
+				break;
+			case "width":
+				resize = true;
+				break;
+		}
+
+		$.widget.prototype._setData.apply(self, arguments);
+		(resize && self._size());
+	},
+
+	_size: function() {
+		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
+		 * divs will both have width and height set, so we need to reset them
+		 */
+		var options = this.options;
+
+		// reset content sizing
+		this.element.css({
+			height: 0,
+			minHeight: 0,
+			width: 'auto'
+		});
+
+		// reset wrapper sizing
+		// determine the height of all the non-content elements
+		var nonContentHeight = this.uiDialog.css({
+				height: 'auto',
+				width: options.width
+			})
+			.height();
+
+		this.element.css(options.height == 'auto'
+			? {
+				minHeight: Math.max(options.minHeight - nonContentHeight, 0),
+				height: 'auto'
+			}
+			: {
+				height: Math.max(options.height - nonContentHeight, 0)
+			});
+
+		(this.uiDialog.is(':data(resizable)') &&
+			this.uiDialog.resizable('option', 'minHeight', this._minHeight()));
+	}
+});
+
+$.extend($.ui.dialog, {
+	version: "@VERSION",
+	defaults: {
+		autoOpen: true,
+		stackfix: false,
+		buttons: {},
+		closeOnEscape: true,
+		closeText: 'close',
+		dialogClass: '',
+		draggable: true,
+		hide: null,
+		height: 'auto',
+		maxHeight: false,
+		maxWidth: false,
+		minHeight: 150,
+		minWidth: 150,
+		modal: false,
+		position: 'center',
+		resizable: true,
+		show: null,
+		stack: true,
+		title: '',
+		width: 300,
+		zIndex: 1000
+	},
+
+	uuid: 0,
+	maxZ: 0,
+
+	getTitleId: function($el) {
+		return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
+	},
+
+	overlay: function(dialog) {
+		this.$el = $.ui.dialog.overlay.create(dialog);
+	}
+});
+
+$.extend($.ui.dialog.overlay, {
+	instances: [],
+	maxZ: 0,
+	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
+		function(event) { return event + '.dialog-overlay'; }).join(' '),
+	create: function(dialog) {
+		if (this.instances.length === 0) {
+			// prevent use of anchors and inputs
+			// we use a setTimeout in case the overlay is created from an
+			// event that we're going to be cancelling (see #2804)
+			setTimeout(function() {
+				// handle $(el).dialog().dialog('close') (see #4065)
+				if ($.ui.dialog.overlay.instances.length) {
+					$(document).bind($.ui.dialog.overlay.events, function(event) {
+						var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
+						return (dialogZ > $.ui.dialog.overlay.maxZ);
+					});
+				}
+			}, 1);
+
+			// allow closing by pressing the escape key
+			$(document).bind('keydown.dialog-overlay', function(event) {
+				(dialog.options.closeOnEscape && event.keyCode
+						&& event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
+			});
+
+			// handle window resize
+			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
+		}
+
+		var $el = $('<div></div>').appendTo(document.body)
+			.addClass('ui-widget-overlay').css({
+				width: this.width(),
+				height: this.height()
+			});
+
+		(dialog.options.stackfix && $.fn.stackfix && $el.stackfix());
+
+		this.instances.push($el);
+		return $el;
+	},
+
+	destroy: function($el) {
+		this.instances.splice($.inArray(this.instances, $el), 1);
+
+		if (this.instances.length === 0) {
+			$([document, window]).unbind('.dialog-overlay');
+		}
+
+		$el.remove();
+		
+		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
+		var maxZ = 0;
+		$.each(this.instances, function() {
+			maxZ = Math.max(maxZ, this.css('z-index'));
+		});
+		this.maxZ = maxZ;
+	},
+
+	height: function() {
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			var scrollHeight = Math.max(
+				document.documentElement.scrollHeight,
+				document.body.scrollHeight
+			);
+			var offsetHeight = Math.max(
+				document.documentElement.offsetHeight,
+				document.body.offsetHeight
+			);
+
+			if (scrollHeight < offsetHeight) {
+				return $(window).height() + 'px';
+			} else {
+				return scrollHeight + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).height() + 'px';
+		}
+	},
+
+	width: function() {
+		// handle IE 6
+		if ($.browser.msie && $.browser.version < 7) {
+			var scrollWidth = Math.max(
+				document.documentElement.scrollWidth,
+				document.body.scrollWidth
+			);
+			var offsetWidth = Math.max(
+				document.documentElement.offsetWidth,
+				document.body.offsetWidth
+			);
+
+			if (scrollWidth < offsetWidth) {
+				return $(window).width() + 'px';
+			} else {
+				return scrollWidth + 'px';
+			}
+		// handle "good" browsers
+		} else {
+			return $(document).width() + 'px';
+		}
+	},
+
+	resize: function() {
+		/* If the dialog is draggable and the user drags it past the
+		 * right edge of the window, the document becomes wider so we
+		 * need to stretch the overlay. If the user then drags the
+		 * dialog back to the left, the document will become narrower,
+		 * so we need to shrink the overlay to the appropriate size.
+		 * This is handled by shrinking the overlay before setting it
+		 * to the full document size.
+		 */
+		var $overlays = $([]);
+		$.each($.ui.dialog.overlay.instances, function() {
+			$overlays = $overlays.add(this);
+		});
+
+		$overlays.css({
+			width: 0,
+			height: 0
+		}).css({
+			width: $.ui.dialog.overlay.width(),
+			height: $.ui.dialog.overlay.height()
+		});
+	}
+});
+
+$.extend($.ui.dialog.overlay.prototype, {
+	destroy: function() {
+		$.ui.dialog.overlay.destroy(this.$el);
+	}
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.draggable.js b/ui/jquery.ui.draggable.js
new file mode 100644
index 000000000..aa24b1333
--- /dev/null
+++ b/ui/jquery.ui.draggable.js
@@ -0,0 +1,784 @@
+/*
+ * jQuery UI Draggable @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
+
+	_init: function() {
+
+		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
+			this.element[0].style.position = 'relative';
+
+		(this.options.addClasses && this.element.addClass("ui-draggable"));
+		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
+
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		if(!this.element.data('draggable')) return;
+		this.element
+			.removeData("draggable")
+			.unbind(".draggable")
+			.removeClass("ui-draggable"
+				+ " ui-draggable-dragging"
+				+ " ui-draggable-disabled");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+
+		var o = this.options;
+
+		// among others, prevent a drag on a resizable-handle
+		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
+			return false;
+
+		//Quit if we're not on a valid handle
+		this.handle = this._getHandle(event);
+		if (!this.handle)
+			return false;
+
+		return true;
+
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options;
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		//If ddmanager is used for droppables, set the global draggable
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Store the helper's css position
+		this.cssPosition = this.helper.css("position");
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.positionAbs = this.element.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this.position = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		//Call plugins and callbacks
+		this._trigger("start", event);
+
+		//Recache the helper size
+		this._cacheHelperProportions();
+
+		//Prepare the droppable offsets
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.helper.addClass("ui-draggable-dragging");
+		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+	},
+
+	_mouseDrag: function(event, noPropagation) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Call plugins and callbacks and use the resulting position if something is returned
+		if (!noPropagation) {
+			var ui = this._uiHash();
+			this._trigger('drag', event, ui);
+			this.position = ui.position;
+		}
+
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		//If we are using droppables, inform the manager about the drop
+		var dropped = false;
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			dropped = $.ui.ddmanager.drop(this, event);
+
+		//if a drop comes from outside (a sortable)
+		if(this.dropped) {
+			dropped = this.dropped;
+			this.dropped = false;
+		}
+		
+		//if the original element is removed, don't bother to continue
+		if(!this.element[0] || !this.element[0].parentNode)
+			return false;
+
+		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
+			var self = this;
+			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
+				self._trigger("stop", event);
+				self._clear();
+			});
+		} else {
+			this._trigger("stop", event);
+			this._clear();
+		}
+
+		return false;
+	},
+
+	_getHandle: function(event) {
+
+		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
+		$(this.options.handle, this.element)
+			.find("*")
+			.andSelf()
+			.each(function() {
+				if(this == event.target) handle = true;
+			});
+
+		return handle;
+
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
+
+		if(!helper.parents('body').length)
+			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
+
+		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
+			helper.css("position", "absolute");
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.element.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.element.css("marginLeft"),10) || 0),
+			top: (parseInt(this.element.css("marginTop"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			0 - this.offset.relative.left - this.offset.parent.left,
+			0 - this.offset.relative.top - this.offset.parent.top,
+			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
+			var ce = $(o.containment)[0]; if(!ce) return;
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+			];
+		} else if(o.containment.constructor == Array) {
+			this.containment = o.containment;
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_clear: function() {
+		this.helper.removeClass("ui-draggable-dragging");
+		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
+		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
+		this.helper = null;
+		this.cancelHelperRemoval = false;
+	},
+
+	// From now on bulk stuff - mainly helpers
+
+	_trigger: function(type, event, ui) {
+		ui = ui || this._uiHash();
+		$.ui.plugin.call(this, type, [event, ui]);
+		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
+		return $.widget.prototype._trigger.call(this, type, event, ui);
+	},
+
+	plugins: {},
+
+	_uiHash: function(event) {
+		return {
+			helper: this.helper,
+			position: this.position,
+			originalPosition: this.originalPosition,
+			offset: this.positionAbs
+		};
+	}
+
+}));
+
+$.extend($.ui.draggable, {
+	version: "@VERSION",
+	eventPrefix: "drag",
+	defaults: $.extend({}, $.ui.mouse.defaults, {
+		addClasses: true,
+		appendTo: "parent",
+		axis: false,
+		connectToSortable: false,
+		containment: false,
+		cursor: "auto",
+		cursorAt: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		iframeFix: false,
+		opacity: false,
+		refreshPositions: false,
+		revert: false,
+		revertDuration: 500,
+		scope: "default",
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		snap: false,
+		snapMode: "both",
+		snapTolerance: 20,
+		stack: false,
+		zIndex: false
+	})
+});
+
+$.ui.plugin.add("draggable", "connectToSortable", {
+	start: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options,
+			uiSortable = $.extend({}, ui, { item: inst.element });
+		inst.sortables = [];
+		$(o.connectToSortable).each(function() {
+			var sortable = $.data(this, 'sortable');
+			if (sortable && !sortable.options.disabled) {
+				inst.sortables.push({
+					instance: sortable,
+					shouldRevert: sortable.options.revert
+				});
+				sortable._refreshItems();	//Do a one-time refresh at start to refresh the containerCache
+				sortable._trigger("activate", event, uiSortable);
+			}
+		});
+
+	},
+	stop: function(event, ui) {
+
+		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
+		var inst = $(this).data("draggable"),
+			uiSortable = $.extend({}, ui, { item: inst.element });
+
+		$.each(inst.sortables, function() {
+			if(this.instance.isOver) {
+
+				this.instance.isOver = 0;
+
+				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
+				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
+
+				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
+				if(this.shouldRevert) this.instance.options.revert = true;
+
+				//Trigger the stop of the sortable
+				this.instance._mouseStop(event);
+
+				this.instance.options.helper = this.instance.options._helper;
+
+				//If the helper has been the original item, restore properties in the sortable
+				if(inst.options.helper == 'original')
+					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
+
+			} else {
+				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
+				this.instance._trigger("deactivate", event, uiSortable);
+			}
+
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), self = this;
+
+		var checkPos = function(o) {
+			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
+			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
+			var itemHeight = o.height, itemWidth = o.width;
+			var itemTop = o.top, itemLeft = o.left;
+
+			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
+		};
+
+		$.each(inst.sortables, function(i) {
+			
+			//Copy over some variables to allow calling the sortable's native _intersectsWith
+			this.instance.positionAbs = inst.positionAbs;
+			this.instance.helperProportions = inst.helperProportions;
+			this.instance.offset.click = inst.offset.click;
+			
+			if(this.instance._intersectsWith(this.instance.containerCache)) {
+
+				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
+				if(!this.instance.isOver) {
+
+					this.instance.isOver = 1;
+					//Now we fake the start of dragging for the sortable instance,
+					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
+					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
+					this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
+					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
+					this.instance.options.helper = function() { return ui.helper[0]; };
+
+					event.target = this.instance.currentItem[0];
+					this.instance._mouseCapture(event, true);
+					this.instance._mouseStart(event, true, true);
+
+					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
+					this.instance.offset.click.top = inst.offset.click.top;
+					this.instance.offset.click.left = inst.offset.click.left;
+					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
+					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
+
+					inst._trigger("toSortable", event);
+					inst.dropped = this.instance.element; //draggable revert needs that
+					//hack so receive/update callbacks work (mostly)
+					inst.currentItem = inst.element;
+					this.instance.fromOutside = inst;
+
+				}
+
+				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
+				if(this.instance.currentItem) this.instance._mouseDrag(event);
+
+			} else {
+
+				//If it doesn't intersect with the sortable, and it intersected before,
+				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
+				if(this.instance.isOver) {
+
+					this.instance.isOver = 0;
+					this.instance.cancelHelperRemoval = true;
+					
+					//Prevent reverting on this forced stop
+					this.instance.options.revert = false;
+					
+					// The out event needs to be triggered independently
+					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
+					
+					this.instance._mouseStop(event, true);
+					this.instance.options.helper = this.instance.options._helper;
+
+					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
+					this.instance.currentItem.remove();
+					if(this.instance.placeholder) this.instance.placeholder.remove();
+
+					inst._trigger("fromSortable", event);
+					inst.dropped = false; //draggable revert needs that
+				}
+
+			};
+
+		});
+
+	}
+});
+
+$.ui.plugin.add("draggable", "cursor", {
+	start: function(event, ui) {
+		var t = $('body'), o = $(this).data('draggable').options;
+		if (t.css("cursor")) o._cursor = t.css("cursor");
+		t.css("cursor", o.cursor);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if (o._cursor) $('body').css("cursor", o._cursor);
+	}
+});
+
+$.ui.plugin.add("draggable", "iframeFix", {
+	start: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
+			$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
+			.css({
+				width: this.offsetWidth+"px", height: this.offsetHeight+"px",
+				position: "absolute", opacity: "0.001", zIndex: 1000
+			})
+			.css($(this).offset())
+			.appendTo("body");
+		});
+	},
+	stop: function(event, ui) {
+		$("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
+	}
+});
+
+$.ui.plugin.add("draggable", "opacity", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data('draggable').options;
+		if(t.css("opacity")) o._opacity = t.css("opacity");
+		t.css('opacity', o.opacity);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data('draggable').options;
+		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
+	}
+});
+
+$.ui.plugin.add("draggable", "scroll", {
+	start: function(event, ui) {
+		var i = $(this).data("draggable");
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
+	},
+	drag: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options, scrolled = false;
+
+		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
+
+			if(!o.axis || o.axis != 'x') {
+				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
+					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
+					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
+			}
+
+		} else {
+
+			if(!o.axis || o.axis != 'x') {
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+			}
+
+			if(!o.axis || o.axis != 'y') {
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+			}
+
+		}
+
+		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(i, event);
+
+	}
+});
+
+$.ui.plugin.add("draggable", "snap", {
+	start: function(event, ui) {
+
+		var i = $(this).data("draggable"), o = i.options;
+		i.snapElements = [];
+
+		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
+			var $t = $(this); var $o = $t.offset();
+			if(this != i.element[0]) i.snapElements.push({
+				item: this,
+				width: $t.outerWidth(), height: $t.outerHeight(),
+				top: $o.top, left: $o.left
+			});
+		});
+
+	},
+	drag: function(event, ui) {
+
+		var inst = $(this).data("draggable"), o = inst.options;
+		var d = o.snapTolerance;
+
+		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
+			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
+
+		for (var i = inst.snapElements.length - 1; i >= 0; i--){
+
+			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
+				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
+
+			//Yes, I know, this is insane ;)
+			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
+				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+				inst.snapElements[i].snapping = false;
+				continue;
+			}
+
+			if(o.snapMode != 'inner') {
+				var ts = Math.abs(t - y2) <= d;
+				var bs = Math.abs(b - y1) <= d;
+				var ls = Math.abs(l - x2) <= d;
+				var rs = Math.abs(r - x1) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
+			}
+
+			var first = (ts || bs || ls || rs);
+
+			if(o.snapMode != 'outer') {
+				var ts = Math.abs(t - y1) <= d;
+				var bs = Math.abs(b - y2) <= d;
+				var ls = Math.abs(l - x1) <= d;
+				var rs = Math.abs(r - x2) <= d;
+				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
+				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
+				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
+				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
+			}
+
+			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
+				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
+			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
+
+		};
+
+	}
+});
+
+$.ui.plugin.add("draggable", "stack", {
+	start: function(event, ui) {
+
+		var o = $(this).data("draggable").options;
+
+		var group = $.makeArray($(o.stack)).sort(function(a,b) {
+			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
+		});
+		
+		var min = parseInt(group[0].style.zIndex) || 0;
+		$(group).each(function(i) {
+			this.style.zIndex = min + i;
+		});
+
+		this[0].style.zIndex = min + group.length;
+
+	}
+});
+
+$.ui.plugin.add("draggable", "zIndex", {
+	start: function(event, ui) {
+		var t = $(ui.helper), o = $(this).data("draggable").options;
+		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
+		t.css('zIndex', o.zIndex);
+	},
+	stop: function(event, ui) {
+		var o = $(this).data("draggable").options;
+		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
+	}
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.droppable.js b/ui/jquery.ui.droppable.js
new file mode 100644
index 000000000..3d1a7f5eb
--- /dev/null
+++ b/ui/jquery.ui.droppable.js
@@ -0,0 +1,284 @@
+/*
+ * jQuery UI Droppable @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Droppables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ *	jquery.ui.draggable.js
+ */
+(function($) {
+
+$.widget("ui.droppable", {
+
+	_init: function() {
+
+		var o = this.options, accept = o.accept;
+		this.isover = 0; this.isout = 1;
+
+		this.accept = $.isFunction(accept) ? accept : function(d) {
+			return d.is(accept);
+		};
+
+		//Store the droppable's proportions
+		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
+
+		// Add the reference and positions to the manager
+		$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
+		$.ui.ddmanager.droppables[o.scope].push(this);
+
+		(o.addClasses && this.element.addClass("ui-droppable"));
+
+	},
+
+	destroy: function() {
+		var drop = $.ui.ddmanager.droppables[this.options.scope];
+		for ( var i = 0; i < drop.length; i++ )
+			if ( drop[i] == this )
+				drop.splice(i, 1);
+
+		this.element
+			.removeClass("ui-droppable ui-droppable-disabled")
+			.removeData("droppable")
+			.unbind(".droppable");
+
+		return this;
+	},
+
+	_setData: function(key, value) {
+
+		if(key == 'accept') {
+			this.accept = $.isFunction(value) ? value : function(d) {
+				return d.is(value);
+			};
+		}
+		$.widget.prototype._setData.apply(this, arguments);
+	},
+
+	_activate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
+		(draggable && this._trigger('activate', event, this.ui(draggable)));
+	},
+
+	_deactivate: function(event) {
+		var draggable = $.ui.ddmanager.current;
+		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
+	},
+
+	_over: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
+			this._trigger('over', event, this.ui(draggable));
+		}
+
+	},
+
+	_out: function(event) {
+
+		var draggable = $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
+
+		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('out', event, this.ui(draggable));
+		}
+
+	},
+
+	_drop: function(event,custom) {
+
+		var draggable = custom || $.ui.ddmanager.current;
+		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
+
+		var childrenIntersection = false;
+		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
+			var inst = $.data(this, 'droppable');
+			if(
+				inst.options.greedy
+				&& !inst.options.disabled
+				&& inst.options.scope == draggable.options.scope
+				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
+				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
+			) { childrenIntersection = true; return false; }
+		});
+		if(childrenIntersection) return false;
+
+		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
+			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
+			this._trigger('drop', event, this.ui(draggable));
+			return this.element;
+		}
+
+		return false;
+
+	},
+
+	ui: function(c) {
+		return {
+			draggable: (c.currentItem || c.element),
+			helper: c.helper,
+			position: c.position,
+			offset: c.positionAbs
+		};
+	}
+
+});
+
+$.extend($.ui.droppable, {
+	version: "@VERSION",
+	eventPrefix: 'drop',
+	defaults: {
+		accept: '*',
+		activeClass: false,
+		addClasses: true,
+		greedy: false,
+		hoverClass: false,
+		scope: 'default',
+		tolerance: 'intersect'
+	}
+});
+
+$.ui.intersect = function(draggable, droppable, toleranceMode) {
+
+	if (!droppable.offset) return false;
+
+	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
+		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
+	var l = droppable.offset.left, r = l + droppable.proportions.width,
+		t = droppable.offset.top, b = t + droppable.proportions.height;
+
+	switch (toleranceMode) {
+		case 'fit':
+			return (l < x1 && x2 < r
+				&& t < y1 && y2 < b);
+			break;
+		case 'intersect':
+			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
+				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
+				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
+			break;
+		case 'pointer':
+			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
+				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
+				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
+			return isOver;
+			break;
+		case 'touch':
+			return (
+					(y1 >= t && y1 <= b) ||	// Top edge touching
+					(y2 >= t && y2 <= b) ||	// Bottom edge touching
+					(y1 < t && y2 > b)		// Surrounded vertically
+				) && (
+					(x1 >= l && x1 <= r) ||	// Left edge touching
+					(x2 >= l && x2 <= r) ||	// Right edge touching
+					(x1 < l && x2 > r)		// Surrounded horizontally
+				);
+			break;
+		default:
+			return false;
+			break;
+		}
+
+};
+
+/*
+	This manager tracks offsets of draggables and droppables
+*/
+$.ui.ddmanager = {
+	current: null,
+	droppables: { 'default': [] },
+	prepareOffsets: function(t, event) {
+
+		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
+		var type = event ? event.type : null; // workaround for #2317
+		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
+
+		droppablesLoop: for (var i = 0; i < m.length; i++) {
+
+			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
+			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
+			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
+
+			m[i].offset = m[i].element.offset();
+			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
+
+			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
+
+		}
+
+	},
+	drop: function(draggable, event) {
+
+		var dropped = false;
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(!this.options) return;
+			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
+				dropped = this._drop.call(this, event);
+
+			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
+				this.isout = 1; this.isover = 0;
+				this._deactivate.call(this, event);
+			}
+
+		});
+		return dropped;
+
+	},
+	drag: function(draggable, event) {
+
+		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
+		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
+
+		//Run through all droppables and check their positions based on specific tolerance options
+		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
+
+			if(this.options.disabled || this.greedyChild || !this.visible) return;
+			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
+
+			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
+			if(!c) return;
+
+			var parentInstance;
+			if (this.options.greedy) {
+				var parent = this.element.parents(':data(droppable):eq(0)');
+				if (parent.length) {
+					parentInstance = $.data(parent[0], 'droppable');
+					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
+				}
+			}
+
+			// we just moved into a greedy child
+			if (parentInstance && c == 'isover') {
+				parentInstance['isover'] = 0;
+				parentInstance['isout'] = 1;
+				parentInstance._out.call(parentInstance, event);
+			}
+
+			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
+			this[c == "isover" ? "_over" : "_out"].call(this, event);
+
+			// we just moved out of a greedy child
+			if (parentInstance && c == 'isout') {
+				parentInstance['isout'] = 0;
+				parentInstance['isover'] = 1;
+				parentInstance._over.call(parentInstance, event);
+			}
+		});
+
+	}
+};
+
+})(jQuery);
diff --git a/ui/jquery.ui.position.js b/ui/jquery.ui.position.js
new file mode 100644
index 000000000..6c5250959
--- /dev/null
+++ b/ui/jquery.ui.position.js
@@ -0,0 +1,227 @@
+/*
+ * jQuery UI Position @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function($) {
+
+$.ui = $.ui || {};
+
+var horizontalPositions = /left|center|right/,
+	horizontalDefault = 'center',
+	verticalPositions = /top|center|bottom/,
+	verticalDefault = 'center',
+	_position = $.fn.position;
+
+$.fn.position = function(options) {
+	if (!options || !options.of) {
+		return _position.apply(this, arguments);
+	}
+
+	var target = $(options.of),
+		collision = (options.collision || 'flip').split(' '),
+		offset = options.offset ? options.offset.split(' ') : [0, 0],
+		targetWidth,
+		targetHeight,
+		basePosition;
+
+	if (options.of == document) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: 0, left: 0 };
+	} else if (options.of == window) {
+		targetWidth = target.width();
+		targetHeight = target.height();
+		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
+	} else if (options.of.preventDefault) {
+		// force left top to allow flipping
+		options.at = 'left top';
+		targetWidth = targetHeight = 0;
+		basePosition = { top: options.of.pageY, left: options.of.pageX };
+	} else {
+		targetWidth = target.outerWidth();
+		targetHeight = target.outerHeight();
+		basePosition = target.offset();
+	}
+
+	// force my and at to have valid horizontal and veritcal positions
+	// if a value is missing or invalid, it will be converted to center 
+	$.each(['my', 'at'], function() {
+		var pos = (options[this] || '').split(' ');
+		pos = pos.length == 1
+			? horizontalPositions.test(pos[0])
+				? pos.concat([verticalDefault])
+				: verticalPositions.test(pos[0])
+					? [horizontalDefault].concat(pos)
+					: [horizontalDefault, verticalDefault]
+			: pos;
+		pos[0] = horizontalPositions.test(pos[0]) ? pos[0] : horizontalDefault;
+		pos[1] = verticalPositions.test(pos[1]) ? pos[1] : verticalDefault;
+		options[this] = pos;
+	});
+
+	// normalize collision option
+	if (collision.length == 1) {
+		collision[1] = collision[0];
+	}
+
+	// normalize offset option
+	offset[0] = parseInt(offset[0], 10) || 0;
+	if (offset.length == 1) {
+		offset[1] = offset[0];
+	}
+	offset[1] = parseInt(offset[1], 10) || 0;
+
+	switch (options.at[0]) {
+		case 'right':
+			basePosition.left += targetWidth;
+			break;
+		case horizontalDefault:
+			basePosition.left += targetWidth / 2;
+			break;
+	}
+
+	switch (options.at[1]) {
+		case 'bottom':
+			basePosition.top += targetHeight;
+			break;
+		case verticalDefault:
+			basePosition.top += targetHeight / 2;
+			break;
+	}
+
+	basePosition.left += offset[0];
+	basePosition.top += offset[1];
+
+	return this.each(function() {
+		var elem = $(this),
+			elemWidth = elem.outerWidth(),
+			elemHeight = elem.outerHeight(),
+			position = $.extend({}, basePosition),
+			over,
+			myOffset,
+			atOffset;
+
+		switch (options.my[0]) {
+			case 'right':
+				position.left -= elemWidth;
+				break;
+			case horizontalDefault:
+				position.left -= elemWidth / 2;
+				break;
+		}
+
+		switch (options.my[1]) {
+			case 'bottom':
+				position.top -= elemHeight;
+				break;
+			case verticalDefault:
+				position.top -= elemHeight / 2;
+				break;
+		}
+
+		$.each(['left', 'top'], function(i, dir) {
+			($.ui.position[collision[i]] &&
+				$.ui.position[collision[i]][dir](position, {
+					targetWidth: targetWidth,
+					targetHeight: targetHeight,
+					elemWidth: elemWidth,
+					elemHeight: elemHeight,
+					offset: offset,
+					my: options.my,
+					at: options.at
+				}));
+		});
+
+		(options.stackfix !== false && $.fn.stackfix && elem.stackfix());
+		// the by function is passed the offset values, not the position values
+		// we'll need the logic from the .offset() setter to be accessible for
+		// us to calculate the position values to make the by option more useful
+		($.isFunction(options.by) ? options.by.call(this, position) : elem.offset(position));
+	});
+};
+
+$.ui.position = {
+	fit: {
+		left: function(position, data) {
+			var over = position.left + data.elemWidth - $(window).width() - $(window).scrollLeft();
+			position.left = over > 0 ? position.left - over : Math.max(0, position.left);
+		},
+		top: function(position, data) {
+			var over = position.top + data.elemHeight - $(window).height() - $(window).scrollTop();
+			position.top = over > 0 ? position.top - over : Math.max(0, position.top);
+		}
+	},
+
+	flip: {
+		left: function(position, data) {
+			if (data.at[0] == 'center')
+				return;
+			var over = position.left + data.elemWidth - $(window).width() - $(window).scrollLeft(),
+				myOffset = data.my[0] == 'left' ? -data.elemWidth : data.my[0] == 'right' ? data.elemWidth : 0,
+				offset = -2 * data.offset[0];
+			position.left += position.left < 0 ? myOffset + data.targetWidth + offset : over > 0 ? myOffset - data.targetWidth + offset : 0;
+		},
+		top: function(position, data) {
+			if (data.at[1] == 'center')
+				return;
+			var over = position.top + data.elemHeight - $(window).height() - $(window).scrollTop(),
+				myOffset = data.my[1] == 'top' ? -data.elemHeight : data.my[1] == 'bottom' ? data.elemHeight : 0,
+				atOffset = data.at[1] == 'top' ? data.targetHeight : -data.targetHeight,
+				offset = -2 * data.offset[1];
+			position.top += position.top < 0 ? myOffset + data.targetHeight + offset : over > 0 ? myOffset + atOffset + offset : 0;
+		}
+	}
+};
+
+
+// the following functionality is planned for jQuery 1.4
+// based on http://plugins.jquery.com/files/offset.js.txt
+$.fn.extend({
+	_offset: $.fn.offset,
+	offset: function(newOffset) {
+	    return !newOffset ? this._offset() : this.each(function() {
+			var elem = $(this),
+				// we need to convert static positioning to relative positioning
+				isRelative = /relative|static/.test(elem.css('position')),
+				hide = elem.css('display') == 'none';
+
+			(isRelative && elem.css('position', 'relative'));
+			(hide && elem.show());
+
+			var offset = elem.offset(),
+				delta = {
+					left : parseInt(elem.css('left'), 10),
+					top: parseInt(elem.css('top'), 10)
+				};
+
+			// in case of 'auto'
+			delta.left = !isNaN(delta.left)
+				? delta.left
+				: isRelative
+					? 0
+					: this.offsetLeft;
+			delta.top = !isNaN(delta.top)
+				? delta.top
+				: isRelative
+					? 0
+					: this.offsetTop;
+
+			// allow setting only left or only top
+			if (newOffset.left || newOffset.left === 0) {
+				elem.css('left', newOffset.left - offset.left + delta.left);
+			}
+			if (newOffset.top || newOffset.top === 0) {
+				elem.css('top', newOffset.top - offset.top + delta.top);
+			}
+
+			(hide && elem.hide());
+		});
+	}
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.progressbar.js b/ui/jquery.ui.progressbar.js
new file mode 100644
index 000000000..079216877
--- /dev/null
+++ b/ui/jquery.ui.progressbar.js
@@ -0,0 +1,119 @@
+/*
+ * jQuery UI Progressbar @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Progressbar
+ *
+ * Depends:
+ *   jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.progressbar", {
+
+	_init: function() {
+
+		this.element
+			.addClass("ui-progressbar"
+				+ " ui-widget"
+				+ " ui-widget-content"
+				+ " ui-corner-all")
+			.attr({
+				role: "progressbar",
+				"aria-valuemin": this._valueMin(),
+				"aria-valuemax": this._valueMax(),
+				"aria-valuenow": this._value()
+			});
+
+		this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
+
+		this._refreshValue();
+
+	},
+
+	destroy: function() {
+
+		this.element
+			.removeClass("ui-progressbar"
+				+ " ui-widget"
+				+ " ui-widget-content"
+				+ " ui-corner-all")
+			.removeAttr("role")
+			.removeAttr("aria-valuemin")
+			.removeAttr("aria-valuemax")
+			.removeAttr("aria-valuenow")
+			.removeData("progressbar")
+			.unbind(".progressbar");
+
+		this.valueDiv.remove();
+
+		$.widget.prototype.destroy.apply(this, arguments);
+
+		return this;
+	},
+
+	value: function(newValue) {
+		if (newValue === undefined) {
+			return this._value();
+		}
+		
+		this._setData('value', newValue);
+		return this;
+	},
+
+	_setData: function(key, value) {
+
+		switch (key) {
+			case 'value':
+				this.options.value = value;
+				this._refreshValue();
+				this._trigger('change', null, {});
+				break;
+		}
+
+		$.widget.prototype._setData.apply(this, arguments);
+
+	},
+
+	_value: function() {
+		var val = this.options.value;
+		// normalize invalid value
+		if (typeof val != "number")
+			val = 0;
+		if (val < this._valueMin()) val = this._valueMin();
+		if (val > this._valueMax()) val = this._valueMax();
+
+		return val;
+
+	},
+
+	_valueMin: function() {
+		var valueMin = 0;
+		return valueMin;
+	},
+
+	_valueMax: function() {
+		var valueMax = 100;
+		return valueMax;
+	},
+
+	_refreshValue: function() {
+		var value = this.value();
+		this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
+		this.valueDiv.width(value + '%');
+		this.element.attr("aria-valuenow", value);
+	}
+
+});
+
+$.extend($.ui.progressbar, {
+	version: "@VERSION",
+	defaults: {
+		value: 0
+	}
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.resizable.js b/ui/jquery.ui.resizable.js
new file mode 100644
index 000000000..0a0c228da
--- /dev/null
+++ b/ui/jquery.ui.resizable.js
@@ -0,0 +1,798 @@
+/*
+ * jQuery UI Resizable @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Resizables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
+
+	_init: function() {
+
+		var self = this, o = this.options;
+		this.element.addClass("ui-resizable");
+
+		$.extend(this, {
+			_aspectRatio: !!(o.aspectRatio),
+			aspectRatio: o.aspectRatio,
+			originalElement: this.element,
+			_proportionallyResizeElements: [],
+			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
+		});
+
+		//Wrap the element if it cannot hold child nodes
+		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
+
+			//Opera fix for relative positioning
+			if (/relative/.test(this.element.css('position')) && $.browser.opera)
+				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+			//Create a wrapper element and set the wrapper to the new current internal element
+			this.element.wrap(
+				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
+					position: this.element.css('position'),
+					width: this.element.outerWidth(),
+					height: this.element.outerHeight(),
+					top: this.element.css('top'),
+					left: this.element.css('left')
+				})
+			);
+
+			//Overwrite the original this.element
+			this.element = this.element.parent().data(
+				"resizable", this.element.data('resizable')
+			);
+
+			this.elementIsWrapper = true;
+
+			//Move margins to the wrapper
+			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
+			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
+
+			//Prevent Safari textarea resize
+			this.originalResizeStyle = this.originalElement.css('resize');
+			this.originalElement.css('resize', 'none');
+
+			//Push the actual element to our proportionallyResize internal array
+			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
+
+			// avoid IE jump (hard set the margin)
+			this.originalElement.css({ margin: this.originalElement.css('margin') });
+
+			// fix handlers offset
+			this._proportionallyResize();
+
+		}
+
+		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
+		if(this.handles.constructor == String) {
+
+			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
+			var n = this.handles.split(","); this.handles = {};
+
+			for(var i = 0; i < n.length; i++) {
+
+				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
+				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
+
+				// increase zIndex of sw, se, ne, nw axis
+				//TODO : this modifies original option
+				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
+
+				//TODO : What's going on here?
+				if ('se' == handle) {
+					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
+				};
+
+				//Insert into internal handles object and append to element
+				this.handles[handle] = '.ui-resizable-'+handle;
+				this.element.append(axis);
+			}
+
+		}
+
+		this._renderAxis = function(target) {
+
+			target = target || this.element;
+
+			for(var i in this.handles) {
+
+				if(this.handles[i].constructor == String)
+					this.handles[i] = $(this.handles[i], this.element).show();
+
+				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
+				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
+
+					var axis = $(this.handles[i], this.element), padWrapper = 0;
+
+					//Checking the correct pad and border
+					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
+
+					//The padding type i have to apply...
+					var padPos = [ 'padding',
+						/ne|nw|n/.test(i) ? 'Top' :
+						/se|sw|s/.test(i) ? 'Bottom' :
+						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
+
+					target.css(padPos, padWrapper);
+
+					this._proportionallyResize();
+
+				}
+
+				//TODO: What's that good for? There's not anything to be executed left
+				if(!$(this.handles[i]).length)
+					continue;
+
+			}
+		};
+
+		//TODO: make renderAxis a prototype function
+		this._renderAxis(this.element);
+
+		this._handles = $('.ui-resizable-handle', this.element)
+			.disableSelection();
+
+		//Matching axis name
+		this._handles.mouseover(function() {
+			if (!self.resizing) {
+				if (this.className)
+					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
+				//Axis, default = se
+				self.axis = axis && axis[1] ? axis[1] : 'se';
+			}
+		});
+
+		//If we want to auto hide the elements
+		if (o.autoHide) {
+			this._handles.hide();
+			$(this.element)
+				.addClass("ui-resizable-autohide")
+				.hover(function() {
+					$(this).removeClass("ui-resizable-autohide");
+					self._handles.show();
+				},
+				function(){
+					if (!self.resizing) {
+						$(this).addClass("ui-resizable-autohide");
+						self._handles.hide();
+					}
+				});
+		}
+
+		//Initialize the mouse interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+
+		this._mouseDestroy();
+
+		var _destroy = function(exp) {
+			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
+				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
+		};
+
+		//TODO: Unwrap at same DOM position
+		if (this.elementIsWrapper) {
+			_destroy(this.element);
+			var wrapper = this.element;
+			wrapper.parent().append(
+				this.originalElement.css({
+					position: wrapper.css('position'),
+					width: wrapper.outerWidth(),
+					height: wrapper.outerHeight(),
+					top: wrapper.css('top'),
+					left: wrapper.css('left')
+				})
+			).end().remove();
+		}
+
+		this.originalElement.css('resize', this.originalResizeStyle);
+		_destroy(this.originalElement);
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+		var handle = false;
+		for (var i in this.handles) {
+			if ($(this.handles[i])[0] == event.target) {
+				handle = true;
+			}
+		}
+
+		return !this.options.disabled && handle;
+	},
+
+	_mouseStart: function(event) {
+
+		var o = this.options, iniPos = this.element.position(), el = this.element;
+
+		this.resizing = true;
+		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
+
+		// bugfix for http://dev.jquery.com/ticket/1749
+		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
+			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
+		}
+
+		//Opera fixing relative position
+		if ($.browser.opera && (/relative/).test(el.css('position')))
+			el.css({ position: 'relative', top: 'auto', left: 'auto' });
+
+		this._renderProxy();
+
+		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
+
+		if (o.containment) {
+			curleft += $(o.containment).scrollLeft() || 0;
+			curtop += $(o.containment).scrollTop() || 0;
+		}
+
+		//Store needed variables
+		this.offset = this.helper.offset();
+		this.position = { left: curleft, top: curtop };
+		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
+		this.originalPosition = { left: curleft, top: curtop };
+		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
+		this.originalMousePosition = { left: event.pageX, top: event.pageY };
+
+		//Aspect Ratio
+		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
+
+	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
+	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
+
+		el.addClass("ui-resizable-resizing");
+		this._propagate("start", event);
+		return true;
+	},
+
+	_mouseDrag: function(event) {
+
+		//Increase performance, avoid regex
+		var el = this.helper, o = this.options, props = {},
+			self = this, smp = this.originalMousePosition, a = this.axis;
+
+		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
+		var trigger = this._change[a];
+		if (!trigger) return false;
+
+		// Calculate the attrs that will be change
+		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
+
+		if (this._aspectRatio || event.shiftKey)
+			data = this._updateRatio(data, event);
+
+		data = this._respectSize(data, event);
+
+		// plugins callbacks need to be called first
+		this._propagate("resize", event);
+
+		el.css({
+			top: this.position.top + "px", left: this.position.left + "px",
+			width: this.size.width + "px", height: this.size.height + "px"
+		});
+
+		if (!this._helper && this._proportionallyResizeElements.length)
+			this._proportionallyResize();
+
+		this._updateCache(data);
+
+		// calling the user callback at the end
+		this._trigger('resize', event, this.ui());
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+
+		this.resizing = false;
+		var o = this.options, self = this;
+
+		if(this._helper) {
+			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+						soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+							soffsetw = ista ? 0 : self.sizeDiff.width;
+
+			var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+			if (!o.animate)
+				this.element.css($.extend(s, { top: top, left: left }));
+
+			self.helper.height(self.size.height);
+			self.helper.width(self.size.width);
+
+			if (this._helper && !o.animate) this._proportionallyResize();
+		}
+
+		$('body').css('cursor', 'auto');
+
+		this.element.removeClass("ui-resizable-resizing");
+
+		this._propagate("stop", event);
+
+		if (this._helper) this.helper.remove();
+		return false;
+
+	},
+
+	_updateCache: function(data) {
+		var o = this.options;
+		this.offset = this.helper.offset();
+		if (isNumber(data.left)) this.position.left = data.left;
+		if (isNumber(data.top)) this.position.top = data.top;
+		if (isNumber(data.height)) this.size.height = data.height;
+		if (isNumber(data.width)) this.size.width = data.width;
+	},
+
+	_updateRatio: function(data, event) {
+
+		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
+
+		if (data.height) data.width = (csize.height * this.aspectRatio);
+		else if (data.width) data.height = (csize.width / this.aspectRatio);
+
+		if (a == 'sw') {
+			data.left = cpos.left + (csize.width - data.width);
+			data.top = null;
+		}
+		if (a == 'nw') {
+			data.top = cpos.top + (csize.height - data.height);
+			data.left = cpos.left + (csize.width - data.width);
+		}
+
+		return data;
+	},
+
+	_respectSize: function(data, event) {
+
+		var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
+				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
+					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
+
+		if (isminw) data.width = o.minWidth;
+		if (isminh) data.height = o.minHeight;
+		if (ismaxw) data.width = o.maxWidth;
+		if (ismaxh) data.height = o.maxHeight;
+
+		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
+		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
+
+		if (isminw && cw) data.left = dw - o.minWidth;
+		if (ismaxw && cw) data.left = dw - o.maxWidth;
+		if (isminh && ch)	data.top = dh - o.minHeight;
+		if (ismaxh && ch)	data.top = dh - o.maxHeight;
+
+		// fixing jump error on top/left - bug #2330
+		var isNotwh = !data.width && !data.height;
+		if (isNotwh && !data.left && data.top) data.top = null;
+		else if (isNotwh && !data.top && data.left) data.left = null;
+
+		return data;
+	},
+
+	_proportionallyResize: function() {
+
+		var o = this.options;
+		if (!this._proportionallyResizeElements.length) return;
+		var element = this.helper || this.element;
+
+		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
+
+			var prel = this._proportionallyResizeElements[i];
+
+			if (!this.borderDif) {
+				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
+					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
+
+				this.borderDif = $.map(b, function(v, i) {
+					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
+					return border + padding;
+				});
+			}
+
+			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
+				continue;
+
+			prel.css({
+				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
+				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
+			});
+
+		};
+
+	},
+
+	_renderProxy: function() {
+
+		var el = this.element, o = this.options;
+		this.elementOffset = el.offset();
+
+		if(this._helper) {
+
+			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
+
+			// fix ie6 offset TODO: This seems broken
+			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
+			pxyoffset = ( ie6 ? 2 : -1 );
+
+			this.helper.addClass(this._helper).css({
+				width: this.element.outerWidth() + pxyoffset,
+				height: this.element.outerHeight() + pxyoffset,
+				position: 'absolute',
+				left: this.elementOffset.left - ie6offset +'px',
+				top: this.elementOffset.top - ie6offset +'px',
+				zIndex: ++o.zIndex //TODO: Don't modify option
+			});
+
+			this.helper
+				.appendTo("body")
+				.disableSelection();
+
+		} else {
+			this.helper = this.element;
+		}
+
+	},
+
+	_change: {
+		e: function(event, dx, dy) {
+			return { width: this.originalSize.width + dx };
+		},
+		w: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { left: sp.left + dx, width: cs.width - dx };
+		},
+		n: function(event, dx, dy) {
+			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
+			return { top: sp.top + dy, height: cs.height - dy };
+		},
+		s: function(event, dx, dy) {
+			return { height: this.originalSize.height + dy };
+		},
+		se: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		sw: function(event, dx, dy) {
+			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		},
+		ne: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
+		},
+		nw: function(event, dx, dy) {
+			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
+		}
+	},
+
+	_propagate: function(n, event) {
+		$.ui.plugin.call(this, n, [event, this.ui()]);
+		(n != "resize" && this._trigger(n, event, this.ui()));
+	},
+
+	plugins: {},
+
+	ui: function() {
+		return {
+			originalElement: this.originalElement,
+			element: this.element,
+			helper: this.helper,
+			position: this.position,
+			size: this.size,
+			originalSize: this.originalSize,
+			originalPosition: this.originalPosition
+		};
+	}
+
+}));
+
+$.extend($.ui.resizable, {
+	version: "@VERSION",
+	eventPrefix: "resize",
+	defaults: $.extend({}, $.ui.mouse.defaults, {
+		alsoResize: false,
+		animate: false,
+		animateDuration: "slow",
+		animateEasing: "swing",
+		aspectRatio: false,
+		autoHide: false,
+		containment: false,
+		ghost: false,
+		grid: false,
+		handles: "e,s,se",
+		helper: false,
+		maxHeight: null,
+		maxWidth: null,
+		minHeight: 10,
+		minWidth: 10,
+		zIndex: 1000
+	})
+});
+
+/*
+ * Resizable Extensions
+ */
+
+$.ui.plugin.add("resizable", "alsoResize", {
+
+	start: function(event, ui) {
+
+		var self = $(this).data("resizable"), o = self.options;
+
+		var _store = function(exp) {
+			$(exp).each(function() {
+				$(this).data("resizable-alsoresize", {
+					width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
+					left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
+				});
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
+			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0];	_store(o.alsoResize); }
+			else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
+		}else{
+			_store(o.alsoResize);
+		}
+	},
+
+	resize: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
+
+		var delta = {
+			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
+			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
+		},
+
+		_alsoResize = function(exp, c) {
+			$(exp).each(function() {
+				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
+
+				$.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
+					var sum = (start[prop]||0) + (delta[prop]||0);
+					if (sum && sum >= 0)
+						style[prop] = sum || null;
+				});
+
+				//Opera fixing relative position
+				if (/relative/.test(el.css('position')) && $.browser.opera) {
+					self._revertToRelativePosition = true;
+					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
+				}
+
+				el.css(style);
+			});
+		};
+
+		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
+			$.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
+		}else{
+			_alsoResize(o.alsoResize);
+		}
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable");
+
+		//Opera fixing relative position
+		if (self._revertToRelativePosition && $.browser.opera) {
+			self._revertToRelativePosition = false;
+			el.css({ position: 'relative' });
+		}
+
+		$(this).removeData("resizable-alsoresize-start");
+	}
+});
+
+$.ui.plugin.add("resizable", "animate", {
+
+	stop: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options;
+
+		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
+					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
+						soffsetw = ista ? 0 : self.sizeDiff.width;
+
+		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
+					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
+						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
+
+		self.element.animate(
+			$.extend(style, top && left ? { top: top, left: left } : {}), {
+				duration: o.animateDuration,
+				easing: o.animateEasing,
+				step: function() {
+
+					var data = {
+						width: parseInt(self.element.css('width'), 10),
+						height: parseInt(self.element.css('height'), 10),
+						top: parseInt(self.element.css('top'), 10),
+						left: parseInt(self.element.css('left'), 10)
+					};
+
+					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
+
+					// propagating resize, and updating values for each animation step
+					self._updateCache(data);
+					self._propagate("resize", event);
+
+				}
+			}
+		);
+	}
+
+});
+
+$.ui.plugin.add("resizable", "containment", {
+
+	start: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, el = self.element;
+		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
+		if (!ce) return;
+
+		self.containerElement = $(ce);
+
+		if (/document/.test(oc) || oc == document) {
+			self.containerOffset = { left: 0, top: 0 };
+			self.containerPosition = { left: 0, top: 0 };
+
+			self.parentData = {
+				element: $(document), left: 0, top: 0,
+				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
+			};
+		}
+
+		// i'm a node, so compute top, left, right, bottom
+		else {
+			var element = $(ce), p = [];
+			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
+
+			self.containerOffset = element.offset();
+			self.containerPosition = element.position();
+			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
+
+			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
+						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
+
+			self.parentData = {
+				element: ce, left: co.left, top: co.top, width: width, height: height
+			};
+		}
+	},
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options,
+				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
+				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
+
+		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
+
+		if (cp.left < (self._helper ? co.left : 0)) {
+			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
+			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
+			self.position.left = o.helper ? co.left : 0;
+		}
+
+		if (cp.top < (self._helper ? co.top : 0)) {
+			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
+			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
+			self.position.top = self._helper ? co.top : 0;
+		}
+
+		self.offset.left = self.parentData.left+self.position.left;
+		self.offset.top = self.parentData.top+self.position.top;
+
+		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
+					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
+
+		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
+		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
+
+		if(isParent && isOffsetRelative) woset -= self.parentData.left;
+
+		if (woset + self.size.width >= self.parentData.width) {
+			self.size.width = self.parentData.width - woset;
+			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
+		}
+
+		if (hoset + self.size.height >= self.parentData.height) {
+			self.size.height = self.parentData.height - hoset;
+			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
+		}
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options, cp = self.position,
+				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
+
+		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
+
+		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
+			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
+
+	}
+});
+
+$.ui.plugin.add("resizable", "ghost", {
+
+	start: function(event, ui) {
+
+		var self = $(this).data("resizable"), o = self.options, cs = self.size;
+
+		self.ghost = self.originalElement.clone();
+		self.ghost
+			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
+			.addClass('ui-resizable-ghost')
+			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
+
+		self.ghost.appendTo(self.helper);
+
+	},
+
+	resize: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
+	},
+
+	stop: function(event, ui){
+		var self = $(this).data("resizable"), o = self.options;
+		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
+	}
+
+});
+
+$.ui.plugin.add("resizable", "grid", {
+
+	resize: function(event, ui) {
+		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
+		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
+		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
+
+		if (/^(se|s|e)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+		}
+		else if (/^(ne)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+		}
+		else if (/^(sw)$/.test(a)) {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.left = op.left - ox;
+		}
+		else {
+			self.size.width = os.width + ox;
+			self.size.height = os.height + oy;
+			self.position.top = op.top - oy;
+			self.position.left = op.left - ox;
+		}
+	}
+
+});
+
+var num = function(v) {
+	return parseInt(v, 10) || 0;
+};
+
+var isNumber = function(value) {
+	return !isNaN(parseInt(value, 10));
+};
+
+})(jQuery);
diff --git a/ui/jquery.ui.selectable.js b/ui/jquery.ui.selectable.js
new file mode 100644
index 000000000..933c6ca96
--- /dev/null
+++ b/ui/jquery.ui.selectable.js
@@ -0,0 +1,257 @@
+/*
+ * jQuery UI Selectable @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Selectables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
+
+	_init: function() {
+		var self = this;
+
+		this.element.addClass("ui-selectable");
+
+		this.dragged = false;
+
+		// cache selectee children based on filter
+		var selectees;
+		this.refresh = function() {
+			selectees = $(self.options.filter, self.element[0]);
+			selectees.each(function() {
+				var $this = $(this);
+				var pos = $this.offset();
+				$.data(this, "selectable-item", {
+					element: this,
+					$element: $this,
+					left: pos.left,
+					top: pos.top,
+					right: pos.left + $this.outerWidth(),
+					bottom: pos.top + $this.outerHeight(),
+					startselected: false,
+					selected: $this.hasClass('ui-selected'),
+					selecting: $this.hasClass('ui-selecting'),
+					unselecting: $this.hasClass('ui-unselecting')
+				});
+			});
+		};
+		this.refresh();
+
+		this.selectees = selectees.addClass("ui-selectee");
+
+		this._mouseInit();
+
+		this.helper = $(document.createElement('div'))
+			.css({border:'1px dotted black'})
+			.addClass("ui-selectable-helper");
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass("ui-selectable ui-selectable-disabled")
+			.removeData("selectable")
+			.unbind(".selectable");
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseStart: function(event) {
+		var self = this;
+
+		this.opos = [event.pageX, event.pageY];
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		this.selectees = $(options.filter, this.element[0]);
+
+		this._trigger("start", event);
+
+		$(options.appendTo).append(this.helper);
+		// position helper (lasso)
+		this.helper.css({
+			"z-index": 100,
+			"position": "absolute",
+			"left": event.clientX,
+			"top": event.clientY,
+			"width": 0,
+			"height": 0
+		});
+
+		if (options.autoRefresh) {
+			this.refresh();
+		}
+
+		this.selectees.filter('.ui-selected').each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.startselected = true;
+			if (!event.metaKey) {
+				selectee.$element.removeClass('ui-selected');
+				selectee.selected = false;
+				selectee.$element.addClass('ui-unselecting');
+				selectee.unselecting = true;
+				// selectable UNSELECTING callback
+				self._trigger("unselecting", event, {
+					unselecting: selectee.element
+				});
+			}
+		});
+
+		$(event.target).parents().andSelf().each(function() {
+			var selectee = $.data(this, "selectable-item");
+			if (selectee) {
+				selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
+				selectee.unselecting = false;
+				selectee.selecting = true;
+				selectee.selected = true;
+				// selectable SELECTING callback
+				self._trigger("selecting", event, {
+					selecting: selectee.element
+				});
+				return false;
+			}
+		});
+
+	},
+
+	_mouseDrag: function(event) {
+		var self = this;
+		this.dragged = true;
+
+		if (this.options.disabled)
+			return;
+
+		var options = this.options;
+
+		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
+		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
+		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
+		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
+
+		this.selectees.each(function() {
+			var selectee = $.data(this, "selectable-item");
+			//prevent helper from being selected if appendTo: selectable
+			if (!selectee || selectee.element == self.element[0])
+				return;
+			var hit = false;
+			if (options.tolerance == 'touch') {
+				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
+			} else if (options.tolerance == 'fit') {
+				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
+			}
+
+			if (hit) {
+				// SELECT
+				if (selectee.selected) {
+					selectee.$element.removeClass('ui-selected');
+					selectee.selected = false;
+				}
+				if (selectee.unselecting) {
+					selectee.$element.removeClass('ui-unselecting');
+					selectee.unselecting = false;
+				}
+				if (!selectee.selecting) {
+					selectee.$element.addClass('ui-selecting');
+					selectee.selecting = true;
+					// selectable SELECTING callback
+					self._trigger("selecting", event, {
+						selecting: selectee.element
+					});
+				}
+			} else {
+				// UNSELECT
+				if (selectee.selecting) {
+					if (event.metaKey && selectee.startselected) {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						selectee.$element.addClass('ui-selected');
+						selectee.selected = true;
+					} else {
+						selectee.$element.removeClass('ui-selecting');
+						selectee.selecting = false;
+						if (selectee.startselected) {
+							selectee.$element.addClass('ui-unselecting');
+							selectee.unselecting = true;
+						}
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+				if (selectee.selected) {
+					if (!event.metaKey && !selectee.startselected) {
+						selectee.$element.removeClass('ui-selected');
+						selectee.selected = false;
+
+						selectee.$element.addClass('ui-unselecting');
+						selectee.unselecting = true;
+						// selectable UNSELECTING callback
+						self._trigger("unselecting", event, {
+							unselecting: selectee.element
+						});
+					}
+				}
+			}
+		});
+
+		return false;
+	},
+
+	_mouseStop: function(event) {
+		var self = this;
+
+		this.dragged = false;
+
+		var options = this.options;
+
+		$('.ui-unselecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-unselecting');
+			selectee.unselecting = false;
+			selectee.startselected = false;
+			self._trigger("unselected", event, {
+				unselected: selectee.element
+			});
+		});
+		$('.ui-selecting', this.element[0]).each(function() {
+			var selectee = $.data(this, "selectable-item");
+			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
+			selectee.selecting = false;
+			selectee.selected = true;
+			selectee.startselected = true;
+			self._trigger("selected", event, {
+				selected: selectee.element
+			});
+		});
+		this._trigger("stop", event);
+
+		this.helper.remove();
+
+		return false;
+	}
+
+}));
+
+$.extend($.ui.selectable, {
+	version: "@VERSION",
+	defaults: $.extend({}, $.ui.mouse.defaults, {
+		appendTo: 'body',
+		autoRefresh: true,
+		distance: 0,
+		filter: '*',
+		tolerance: 'touch'
+	})
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.slider.js b/ui/jquery.ui.slider.js
new file mode 100644
index 000000000..f2ea5f67e
--- /dev/null
+++ b/ui/jquery.ui.slider.js
@@ -0,0 +1,559 @@
+/*
+ * jQuery UI Slider @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Slider
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+
+(function($) {
+
+$.widget("ui.slider", $.extend({}, $.ui.mouse, {
+
+	_init: function() {
+
+		var self = this, o = this.options;
+		this._keySliding = false;
+		this._handleIndex = null;
+		this._detectOrientation();
+		this._mouseInit();
+
+		this.element
+			.addClass("ui-slider"
+				+ " ui-slider-" + this.orientation
+				+ " ui-widget"
+				+ " ui-widget-content"
+				+ " ui-corner-all");
+
+		this.range = $([]);
+
+		if (o.range) {
+
+			if (o.range === true) {
+				this.range = $('<div></div>');
+				if (!o.values) o.values = [this._valueMin(), this._valueMin()];
+				if (o.values.length && o.values.length != 2) {
+					o.values = [o.values[0], o.values[0]];
+				}
+			} else {
+				this.range = $('<div></div>');
+			}
+
+			this.range
+				.appendTo(this.element)
+				.addClass("ui-slider-range");
+
+			if (o.range == "min" || o.range == "max") {
+				this.range.addClass("ui-slider-range-" + o.range);
+			}
+
+			// note: this isn't the most fittingly semantic framework class for this element,
+			// but worked best visually with a variety of themes
+			this.range.addClass("ui-widget-header");
+
+		}
+
+		if ($(".ui-slider-handle", this.element).length == 0)
+			$('<a href="#"></a>')
+				.appendTo(this.element)
+				.addClass("ui-slider-handle");
+
+		if (o.values && o.values.length) {
+			while ($(".ui-slider-handle", this.element).length < o.values.length)
+				$('<a href="#"></a>')
+					.appendTo(this.element)
+					.addClass("ui-slider-handle");
+		}
+
+		this.handles = $(".ui-slider-handle", this.element)
+			.addClass("ui-state-default"
+				+ " ui-corner-all");
+
+		this.handle = this.handles.eq(0);
+
+		this.handles.add(this.range).filter("a")
+			.click(function(event) {
+				event.preventDefault();
+			})
+			.hover(function() {
+				if (!o.disabled) {
+					$(this).addClass('ui-state-hover');
+				}
+			}, function() {
+				$(this).removeClass('ui-state-hover');
+			})
+			.focus(function() {
+				if (!o.disabled) {
+					$(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus');
+				} else {
+					$(this).blur();
+				}
+			})
+			.blur(function() {
+				$(this).removeClass('ui-state-focus');
+			});
+
+		this.handles.each(function(i) {
+			$(this).data("index.ui-slider-handle", i);
+		});
+
+		this.handles.keydown(function(event) {
+
+			var ret = true;
+
+			var index = $(this).data("index.ui-slider-handle");
+
+			if (self.options.disabled)
+				return;
+
+			switch (event.keyCode) {
+				case $.ui.keyCode.HOME:
+				case $.ui.keyCode.END:
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					ret = false;
+					if (!self._keySliding) {
+						self._keySliding = true;
+						$(this).addClass("ui-state-active");
+						self._start(event, index);
+					}
+					break;
+			}
+
+			var curVal, newVal, step = self._step();
+			if (self.options.values && self.options.values.length) {
+				curVal = newVal = self.values(index);
+			} else {
+				curVal = newVal = self.value();
+			}
+
+			switch (event.keyCode) {
+				case $.ui.keyCode.HOME:
+					newVal = self._valueMin();
+					break;
+				case $.ui.keyCode.END:
+					newVal = self._valueMax();
+					break;
+				case $.ui.keyCode.UP:
+				case $.ui.keyCode.RIGHT:
+					if(curVal == self._valueMax()) return;
+					newVal = curVal + step;
+					break;
+				case $.ui.keyCode.DOWN:
+				case $.ui.keyCode.LEFT:
+					if(curVal == self._valueMin()) return;
+					newVal = curVal - step;
+					break;
+			}
+
+			self._slide(event, index, newVal);
+
+			return ret;
+
+		}).keyup(function(event) {
+
+			var index = $(this).data("index.ui-slider-handle");
+
+			if (self._keySliding) {
+				self._stop(event, index);
+				self._change(event, index);
+				self._keySliding = false;
+				$(this).removeClass("ui-state-active");
+			}
+
+		});
+
+		this._refreshValue();
+
+	},
+
+	destroy: function() {
+
+		this.handles.remove();
+		this.range.remove();
+
+		this.element
+			.removeClass("ui-slider"
+				+ " ui-slider-horizontal"
+				+ " ui-slider-vertical"
+				+ " ui-slider-disabled"
+				+ " ui-widget"
+				+ " ui-widget-content"
+				+ " ui-corner-all")
+			.removeData("slider")
+			.unbind(".slider");
+
+		this._mouseDestroy();
+
+		return this;
+	},
+
+	_mouseCapture: function(event) {
+
+		var o = this.options;
+
+		if (o.disabled)
+			return false;
+
+		this.elementSize = {
+			width: this.element.outerWidth(),
+			height: this.element.outerHeight()
+		};
+		this.elementOffset = this.element.offset();
+
+		var position = { x: event.pageX, y: event.pageY };
+		var normValue = this._normValueFromMouse(position);
+
+		var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
+		var self = this, index;
+		this.handles.each(function(i) {
+			var thisDistance = Math.abs(normValue - self.values(i));
+			if (distance > thisDistance) {
+				distance = thisDistance;
+				closestHandle = $(this);
+				index = i;
+			}
+		});
+
+		// workaround for bug #3736 (if both handles of a range are at 0,
+		// the first is always used as the one with least distance,
+		// and moving it is obviously prevented by preventing negative ranges)
+		if(o.range == true && this.values(1) == o.min) {
+			closestHandle = $(this.handles[++index]);
+		}
+
+		this._start(event, index);
+
+		self._handleIndex = index;
+
+		closestHandle
+			.addClass("ui-state-active")
+			.focus();
+		
+		var offset = closestHandle.offset();
+		var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
+		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
+			left: event.pageX - offset.left - (closestHandle.width() / 2),
+			top: event.pageY - offset.top
+				- (closestHandle.height() / 2)
+				- (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
+				- (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
+				+ (parseInt(closestHandle.css('marginTop'),10) || 0)
+		};
+
+		normValue = this._normValueFromMouse(position);
+		this._slide(event, index, normValue);
+		return true;
+
+	},
+
+	_mouseStart: function(event) {
+		return true;
+	},
+
+	_mouseDrag: function(event) {
+
+		var position = { x: event.pageX, y: event.pageY };
+		var normValue = this._normValueFromMouse(position);
+		
+		this._slide(event, this._handleIndex, normValue);
+
+		return false;
+
+	},
+
+	_mouseStop: function(event) {
+
+		this.handles.removeClass("ui-state-active");
+		this._stop(event, this._handleIndex);
+		this._change(event, this._handleIndex);
+		this._handleIndex = null;
+		this._clickOffset = null;
+
+		return false;
+
+	},
+	
+	_detectOrientation: function() {
+		this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
+	},
+
+	_normValueFromMouse: function(position) {
+
+		var pixelTotal, pixelMouse;
+		if ('horizontal' == this.orientation) {
+			pixelTotal = this.elementSize.width;
+			pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
+		} else {
+			pixelTotal = this.elementSize.height;
+			pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
+		}
+
+		var percentMouse = (pixelMouse / pixelTotal);
+		if (percentMouse > 1) percentMouse = 1;
+		if (percentMouse < 0) percentMouse = 0;
+		if ('vertical' == this.orientation)
+			percentMouse = 1 - percentMouse;
+
+		var valueTotal = this._valueMax() - this._valueMin(),
+			valueMouse = percentMouse * valueTotal,
+			valueMouseModStep = valueMouse % this.options.step,
+			normValue = this._valueMin() + valueMouse - valueMouseModStep;
+
+		if (valueMouseModStep > (this.options.step / 2))
+			normValue += this.options.step;
+
+		// Since JavaScript has problems with large floats, round
+		// the final value to 5 digits after the decimal point (see #4124)
+		return parseFloat(normValue.toFixed(5));
+
+	},
+
+	_start: function(event, index) {
+		var uiHash = {
+			handle: this.handles[index],
+			value: this.value()
+		};
+		if (this.options.values && this.options.values.length) {
+			uiHash.value = this.values(index);
+			uiHash.values = this.values();
+		}
+		this._trigger("start", event, uiHash);
+	},
+
+	_slide: function(event, index, newVal) {
+
+		var handle = this.handles[index];
+
+		if (this.options.values && this.options.values.length) {
+
+			var otherVal = this.values(index ? 0 : 1);
+
+			if ((this.options.values.length == 2 && this.options.range === true) && 
+				((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){
+ 				newVal = otherVal;
+			}
+
+			if (newVal != this.values(index)) {
+				var newValues = this.values();
+				newValues[index] = newVal;
+				// A slide can be canceled by returning false from the slide callback
+				var allowed = this._trigger("slide", event, {
+					handle: this.handles[index],
+					value: newVal,
+					values: newValues
+				});
+				var otherVal = this.values(index ? 0 : 1);
+				if (allowed !== false) {
+					this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
+				}
+			}
+
+		} else {
+
+			if (newVal != this.value()) {
+				// A slide can be canceled by returning false from the slide callback
+				var allowed = this._trigger("slide", event, {
+					handle: this.handles[index],
+					value: newVal
+				});
+				if (allowed !== false) {
+					this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
+				}
+					
+			}
+
+		}
+
+	},
+
+	_stop: function(event, index) {
+		var uiHash = {
+			handle: this.handles[index],
+			value: this.value()
+		};
+		if (this.options.values && this.options.values.length) {
+			uiHash.value = this.values(index);
+			uiHash.values = this.values();
+		}
+		this._trigger("stop", event, uiHash);
+	},
+
+	_change: function(event, index) {
+		var uiHash = {
+			handle: this.handles[index],
+			value: this.value()
+		};
+		if (this.options.values && this.options.values.length) {
+			uiHash.value = this.values(index);
+			uiHash.values = this.values();
+		}
+		this._trigger("change", event, uiHash);
+	},
+
+	value: function(newValue) {
+
+		if (arguments.length) {
+			this._setData("value", newValue);
+			this._change(null, 0);
+		}
+
+		return this._value();
+
+	},
+
+	values: function(index, newValue, animated, noPropagation) {
+
+		if (arguments.length > 1) {
+			this.options.values[index] = newValue;
+			this._refreshValue(animated);
+			if(!noPropagation) this._change(null, index);
+		}
+
+		if (arguments.length) {
+			if (this.options.values && this.options.values.length) {
+				return this._values(index);
+			} else {
+				return this.value();
+			}
+		} else {
+			return this._values();
+		}
+
+	},
+
+	_setData: function(key, value, animated) {
+
+		$.widget.prototype._setData.apply(this, arguments);
+
+		switch (key) {
+			case 'disabled':
+				if (value) {
+					this.handles.filter(".ui-state-focus").blur();
+					this.handles.removeClass("ui-state-hover");
+					this.handles.attr("disabled", "disabled");
+				} else {
+					this.handles.removeAttr("disabled");
+				}
+			case 'orientation':
+
+				this._detectOrientation();
+				
+				this.element
+					.removeClass("ui-slider-horizontal ui-slider-vertical")
+					.addClass("ui-slider-" + this.orientation);
+				this._refreshValue(animated);
+				break;
+			case 'value':
+				this._refreshValue(animated);
+				break;
+		}
+
+	},
+
+	_step: function() {
+		var step = this.options.step;
+		return step;
+	},
+
+	_value: function() {
+
+		var val = this.options.value;
+		if (val < this._valueMin()) val = this._valueMin();
+		if (val > this._valueMax()) val = this._valueMax();
+
+		return val;
+
+	},
+
+	_values: function(index) {
+
+		if (arguments.length) {
+			var val = this.options.values[index];
+			if (val < this._valueMin()) val = this._valueMin();
+			if (val > this._valueMax()) val = this._valueMax();
+
+			return val;
+		} else {
+			// .slice() creates a copy of the array
+			// this prevents outside manipulation of the internal state
+			return this.options.values.slice();
+		}
+
+	},
+
+	_valueMin: function() {
+		var valueMin = this.options.min;
+		return valueMin;
+	},
+
+	_valueMax: function() {
+		var valueMax = this.options.max;
+		return valueMax;
+	},
+
+	_refreshValue: function(animate) {
+
+		var oRange = this.options.range, o = this.options, self = this;
+
+		if (this.options.values && this.options.values.length) {
+			var vp0, vp1;
+			this.handles.each(function(i, j) {
+				var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
+				var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+				$(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+				if (self.options.range === true) {
+					if (self.orientation == 'horizontal') {
+						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
+						(i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+					} else {
+						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
+						(i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
+					}
+				}
+				lastValPercent = valPercent;
+			});
+		} else {
+			var value = this.value(),
+				valueMin = this._valueMin(),
+				valueMax = this._valueMax(),
+				valPercent = valueMax != valueMin
+					? (value - valueMin) / (valueMax - valueMin) * 100
+					: 0;
+			var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
+			this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
+
+			(oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
+			(oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+			(oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
+			(oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
+		}
+
+	}
+	
+}));
+
+$.extend($.ui.slider, {
+	version: "@VERSION",
+	eventPrefix: "slide",
+	defaults: $.extend({}, $.ui.mouse.defaults, {
+		animate: false,
+		distance: 0,
+		max: 100,
+		min: 0,
+		orientation: 'horizontal',
+		range: false,
+		step: 1,
+		value: 0,
+		values: null
+	})
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.sortable.js b/ui/jquery.ui.sortable.js
new file mode 100644
index 000000000..dbfbbb20f
--- /dev/null
+++ b/ui/jquery.ui.sortable.js
@@ -0,0 +1,1050 @@
+/*
+ * jQuery UI Sortable @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Sortables
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
+	_init: function() {
+
+		var o = this.options;
+		this.containerCache = {};
+		this.element.addClass("ui-sortable");
+
+		//Get the items
+		this.refresh();
+
+		//Let's determine if the items are floating
+		this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
+
+		//Let's determine the parent's offset
+		this.offset = this.element.offset();
+
+		//Initialize mouse events for interaction
+		this._mouseInit();
+
+	},
+
+	destroy: function() {
+		this.element
+			.removeClass("ui-sortable ui-sortable-disabled")
+			.removeData("sortable")
+			.unbind(".sortable");
+		this._mouseDestroy();
+
+		for ( var i = this.items.length - 1; i >= 0; i-- )
+			this.items[i].item.removeData("sortable-item");
+
+		return this;
+	},
+
+	_mouseCapture: function(event, overrideHandle) {
+
+		if (this.reverting) {
+			return false;
+		}
+
+		if(this.options.disabled || this.options.type == 'static') return false;
+
+		//We have to refresh the items data once first
+		this._refreshItems(event);
+
+		//Find out if the clicked node (or one of its parents) is a actual item in this.items
+		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
+			if($.data(this, 'sortable-item') == self) {
+				currentItem = $(this);
+				return false;
+			}
+		});
+		if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
+
+		if(!currentItem) return false;
+		if(this.options.handle && !overrideHandle) {
+			var validHandle = false;
+
+			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
+			if(!validHandle) return false;
+		}
+
+		this.currentItem = currentItem;
+		this._removeCurrentsFromItems();
+		return true;
+
+	},
+
+	_mouseStart: function(event, overrideHandle, noActivation) {
+
+		var o = this.options, self = this;
+		this.currentContainer = this;
+
+		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
+		this.refreshPositions();
+
+		//Create and append the visible helper
+		this.helper = this._createHelper(event);
+
+		//Cache the helper size
+		this._cacheHelperProportions();
+
+		/*
+		 * - Position generation -
+		 * This block generates everything position related - it's the core of draggables.
+		 */
+
+		//Cache the margins of the original element
+		this._cacheMargins();
+
+		//Get the next scrolling parent
+		this.scrollParent = this.helper.scrollParent();
+
+		//The element's absolute position on the page minus margins
+		this.offset = this.currentItem.offset();
+		this.offset = {
+			top: this.offset.top - this.margins.top,
+			left: this.offset.left - this.margins.left
+		};
+
+		// Only after we got the offset, we can change the helper's position to absolute
+		// TODO: Still need to figure out a way to make relative sorting possible
+		this.helper.css("position", "absolute");
+		this.cssPosition = this.helper.css("position");
+
+		$.extend(this.offset, {
+			click: { //Where the click happened, relative to the element
+				left: event.pageX - this.offset.left,
+				top: event.pageY - this.offset.top
+			},
+			parent: this._getParentOffset(),
+			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
+		});
+
+		//Generate the original position
+		this.originalPosition = this._generatePosition(event);
+		this.originalPageX = event.pageX;
+		this.originalPageY = event.pageY;
+
+		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
+		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
+
+		//Cache the former DOM position
+		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
+
+		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
+		if(this.helper[0] != this.currentItem[0]) {
+			this.currentItem.hide();
+		}
+
+		//Create the placeholder
+		this._createPlaceholder();
+
+		//Set a containment if given in the options
+		if(o.containment)
+			this._setContainment();
+
+		if(o.cursor) { // cursor option
+			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
+			$('body').css("cursor", o.cursor);
+		}
+
+		if(o.opacity) { // opacity option
+			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
+			this.helper.css("opacity", o.opacity);
+		}
+
+		if(o.zIndex) { // zIndex option
+			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
+			this.helper.css("zIndex", o.zIndex);
+		}
+
+		//Prepare scrolling
+		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
+			this.overflowOffset = this.scrollParent.offset();
+
+		//Call callbacks
+		this._trigger("start", event, this._uiHash());
+
+		//Recache the helper size
+		if(!this._preserveHelperProportions)
+			this._cacheHelperProportions();
+
+
+		//Post 'activate' events to possible containers
+		if(!noActivation) {
+			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
+		}
+
+		//Prepare possible droppables
+		if($.ui.ddmanager)
+			$.ui.ddmanager.current = this;
+
+		if ($.ui.ddmanager && !o.dropBehaviour)
+			$.ui.ddmanager.prepareOffsets(this, event);
+
+		this.dragging = true;
+
+		this.helper.addClass("ui-sortable-helper");
+		this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
+		return true;
+
+	},
+
+	_mouseDrag: function(event) {
+
+		//Compute the helpers position
+		this.position = this._generatePosition(event);
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		if (!this.lastPositionAbs) {
+			this.lastPositionAbs = this.positionAbs;
+		}
+
+		//Do scrolling
+		if(this.options.scroll) {
+			var o = this.options, scrolled = false;
+			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
+
+				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
+				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
+					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
+
+				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
+				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
+					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
+
+			} else {
+
+				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
+				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
+					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
+
+				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
+				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
+					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
+
+			}
+
+			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
+				$.ui.ddmanager.prepareOffsets(this, event);
+		}
+
+		//Regenerate the absolute position used for position checks
+		this.positionAbs = this._convertPositionTo("absolute");
+
+		//Set the helper position
+		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
+		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
+
+		//Rearrange
+		for (var i = this.items.length - 1; i >= 0; i--) {
+
+			//Cache variables and intersection, continue if no intersection
+			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
+			if (!intersection) continue;
+
+			if(itemElement != this.currentItem[0] //cannot intersect with itself
+				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
+				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
+				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
+				//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
+			) {
+
+				this.direction = intersection == 1 ? "down" : "up";
+
+				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
+					this._rearrange(event, item);
+				} else {
+					break;
+				}
+
+				this._trigger("change", event, this._uiHash());
+				break;
+			}
+		}
+
+		//Post events to containers
+		this._contactContainers(event);
+
+		//Interconnect with droppables
+		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
+
+		//Call callbacks
+		this._trigger('sort', event, this._uiHash());
+
+		this.lastPositionAbs = this.positionAbs;
+		return false;
+
+	},
+
+	_mouseStop: function(event, noPropagation) {
+
+		if(!event) return;
+
+		//If we are using droppables, inform the manager about the drop
+		if ($.ui.ddmanager && !this.options.dropBehaviour)
+			$.ui.ddmanager.drop(this, event);
+
+		if(this.options.revert) {
+			var self = this;
+			var cur = self.placeholder.offset();
+
+			self.reverting = true;
+
+			$(this.helper).animate({
+				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
+				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
+			}, parseInt(this.options.revert, 10) || 500, function() {
+				self._clear(event);
+			});
+		} else {
+			this._clear(event, noPropagation);
+		}
+
+		return false;
+
+	},
+
+	cancel: function() {
+
+		var self = this;
+
+		if(this.dragging) {
+
+			this._mouseUp();
+
+			if(this.options.helper == "original")
+				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+			else
+				this.currentItem.show();
+
+			//Post deactivating events to containers
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", null, self._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+		if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+		if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
+
+		$.extend(this, {
+			helper: null,
+			dragging: false,
+			reverting: false,
+			_noFinalSort: null
+		});
+
+		if(this.domPosition.prev) {
+			$(this.domPosition.prev).after(this.currentItem);
+		} else {
+			$(this.domPosition.parent).prepend(this.currentItem);
+		}
+
+		return this;
+
+	},
+
+	serialize: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var str = []; o = o || {};
+
+		$(items).each(function() {
+			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
+			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
+		});
+
+		return str.join('&');
+
+	},
+
+	toArray: function(o) {
+
+		var items = this._getItemsAsjQuery(o && o.connected);
+		var ret = []; o = o || {};
+
+		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
+		return ret;
+
+	},
+
+	/* Be careful with the following core functions */
+	_intersectsWith: function(item) {
+
+		var x1 = this.positionAbs.left,
+			x2 = x1 + this.helperProportions.width,
+			y1 = this.positionAbs.top,
+			y2 = y1 + this.helperProportions.height;
+
+		var l = item.left,
+			r = l + item.width,
+			t = item.top,
+			b = t + item.height;
+
+		var dyClick = this.offset.click.top,
+			dxClick = this.offset.click.left;
+
+		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
+
+		if(	   this.options.tolerance == "pointer"
+			|| this.options.forcePointerForContainers
+			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
+		) {
+			return isOverElement;
+		} else {
+
+			return (l < x1 + (this.helperProportions.width / 2) // Right Half
+				&& x2 - (this.helperProportions.width / 2) < r // Left Half
+				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
+				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
+
+		}
+	},
+
+	_intersectsWithPointer: function(item) {
+
+		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
+			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
+			isOverElement = isOverElementHeight && isOverElementWidth,
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (!isOverElement)
+			return false;
+
+		return this.floating ?
+			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
+			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
+
+	},
+
+	_intersectsWithSides: function(item) {
+
+		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
+			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
+			verticalDirection = this._getDragVerticalDirection(),
+			horizontalDirection = this._getDragHorizontalDirection();
+
+		if (this.floating && horizontalDirection) {
+			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
+		} else {
+			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
+		}
+
+	},
+
+	_getDragVerticalDirection: function() {
+		var delta = this.positionAbs.top - this.lastPositionAbs.top;
+		return delta != 0 && (delta > 0 ? "down" : "up");
+	},
+
+	_getDragHorizontalDirection: function() {
+		var delta = this.positionAbs.left - this.lastPositionAbs.left;
+		return delta != 0 && (delta > 0 ? "right" : "left");
+	},
+
+	refresh: function(event) {
+		this._refreshItems(event);
+		this.refreshPositions();
+		return this;
+	},
+
+	_connectWith: function() {
+		var options = this.options;
+		return options.connectWith.constructor == String
+			? [options.connectWith]
+			: options.connectWith;
+	},
+	
+	_getItemsAsjQuery: function(connected) {
+
+		var self = this;
+		var items = [];
+		var queries = [];
+		var connectWith = this._connectWith();
+
+		if(connectWith && connected) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
+					}
+				};
+			};
+		}
+
+		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
+
+		for (var i = queries.length - 1; i >= 0; i--){
+			queries[i][0].each(function() {
+				items.push(this);
+			});
+		};
+
+		return $(items);
+
+	},
+
+	_removeCurrentsFromItems: function() {
+
+		var list = this.currentItem.find(":data(sortable-item)");
+
+		for (var i=0; i < this.items.length; i++) {
+
+			for (var j=0; j < list.length; j++) {
+				if(list[j] == this.items[i].item[0])
+					this.items.splice(i,1);
+			};
+
+		};
+
+	},
+
+	_refreshItems: function(event) {
+
+		this.items = [];
+		this.containers = [this];
+		var items = this.items;
+		var self = this;
+		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
+		var connectWith = this._connectWith();
+
+		if(connectWith) {
+			for (var i = connectWith.length - 1; i >= 0; i--){
+				var cur = $(connectWith[i]);
+				for (var j = cur.length - 1; j >= 0; j--){
+					var inst = $.data(cur[j], 'sortable');
+					if(inst && inst != this && !inst.options.disabled) {
+						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
+						this.containers.push(inst);
+					}
+				};
+			};
+		}
+
+		for (var i = queries.length - 1; i >= 0; i--) {
+			var targetData = queries[i][1];
+			var _queries = queries[i][0];
+
+			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
+				var item = $(_queries[j]);
+
+				item.data('sortable-item', targetData); // Data for target checking (mouse manager)
+
+				items.push({
+					item: item,
+					instance: targetData,
+					width: 0, height: 0,
+					left: 0, top: 0
+				});
+			};
+		};
+
+	},
+
+	refreshPositions: function(fast) {
+
+		//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
+		if(this.offsetParent && this.helper) {
+			this.offset.parent = this._getParentOffset();
+		}
+
+		for (var i = this.items.length - 1; i >= 0; i--){
+			var item = this.items[i];
+
+			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
+
+			if (!fast) {
+				item.width = t.outerWidth();
+				item.height = t.outerHeight();
+			}
+
+			var p = t.offset();
+			item.left = p.left;
+			item.top = p.top;
+		};
+
+		if(this.options.custom && this.options.custom.refreshContainers) {
+			this.options.custom.refreshContainers.call(this);
+		} else {
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				var p = this.containers[i].element.offset();
+				this.containers[i].containerCache.left = p.left;
+				this.containers[i].containerCache.top = p.top;
+				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
+				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
+			};
+		}
+
+		return this;
+	},
+
+	_createPlaceholder: function(that) {
+
+		var self = that || this, o = self.options;
+
+		if(!o.placeholder || o.placeholder.constructor == String) {
+			var className = o.placeholder;
+			o.placeholder = {
+				element: function() {
+
+					var el = $(document.createElement(self.currentItem[0].nodeName))
+						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
+						.removeClass("ui-sortable-helper")[0];
+
+					if(!className)
+						el.style.visibility = "hidden";
+
+					return el;
+				},
+				update: function(container, p) {
+
+					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
+					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
+					if(className && !o.forcePlaceholderSize) return;
+
+					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
+					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
+					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
+				}
+			};
+		}
+
+		//Create the placeholder
+		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
+
+		//Append it after the actual current item
+		self.currentItem.after(self.placeholder);
+
+		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
+		o.placeholder.update(self, self.placeholder);
+
+	},
+
+	_contactContainers: function(event) {
+		
+		// get innermost container that intersects with item 
+		var innermostContainer = null, innermostIndex = null;		
+		
+		
+		for (var i = this.containers.length - 1; i >= 0; i--){
+
+			// never consider a container that's located within the item itself 
+			if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
+				continue;
+
+			if(this._intersectsWith(this.containers[i].containerCache)) {
+
+				// if we've already found a container and it's more "inner" than this, then continue 
+				if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
+					continue;
+
+				innermostContainer = this.containers[i]; 
+				innermostIndex = i;
+					
+			} else {
+				// container doesn't intersect. trigger "out" event if necessary 
+				if(this.containers[i].containerCache.over) {
+					this.containers[i]._trigger("out", event, this._uiHash(this));
+					this.containers[i].containerCache.over = 0;
+				}
+			}
+
+		}
+		
+		// if no intersecting containers found, return 
+		if(!innermostContainer) return; 
+
+		// move the item into the container if it's not there already 
+		if(this.currentContainer != this.containers[innermostIndex]) { 
+
+			//When entering a new container, we will find the item with the least distance and append our item near it 
+			var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; 
+			for (var j = this.items.length - 1; j >= 0; j--) { 
+				if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; 
+				var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; 
+				if(Math.abs(cur - base) < dist) { 
+					dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; 
+				} 
+			} 
+
+			if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled 
+				return; 
+
+			this.currentContainer = this.containers[innermostIndex]; 
+			itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); 
+			this._trigger("change", event, this._uiHash()); 
+			this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); 
+
+			//Update the placeholder 
+			this.options.placeholder.update(this.currentContainer, this.placeholder); 
+		
+		} 
+	
+		this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); 
+		this.containers[innermostIndex].containerCache.over = 1;
+		
+	},
+
+	_createHelper: function(event) {
+
+		var o = this.options;
+		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
+
+		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
+			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
+
+		if(helper[0] == this.currentItem[0])
+			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
+
+		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
+		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
+
+		return helper;
+
+	},
+
+	_adjustOffsetFromHelper: function(obj) {
+		if (typeof obj == 'string') {
+			obj = obj.split(' ');
+		}
+		if ($.isArray(obj)) {
+			obj = {left: +obj[0], top: +obj[1] || 0};
+		}
+		if ('left' in obj) {
+			this.offset.click.left = obj.left + this.margins.left;
+		}
+		if ('right' in obj) {
+			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
+		}
+		if ('top' in obj) {
+			this.offset.click.top = obj.top + this.margins.top;
+		}
+		if ('bottom' in obj) {
+			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
+		}
+	},
+
+	_getParentOffset: function() {
+
+
+		//Get the offsetParent and cache its position
+		this.offsetParent = this.helper.offsetParent();
+		var po = this.offsetParent.offset();
+
+		// This is a special case where we need to modify a offset calculated on start, since the following happened:
+		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
+		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
+		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
+		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
+			po.left += this.scrollParent.scrollLeft();
+			po.top += this.scrollParent.scrollTop();
+		}
+
+		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
+		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
+			po = { top: 0, left: 0 };
+
+		return {
+			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
+			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
+		};
+
+	},
+
+	_getRelativeOffset: function() {
+
+		if(this.cssPosition == "relative") {
+			var p = this.currentItem.position();
+			return {
+				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
+				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
+			};
+		} else {
+			return { top: 0, left: 0 };
+		}
+
+	},
+
+	_cacheMargins: function() {
+		this.margins = {
+			left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
+			top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
+		};
+	},
+
+	_cacheHelperProportions: function() {
+		this.helperProportions = {
+			width: this.helper.outerWidth(),
+			height: this.helper.outerHeight()
+		};
+	},
+
+	_setContainment: function() {
+
+		var o = this.options;
+		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
+		if(o.containment == 'document' || o.containment == 'window') this.containment = [
+			0 - this.offset.relative.left - this.offset.parent.left,
+			0 - this.offset.relative.top - this.offset.parent.top,
+			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
+			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
+		];
+
+		if(!(/^(document|window|parent)$/).test(o.containment)) {
+			var ce = $(o.containment)[0];
+			var co = $(o.containment).offset();
+			var over = ($(ce).css("overflow") != 'hidden');
+
+			this.containment = [
+				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
+				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
+				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
+				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
+			];
+		}
+
+	},
+
+	_convertPositionTo: function(d, pos) {
+
+		if(!pos) pos = this.position;
+		var mod = d == "absolute" ? 1 : -1;
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		return {
+			top: (
+				pos.top																	// The absolute mouse position
+				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
+			),
+			left: (
+				pos.left																// The absolute mouse position
+				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
+				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
+				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
+			)
+		};
+
+	},
+
+	_generatePosition: function(event) {
+
+		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
+
+		// This is another very weird special case that only happens for relative elements:
+		// 1. If the css position is relative
+		// 2. and the scroll parent is the document or similar to the offset parent
+		// we have to refresh the relative offset during the scroll so there are no jumps
+		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
+			this.offset.relative = this._getRelativeOffset();
+		}
+
+		var pageX = event.pageX;
+		var pageY = event.pageY;
+
+		/*
+		 * - Position constraining -
+		 * Constrain the position to a mix of grid, containment.
+		 */
+
+		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
+
+			if(this.containment) {
+				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
+				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
+				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
+			}
+
+			if(o.grid) {
+				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
+				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
+
+				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
+				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
+			}
+
+		}
+
+		return {
+			top: (
+				pageY																// The absolute mouse position
+				- this.offset.click.top													// Click offset (relative to the element)
+				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
+			),
+			left: (
+				pageX																// The absolute mouse position
+				- this.offset.click.left												// Click offset (relative to the element)
+				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
+				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
+				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
+			)
+		};
+
+	},
+
+	_rearrange: function(event, i, a, hardRefresh) {
+
+		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
+
+		//Various things done here to improve the performance:
+		// 1. we create a setTimeout, that calls refreshPositions
+		// 2. on the instance, we have a counter variable, that get's higher after every append
+		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
+		// 4. this lets only the last addition to the timeout stack through
+		this.counter = this.counter ? ++this.counter : 1;
+		var self = this, counter = this.counter;
+
+		window.setTimeout(function() {
+			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
+		},0);
+
+	},
+
+	_clear: function(event, noPropagation) {
+
+		this.reverting = false;
+		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
+		// everything else normalized again
+		var delayedTriggers = [], self = this;
+
+		// We first have to update the dom position of the actual currentItem
+		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
+		if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
+		this._noFinalSort = null;
+
+		if(this.helper[0] == this.currentItem[0]) {
+			for(var i in this._storedCSS) {
+				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
+			}
+			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
+		} else {
+			this.currentItem.show();
+		}
+
+		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
+		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
+		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
+			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
+			for (var i = this.containers.length - 1; i >= 0; i--){
+				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
+				}
+			};
+		};
+
+		//Post events to containers
+		for (var i = this.containers.length - 1; i >= 0; i--){
+			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+			if(this.containers[i].containerCache.over) {
+				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
+				this.containers[i].containerCache.over = 0;
+			}
+		}
+
+		//Do what was originally in plugins
+		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
+		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
+		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
+
+		this.dragging = false;
+		if(this.cancelHelperRemoval) {
+			if(!noPropagation) {
+				this._trigger("beforeStop", event, this._uiHash());
+				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+				this._trigger("stop", event, this._uiHash());
+			}
+			return false;
+		}
+
+		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
+
+		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
+		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
+
+		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
+
+		if(!noPropagation) {
+			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
+			this._trigger("stop", event, this._uiHash());
+		}
+
+		this.fromOutside = false;
+		return true;
+
+	},
+
+	_trigger: function() {
+		if ($.widget.prototype._trigger.apply(this, arguments) === false) {
+			this.cancel();
+		}
+	},
+
+	_uiHash: function(inst) {
+		var self = inst || this;
+		return {
+			helper: self.helper,
+			placeholder: self.placeholder || $([]),
+			position: self.position,
+			originalPosition: originalPosition,
+			offset: self.positionAbs,
+			item: self.currentItem,
+			sender: inst ? inst.element : null
+		};
+	}
+
+}));
+
+$.extend($.ui.sortable, {
+	version: "@VERSION",
+	eventPrefix: "sort",
+	defaults: $.extend({}, $.ui.mouse.defaults, {
+		appendTo: "parent",
+		axis: false,
+		connectWith: false,
+		containment: false,
+		cursor: 'auto',
+		cursorAt: false,
+		dropOnEmpty: true,
+		forcePlaceholderSize: false,
+		forceHelperSize: false,
+		grid: false,
+		handle: false,
+		helper: "original",
+		items: '> *',
+		opacity: false,
+		placeholder: false,
+		revert: false,
+		scroll: true,
+		scrollSensitivity: 20,
+		scrollSpeed: 20,
+		scope: "default",
+		tolerance: "intersect",
+		zIndex: 1000
+	})
+});
+
+})(jQuery);
diff --git a/ui/jquery.ui.stackfix.js b/ui/jquery.ui.stackfix.js
new file mode 100644
index 000000000..5631dc536
--- /dev/null
+++ b/ui/jquery.ui.stackfix.js
@@ -0,0 +1,40 @@
+/*
+ * jQuery UI Stackfix @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Stackfix
+ */
+
+(function($){
+
+// This is only for IE6
+$.fn.stackfix = $.browser.msie && /msie 6\.0/i.test(navigator.userAgent) ? function(s) {
+	s = $.extend({
+		top     : 'auto', // auto == .currentStyle.borderTopWidth
+		left    : 'auto', // auto == .currentStyle.borderLeftWidth
+		width   : 'auto', // auto == offsetWidth
+		height  : 'auto', // auto == offsetHeight
+		opacity : true,
+		src     : 'javascript:false;'
+	}, s || {});
+	var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
+	    html = '<iframe class="ui-stackfix" frameborder="0" tabindex="-1" src="'+s.src+'" '+
+	               'style="display:block;position:absolute;z-index:-1;'+
+		               (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
+				       'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+
+				       'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+
+				       'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
+				       'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
+				'"/>';
+	return this.each(function() {
+		if ( $('> iframe.ui-stackfix', this).length == 0 )
+			this.insertBefore( document.createElement(html), this.firstChild );
+	});
+} : function() {
+	return this;
+};
+
+})(jQuery);
\ No newline at end of file
diff --git a/ui/jquery.ui.tabs.js b/ui/jquery.ui.tabs.js
new file mode 100644
index 000000000..172177cf2
--- /dev/null
+++ b/ui/jquery.ui.tabs.js
@@ -0,0 +1,708 @@
+/*
+ * jQuery UI Tabs @VERSION
+ *
+ * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT (MIT-LICENSE.txt)
+ * and GPL (GPL-LICENSE.txt) licenses.
+ *
+ * http://docs.jquery.com/UI/Tabs
+ *
+ * Depends:
+ *	jquery.ui.core.js
+ */
+(function($) {
+
+$.widget("ui.tabs", {
+
+	_init: function() {
+		if (this.options.deselectable !== undefined) {
+			this.options.collapsible = this.options.deselectable;
+		}
+		this._tabify(true);
+	},
+
+	_setData: function(key, value) {
+		if (key == 'selected') {
+			if (this.options.collapsible && value == this.options.selected) {
+				return;
+			}
+			this.select(value);
+		}
+		else {
+			this.options[key] = value;
+			if (key == 'deselectable') {
+				this.options.collapsible = value;
+			}
+			this._tabify();
+		}
+	},
+
+	_tabId: function(a) {
+		return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
+			this.options.idPrefix + $.data(a);
+	},
+
+	_sanitizeSelector: function(hash) {
+		return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
+	},
+
+	_cookie: function() {
+		var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
+		return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
+	},
+
+	_ui: function(tab, panel) {
+		return {
+			tab: tab,
+			panel: panel,
+			index: this.anchors.index(tab)
+		};
+	},
+
+	_cleanup: function() {
+		// restore all former loading tabs labels
+		this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
+				.find('span:data(label.tabs)')
+				.each(function() {
+					var el = $(this);
+					el.html(el.data('label.tabs')).removeData('label.tabs');
+				});
+	},
+
+	_tabify: function(init) {
+
+		this.list = this.element.children('ul:first');
+		this.lis = $('li:has(a[href])', this.list);
+		this.anchors = this.lis.map(function() { return $('a', this)[0]; });
+		this.panels = $([]);
+
+		var self = this, o = this.options;
+
+		var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
+		this.anchors.each(function(i, a) {
+			var href = $(a).attr('href');
+
+			// For dynamically created HTML that contains a hash as href IE < 8 expands
+			// such href to the full page url with hash and then misinterprets tab as ajax.
+			// Same consideration applies for an added tab with a fragment identifier
+			// since a[href=#fragment-identifier] does unexpectedly not match.
+			// Thus normalize href attribute...
+			var hrefBase = href.split('#')[0], baseEl;
+			if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
+					(baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
+				href = a.hash;
+				a.href = href;
+			}
+
+			// inline tab
+			if (fragmentId.test(href)) {
+				self.panels = self.panels.add(self._sanitizeSelector(href));
+			}
+
+			// remote tab
+			else if (href != '#') { // prevent loading the page itself if href is just "#"
+				$.data(a, 'href.tabs', href); // required for restore on destroy
+
+				// TODO until #3808 is fixed strip fragment identifier from url
+				// (IE fails to load from such url)
+				$.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
+
+				var id = self._tabId(a);
+				a.href = '#' + id;
+				var $panel = $('#' + id);
+				if (!$panel.length) {
+					$panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
+						.insertAfter(self.panels[i - 1] || self.list);
+					$panel.data('destroy.tabs', true);
+				}
+				self.panels = self.panels.add($panel);
+			}
+
+			// invalid tab href
+			else {
+				o.disabled.push(i);
+			}
+		});
+
+		// initialization from scratch
+		if (init) {
+
+			// attach necessary classes for styling
+			this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
+			this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+			this.lis.addClass('ui-state-default ui-corner-top');
+			this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
+
+			// Selected tab
+			// use "selected" option or try to retrieve:
+			// 1. from fragment identifier in url
+			// 2. from cookie
+			// 3. from selected class attribute on <li>
+			if (o.selected === undefined) {
+				if (location.hash) {
+					this.anchors.each(function(i, a) {
+						if (a.hash == location.hash) {
+							o.selected = i;
+							return false; // break
+						}
+					});
+				}
+				if (typeof o.selected != 'number' && o.cookie) {
+					o.selected = parseInt(self._cookie(), 10);
+				}
+				if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
+					o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+				}
+				o.selected = o.selected || 0;
+			}
+			else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
+				o.selected = -1;
+			}
+
+			// sanity check - default to first tab...
+			o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
+
+			// Take disabling tabs via class attribute from HTML
+			// into account and update option properly.
+			// A selected tab cannot become disabled.
+			o.disabled = $.unique(o.disabled.concat(
+				$.map(this.lis.filter('.ui-state-disabled'),
+					function(n, i) { return self.lis.index(n); } )
+			)).sort();
+
+			if ($.inArray(o.selected, o.disabled) != -1) {
+				o.disabled.splice($.inArray(o.selected, o.disabled), 1);
+			}
+
+			// highlight selected tab
+			this.panels.addClass('ui-tabs-hide');
+			this.lis.removeClass('ui-tabs-selected ui-state-active');
+			if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
+				this.panels.eq(o.selected).removeClass('ui-tabs-hide');
+				this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
+
+				// seems to be expected behavior that the show callback is fired
+				self.element.queue("tabs", function() {
+					self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
+				});
+				
+				this.load(o.selected);
+			}
+
+			// clean up to avoid memory leaks in certain versions of IE 6
+			$(window).bind('unload', function() {
+				self.lis.add(self.anchors).unbind('.tabs');
+				self.lis = self.anchors = self.panels = null;
+			});
+
+		}
+		// update selected after add/remove
+		else {
+			o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
+		}
+
+		// update collapsible
+		this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
+
+		// set or update cookie after init and add/remove respectively
+		if (o.cookie) {
+			this._cookie(o.selected, o.cookie);
+		}
+
+		// disable tabs
+		for (var i = 0, li; (li = this.lis[i]); i++) {
+			$(li)[$.inArray(i, o.disabled) != -1 &&
+				!$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
+		}
+
+		// reset cache if switching from cached to not cached
+		if (o.cache === false) {
+			this.anchors.removeData('cache.tabs');
+		}
+
+		// remove all handlers before, tabify may run on existing tabs after add or option change
+		this.lis.add(this.anchors).unbind('.tabs');
+
+		if (o.event != 'mouseover') {
+			var addState = function(state, el) {
+				if (el.is(':not(.ui-state-disabled)')) {
+					el.addClass('ui-state-' + state);
+				}
+			};
+			var removeState = function(state, el) {
+				el.removeClass('ui-state-' + state);
+			};
+			this.lis.bind('mouseover.tabs', function() {
+				addState('hover', $(this));
+			});
+			this.lis.bind('mouseout.tabs', function() {
+				removeState('hover', $(this));
+			});
+			this.anchors.bind('focus.tabs', function() {
+				addState('focus', $(this).closest('li'));
+			});
+			this.anchors.bind('blur.tabs', function() {
+				removeState('focus', $(this).closest('li'));
+			});
+		}
+
+		// set up animations
+		var hideFx, showFx;
+		if (o.fx) {
+			if ($.isArray(o.fx)) {
+				hideFx = o.fx[0];
+				showFx = o.fx[1];
+			}
+			else {
+				hideFx = showFx = o.fx;
+			}
+		}
+
+		// Reset certain styles left over from animation
+		// and prevent IE's ClearType bug...
+		function resetStyle($el, fx) {
+			$el.css({ display: '' });
+			if (!$.support.opacity && fx.opacity) {
+				$el[0].style.removeAttribute('filter');
+			}
+		}
+
+		// Show a tab...
+		var showTab = showFx ?
+			function(clicked, $show) {
+				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+				$show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
+					.animate(showFx, showFx.duration || 'normal', function() {
+						resetStyle($show, showFx);
+						self._trigger('show', null, self._ui(clicked, $show[0]));
+					});
+			} :
+			function(clicked, $show) {
+				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
+				$show.removeClass('ui-tabs-hide');
+				self._trigger('show', null, self._ui(clicked, $show[0]));
+			};
+
+		// Hide a tab, $show is optional...
+		var hideTab = hideFx ?
+			function(clicked, $hide) {
+				$hide.animate(hideFx, hideFx.duration || 'normal', function() {
+					self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+					$hide.addClass('ui-tabs-hide');
+					resetStyle($hide, hideFx);
+					self.element.dequeue("tabs");
+				});
+			} :
+			function(clicked, $hide, $show) {
+				self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
+				$hide.addClass('ui-tabs-hide');
+				self.element.dequeue("tabs");
+			};
+
+		// attach tab event handler, unbind to avoid duplicates from former tabifying...
+		this.anchors.bind(o.event + '.tabs', function() {
+			var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
+					$show = $(self._sanitizeSelector(this.hash));
+
+			// If tab is already selected and not collapsible or tab disabled or
+			// or is already loading or click callback returns false stop here.
+			// Check if click handler returns false last so that it is not executed
+			// for a disabled or loading tab!
+			if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
+				$li.hasClass('ui-state-disabled') ||
+				$li.hasClass('ui-state-processing') ||
+				self._trigger('select', null, self._ui(this, $show[0])) === false) {
+				this.blur();
+				return false;
+			}
+
+			o.selected = self.anchors.index(this);
+
+			self.abort();
+
+			// if tab may be closed
+			if (o.collapsible) {
+				if ($li.hasClass('ui-tabs-selected')) {
+					o.selected = -1;
+
+					if (o.cookie) {
+						self._cookie(o.selected, o.cookie);
+					}
+
+					self.element.queue("tabs", function() {
+						hideTab(el, $hide);
+					}).dequeue("tabs");
+					
+					this.blur();
+					return false;
+				}
+				else if (!$hide.length) {
+					if (o.cookie) {
+						self._cookie(o.selected, o.cookie);
+					}
+					
+					self.element.queue("tabs", function() {
+						showTab(el, $show);
+					});
+
+					self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
+					
+					this.blur();
+					return false;
+				}
+			}
+
+			if (o.cookie) {
+				self._cookie(o.selected, o.cookie);
+			}
+
+			// show new tab
+			if ($show.length) {
+				if ($hide.length) {
+					self.element.queue("tabs", function() {
+						hideTab(el, $hide);
+					});
+				}
+				self.element.queue("tabs", function() {
+					showTab(el, $show);
+				});
+				
+				self.load(self.anchors.index(this));
+			}
+			else {
+				throw 'jQuery UI Tabs: Mismatching fragment identifier.';
+			}
+
+			// Prevent IE from keeping other link focussed when using the back button
+			// and remove dotted border from clicked link. This is controlled via CSS
+			// in modern browsers; blur() removes focus from address bar in Firefox
+			// which can become a usability and annoying problem with tabs('rotate').
+			if ($.browser.msie) {
+				this.blur();
+			}
+
+		});
+
+		// disable click in any case
+		this.anchors.bind('click.tabs', function(){return false;});
+
+	},
+
+	destroy: function() {
+		var o = this.options;
+
+		this.abort();
+		
+		this.element.unbind('.tabs')
+			.removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
+			.removeData('tabs');
+
+		this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
+
+		this.anchors.each(function() {
+			var href = $.data(this, 'href.tabs');
+			if (href) {
+				this.href = href;
+			}
+			var $this = $(this).unbind('.tabs');
+			$.each(['href', 'load', 'cache'], function(i, prefix) {
+				$this.removeData(prefix + '.tabs');
+			});
+		});
+
+		this.lis.unbind('.tabs').add(this.panels).each(function() {
+			if ($.data(this, 'destroy.tabs')) {
+				$(this).remove();
+			}
+			else {
+				$(this).removeClass([
+					'ui-state-default',
+					'ui-corner-top',
+					'ui-tabs-selected',
+					'ui-state-active',
+					'ui-state-hover',
+					'ui-state-focus',
+					'ui-state-disabled',
+					'ui-tabs-panel',
+					'ui-widget-content',
+					'ui-corner-bottom',
+					'ui-tabs-hide'
+				].join(' '));
+			}
+		});
+
+		if (o.cookie) {
+			this._cookie(null, o.cookie);
+		}
+
+		return this;
+	},
+
+	add: function(url, label, index) {
+		if (index === undefined) {
+			index = this.anchors.length; // append by default
+		}
+
+		var self = this, o = this.options,
+			$li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
+			id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
+
+		$li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
+
+		// try to find an existing element before creating a new one
+		var $panel = $('#' + id);
+		if (!$panel.length) {
+			$panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
+		}
+		$panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
+
+		if (index >= this.lis.length) {
+			$li.appendTo(this.list);
+			$panel.appendTo(this.list[0].parentNode);
+		}
+		else {
+			$li.insertBefore(this.lis[index]);
+			$panel.insertBefore(this.panels[index]);
+		}
+
+		o.disabled = $.map(o.disabled,
+			function(n, i) { return n >= index ? ++n : n; });
+
+		this._tabify();
+
+		if (this.anchors.length == 1) { // after tabify
+			$li.addClass('ui-tabs-selected ui-state-active');
+			$panel.removeClass('ui-tabs-hide');
+			this.element.queue("tabs", function() {
+				self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
+			});
+				
+			this.load(0);
+		}
+
+		// callback
+		this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
+		return this;
+	},
+
+	remove: function(index) {
+		var o = this.options, $li = this.lis.eq(index).remove(),
+			$panel = this.panels.eq(index).remove();
+
+		// If selected tab was removed focus tab to the right or
+		// in case the last tab was removed the tab to the left.
+		if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
+			this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
+		}
+
+		o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
+			function(n, i) { return n >= index ? --n : n; });
+
+		this._tabify();
+
+		// callback
+		this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
+		return this;
+	},
+
+	enable: function(index) {
+		var o = this.options;
+		if ($.inArray(index, o.disabled) == -1) {
+			return;
+		}
+
+		this.lis.eq(index).removeClass('ui-state-disabled');
+		o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
+
+		// callback
+		this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
+		return this;
+	},
+
+	disable: function(index) {
+		var self = this, o = this.options;
+		if (index != o.selected) { // cannot disable already selected tab
+			this.lis.eq(index).addClass('ui-state-disabled');
+
+			o.disabled.push(index);
+			o.disabled.sort();
+
+			// callback
+			this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
+		}
+
+		return this;
+	},
+
+	select: function(index) {
+		if (typeof index == 'string') {
+			index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
+		}
+		else if (index === null) { // usage of null is deprecated, TODO remove in next release
+			index = -1;
+		}
+		if (index == -1 && this.options.collapsible) {
+			index = this.options.selected;
+		}
+
+		this.anchors.eq(index).trigger(this.options.event + '.tabs');
+		return this;
+	},
+
+	load: function(index) {
+		var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
+
+		this.abort();
+
+		// not remote or from cache
+		if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
+			this.element.dequeue("tabs");
+			return;
+		}
+
+		// load remote from here on
+		this.lis.eq(index).addClass('ui-state-processing');
+
+		if (o.spinner) {
+			var span = $('span', a);
+			span.data('label.tabs', span.html()).html(o.spinner);
+		}
+
+		this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
+			url: url,
+			success: function(r, s) {
+				$(self._sanitizeSelector(a.hash)).html(r);
+
+				// take care of tab labels
+				self._cleanup();
+
+				if (o.cache) {
+					$.data(a, 'cache.tabs', true); // if loaded once do not load them again
+				}
+
+				// callbacks
+				self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
+				try {
+					o.ajaxOptions.success(r, s);
+				}
+				catch (e) {}
+
+				// last, so that load event is fired before show...
+				self.element.dequeue("tabs");
+			}
+		}));
+
+		return this;
+	},
+
+	abort: function() {
+		// stop possibly running animations
+		this.element.queue([]);
+		this.panels.stop(false, true);
+
+		// "tabs" queue must not contain more than two elements,
+		// which are the callbacks for the latest clicked tab...
+		this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
+
+		// terminate pending requests from other tabs
+		if (this.xhr) {
+			this.xhr.abort();
+			delete this.xhr;
+		}
+
+		// take care of tab labels
+		this._cleanup();
+		return this;
+	},
+
+	url: function(index, url) {
+		this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
+		return this;
+	},
+
+	length: function() {
+		return this.anchors.length;
+	}
+
+});
+
+$.extend($.ui.tabs, {
+	version: '@VERSION',
+	defaults: {
+		add: null,
+		ajaxOptions: null,
+		cache: false,
+		cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
+		collapsible: false,
+		disable: null,
+		disabled: [],
+		enable: null,
+		event: 'click',
+		fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
+		idPrefix: 'ui-tabs-',
+		load: null,
+		panelTemplate: '<div></div>',
+		remove: null,
+		select: null,
+		show: null,
+		spinner: '<em>Loading&#8230;</em>',
+		tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
+	}
+});
+
+/*
+ * Tabs Extensions
+ */
+
+/*
+ * Rotate
+ */
+$.extend($.ui.tabs.prototype, {
+	rotation: null,
+	rotate: function(ms, continuing) {
+
+		var self = this, o = this.options;
+		
+		var rotate = self._rotate || (self._rotate = function(e) {
+			clearTimeout(self.rotation);
+			self.rotation = setTimeout(function() {
+				var t = o.selected;
+				self.select( ++t < self.anchors.length ? t : 0 );
+			}, ms);
+			
+			if (e) {
+				e.stopPropagation();
+			}
+		});
+		
+		var stop = self._unrotate || (self._unrotate = !continuing ?
+			function(e) {
+				if (e.clientX) { // in case of a true click
+					self.rotate(null);
+				}
+			} :
+			function(e) {
+				t = o.selected;
+				rotate();
+			});
+
+		// start rotation
+		if (ms) {
+			this.element.bind('tabsshow', rotate);
+			this.anchors.bind(o.event + '.tabs', stop);
+			rotate();
+		}
+		// stop rotation
+		else {
+			clearTimeout(self.rotation);
+			this.element.unbind('tabsshow', rotate);
+			this.anchors.unbind(o.event + '.tabs', stop);
+			delete this._rotate;
+			delete this._unrotate;
+		}
+
+		return this;
+	}
+});
+
+})(jQuery);
diff --git a/ui/ui.accordion.js b/ui/ui.accordion.js
deleted file mode 100644
index cbad4e913..000000000
--- a/ui/ui.accordion.js
+++ /dev/null
@@ -1,510 +0,0 @@
-/*
- * jQuery UI Accordion @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Accordion
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.accordion", {
-
-	_init: function() {
-
-		var o = this.options, self = this;
-		this.running = 0;
-
-		this.element.addClass("ui-accordion ui-widget ui-helper-reset");
-		
-		// in lack of child-selectors in CSS we need to mark top-LIs in a UL-accordion for some IE-fix
-		if (this.element[0].nodeName == "UL") {
-			this.element.children("li").addClass("ui-accordion-li-fix");
-		}
-
-		this.headers = this.element.find(o.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all")
-			.bind("mouseenter.accordion", function(){ $(this).addClass('ui-state-hover'); })
-			.bind("mouseleave.accordion", function(){ $(this).removeClass('ui-state-hover'); })
-			.bind("focus.accordion", function(){ $(this).addClass('ui-state-focus'); })
-			.bind("blur.accordion", function(){ $(this).removeClass('ui-state-focus'); });
-
-		this.headers
-			.next()
-				.addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom");
-
-		if ( o.navigation ) {
-			var current = this.element.find("a").filter(o.navigationFilter);
-			if ( current.length ) {
-				var header = current.closest(".ui-accordion-header");
-				if ( header.length ) {
-					// anchor within header
-					this.active = header;
-				} else {
-					// anchor within content
-					this.active = current.closest(".ui-accordion-content").prev();
-				}
-			}
-		}
-
-		this.active = this._findActive(this.active || o.active).toggleClass("ui-state-default").toggleClass("ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");
-		this.active.next().addClass('ui-accordion-content-active');
-
-		//Append icon elements
-		this._createIcons();
-
-		// IE7-/Win - Extra vertical space in lists fixed
-		if ($.browser.msie) {
-			this.element.find('a').css('zoom', '1');
-		}
-
-		this.resize();
-
-		//ARIA
-		this.element.attr('role','tablist');
-
-		this.headers
-			.attr('role','tab')
-			.bind('keydown', function(event) { return self._keydown(event); })
-			.next()
-			.attr('role','tabpanel');
-
-		this.headers
-			.not(this.active || "")
-			.attr('aria-expanded','false')
-			.attr("tabIndex", "-1")
-			.next()
-			.hide();
-
-		// make sure at least one header is in the tab order
-		if (!this.active.length) {
-			this.headers.eq(0).attr('tabIndex','0');
-		} else {
-			this.active
-				.attr('aria-expanded','true')
-				.attr('tabIndex', '0');
-		}
-
-		// only need links in taborder for Safari
-		if (!$.browser.safari)
-			this.headers.find('a').attr('tabIndex','-1');
-
-		if (o.event) {
-			this.headers.bind((o.event) + ".accordion", function(event) {
-				self._clickHandler.call(self, event, this);
-				event.preventDefault();
-			});
-		}
-
-	},
-	
-	_createIcons: function() {
-		var o = this.options;
-		if (o.icons) {
-			$("<span/>").addClass("ui-icon " + o.icons.header).prependTo(this.headers);
-			this.active.find(".ui-icon").toggleClass(o.icons.header).toggleClass(o.icons.headerSelected);
-			this.element.addClass("ui-accordion-icons");
-		}
-	},
-	
-	_destroyIcons: function() {
-		this.headers.children(".ui-icon").remove();
-		this.element.removeClass("ui-accordion-icons");
-	},
-
-	destroy: function() {
-		var o = this.options;
-
-		this.element
-			.removeClass("ui-accordion ui-widget ui-helper-reset")
-			.removeAttr("role")
-			.unbind('.accordion')
-			.removeData('accordion');
-
-		this.headers
-			.unbind(".accordion")
-			.removeClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-corner-top")
-			.removeAttr("role").removeAttr("aria-expanded").removeAttr("tabindex");
-
-		this.headers.find("a").removeAttr("tabindex");
-		this._destroyIcons();
-		var contents = this.headers.next().css("display", "").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active");
-		if (o.autoHeight || o.fillHeight) {
-			contents.css("height", "");
-		}
-
-		return this;
-	},
-	
-	_setData: function(key, value) {
-		$.widget.prototype._setData.apply(this, arguments);
-			
-		if (key == "active") {
-			this.activate(value);
-		}
-		if (key == "icons") {
-			this._destroyIcons();
-			if (value) {
-				this._createIcons();
-			}
-		}
-		
-	},
-
-	_keydown: function(event) {
-
-		var o = this.options, keyCode = $.ui.keyCode;
-
-		if (o.disabled || event.altKey || event.ctrlKey)
-			return;
-
-		var length = this.headers.length;
-		var currentIndex = this.headers.index(event.target);
-		var toFocus = false;
-
-		switch(event.keyCode) {
-			case keyCode.RIGHT:
-			case keyCode.DOWN:
-				toFocus = this.headers[(currentIndex + 1) % length];
-				break;
-			case keyCode.LEFT:
-			case keyCode.UP:
-				toFocus = this.headers[(currentIndex - 1 + length) % length];
-				break;
-			case keyCode.SPACE:
-			case keyCode.ENTER:
-				this._clickHandler({ target: event.target }, event.target);
-				event.preventDefault();
-		}
-
-		if (toFocus) {
-			$(event.target).attr('tabIndex','-1');
-			$(toFocus).attr('tabIndex','0');
-			toFocus.focus();
-			return false;
-		}
-
-		return true;
-
-	},
-
-	resize: function() {
-
-		var o = this.options, maxHeight;
-
-		if (o.fillSpace) {
-			
-			if($.browser.msie) { var defOverflow = this.element.parent().css('overflow'); this.element.parent().css('overflow', 'hidden'); }
-			maxHeight = this.element.parent().height();
-			if($.browser.msie) { this.element.parent().css('overflow', defOverflow); }
-	
-			this.headers.each(function() {
-				maxHeight -= $(this).outerHeight(true);
-			});
-
-			this.headers.next().each(function() {
-    		   $(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()));
-			}).css('overflow', 'auto');
-
-		} else if ( o.autoHeight ) {
-			maxHeight = 0;
-			this.headers.next().each(function() {
-				maxHeight = Math.max(maxHeight, $(this).height());
-			}).height(maxHeight);
-		}
-
-		return this;
-	},
-
-	activate: function(index) {
-		// TODO this gets called on init, changing the option without an explicit call for that
-		this.options.active = index;
-		// call clickHandler with custom event
-		var active = this._findActive(index)[0];
-		this._clickHandler({ target: active }, active);
-
-		return this;
-	},
-
-	_findActive: function(selector) {
-		return selector
-			? typeof selector == "number"
-				? this.headers.filter(":eq(" + selector + ")")
-				: this.headers.not(this.headers.not(selector))
-			: selector === false
-				? $([])
-				: this.headers.filter(":eq(0)");
-	},
-
-	// TODO isn't event.target enough? why the seperate target argument?
-	_clickHandler: function(event, target) {
-
-		var o = this.options;
-		if (o.disabled)
-			return;
-
-		// called only when using activate(false) to close all parts programmatically
-		if (!event.target) {
-			if (!o.collapsible)
-				return;
-			this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
-				.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
-			this.active.next().addClass('ui-accordion-content-active');
-			var toHide = this.active.next(),
-				data = {
-					options: o,
-					newHeader: $([]),
-					oldHeader: o.active,
-					newContent: $([]),
-					oldContent: toHide
-				},
-				toShow = (this.active = $([]));
-			this._toggle(toShow, toHide, data);
-			return;
-		}
-
-		// get the click target
-		var clicked = $(event.currentTarget || target);
-		var clickedIsActive = clicked[0] == this.active[0];
-		
-		// TODO the option is changed, is that correct?
-		// TODO if it is correct, shouldn't that happen after determining that the click is valid?
-		o.active = o.collapsible && clickedIsActive ? false : $('.ui-accordion-header', this.element).index(clicked);
-
-		// if animations are still active, or the active header is the target, ignore click
-		if (this.running || (!o.collapsible && clickedIsActive)) {
-			return;
-		}
-
-		// switch classes
-		this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all")
-			.find(".ui-icon").removeClass(o.icons.headerSelected).addClass(o.icons.header);
-		if (!clickedIsActive) {
-			clicked.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top")
-				.find(".ui-icon").removeClass(o.icons.header).addClass(o.icons.headerSelected);
-			clicked.next().addClass('ui-accordion-content-active');
-		}
-
-		// find elements to show and hide
-		var toShow = clicked.next(),
-			toHide = this.active.next(),
-			data = {
-				options: o,
-				newHeader: clickedIsActive && o.collapsible ? $([]) : clicked,
-				oldHeader: this.active,
-				newContent: clickedIsActive && o.collapsible ? $([]) : toShow.find('> *'),
-				oldContent: toHide.find('> *')
-			},
-			down = this.headers.index( this.active[0] ) > this.headers.index( clicked[0] );
-
-		this.active = clickedIsActive ? $([]) : clicked;
-		this._toggle(toShow, toHide, data, clickedIsActive, down);
-
-		return;
-
-	},
-
-	_toggle: function(toShow, toHide, data, clickedIsActive, down) {
-
-		var o = this.options, self = this;
-
-		this.toShow = toShow;
-		this.toHide = toHide;
-		this.data = data;
-
-		var complete = function() { if(!self) return; return self._completed.apply(self, arguments); };
-
-		// trigger changestart event
-		this._trigger("changestart", null, this.data);
-
-		// count elements to animate
-		this.running = toHide.size() === 0 ? toShow.size() : toHide.size();
-
-		if (o.animated) {
-
-			var animOptions = {};
-
-			if ( o.collapsible && clickedIsActive ) {
-				animOptions = {
-					toShow: $([]),
-					toHide: toHide,
-					complete: complete,
-					down: down,
-					autoHeight: o.autoHeight || o.fillSpace
-				};
-			} else {
-				animOptions = {
-					toShow: toShow,
-					toHide: toHide,
-					complete: complete,
-					down: down,
-					autoHeight: o.autoHeight || o.fillSpace
-				};
-			}
-
-			if (!o.proxied) {
-				o.proxied = o.animated;
-			}
-
-			if (!o.proxiedDuration) {
-				o.proxiedDuration = o.duration;
-			}
-
-			o.animated = $.isFunction(o.proxied) ?
-				o.proxied(animOptions) : o.proxied;
-
-			o.duration = $.isFunction(o.proxiedDuration) ?
-				o.proxiedDuration(animOptions) : o.proxiedDuration;
-
-			var animations = $.ui.accordion.animations,
-				duration = o.duration,
-				easing = o.animated;
-
-			if (easing && !animations[easing] && !$.easing[easing]) {
-				easing = 'slide';
-			}
-			if (!animations[easing]) {
-				animations[easing] = function(options) {
-					this.slide(options, {
-						easing: easing,
-						duration: duration || 700
-					});
-				};
-			}
-
-			animations[easing](animOptions);
-
-		} else {
-
-			if (o.collapsible && clickedIsActive) {
-				toShow.toggle();
-			} else {
-				toHide.hide();
-				toShow.show();
-			}
-
-			complete(true);
-
-		}
-
-		// TODO assert that the blur and focus triggers are really necessary, remove otherwise
-		toHide.prev().attr('aria-expanded','false').attr("tabIndex", "-1").blur();
-		toShow.prev().attr('aria-expanded','true').attr("tabIndex", "0").focus();
-
-	},
-
-	_completed: function(cancel) {
-
-		var o = this.options;
-
-		this.running = cancel ? 0 : --this.running;
-		if (this.running) return;
-
-		if (o.clearStyle) {
-			this.toShow.add(this.toHide).css({
-				height: "",
-				overflow: ""
-			});
-		}
-		
-		// other classes are removed before the animation; this one needs to stay until completed
-		this.toHide.removeClass("ui-accordion-content-active");
-
-		this._trigger('change', null, this.data);
-	}
-
-});
-
-
-$.extend($.ui.accordion, {
-	version: "@VERSION",
-	defaults: {
-		active: 0,
-		animated: 'slide',
-		autoHeight: true,
-		clearStyle: false,
-		collapsible: false,
-		event: "click",
-		fillSpace: false,
-		header: "> li > :first-child,> :not(li):even",
-		icons: {
-			header: "ui-icon-triangle-1-e",
-			headerSelected: "ui-icon-triangle-1-s"
-		},
-		navigation: false,
-		navigationFilter: function() {
-			return this.href.toLowerCase() == location.href.toLowerCase();
-		}
-	},
-	animations: {
-		slide: function(options, additions) {
-			options = $.extend({
-				easing: "swing",
-				duration: 300
-			}, options, additions);
-			if ( !options.toHide.size() ) {
-				options.toShow.animate({height: "show"}, options);
-				return;
-			}
-			if ( !options.toShow.size() ) {
-				options.toHide.animate({height: "hide"}, options);
-				return;
-			}
-			var overflow = options.toShow.css('overflow'),
-				percentDone,
-				showProps = {},
-				hideProps = {},
-				fxAttrs = [ "height", "paddingTop", "paddingBottom" ],
-				originalWidth;
-			// fix width before calculating height of hidden element
-			var s = options.toShow;
-			originalWidth = s[0].style.width;
-			s.width( parseInt(s.parent().width(),10) - parseInt(s.css("paddingLeft"),10) - parseInt(s.css("paddingRight"),10) - (parseInt(s.css("borderLeftWidth"),10) || 0) - (parseInt(s.css("borderRightWidth"),10) || 0) );
-			
-			$.each(fxAttrs, function(i, prop) {
-				hideProps[prop] = 'hide';
-				
-				var parts = ('' + $.css(options.toShow[0], prop)).match(/^([\d+-.]+)(.*)$/);
-				showProps[prop] = {
-					value: parts[1],
-					unit: parts[2] || 'px'
-				};
-			});
-			options.toShow.css({ height: 0, overflow: 'hidden' }).show();
-			options.toHide.filter(":hidden").each(options.complete).end().filter(":visible").animate(hideProps,{
-				step: function(now, settings) {
-					// only calculate the percent when animating height
-					// IE gets very inconsistent results when animating elements
-					// with small values, which is common for padding
-					if (settings.prop == 'height') {
-						percentDone = (settings.now - settings.start) / (settings.end - settings.start);
-					}
-					
-					options.toShow[0].style[settings.prop] =
-						(percentDone * showProps[settings.prop].value) + showProps[settings.prop].unit;
-				},
-				duration: options.duration,
-				easing: options.easing,
-				complete: function() {
-					if ( !options.autoHeight ) {
-						options.toShow.css("height", "");
-					}
-					options.toShow.css("width", originalWidth);
-					options.toShow.css({overflow: overflow});
-					options.complete();
-				}
-			});
-		},
-		bounceslide: function(options) {
-			this.slide(options, {
-				easing: options.down ? "easeOutBounce" : "swing",
-				duration: options.down ? 1000 : 200
-			});
-		}
-	}
-});
-
-})(jQuery);
diff --git a/ui/ui.core.js b/ui/ui.core.js
deleted file mode 100644
index 1b4794485..000000000
--- a/ui/ui.core.js
+++ /dev/null
@@ -1,552 +0,0 @@
-/*
- * jQuery UI @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI
- */
-;jQuery.ui || (function($) {
-
-var _remove = $.fn.remove,
-	isFF2 = $.browser.mozilla && (parseFloat($.browser.version) < 1.9);
-
-//Helper functions and ui object
-$.ui = {
-	version: "@VERSION",
-
-	// $.ui.plugin is deprecated.  Use the proxy pattern instead.
-	plugin: {
-		add: function(module, option, set) {
-			var proto = $.ui[module].prototype;
-			for(var i in set) {
-				proto.plugins[i] = proto.plugins[i] || [];
-				proto.plugins[i].push([option, set[i]]);
-			}
-		},
-		call: function(instance, name, args) {
-			var set = instance.plugins[name];
-			if(!set || !instance.element[0].parentNode) { return; }
-
-			for (var i = 0; i < set.length; i++) {
-				if (instance.options[set[i][0]]) {
-					set[i][1].apply(instance.element, args);
-				}
-			}
-		}
-	},
-
-	contains: function(a, b) {
-		return document.compareDocumentPosition
-			? a.compareDocumentPosition(b) & 16
-			: a !== b && a.contains(b);
-	},
-
-	hasScroll: function(el, a) {
-
-		//If overflow is hidden, the element might have extra content, but the user wants to hide it
-		if ($(el).css('overflow') == 'hidden') { return false; }
-
-		var scroll = (a && a == 'left') ? 'scrollLeft' : 'scrollTop',
-			has = false;
-
-		if (el[scroll] > 0) { return true; }
-
-		// TODO: determine which cases actually cause this to happen
-		// if the element doesn't have the scroll set, see if it's possible to
-		// set the scroll
-		el[scroll] = 1;
-		has = (el[scroll] > 0);
-		el[scroll] = 0;
-		return has;
-	},
-
-	isOverAxis: function(x, reference, size) {
-		//Determines when x coordinate is over "b" element axis
-		return (x > reference) && (x < (reference + size));
-	},
-
-	isOver: function(y, x, top, left, height, width) {
-		//Determines when x, y coordinates is over "b" element
-		return $.ui.isOverAxis(y, top, height) && $.ui.isOverAxis(x, left, width);
-	},
-
-	keyCode: {
-		BACKSPACE: 8,
-		CAPS_LOCK: 20,
-		COMMA: 188,
-		CONTROL: 17,
-		DELETE: 46,
-		DOWN: 40,
-		END: 35,
-		ENTER: 13,
-		ESCAPE: 27,
-		HOME: 36,
-		INSERT: 45,
-		LEFT: 37,
-		NUMPAD_ADD: 107,
-		NUMPAD_DECIMAL: 110,
-		NUMPAD_DIVIDE: 111,
-		NUMPAD_ENTER: 108,
-		NUMPAD_MULTIPLY: 106,
-		NUMPAD_SUBTRACT: 109,
-		PAGE_DOWN: 34,
-		PAGE_UP: 33,
-		PERIOD: 190,
-		RIGHT: 39,
-		SHIFT: 16,
-		SPACE: 32,
-		TAB: 9,
-		UP: 38
-	}
-};
-
-// WAI-ARIA normalization
-if (isFF2) {
-	var attr = $.attr,
-		removeAttr = $.fn.removeAttr,
-		ariaNS = "http://www.w3.org/2005/07/aaa",
-		ariaState = /^aria-/,
-		ariaRole = /^wairole:/;
-
-	$.attr = function(elem, name, value) {
-		var set = value !== undefined;
-
-		return (name == 'role'
-			? (set
-				? attr.call(this, elem, name, "wairole:" + value)
-				: (attr.apply(this, arguments) || "").replace(ariaRole, ""))
-			: (ariaState.test(name)
-				? (set
-					? elem.setAttributeNS(ariaNS,
-						name.replace(ariaState, "aaa:"), value)
-					: attr.call(this, elem, name.replace(ariaState, "aaa:")))
-				: attr.apply(this, arguments)));
-	};
-
-	$.fn.removeAttr = function(name) {
-		return (ariaState.test(name)
-			? this.each(function() {
-				this.removeAttributeNS(ariaNS, name.replace(ariaState, ""));
-			}) : removeAttr.call(this, name));
-	};
-}
-
-//jQuery plugins
-$.fn.extend({
-	_focus: $.fn.focus,
-	focus: function(delay, fn) {
-		return typeof delay === 'number'
-			? this.each(function() {
-				var elem = this;
-				setTimeout(function() {
-					$(elem).focus();
-					(fn && fn.call(elem));
-				}, delay);
-			})
-			: this._focus.apply(this, arguments);
-	},
-	
-	remove: function() {
-		// Safari has a native remove event which actually removes DOM elements,
-		// so we have to use triggerHandler instead of trigger (#3037).
-		$("*", this).add(this).each(function() {
-			$(this).triggerHandler("remove");
-		});
-		return _remove.apply(this, arguments );
-	},
-
-	enableSelection: function() {
-		return this
-			.attr('unselectable', 'off')
-			.css('MozUserSelect', '')
-			.unbind('selectstart.ui');
-	},
-
-	disableSelection: function() {
-		return this
-			.attr('unselectable', 'on')
-			.css('MozUserSelect', 'none')
-			.bind('selectstart.ui', function() { return false; });
-	},
-
-	scrollParent: function() {
-		var scrollParent;
-		if(($.browser.msie && (/(static|relative)/).test(this.css('position'))) || (/absolute/).test(this.css('position'))) {
-			scrollParent = this.parents().filter(function() {
-				return (/(relative|absolute|fixed)/).test($.curCSS(this,'position',1)) && (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
-			}).eq(0);
-		} else {
-			scrollParent = this.parents().filter(function() {
-				return (/(auto|scroll)/).test($.curCSS(this,'overflow',1)+$.curCSS(this,'overflow-y',1)+$.curCSS(this,'overflow-x',1));
-			}).eq(0);
-		}
-
-		return (/fixed/).test(this.css('position')) || !scrollParent.length ? $(document) : scrollParent;
-	},
-
-	zIndex: function(zIndex) {
-		if (zIndex !== undefined) {
-			return this.css('zIndex', zIndex);
-		}
-
-		var elem = this[0];
-		while (elem && elem.style) {
-			// IE returns 0 when zIndex is not specified
-			// other browsers return an empty string
-			// we ignore the case of nested elements with an explicit value of 0
-			// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
-			if (elem.style.zIndex !== '' && elem.style.zIndex !== 0) {
-				return +elem.style.zIndex;
-			}
-			elem = elem.parentNode;
-		}
-
-		return 0;
-	}
-});
-
-
-//Additional selectors
-$.extend($.expr[':'], {
-	data: function(elem, i, match) {
-		return !!$.data(elem, match[3]);
-	},
-
-	focusable: function(element) {
-		var nodeName = element.nodeName.toLowerCase(),
-			tabIndex = $.attr(element, 'tabindex');
-		return (/input|select|textarea|button|object/.test(nodeName)
-			? !element.disabled
-			: 'a' == nodeName || 'area' == nodeName
-				? element.href || !isNaN(tabIndex)
-				: !isNaN(tabIndex))
-			// the element and all of its ancestors must be visible
-			// the browser may report that the area is hidden
-			&& !$(element)['area' == nodeName ? 'parents' : 'closest'](':hidden').length;
-	},
-
-	tabbable: function(element) {
-		var tabIndex = $.attr(element, 'tabindex');
-		return (isNaN(tabIndex) || tabIndex >= 0) && $(element).is(':focusable');
-	}
-});
-
-
-// $.widget is a factory to create jQuery plugins
-// taking some boilerplate code out of the plugin code
-$.widget = function(name, prototype) {
-	var namespace = name.split(".")[0],
-		fullName;
-	name = name.split(".")[1];
-	fullName = namespace + '-' + name;
-
-	// create selector for plugin
-	$.expr[':'][fullName] = function(elem) {
-		return !!$.data(elem, name);
-	};
-	
-	// create plugin method
-	$.fn[name] = function(options) {
-		var isMethodCall = (typeof options == 'string'),
-			args = Array.prototype.slice.call(arguments, 1),
-			returnValue = this;
-
-		// allow multiple hashes to be passed on init
-		options = !isMethodCall && args.length
-			? $.extend.apply(null, [true, options].concat(args))
-			: options;
-
-		// prevent calls to internal methods
-		if (isMethodCall && options.substring(0, 1) == '_') {
-			return returnValue;
-		}
-
-		(isMethodCall
-			? this.each(function() {
-				var instance = $.data(this, name),
-					methodValue = (instance && $.isFunction(instance[options])
-						? instance[options].apply(instance, args)
-						: instance);
-				if (methodValue !== instance && methodValue !== undefined) {
-					returnValue = methodValue;
-					return false;
-				}
-			})
-			: this.each(function() {
-				($.data(this, name) ||
-					$.data(this, name, new $[namespace][name](this, options))._init());
-			}));
-
-		return returnValue;
-	};
-
-	// create widget constructor
-	$[namespace] = $[namespace] || {};
-	$[namespace][name] = function(element, options) {
-		var self = this;
-
-		this.namespace = namespace;
-		this.widgetName = name;
-		this.widgetEventPrefix = $[namespace][name].eventPrefix || name;
-		this.widgetBaseClass = fullName;
-
-		this.options = $.extend(true, {},
-			$.widget.defaults,
-			$[namespace][name].defaults,
-			$.metadata && $.metadata.get(element)[name],
-			options);
-
-		this.element = $(element)
-			.bind('setData.' + name, function(event, key, value) {
-				if (event.target == element) {
-					return self._setData(key, value);
-				}
-			})
-			.bind('getData.' + name, function(event, key) {
-				if (event.target == element) {
-					return self._getData(key);
-				}
-			})
-			.bind('remove.' + name, function() {
-				return self.destroy();
-			});
-	};
-
-	// add widget prototype
-	$[namespace][name].prototype = $.extend({}, $.widget.prototype, prototype);
-};
-
-$.widget.prototype = {
-	_init: function() {},
-	destroy: function() {
-		this.element.removeData(this.widgetName)
-			.removeClass(this.widgetBaseClass + '-disabled' + ' ' + this.namespace + '-state-disabled')
-			.removeAttr('aria-disabled');
-
-		return this;
-	},
-
-	option: function(key, value) {
-		var options = key,
-			self = this;
-
-		if (typeof key == "string") {
-			if (value === undefined) {
-				return this._getData(key);
-			}
-			options = {};
-			options[key] = value;
-		}
-
-		$.each(options, function(key, value) {
-			self._setData(key, value);
-		});
-
-		return self;
-	},
-	_getData: function(key) {
-		return this.options[key];
-	},
-	_setData: function(key, value) {
-		this.options[key] = value;
-
-		if (key == 'disabled') {
-			this.element
-				[value ? 'addClass' : 'removeClass'](
-					this.widgetBaseClass + '-disabled' + ' ' +
-					this.namespace + '-state-disabled')
-				.attr("aria-disabled", value);
-		}
-	},
-
-	enable: function() {
-		this._setData('disabled', false);
-		return this;
-	},
-	disable: function() {
-		this._setData('disabled', true);
-		return this;
-	},
-
-	_trigger: function(type, event, data) {
-		var callback = this.options[type];
-
-		event = $.Event(event);
-		event.type = (type == this.widgetEventPrefix
-				? type : this.widgetEventPrefix + type).toLowerCase();
-		data = data || {};
-
-		// copy original event properties over to the new event
-		// this would happen if we could call $.event.fix instead of $.Event
-		// but we don't have a way to force an event to be fixed multiple times
-		if (event.originalEvent) {
-			for (var i = $.event.props.length, prop; i;) {
-				prop = $.event.props[--i];
-				event[prop] = event.originalEvent[prop];
-			}
-		}
-
-		this.element.trigger(event, data);
-
-		return !($.isFunction(callback) && callback.call(this.element[0], event, data) === false
-			|| event.isDefaultPrevented());
-	}
-};
-
-$.widget.defaults = {
-	disabled: false
-};
-
-
-/** Mouse Interaction Plugin **/
-
-$.ui.mouse = {
-	_mouseInit: function() {
-		var self = this;
-
-		this.element
-			.bind('mousedown.'+this.widgetName, function(event) {
-				return self._mouseDown(event);
-			})
-			.bind('click.'+this.widgetName, function(event) {
-				if(self._preventClickEvent) {
-					self._preventClickEvent = false;
-					event.stopImmediatePropagation();
-					return false;
-				}
-			});
-
-		// Prevent text selection in IE
-		if ($.browser.msie) {
-			this._mouseUnselectable = this.element.attr('unselectable');
-			this.element.attr('unselectable', 'on');
-		}
-
-		this.started = false;
-	},
-
-	// TODO: make sure destroying one instance of mouse doesn't mess with
-	// other instances of mouse
-	_mouseDestroy: function() {
-		this.element.unbind('.'+this.widgetName);
-
-		// Restore text selection in IE
-		($.browser.msie
-			&& this.element.attr('unselectable', this._mouseUnselectable));
-	},
-
-	_mouseDown: function(event) {
-		// don't let more than one widget handle mouseStart
-		// TODO: figure out why we have to use originalEvent
-		event.originalEvent = event.originalEvent || {};
-		if (event.originalEvent.mouseHandled) { return; }
-
-		// we may have missed mouseup (out of window)
-		(this._mouseStarted && this._mouseUp(event));
-
-		this._mouseDownEvent = event;
-
-		var self = this,
-			btnIsLeft = (event.which == 1),
-			elIsCancel = (typeof this.options.cancel == "string" ? $(event.target).parents().add(event.target).filter(this.options.cancel).length : false);
-		if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
-			return true;
-		}
-
-		this.mouseDelayMet = !this.options.delay;
-		if (!this.mouseDelayMet) {
-			this._mouseDelayTimer = setTimeout(function() {
-				self.mouseDelayMet = true;
-			}, this.options.delay);
-		}
-
-		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
-			this._mouseStarted = (this._mouseStart(event) !== false);
-			if (!this._mouseStarted) {
-				event.preventDefault();
-				return true;
-			}
-		}
-
-		// these delegates are required to keep context
-		this._mouseMoveDelegate = function(event) {
-			return self._mouseMove(event);
-		};
-		this._mouseUpDelegate = function(event) {
-			return self._mouseUp(event);
-		};
-		$(document)
-			.bind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-			.bind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
-		// preventDefault() is used to prevent the selection of text here -
-		// however, in Safari, this causes select boxes not to be selectable
-		// anymore, so this fix is needed
-		($.browser.safari || event.preventDefault());
-
-		event.originalEvent.mouseHandled = true;
-		return true;
-	},
-
-	_mouseMove: function(event) {
-		// IE mouseup check - mouseup happened when mouse was out of window
-		if ($.browser.msie && !event.button) {
-			return this._mouseUp(event);
-		}
-
-		if (this._mouseStarted) {
-			this._mouseDrag(event);
-			return event.preventDefault();
-		}
-
-		if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
-			this._mouseStarted =
-				(this._mouseStart(this._mouseDownEvent, event) !== false);
-			(this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event));
-		}
-
-		return !this._mouseStarted;
-	},
-
-	_mouseUp: function(event) {
-		$(document)
-			.unbind('mousemove.'+this.widgetName, this._mouseMoveDelegate)
-			.unbind('mouseup.'+this.widgetName, this._mouseUpDelegate);
-
-		if (this._mouseStarted) {
-			this._mouseStarted = false;
-			this._preventClickEvent = (event.target == this._mouseDownEvent.target);
-			this._mouseStop(event);
-		}
-
-		return false;
-	},
-
-	_mouseDistanceMet: function(event) {
-		return (Math.max(
-				Math.abs(this._mouseDownEvent.pageX - event.pageX),
-				Math.abs(this._mouseDownEvent.pageY - event.pageY)
-			) >= this.options.distance
-		);
-	},
-
-	_mouseDelayMet: function(event) {
-		return this.mouseDelayMet;
-	},
-
-	// These are placeholder methods, to be overriden by extending plugin
-	_mouseStart: function(event) {},
-	_mouseDrag: function(event) {},
-	_mouseStop: function(event) {},
-	_mouseCapture: function(event) { return true; }
-};
-
-$.ui.mouse.defaults = {
-	cancel: ':input,option',
-	distance: 1,
-	delay: 0
-};
-
-})(jQuery);
diff --git a/ui/ui.datepicker.js b/ui/ui.datepicker.js
deleted file mode 100644
index 57086babc..000000000
--- a/ui/ui.datepicker.js
+++ /dev/null
@@ -1,1684 +0,0 @@
-/*
- * jQuery UI Datepicker @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Datepicker
- *
- * Depends:
- *	ui.core.js
- */
-
-(function($) { // hide the namespace
-
-$.extend($.ui, { datepicker: { version: "@VERSION" } });
-
-var PROP_NAME = 'datepicker';
-
-/* Date picker manager.
-   Use the singleton instance of this class, $.datepicker, to interact with the date picker.
-   Settings for (groups of) date pickers are maintained in an instance object,
-   allowing multiple different settings on the same page. */
-
-function Datepicker() {
-	this.debug = false; // Change this to true to start debugging
-	this._curInst = null; // The current instance in use
-	this._keyEvent = false; // If the last event was a key event
-	this._disabledInputs = []; // List of date picker inputs that have been disabled
-	this._datepickerShowing = false; // True if the popup picker is showing , false if not
-	this._inDialog = false; // True if showing within a "dialog", false if not
-	this._mainDivId = 'ui-datepicker-div'; // The ID of the main datepicker division
-	this._inlineClass = 'ui-datepicker-inline'; // The name of the inline marker class
-	this._appendClass = 'ui-datepicker-append'; // The name of the append marker class
-	this._triggerClass = 'ui-datepicker-trigger'; // The name of the trigger marker class
-	this._dialogClass = 'ui-datepicker-dialog'; // The name of the dialog marker class
-	this._disableClass = 'ui-datepicker-disabled'; // The name of the disabled covering marker class
-	this._unselectableClass = 'ui-datepicker-unselectable'; // The name of the unselectable cell marker class
-	this._currentClass = 'ui-datepicker-current-day'; // The name of the current day marker class
-	this._dayOverClass = 'ui-datepicker-days-cell-over'; // The name of the day hover marker class
-	this.regional = []; // Available regional settings, indexed by language code
-	this.regional[''] = { // Default regional settings
-		closeText: 'Done', // Display text for close link
-		prevText: 'Prev', // Display text for previous month link
-		nextText: 'Next', // Display text for next month link
-		currentText: 'Today', // Display text for current month link
-		monthNames: ['January','February','March','April','May','June',
-			'July','August','September','October','November','December'], // Names of months for drop-down and formatting
-		monthNamesShort: ['Jan', 'Feb', 'Mar', 'Apr', 'May', 'Jun', 'Jul', 'Aug', 'Sep', 'Oct', 'Nov', 'Dec'], // For formatting
-		dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
-		dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
-		dayNamesMin: ['Su','Mo','Tu','We','Th','Fr','Sa'], // Column headings for days starting at Sunday
-		weekHeader: 'Wk', // Column header for week of the year
-		dateFormat: 'mm/dd/yy', // See format options on parseDate
-		firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
-		isRTL: false, // True if right-to-left language, false if left-to-right
-		showMonthAfterYear: false, // True if the year select precedes month, false for month then year
-		yearSuffix: '' // Additional text to append to the year in the month headers
-	};
-	this._defaults = { // Global defaults for all the date picker instances
-		showOn: 'focus', // 'focus' for popup on focus,
-			// 'button' for trigger button, or 'both' for either
-		showAnim: 'show', // Name of jQuery animation for popup
-		showOptions: {}, // Options for enhanced animations
-		defaultDate: null, // Used when field is blank: actual date,
-			// +/-number for offset from today, null for today
-		appendText: '', // Display text following the input box, e.g. showing the format
-		buttonText: '...', // Text for trigger button
-		buttonImage: '', // URL for trigger button image
-		buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
-		hideIfNoPrevNext: false, // True to hide next/previous month links
-			// if not applicable, false to just disable them
-		navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
-		gotoCurrent: false, // True if today link goes back to current selection instead
-		changeMonth: false, // True if month can be selected directly, false if only prev/next
-		changeYear: false, // True if year can be selected directly, false if only prev/next
-		yearRange: '-10:+10', // Range of years to display in drop-down,
-			// either relative to current year (-nn:+nn) or absolute (nnnn:nnnn)
-		showOtherMonths: false, // True to show dates in other months, false to leave blank
-		selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
-		showWeek: false, // True to show week of the year, false to not show it
-		calculateWeek: this.iso8601Week, // How to calculate the week of the year,
-			// takes a Date and returns the number of the week for it
-		shortYearCutoff: '+10', // Short year values < this are in the current century,
-			// > this are in the previous century,
-			// string value starting with '+' for current year + value
-		minDate: null, // The earliest selectable date, or null for no limit
-		maxDate: null, // The latest selectable date, or null for no limit
-		duration: '_default', // Duration of display/closure
-		beforeShowDay: null, // Function that takes a date and returns an array with
-			// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or '',
-			// [2] = cell title (optional), e.g. $.datepicker.noWeekends
-		beforeShow: null, // Function that takes an input field and
-			// returns a set of custom settings for the date picker
-		onSelect: null, // Define a callback function when a date is selected
-		onChangeMonthYear: null, // Define a callback function when the month or year is changed
-		onClose: null, // Define a callback function when the datepicker is closed
-		numberOfMonths: 1, // Number of months to show at a time
-		showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
-		stepMonths: 1, // Number of months to step back/forward
-		stepBigMonths: 12, // Number of months to step back/forward for the big links
-		altField: '', // Selector for an alternate field to store selected dates into
-		altFormat: '', // The date format to use for the alternate field
-		constrainInput: true, // The input is constrained by the current date format
-		showButtonPanel: false, // True to show button panel, false to not show it
-		autoSize: false // True to size the input for the date format, false to leave as is
-	};
-	$.extend(this._defaults, this.regional['']);
-	this.dpDiv = $('<div id="' + this._mainDivId + '" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all ui-helper-hidden-accessible"></div>');
-}
-
-$.extend(Datepicker.prototype, {
-	/* Class name added to elements to indicate already configured with a date picker. */
-	markerClassName: 'hasDatepicker',
-
-	/* Debug logging (if enabled). */
-	log: function () {
-		if (this.debug)
-			console.log.apply('', arguments);
-	},
-
-	/* Override the default settings for all instances of the date picker.
-	   @param  settings  object - the new settings to use as defaults (anonymous object)
-	   @return the manager object */
-	setDefaults: function(settings) {
-		extendRemove(this._defaults, settings || {});
-		return this;
-	},
-
-	/* Attach the date picker to a jQuery selection.
-	   @param  target    element - the target input field or division or span
-	   @param  settings  object - the new settings to use for this date picker instance (anonymous) */
-	_attachDatepicker: function(target, settings) {
-		// check for settings on the control itself - in namespace 'date:'
-		var inlineSettings = null;
-		for (var attrName in this._defaults) {
-			var attrValue = target.getAttribute('date:' + attrName);
-			if (attrValue) {
-				inlineSettings = inlineSettings || {};
-				try {
-					inlineSettings[attrName] = eval(attrValue);
-				} catch (err) {
-					inlineSettings[attrName] = attrValue;
-				}
-			}
-		}
-		var nodeName = target.nodeName.toLowerCase();
-		var inline = (nodeName == 'div' || nodeName == 'span');
-		if (!target.id)
-			target.id = 'dp' + (++this.uuid);
-		var inst = this._newInst($(target), inline);
-		inst.settings = $.extend({}, settings || {}, inlineSettings || {});
-		if (nodeName == 'input') {
-			this._connectDatepicker(target, inst);
-		} else if (inline) {
-			this._inlineDatepicker(target, inst);
-		}
-	},
-
-	/* Create a new instance object. */
-	_newInst: function(target, inline) {
-		var id = target[0].id.replace(/([:\[\]\.\$])/g, '\\\\$1'); // escape jQuery meta chars
-		return {id: id, input: target, // associated target
-			selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection
-			drawMonth: 0, drawYear: 0, // month being drawn
-			inline: inline, // is datepicker inline or not
-			dpDiv: (!inline ? this.dpDiv : // presentation div
-			$('<div class="' + this._inlineClass + ' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))};
-	},
-
-	/* Attach the date picker to an input field. */
-	_connectDatepicker: function(target, inst) {
-		var input = $(target);
-		inst.append = $([]);
-		inst.trigger = $([]);
-		if (input.hasClass(this.markerClassName))
-			return;
-		var appendText = this._get(inst, 'appendText');
-		var isRTL = this._get(inst, 'isRTL');
-		if (appendText) {
-			inst.append = $('<span class="' + this._appendClass + '">' + appendText + '</span>');
-			input[isRTL ? 'before' : 'after'](inst.append);
-		}
-		var showOn = this._get(inst, 'showOn');
-		if (showOn == 'focus' || showOn == 'both') // pop-up date picker when in the marked field
-			input.focus(this._showDatepicker);
-		if (showOn == 'button' || showOn == 'both') { // pop-up date picker when button clicked
-			var buttonText = this._get(inst, 'buttonText');
-			var buttonImage = this._get(inst, 'buttonImage');
-			inst.trigger = $(this._get(inst, 'buttonImageOnly') ?
-				$('<img/>').addClass(this._triggerClass).
-					attr({ src: buttonImage, alt: buttonText, title: buttonText }) :
-				$('<button type="button"></button>').addClass(this._triggerClass).
-					html(buttonImage == '' ? buttonText : $('<img/>').attr(
-					{ src:buttonImage, alt:buttonText, title:buttonText })));
-			input[isRTL ? 'before' : 'after'](inst.trigger);
-			inst.trigger.click(function() {
-				if ($.datepicker._datepickerShowing && $.datepicker._lastInput == target)
-					$.datepicker._hideDatepicker();
-				else
-					$.datepicker._showDatepicker(target);
-				return false;
-			});
-		}
-		input.addClass(this.markerClassName).keydown(this._doKeyDown).
-			keypress(this._doKeyPress).keyup(this._doKeyUp).
-			bind("setData.datepicker", function(event, key, value) {
-				inst.settings[key] = value;
-			}).bind("getData.datepicker", function(event, key) {
-				return this._get(inst, key);
-			});
-		this._autoSize(inst);
-		$.data(target, PROP_NAME, inst);
-	},
-
-	/* Apply the maximum length for the date format. */
-	_autoSize: function(inst) {
-		if (this._get(inst, 'autoSize') && !inst.inline) {
-			var date = new Date(2009, 12 - 1, 20); // Ensure double digits
-			var dateFormat = this._get(inst, 'dateFormat');
-			if (dateFormat.match(/[DM]/)) {
-				var findMax = function(names) {
-					var max = 0;
-					var maxI = 0;
-					for (var i = 0; i < names.length; i++) {
-						if (names[i].length > max) {
-							max = names[i].length;
-							maxI = i;
-						}
-					}
-					return maxI;
-				};
-				date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ?
-					'monthNames' : 'monthNamesShort'))));
-				date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ?
-					'dayNames' : 'dayNamesShort'))) + 20 - date.getDay());
-			}
-			inst.input.attr('size', this._formatDate(inst, date).length);
-		}
-	},
-
-	/* Attach an inline date picker to a div. */
-	_inlineDatepicker: function(target, inst) {
-		var divSpan = $(target);
-		if (divSpan.hasClass(this.markerClassName))
-			return;
-		divSpan.addClass(this.markerClassName).append(inst.dpDiv).
-			bind("setData.datepicker", function(event, key, value){
-				inst.settings[key] = value;
-			}).bind("getData.datepicker", function(event, key){
-				return this._get(inst, key);
-			});
-		$.data(target, PROP_NAME, inst);
-		this._setDate(inst, this._getDefaultDate(inst));
-		this._updateDatepicker(inst);
-		this._updateAlternate(inst);
-	},
-
-	/* Pop-up the date picker in a "dialog" box.
-	   @param  input     element - ignored
-	   @param  date      string or Date - the initial date to display
-	   @param  onSelect  function - the function to call when a date is selected
-	   @param  settings  object - update the dialog date picker instance's settings (anonymous object)
-	   @param  pos       int[2] - coordinates for the dialog's position within the screen or
-	                     event - with x/y coordinates or
-	                     leave empty for default (screen centre)
-	   @return the manager object */
-	_dialogDatepicker: function(input, date, onSelect, settings, pos) {
-		var inst = this._dialogInst; // internal instance
-		if (!inst) {
-			var id = 'dp' + (++this.uuid);
-			this._dialogInput = $('<input type="text" id="' + id +
-				'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');
-			this._dialogInput.keydown(this._doKeyDown);
-			$('body').append(this._dialogInput);
-			inst = this._dialogInst = this._newInst(this._dialogInput, false);
-			inst.settings = {};
-			$.data(this._dialogInput[0], PROP_NAME, inst);
-		}
-		extendRemove(inst.settings, settings || {});
-		date = (date && date.constructor == Date ? this._formatDate(inst, date) : date);
-		this._dialogInput.val(date);
-
-		this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null);
-		if (!this._pos) {
-			var browserWidth = document.documentElement.clientWidth;
-			var browserHeight = document.documentElement.clientHeight;
-			var scrollX = document.documentElement.scrollLeft || document.body.scrollLeft;
-			var scrollY = document.documentElement.scrollTop || document.body.scrollTop;
-			this._pos = // should use actual width/height below
-				[(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY];
-		}
-
-		// move input on screen for focus, but hidden behind dialog
-		this._dialogInput.css('left', (this._pos[0] + 20) + 'px').css('top', this._pos[1] + 'px');
-		inst.settings.onSelect = onSelect;
-		this._inDialog = true;
-		this.dpDiv.addClass(this._dialogClass);
-		this._showDatepicker(this._dialogInput[0]);
-		if ($.blockUI)
-			$.blockUI(this.dpDiv);
-		$.data(this._dialogInput[0], PROP_NAME, inst);
-		return this;
-	},
-
-	/* Detach a datepicker from its control.
-	   @param  target    element - the target input field or division or span */
-	_destroyDatepicker: function(target) {
-		var $target = $(target);
-		var inst = $.data(target, PROP_NAME);
-		if (!$target.hasClass(this.markerClassName)) {
-			return;
-		}
-		var nodeName = target.nodeName.toLowerCase();
-		$.removeData(target, PROP_NAME);
-		if (nodeName == 'input') {
-			inst.append.remove();
-			inst.trigger.remove();
-			$target.removeClass(this.markerClassName).
-				unbind('focus', this._showDatepicker).
-				unbind('keydown', this._doKeyDown).
-				unbind('keypress', this._doKeyPress).
-				unbind('keyup', this._doKeyUp);
-		} else if (nodeName == 'div' || nodeName == 'span')
-			$target.removeClass(this.markerClassName).empty();
-	},
-
-	/* Enable the date picker to a jQuery selection.
-	   @param  target    element - the target input field or division or span */
-	_enableDatepicker: function(target) {
-		var $target = $(target);
-		var inst = $.data(target, PROP_NAME);
-		if (!$target.hasClass(this.markerClassName)) {
-			return;
-		}
-		var nodeName = target.nodeName.toLowerCase();
-		if (nodeName == 'input') {
-			target.disabled = false;
-			inst.trigger.filter('button').
-				each(function() { this.disabled = false; }).end().
-				filter('img').css({opacity: '1.0', cursor: ''});
-		}
-		else if (nodeName == 'div' || nodeName == 'span') {
-			var inline = $target.children('.' + this._inlineClass);
-			inline.children().removeClass('ui-state-disabled');
-		}
-		this._disabledInputs = $.map(this._disabledInputs,
-			function(value) { return (value == target ? null : value); }); // delete entry
-	},
-
-	/* Disable the date picker to a jQuery selection.
-	   @param  target    element - the target input field or division or span */
-	_disableDatepicker: function(target) {
-		var $target = $(target);
-		var inst = $.data(target, PROP_NAME);
-		if (!$target.hasClass(this.markerClassName)) {
-			return;
-		}
-		var nodeName = target.nodeName.toLowerCase();
-		if (nodeName == 'input') {
-			target.disabled = true;
-			inst.trigger.filter('button').
-				each(function() { this.disabled = true; }).end().
-				filter('img').css({opacity: '0.5', cursor: 'default'});
-		}
-		else if (nodeName == 'div' || nodeName == 'span') {
-			var inline = $target.children('.' + this._inlineClass);
-			inline.children().addClass('ui-state-disabled');
-		}
-		this._disabledInputs = $.map(this._disabledInputs,
-			function(value) { return (value == target ? null : value); }); // delete entry
-		this._disabledInputs[this._disabledInputs.length] = target;
-	},
-
-	/* Is the first field in a jQuery collection disabled as a datepicker?
-	   @param  target    element - the target input field or division or span
-	   @return boolean - true if disabled, false if enabled */
-	_isDisabledDatepicker: function(target) {
-		if (!target) {
-			return false;
-		}
-		for (var i = 0; i < this._disabledInputs.length; i++) {
-			if (this._disabledInputs[i] == target)
-				return true;
-		}
-		return false;
-	},
-
-	/* Retrieve the instance data for the target control.
-	   @param  target  element - the target input field or division or span
-	   @return  object - the associated instance data
-	   @throws  error if a jQuery problem getting data */
-	_getInst: function(target) {
-		try {
-			return $.data(target, PROP_NAME);
-		}
-		catch (err) {
-			throw 'Missing instance data for this datepicker';
-		}
-	},
-
-	/* Update or retrieve the settings for a date picker attached to an input field or division.
-	   @param  target  element - the target input field or division or span
-	   @param  name    object - the new settings to update or
-	                   string - the name of the setting to change or retrieve,
-	                   when retrieving also 'all' for all instance settings or
-	                   'defaults' for all global defaults
-	   @param  value   any - the new value for the setting
-	                   (omit if above is an object or to retrieve a value) */
-	_optionDatepicker: function(target, name, value) {
-		var inst = this._getInst(target);
-		if (arguments.length == 2 && typeof name == 'string') {
-			return (name == 'defaults' ? $.extend({}, $.datepicker._defaults) :
-				(inst ? (name == 'all' ? $.extend({}, inst.settings) :
-				this._get(inst, name)) : null));
-		}
-		var settings = name || {};
-		if (typeof name == 'string') {
-			settings = {};
-			settings[name] = value;
-		}
-		if (inst) {
-			if (this._curInst == inst) {
-				this._hideDatepicker(null);
-			}
-			var date = this._getDateDatepicker(target);
-			extendRemove(inst.settings, settings);
-			this._autoSize(inst);
-			this._setDateDatepicker(target, date);
-			this._updateDatepicker(inst);
-		}
-	},
-
-	// change method deprecated
-	_changeDatepicker: function(target, name, value) {
-		this._optionDatepicker(target, name, value);
-	},
-
-	/* Redraw the date picker attached to an input field or division.
-	   @param  target  element - the target input field or division or span */
-	_refreshDatepicker: function(target) {
-		var inst = this._getInst(target);
-		if (inst) {
-			this._updateDatepicker(inst);
-		}
-	},
-
-	/* Set the dates for a jQuery selection.
-	   @param  target   element - the target input field or division or span
-	   @param  date     Date - the new date */
-	_setDateDatepicker: function(target, date) {
-		var inst = this._getInst(target);
-		if (inst) {
-			this._setDate(inst, date);
-			this._updateDatepicker(inst);
-			this._updateAlternate(inst);
-		}
-	},
-
-	/* Get the date(s) for the first entry in a jQuery selection.
-	   @param  target  element - the target input field or division or span
-	   @return Date - the current date */
-	_getDateDatepicker: function(target) {
-		var inst = this._getInst(target);
-		if (inst && !inst.inline)
-			this._setDateFromField(inst);
-		return (inst ? this._getDate(inst) : null);
-	},
-
-	/* Handle keystrokes. */
-	_doKeyDown: function(event) {
-		var inst = $.datepicker._getInst(event.target);
-		var handled = true;
-		var isRTL = inst.dpDiv.is('.ui-datepicker-rtl');
-		inst._keyEvent = true;
-		if ($.datepicker._datepickerShowing)
-			switch (event.keyCode) {
-				case 9:  $.datepicker._hideDatepicker(null, '');
-						break; // hide on tab out
-				case 13: var sel = $('td.' + $.datepicker._dayOverClass +
-							', td.' + $.datepicker._currentClass, inst.dpDiv);
-						if (sel[0])
-							$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]);
-						else
-							$.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
-						return false; // don't submit the form
-						break; // select the value on enter
-				case 27: $.datepicker._hideDatepicker(null, $.datepicker._get(inst, 'duration'));
-						break; // hide on escape
-				case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
-							-$.datepicker._get(inst, 'stepBigMonths') :
-							-$.datepicker._get(inst, 'stepMonths')), 'M');
-						break; // previous month/year on page up/+ ctrl
-				case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ?
-							+$.datepicker._get(inst, 'stepBigMonths') :
-							+$.datepicker._get(inst, 'stepMonths')), 'M');
-						break; // next month/year on page down/+ ctrl
-				case 35: if (event.ctrlKey || event.metaKey) $.datepicker._clearDate(event.target);
-						handled = event.ctrlKey || event.metaKey;
-						break; // clear on ctrl or command +end
-				case 36: if (event.ctrlKey || event.metaKey) $.datepicker._gotoToday(event.target);
-						handled = event.ctrlKey || event.metaKey;
-						break; // current on ctrl or command +home
-				case 37: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), 'D');
-						handled = event.ctrlKey || event.metaKey;
-						// -1 day on ctrl or command +left
-						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
-									-$.datepicker._get(inst, 'stepBigMonths') :
-									-$.datepicker._get(inst, 'stepMonths')), 'M');
-						// next month/year on alt +left on Mac
-						break;
-				case 38: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, -7, 'D');
-						handled = event.ctrlKey || event.metaKey;
-						break; // -1 week on ctrl or command +up
-				case 39: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), 'D');
-						handled = event.ctrlKey || event.metaKey;
-						// +1 day on ctrl or command +right
-						if (event.originalEvent.altKey) $.datepicker._adjustDate(event.target, (event.ctrlKey ?
-									+$.datepicker._get(inst, 'stepBigMonths') :
-									+$.datepicker._get(inst, 'stepMonths')), 'M');
-						// next month/year on alt +right
-						break;
-				case 40: if (event.ctrlKey || event.metaKey) $.datepicker._adjustDate(event.target, +7, 'D');
-						handled = event.ctrlKey || event.metaKey;
-						break; // +1 week on ctrl or command +down
-				default: handled = false;
-			}
-		else if (event.keyCode == 36 && event.ctrlKey) // display the date picker on ctrl+home
-			$.datepicker._showDatepicker(this);
-		else {
-			handled = false;
-		}
-		if (handled) {
-			event.preventDefault();
-			event.stopPropagation();
-		}
-	},
-
-	/* Filter entered characters - based on date format. */
-	_doKeyPress: function(event) {
-		var inst = $.datepicker._getInst(event.target);
-		if ($.datepicker._get(inst, 'constrainInput')) {
-			var chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'));
-			var chr = String.fromCharCode(event.charCode == undefined ? event.keyCode : event.charCode);
-			return event.ctrlKey || (chr < ' ' || !chars || chars.indexOf(chr) > -1);
-		}
-	},
-
-	/* Synchronise manual entry and field/alternate field. */
-	_doKeyUp: function(event) {
-		var inst = $.datepicker._getInst(event.target);
-		try {
-			var date = $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
-				(inst.input ? inst.input.val() : null),
-				$.datepicker._getFormatConfig(inst));
-			if (date) { // only if valid
-				$.datepicker._setDateFromField(inst);
-				$.datepicker._updateAlternate(inst);
-				$.datepicker._updateDatepicker(inst);
-			}
-		}
-		catch (event) {
-			$.datepicker.log(event);
-		}
-		return true;
-	},
-
-	/* Pop-up the date picker for a given input field.
-	   @param  input  element - the input field attached to the date picker or
-	                  event - if triggered by focus */
-	_showDatepicker: function(input) {
-		input = input.target || input;
-		if (input.nodeName.toLowerCase() != 'input') // find from button/image trigger
-			input = $('input', input.parentNode)[0];
-		if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput == input) // already here
-			return;
-		var inst = $.datepicker._getInst(input);
-		var beforeShow = $.datepicker._get(inst, 'beforeShow');
-		extendRemove(inst.settings, (beforeShow ? beforeShow.apply(input, [input, inst]) : {}));
-		$.datepicker._hideDatepicker(null, '');
-		$.datepicker._lastInput = input;
-		$.datepicker._setDateFromField(inst);
-		if ($.datepicker._inDialog) // hide cursor
-			input.value = '';
-		if (!$.datepicker._pos) { // position below input
-			$.datepicker._pos = $.datepicker._findPos(input);
-			$.datepicker._pos[1] += input.offsetHeight; // add the height
-		}
-		var isFixed = false;
-		$(input).parents().each(function() {
-			isFixed |= $(this).css('position') == 'fixed';
-			return !isFixed;
-		});
-		if (isFixed && $.browser.opera) { // correction for Opera when fixed and scrolled
-			$.datepicker._pos[0] -= document.documentElement.scrollLeft;
-			$.datepicker._pos[1] -= document.documentElement.scrollTop;
-		}
-		var offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]};
-		$.datepicker._pos = null;
-		// determine sizing offscreen
-		inst.dpDiv.css({position: 'absolute', display: 'block', top: '-1000px'});
-		$.datepicker._updateDatepicker(inst);
-		// fix width for dynamic number of date pickers
-		// and adjust position before showing
-		offset = $.datepicker._checkOffset(inst, offset, isFixed);
-		inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ?
-			'static' : (isFixed ? 'fixed' : 'absolute')), display: 'none',
-			left: offset.left + 'px', top: offset.top + 'px'});
-		if (!inst.inline) {
-			var showAnim = $.datepicker._get(inst, 'showAnim') || 'show';
-			var duration = $.datepicker._get(inst, 'duration');
-			var postProcess = function() {
-				$.datepicker._datepickerShowing = true;
-				var borders = $.datepicker._getBorders(inst.dpDiv);
-				inst.dpDiv.find('iframe.ui-datepicker-cover'). // IE6- only
-					css({left: -borders[0], top: -borders[1],
-						width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()});
-			};
-			if ($.effects && $.effects[showAnim])
-				inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess);
-			else
-				inst.dpDiv[showAnim](duration, postProcess);
-			if (duration == '')
-				postProcess();
-			if (inst.input[0].type != 'hidden')
-				inst.input[0].focus();
-			$.datepicker._curInst = inst;
-		}
-	},
-
-	/* Generate the date picker content. */
-	_updateDatepicker: function(inst) {
-		var self = this;
-		var borders = $.datepicker._getBorders(inst.dpDiv);
-		inst.dpDiv.empty().append(this._generateHTML(inst))
-			.find('iframe.ui-datepicker-cover') // IE6- only
-				.css({left: -borders[0], top: -borders[1],
-					width: inst.dpDiv.outerWidth(), height: inst.dpDiv.outerHeight()})
-			.end()
-			.find('button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a')
-				.bind('mouseout', function(){
-					$(this).removeClass('ui-state-hover');
-					if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).removeClass('ui-datepicker-prev-hover');
-					if(this.className.indexOf('ui-datepicker-next') != -1) $(this).removeClass('ui-datepicker-next-hover');
-				})
-				.bind('mouseover', function(){
-					if (!self._isDisabledDatepicker( inst.inline ? inst.dpDiv.parent()[0] : inst.input[0])) {
-						$(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover');
-						$(this).addClass('ui-state-hover');
-						if(this.className.indexOf('ui-datepicker-prev') != -1) $(this).addClass('ui-datepicker-prev-hover');
-						if(this.className.indexOf('ui-datepicker-next') != -1) $(this).addClass('ui-datepicker-next-hover');
-					}
-				})
-			.end()
-			.find('.' + this._dayOverClass + ' a')
-				.trigger('mouseover')
-			.end();
-		var numMonths = this._getNumberOfMonths(inst);
-		var cols = numMonths[1];
-		var width = 17;
-		if (cols > 1)
-			inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', (width * cols) + 'em');
-		else
-			inst.dpDiv.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4').width('');
-		inst.dpDiv[(numMonths[0] != 1 || numMonths[1] != 1 ? 'add' : 'remove') +
-			'Class']('ui-datepicker-multi');
-		inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') +
-			'Class']('ui-datepicker-rtl');
-		if (inst.input && inst.input[0].type != 'hidden' && inst == $.datepicker._curInst)
-			$(inst.input[0]).focus();
-	},
-
-	/* Retrieve the size of left and top borders for an element.
-	   @param  elem  (jQuery object) the element of interest
-	   @return  (number[2]) the left and top borders */
-	_getBorders: function(elem) {
-		var convert = function(value) {
-			return {thin: 1, medium: 2, thick: 3}[value] || value;
-		};
-		return [parseFloat(convert(elem.css('border-left-width'))),
-			parseFloat(convert(elem.css('border-top-width')))];
-	},
-
-	/* Check positioning to remain on screen. */
-	_checkOffset: function(inst, offset, isFixed) {
-		var dpWidth = inst.dpDiv.outerWidth();
-		var dpHeight = inst.dpDiv.outerHeight();
-		var inputWidth = inst.input ? inst.input.outerWidth() : 0;
-		var inputHeight = inst.input ? inst.input.outerHeight() : 0;
-		var viewWidth = document.documentElement.clientWidth + $(document).scrollLeft();
-		var viewHeight = document.documentElement.clientHeight + $(document).scrollTop();
-
-		offset.left -= (this._get(inst, 'isRTL') ? (dpWidth - inputWidth) : 0);
-		offset.left -= (isFixed && offset.left == inst.input.offset().left) ? $(document).scrollLeft() : 0;
-		offset.top -= (isFixed && offset.top == (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0;
-
-		// now check if datepicker is showing outside window viewport - move to a better place if so.
-		offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ?
-			Math.abs(offset.left + dpWidth - viewWidth) : 0);
-		offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ?
-			Math.abs(offset.top + dpHeight + inputHeight * 2 - viewHeight) : 0);
-
-		return offset;
-	},
-
-	/* Find an object's position on the screen. */
-	_findPos: function(obj) {
-        while (obj && (obj.type == 'hidden' || obj.nodeType != 1)) {
-            obj = obj.nextSibling;
-        }
-        var position = $(obj).offset();
-	    return [position.left, position.top];
-	},
-
-	/* Hide the date picker from view.
-	   @param  input  element - the input field attached to the date picker
-	   @param  duration  string - the duration over which to close the date picker */
-	_hideDatepicker: function(input, duration) {
-		var inst = this._curInst;
-		if (!inst || (input && inst != $.data(input, PROP_NAME)))
-			return;
-		if (this._datepickerShowing) {
-			duration = (duration != null ? duration : this._get(inst, 'duration'));
-			var showAnim = this._get(inst, 'showAnim');
-			var postProcess = function() {
-				$.datepicker._tidyDialog(inst);
-			};
-			if (duration != '' && $.effects && $.effects[showAnim])
-				inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'),
-					duration, postProcess);
-			else
-				inst.dpDiv[(duration == '' ? 'hide' : (showAnim == 'slideDown' ? 'slideUp' :
-					(showAnim == 'fadeIn' ? 'fadeOut' : 'hide')))](duration, postProcess);
-			if (duration == '')
-				this._tidyDialog(inst);
-			var onClose = this._get(inst, 'onClose');
-			if (onClose)
-				onClose.apply((inst.input ? inst.input[0] : null),
-					[(inst.input ? inst.input.val() : ''), inst]);  // trigger custom callback
-			this._datepickerShowing = false;
-			this._lastInput = null;
-			if (this._inDialog) {
-				this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' });
-				if ($.blockUI) {
-					$.unblockUI();
-					$('body').append(this.dpDiv);
-				}
-			}
-			this._inDialog = false;
-		}
-		this._curInst = null;
-	},
-
-	/* Tidy up after a dialog display. */
-	_tidyDialog: function(inst) {
-		inst.dpDiv.removeClass(this._dialogClass).unbind('.ui-datepicker-calendar');
-	},
-
-	/* Close date picker if clicked elsewhere. */
-	_checkExternalClick: function(event) {
-		if (!$.datepicker._curInst)
-			return;
-		var $target = $(event.target);
-		if (($target.parents('#' + $.datepicker._mainDivId).length == 0) &&
-				!$target.hasClass($.datepicker.markerClassName) &&
-				!$target.hasClass($.datepicker._triggerClass) &&
-				$.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI))
-			$.datepicker._hideDatepicker(null, '');
-	},
-
-	/* Adjust one of the date sub-fields. */
-	_adjustDate: function(id, offset, period) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		if (this._isDisabledDatepicker(target[0])) {
-			return;
-		}
-		this._adjustInstDate(inst, offset +
-			(period == 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
-			period);
-		this._updateDatepicker(inst);
-	},
-
-	/* Action for current link. */
-	_gotoToday: function(id) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
-			inst.selectedDay = inst.currentDay;
-			inst.drawMonth = inst.selectedMonth = inst.currentMonth;
-			inst.drawYear = inst.selectedYear = inst.currentYear;
-		}
-		else {
-		var date = new Date();
-		inst.selectedDay = date.getDate();
-		inst.drawMonth = inst.selectedMonth = date.getMonth();
-		inst.drawYear = inst.selectedYear = date.getFullYear();
-		}
-		this._notifyChange(inst);
-		this._adjustDate(target);
-	},
-
-	/* Action for selecting a new month/year. */
-	_selectMonthYear: function(id, select, period) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		inst._selectingMonthYear = false;
-		inst['selected' + (period == 'M' ? 'Month' : 'Year')] =
-		inst['draw' + (period == 'M' ? 'Month' : 'Year')] =
-			parseInt(select.options[select.selectedIndex].value,10);
-		this._notifyChange(inst);
-		this._adjustDate(target);
-	},
-
-	/* Restore input focus after not changing month/year. */
-	_clickMonthYear: function(id) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		if (inst.input && inst._selectingMonthYear && !$.browser.msie)
-			inst.input[0].focus();
-		inst._selectingMonthYear = !inst._selectingMonthYear;
-	},
-
-	/* Action for selecting a day. */
-	_selectDay: function(id, month, year, td) {
-		var target = $(id);
-		if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
-			return;
-		}
-		var inst = this._getInst(target[0]);
-		inst.selectedDay = inst.currentDay = $('a', td).html();
-		inst.selectedMonth = inst.currentMonth = month;
-		inst.selectedYear = inst.currentYear = year;
-		this._selectDate(id, this._formatDate(inst,
-			inst.currentDay, inst.currentMonth, inst.currentYear));
-	},
-
-	/* Erase the input field and hide the date picker. */
-	_clearDate: function(id) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		this._selectDate(target, '');
-	},
-
-	/* Update the input field with the selected date. */
-	_selectDate: function(id, dateStr) {
-		var target = $(id);
-		var inst = this._getInst(target[0]);
-		dateStr = (dateStr != null ? dateStr : this._formatDate(inst));
-		if (inst.input)
-			inst.input.val(dateStr);
-		this._updateAlternate(inst);
-		var onSelect = this._get(inst, 'onSelect');
-		if (onSelect)
-			onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]);  // trigger custom callback
-		else if (inst.input)
-			inst.input.trigger('change'); // fire the change event
-		if (inst.inline)
-			this._updateDatepicker(inst);
-		else {
-			this._hideDatepicker(null, this._get(inst, 'duration'));
-			this._lastInput = inst.input[0];
-			if (typeof(inst.input[0]) != 'object')
-				inst.input[0].focus(); // restore focus
-			this._lastInput = null;
-		}
-	},
-
-	/* Update any alternate field to synchronise with the main field. */
-	_updateAlternate: function(inst) {
-		var altField = this._get(inst, 'altField');
-		if (altField) { // update alternate field too
-			var altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat');
-			var date = this._getDate(inst);
-			var dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst));
-			$(altField).each(function() { $(this).val(dateStr); });
-		}
-	},
-
-	/* Set as beforeShowDay function to prevent selection of weekends.
-	   @param  date  Date - the date to customise
-	   @return [boolean, string] - is this date selectable?, what is its CSS class? */
-	noWeekends: function(date) {
-		var day = date.getDay();
-		return [(day > 0 && day < 6), ''];
-	},
-
-	/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
-	   @param  date  Date - the date to get the week for
-	   @return  number - the number of the week within the year that contains this date */
-	iso8601Week: function(date) {
-		var checkDate = new Date(date.getTime());
-		// Find Thursday of this week starting on Monday
-		checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7));
-		var time = checkDate.getTime();
-		checkDate.setMonth(0); // Compare with Jan 1
-		checkDate.setDate(1);
-		return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1;
-	},
-
-	/* Parse a string value into a date object.
-	   See formatDate below for the possible formats.
-
-	   @param  format    string - the expected format of the date
-	   @param  value     string - the date in the above format
-	   @param  settings  Object - attributes include:
-	                     shortYearCutoff  number - the cutoff year for determining the century (optional)
-	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
-	                     dayNames         string[7] - names of the days from Sunday (optional)
-	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
-	                     monthNames       string[12] - names of the months (optional)
-	   @return  Date - the extracted date value or null if value is blank */
-	parseDate: function (format, value, settings) {
-		if (format == null || value == null)
-			throw 'Invalid arguments';
-		value = (typeof value == 'object' ? value.toString() : value + '');
-		if (value == '')
-			return null;
-		var shortYearCutoff = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff;
-		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
-		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
-		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
-		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
-		var year = -1;
-		var month = -1;
-		var day = -1;
-		var doy = -1;
-		var literal = false;
-		// Check whether a format character is doubled
-		var lookAhead = function(match) {
-			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
-			if (matches)
-				iFormat++;
-			return matches;
-		};
-		// Extract a number from the string value
-		var getNumber = function(match) {
-			lookAhead(match);
-			var size = (match == '@' ? 14 : (match == '!' ? 20 :
-				(match == 'y' ? 4 : (match == 'o' ? 3 : 2))));
-			var digits = new RegExp('^\\d{1,' + size + '}');
-			var num = value.substring(iValue).match(digits);
-			if (!num)
-				throw 'Missing number at position ' + iValue;
-			iValue += num[0].length;
-			return parseInt(num[0], 10);
-		};
-		// Extract a name from the string value and convert to an index
-		var getName = function(match, shortNames, longNames) {
-			var names = (lookAhead(match) ? longNames : shortNames);
-			for (var i = 0; i < names.length; i++) {
-				if (value.substr(iValue, names[i].length) == names[i]) {
-					iValue += names[i].length;
-					return i + 1;
-				}
-			}
-			throw 'Unknown name at position ' + iValue;
-		};
-		// Confirm that a literal character matches the string value
-		var checkLiteral = function() {
-			if (value.charAt(iValue) != format.charAt(iFormat))
-				throw 'Unexpected literal at position ' + iValue;
-			iValue++;
-		};
-		var iValue = 0;
-		for (var iFormat = 0; iFormat < format.length; iFormat++) {
-			if (literal)
-				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
-					literal = false;
-				else
-					checkLiteral();
-			else
-				switch (format.charAt(iFormat)) {
-					case 'd':
-						day = getNumber('d');
-						break;
-					case 'D':
-						getName('D', dayNamesShort, dayNames);
-						break;
-					case 'o':
-						doy = getNumber('o');
-						break;
-					case 'm':
-						month = getNumber('m');
-						break;
-					case 'M':
-						month = getName('M', monthNamesShort, monthNames);
-						break;
-					case 'y':
-						year = getNumber('y');
-						break;
-					case '@':
-						var date = new Date(getNumber('@'));
-						year = date.getFullYear();
-						month = date.getMonth() + 1;
-						day = date.getDate();
-						break;
-					case '!':
-						var date = new Date((getNumber('!') - this._ticksTo1970) / 10000);
-						year = date.getFullYear();
-						month = date.getMonth() + 1;
-						day = date.getDate();
-						break;
-					case "'":
-						if (lookAhead("'"))
-							checkLiteral();
-						else
-							literal = true;
-						break;
-					default:
-						checkLiteral();
-				}
-		}
-		if (year == -1)
-			year = new Date().getFullYear();
-		else if (year < 100)
-			year += new Date().getFullYear() - new Date().getFullYear() % 100 +
-				(year <= shortYearCutoff ? 0 : -100);
-		if (doy > -1) {
-			month = 1;
-			day = doy;
-			do {
-				var dim = this._getDaysInMonth(year, month - 1);
-				if (day <= dim)
-					break;
-				month++;
-				day -= dim;
-			} while (true);
-		}
-		var date = this._daylightSavingAdjust(new Date(year, month - 1, day));
-		if (date.getFullYear() != year || date.getMonth() + 1 != month || date.getDate() != day)
-			throw 'Invalid date'; // E.g. 31/02/*
-		return date;
-	},
-
-	/* Standard date formats. */
-	ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
-	COOKIE: 'D, dd M yy',
-	ISO_8601: 'yy-mm-dd',
-	RFC_822: 'D, d M y',
-	RFC_850: 'DD, dd-M-y',
-	RFC_1036: 'D, d M y',
-	RFC_1123: 'D, d M yy',
-	RFC_2822: 'D, d M yy',
-	RSS: 'D, d M y', // RFC 822
-	TICKS: '!',
-	TIMESTAMP: '@',
-	W3C: 'yy-mm-dd', // ISO 8601
-
-	_ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) +
-		Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000),
-
-	/* Format a date object into a string value.
-	   The format can be combinations of the following:
-	   d  - day of month (no leading zero)
-	   dd - day of month (two digit)
-	   o  - day of year (no leading zeros)
-	   oo - day of year (three digit)
-	   D  - day name short
-	   DD - day name long
-	   m  - month of year (no leading zero)
-	   mm - month of year (two digit)
-	   M  - month name short
-	   MM - month name long
-	   y  - year (two digit)
-	   yy - year (four digit)
-	   @ - Unix timestamp (ms since 01/01/1970)
-	   ! - Windows ticks (100ns since 01/01/0001)
-	   '...' - literal text
-	   '' - single quote
-
-	   @param  format    string - the desired format of the date
-	   @param  date      Date - the date value to format
-	   @param  settings  Object - attributes include:
-	                     dayNamesShort    string[7] - abbreviated names of the days from Sunday (optional)
-	                     dayNames         string[7] - names of the days from Sunday (optional)
-	                     monthNamesShort  string[12] - abbreviated names of the months (optional)
-	                     monthNames       string[12] - names of the months (optional)
-	   @return  string - the date in the above format */
-	formatDate: function (format, date, settings) {
-		if (!date)
-			return '';
-		var dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort;
-		var dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames;
-		var monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort;
-		var monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames;
-		// Check whether a format character is doubled
-		var lookAhead = function(match) {
-			var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) == match);
-			if (matches)
-				iFormat++;
-			return matches;
-		};
-		// Format a number, with leading zero if necessary
-		var formatNumber = function(match, value, len) {
-			var num = '' + value;
-			if (lookAhead(match))
-				while (num.length < len)
-					num = '0' + num;
-			return num;
-		};
-		// Format a name, short or long as requested
-		var formatName = function(match, value, shortNames, longNames) {
-			return (lookAhead(match) ? longNames[value] : shortNames[value]);
-		};
-		var output = '';
-		var literal = false;
-		if (date)
-			for (var iFormat = 0; iFormat < format.length; iFormat++) {
-				if (literal)
-					if (format.charAt(iFormat) == "'" && !lookAhead("'"))
-						literal = false;
-					else
-						output += format.charAt(iFormat);
-				else
-					switch (format.charAt(iFormat)) {
-						case 'd':
-							output += formatNumber('d', date.getDate(), 2);
-							break;
-						case 'D':
-							output += formatName('D', date.getDay(), dayNamesShort, dayNames);
-							break;
-						case 'o':
-							output += formatNumber('o',
-								(date.getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000, 3);
-							break;
-						case 'm':
-							output += formatNumber('m', date.getMonth() + 1, 2);
-							break;
-						case 'M':
-							output += formatName('M', date.getMonth(), monthNamesShort, monthNames);
-							break;
-						case 'y':
-							output += (lookAhead('y') ? date.getFullYear() :
-								(date.getYear() % 100 < 10 ? '0' : '') + date.getYear() % 100);
-							break;
-						case '@':
-							output += date.getTime();
-							break;
-						case '!':
-							output += date.getTime() * 10000 + this._ticksTo1970;
-							break;
-						case "'":
-							if (lookAhead("'"))
-								output += "'";
-							else
-								literal = true;
-							break;
-						default:
-							output += format.charAt(iFormat);
-					}
-			}
-		return output;
-	},
-
-	/* Extract all possible characters from the date format. */
-	_possibleChars: function (format) {
-		var chars = '';
-		var literal = false;
-		for (var iFormat = 0; iFormat < format.length; iFormat++)
-			if (literal)
-				if (format.charAt(iFormat) == "'" && !lookAhead("'"))
-					literal = false;
-				else
-					chars += format.charAt(iFormat);
-			else
-				switch (format.charAt(iFormat)) {
-					case 'd': case 'm': case 'y': case '@':
-						chars += '0123456789';
-						break;
-					case 'D': case 'M':
-						return null; // Accept anything
-					case "'":
-						if (lookAhead("'"))
-							chars += "'";
-						else
-							literal = true;
-						break;
-					default:
-						chars += format.charAt(iFormat);
-				}
-		return chars;
-	},
-
-	/* Get a setting value, defaulting if necessary. */
-	_get: function(inst, name) {
-		return inst.settings[name] !== undefined ?
-			inst.settings[name] : this._defaults[name];
-	},
-
-	/* Parse existing date and initialise date picker. */
-	_setDateFromField: function(inst) {
-		var dateFormat = this._get(inst, 'dateFormat');
-		var dates = inst.input ? inst.input.val() : null;
-		var date, defaultDate;
-		date = defaultDate = this._getDefaultDate(inst);
-		var settings = this._getFormatConfig(inst);
-		try {
-			date = this.parseDate(dateFormat, dates, settings) || defaultDate;
-		} catch (event) {
-			this.log(event);
-			date = defaultDate;
-		}
-		inst.selectedDay = date.getDate();
-		inst.drawMonth = inst.selectedMonth = date.getMonth();
-		inst.drawYear = inst.selectedYear = date.getFullYear();
-		inst.currentDay = (dates ? date.getDate() : 0);
-		inst.currentMonth = (dates ? date.getMonth() : 0);
-		inst.currentYear = (dates ? date.getFullYear() : 0);
-		this._adjustInstDate(inst);
-	},
-
-	/* Retrieve the default date shown on opening. */
-	_getDefaultDate: function(inst) {
-		return this._restrictMinMax(inst,
-			this._determineDate(inst, this._get(inst, 'defaultDate'), new Date()));
-	},
-
-	/* A date may be specified as an exact value or a relative one. */
-	_determineDate: function(inst, date, defaultDate) {
-		var offsetNumeric = function(offset) {
-			var date = new Date();
-			date.setDate(date.getDate() + offset);
-			return date;
-		};
-		var offsetString = function(offset) {
-			try {
-				return $.datepicker.parseDate($.datepicker._get(inst, 'dateFormat'),
-					offset, $.datepicker._getFormatConfig(inst));
-			}
-			catch (e) {
-				// Ignore
-			}
-			var date = (offset.toLowerCase().match(/^c/) ?
-				$.datepicker._getDate(inst) : null) || new Date();
-			var year = date.getFullYear();
-			var month = date.getMonth();
-			var day = date.getDate();
-			var pattern = /([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g;
-			var matches = pattern.exec(offset);
-			while (matches) {
-				switch (matches[2] || 'd') {
-					case 'd' : case 'D' :
-						day += parseInt(matches[1],10); break;
-					case 'w' : case 'W' :
-						day += parseInt(matches[1],10) * 7; break;
-					case 'm' : case 'M' :
-						month += parseInt(matches[1],10);
-						day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
-						break;
-					case 'y': case 'Y' :
-						year += parseInt(matches[1],10);
-						day = Math.min(day, $.datepicker._getDaysInMonth(year, month));
-						break;
-				}
-				matches = pattern.exec(offset);
-			}
-			return new Date(year, month, day);
-		};
-		date = (date == null ? defaultDate : (typeof date == 'string' ? offsetString(date) :
-			(typeof date == 'number' ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : date)));
-		date = (date && date.toString() == 'Invalid Date' ? defaultDate : date);
-		if (date) {
-			date.setHours(0);
-			date.setMinutes(0);
-			date.setSeconds(0);
-			date.setMilliseconds(0);
-		}
-		return this._daylightSavingAdjust(date);
-	},
-
-	/* Handle switch to/from daylight saving.
-	   Hours may be non-zero on daylight saving cut-over:
-	   > 12 when midnight changeover, but then cannot generate
-	   midnight datetime, so jump to 1AM, otherwise reset.
-	   @param  date  (Date) the date to check
-	   @return  (Date) the corrected date */
-	_daylightSavingAdjust: function(date) {
-		if (!date) return null;
-		date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0);
-		return date;
-	},
-
-	/* Set the date(s) directly. */
-	_setDate: function(inst, date) {
-		var clear = !(date);
-		var origMonth = inst.selectedMonth;
-		var origYear = inst.selectedYear;
-		date = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()));
-		inst.selectedDay = inst.currentDay = date.getDate();
-		inst.drawMonth = inst.selectedMonth = inst.currentMonth = date.getMonth();
-		inst.drawYear = inst.selectedYear = inst.currentYear = date.getFullYear();
-		if (origMonth != inst.selectedMonth || origYear != inst.selectedYear)
-			this._notifyChange(inst);
-		this._adjustInstDate(inst);
-		if (inst.input) {
-			inst.input.val(clear ? '' : this._formatDate(inst));
-		}
-	},
-
-	/* Retrieve the date(s) directly. */
-	_getDate: function(inst) {
-		var startDate = (!inst.currentYear || (inst.input && inst.input.val() == '') ? null :
-			this._daylightSavingAdjust(new Date(
-			inst.currentYear, inst.currentMonth, inst.currentDay)));
-			return startDate;
-	},
-
-	/* Generate the HTML for the current state of the date picker. */
-	_generateHTML: function(inst) {
-		var today = new Date();
-		today = this._daylightSavingAdjust(
-			new Date(today.getFullYear(), today.getMonth(), today.getDate())); // clear time
-		var isRTL = this._get(inst, 'isRTL');
-		var showButtonPanel = this._get(inst, 'showButtonPanel');
-		var hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext');
-		var navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat');
-		var numMonths = this._getNumberOfMonths(inst);
-		var showCurrentAtPos = this._get(inst, 'showCurrentAtPos');
-		var stepMonths = this._get(inst, 'stepMonths');
-		var isMultiMonth = (numMonths[0] != 1 || numMonths[1] != 1);
-		var currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) :
-			new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
-		var minDate = this._getMinMaxDate(inst, 'min');
-		var maxDate = this._getMinMaxDate(inst, 'max');
-		var drawMonth = inst.drawMonth - showCurrentAtPos;
-		var drawYear = inst.drawYear;
-		if (drawMonth < 0) {
-			drawMonth += 12;
-			drawYear--;
-		}
-		if (maxDate) {
-			var maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(),
-				maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate()));
-			maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw);
-			while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
-				drawMonth--;
-				if (drawMonth < 0) {
-					drawMonth = 11;
-					drawYear--;
-				}
-			}
-		}
-		inst.drawMonth = drawMonth;
-		inst.drawYear = drawYear;
-		var prevText = this._get(inst, 'prevText');
-		prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText,
-			this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
-			this._getFormatConfig(inst)));
-		var prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ?
-			'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', -' + stepMonths + ', \'M\');"' +
-			' title="' + prevText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>' :
-			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+ prevText +'"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'e' : 'w') + '">' + prevText + '</span></a>'));
-		var nextText = this._get(inst, 'nextText');
-		nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText,
-			this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
-			this._getFormatConfig(inst)));
-		var next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ?
-			'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery.datepicker._adjustDate(\'#' + inst.id + '\', +' + stepMonths + ', \'M\');"' +
-			' title="' + nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>' :
-			(hideIfNoPrevNext ? '' : '<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+ nextText + '"><span class="ui-icon ui-icon-circle-triangle-' + ( isRTL ? 'w' : 'e') + '">' + nextText + '</span></a>'));
-		var currentText = this._get(inst, 'currentText');
-		var gotoDate = (this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today);
-		currentText = (!navigationAsDateFormat ? currentText :
-			this.formatDate(currentText, gotoDate, this._getFormatConfig(inst)));
-		var controls = (!inst.inline ? '<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery.datepicker._hideDatepicker();">' + this._get(inst, 'closeText') + '</button>' : '');
-		var buttonPanel = (showButtonPanel) ? '<div class="ui-datepicker-buttonpane ui-widget-content">' + (isRTL ? controls : '') +
-			(this._isInRange(inst, gotoDate) ? '<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery.datepicker._gotoToday(\'#' + inst.id + '\');"' +
-			'>' + currentText + '</button>' : '') + (isRTL ? '' : controls) + '</div>' : '';
-		var firstDay = parseInt(this._get(inst, 'firstDay'),10);
-		firstDay = (isNaN(firstDay) ? 0 : firstDay);
-		var showWeek = this._get(inst, 'showWeek');
-		var dayNames = this._get(inst, 'dayNames');
-		var dayNamesShort = this._get(inst, 'dayNamesShort');
-		var dayNamesMin = this._get(inst, 'dayNamesMin');
-		var monthNames = this._get(inst, 'monthNames');
-		var monthNamesShort = this._get(inst, 'monthNamesShort');
-		var beforeShowDay = this._get(inst, 'beforeShowDay');
-		var showOtherMonths = this._get(inst, 'showOtherMonths');
-		var selectOtherMonths = this._get(inst, 'selectOtherMonths');
-		var calculateWeek = this._get(inst, 'calculateWeek') || this.iso8601Week;
-		var defaultDate = this._getDefaultDate(inst);
-		var html = '';
-		for (var row = 0; row < numMonths[0]; row++) {
-			var group = '';
-			for (var col = 0; col < numMonths[1]; col++) {
-				var selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay));
-				var cornerClass = ' ui-corner-all';
-				var calender = '';
-				if (isMultiMonth) {
-					calender += '<div class="ui-datepicker-group ui-datepicker-group-';
-					switch (col) {
-						case 0: calender += 'first'; cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left'); break;
-						case numMonths[1]-1: calender += 'last'; cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right'); break;
-						default: calender += 'middle'; cornerClass = ''; break;
-					}
-					calender += '">';
-				}
-				calender += '<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix' + cornerClass + '">' +
-					(/all|left/.test(cornerClass) && row == 0 ? (isRTL ? next : prev) : '') +
-					(/all|right/.test(cornerClass) && row == 0 ? (isRTL ? prev : next) : '') +
-					this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate,
-					row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers
-					'</div><table class="ui-datepicker-calendar"><thead>' +
-					'<tr>';
-				var thead = (showWeek ? '<th class="ui-datepicker-week-col">' + this._get(inst, 'weekHeader') + '</th>' : '');
-				for (var dow = 0; dow < 7; dow++) { // days of the week
-					var day = (dow + firstDay) % 7;
-					thead += '<th' + ((dow + firstDay + 6) % 7 >= 5 ? ' class="ui-datepicker-week-end"' : '') + '>' +
-						'<span title="' + dayNames[day] + '">' + dayNamesMin[day] + '</span></th>';
-				}
-				calender += thead + '</tr></thead><tbody>';
-				var daysInMonth = this._getDaysInMonth(drawYear, drawMonth);
-				if (drawYear == inst.selectedYear && drawMonth == inst.selectedMonth)
-					inst.selectedDay = Math.min(inst.selectedDay, daysInMonth);
-				var leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7;
-				var numRows = (isMultiMonth ? 6 : Math.ceil((leadDays + daysInMonth) / 7)); // calculate the number of rows to generate
-				var printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays));
-				for (var dRow = 0; dRow < numRows; dRow++) { // create date picker rows
-					calender += '<tr>';
-					var tbody = (!showWeek ? '' : '<td class="ui-datepicker-week-col">' +
-						this._get(inst, 'calculateWeek')(printDate) + '</td>');
-					for (var dow = 0; dow < 7; dow++) { // create date picker days
-						var daySettings = (beforeShowDay ?
-							beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, '']);
-						var otherMonth = (printDate.getMonth() != drawMonth);
-						var unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] ||
-							(minDate && printDate < minDate) || (maxDate && printDate > maxDate);
-						tbody += '<td class="' +
-							((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
-							(otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
-							((printDate.getTime() == selectedDate.getTime() && drawMonth == inst.selectedMonth && inst._keyEvent) || // user pressed key
-							(defaultDate.getTime() == printDate.getTime() && defaultDate.getTime() == selectedDate.getTime()) ?
-							// or defaultDate is current printedDate and defaultDate is selectedDate
-							' ' + this._dayOverClass : '') + // highlight selected day
-							(unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled': '') +  // highlight unselectable days
-							(otherMonth && !showOtherMonths ? '' : ' ' + daySettings[1] + // highlight custom dates
-							(printDate.getTime() == currentDate.getTime() ? ' ' + this._currentClass : '') + // highlight selected day
-							(printDate.getTime() == today.getTime() ? ' ui-datepicker-today' : '')) + '"' + // highlight today (if different)
-							((!otherMonth || showOtherMonths) && daySettings[2] ? ' title="' + daySettings[2] + '"' : '') + // cell title
-							(unselectable ? '' : ' onclick="DP_jQuery.datepicker._selectDay(\'#' +
-							inst.id + '\',' + printDate.getMonth() + ',' + printDate.getFullYear() + ', this);return false;"') + '>' + // actions
-							(otherMonth && !showOtherMonths ? '&#xa0;' : // display for other months
-							(unselectable ? '<span class="ui-state-default">' + printDate.getDate() + '</span>' : '<a class="ui-state-default' +
-							(printDate.getTime() == today.getTime() ? ' ui-state-highlight' : '') +
-							(printDate.getTime() == currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
-							(otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
-							'" href="#">' + printDate.getDate() + '</a>')) + '</td>'; // display selectable date
-						printDate.setDate(printDate.getDate() + 1);
-						printDate = this._daylightSavingAdjust(printDate);
-					}
-					calender += tbody + '</tr>';
-				}
-				drawMonth++;
-				if (drawMonth > 11) {
-					drawMonth = 0;
-					drawYear++;
-				}
-				calender += '</tbody></table>' + (isMultiMonth ? '</div>' + 
-							((numMonths[0] > 0 && col == numMonths[1]-1) ? '<div class="ui-datepicker-row-break"></div>' : '') : '');
-				group += calender;
-			}
-			html += group;
-		}
-		html += buttonPanel + ($.browser.msie && parseInt($.browser.version,10) < 7 && !inst.inline ?
-			'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>' : '');
-		inst._keyEvent = false;
-		return html;
-	},
-
-	/* Generate the month and year header. */
-	_generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate,
-			secondary, monthNames, monthNamesShort) {
-		var changeMonth = this._get(inst, 'changeMonth');
-		var changeYear = this._get(inst, 'changeYear');
-		var showMonthAfterYear = this._get(inst, 'showMonthAfterYear');
-		var html = '<div class="ui-datepicker-title">';
-		var monthHtml = '';
-		// month selection
-		if (secondary || !changeMonth)
-			monthHtml += '<span class="ui-datepicker-month">' + monthNames[drawMonth] + '</span> ';
-		else {
-			var inMinYear = (minDate && minDate.getFullYear() == drawYear);
-			var inMaxYear = (maxDate && maxDate.getFullYear() == drawYear);
-			monthHtml += '<select class="ui-datepicker-month" ' +
-				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'M\');" ' +
-				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
-			 	'>';
-			for (var month = 0; month < 12; month++) {
-				if ((!inMinYear || month >= minDate.getMonth()) &&
-						(!inMaxYear || month <= maxDate.getMonth()))
-					monthHtml += '<option value="' + month + '"' +
-						(month == drawMonth ? ' selected="selected"' : '') +
-						'>' + monthNamesShort[month] + '</option>';
-			}
-			monthHtml += '</select>';
-		}
-		if (!showMonthAfterYear)
-			html += monthHtml + ((secondary || changeMonth || changeYear) && (!(changeMonth && changeYear)) ? '&#xa0;' : '');
-		// year selection
-		if (secondary || !changeYear)
-			html += '<span class="ui-datepicker-year">' + drawYear + '</span>';
-		else {
-			// determine range of years to display
-			var years = this._get(inst, 'yearRange').split(':');
-			var year = 0;
-			var endYear = 0;
-			if (years.length != 2) {
-				year = drawYear - 10;
-				endYear = drawYear + 10;
-			} else if (years[0].charAt(0) == '+' || years[0].charAt(0) == '-') {
-				year = drawYear + parseInt(years[0], 10);
-				endYear = drawYear + parseInt(years[1], 10);
-			} else {
-				year = parseInt(years[0], 10);
-				endYear = parseInt(years[1], 10);
-			}
-			year = (minDate ? Math.max(year, minDate.getFullYear()) : year);
-			endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear);
-			html += '<select class="ui-datepicker-year" ' +
-				'onchange="DP_jQuery.datepicker._selectMonthYear(\'#' + inst.id + '\', this, \'Y\');" ' +
-				'onclick="DP_jQuery.datepicker._clickMonthYear(\'#' + inst.id + '\');"' +
-				'>';
-			for (; year <= endYear; year++) {
-				html += '<option value="' + year + '"' +
-					(year == drawYear ? ' selected="selected"' : '') +
-					'>' + year + '</option>';
-			}
-			html += '</select>';
-		}
-		html += this._get(inst, 'yearSuffix');
-		if (showMonthAfterYear)
-			html += (secondary || changeMonth || changeYear ? '&#xa0;' : '') + monthHtml;
-		html += '</div>'; // Close datepicker_header
-		return html;
-	},
-
-	/* Adjust one of the date sub-fields. */
-	_adjustInstDate: function(inst, offset, period) {
-		var year = inst.drawYear + (period == 'Y' ? offset : 0);
-		var month = inst.drawMonth + (period == 'M' ? offset : 0);
-		var day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
-			(period == 'D' ? offset : 0);
-		var date = this._restrictMinMax(inst,
-			this._daylightSavingAdjust(new Date(year, month, day)));
-		inst.selectedDay = date.getDate();
-		inst.drawMonth = inst.selectedMonth = date.getMonth();
-		inst.drawYear = inst.selectedYear = date.getFullYear();
-		if (period == 'M' || period == 'Y')
-			this._notifyChange(inst);
-	},
-
-	/* Ensure a date is within any min/max bounds. */
-	_restrictMinMax: function(inst, date) {
-		var minDate = this._getMinMaxDate(inst, 'min');
-		var maxDate = this._getMinMaxDate(inst, 'max');
-		date = (minDate && date < minDate ? minDate : date);
-		date = (maxDate && date > maxDate ? maxDate : date);
-		return date;
-	},
-
-	/* Notify change of month/year. */
-	_notifyChange: function(inst) {
-		var onChange = this._get(inst, 'onChangeMonthYear');
-		if (onChange)
-			onChange.apply((inst.input ? inst.input[0] : null),
-				[inst.selectedYear, inst.selectedMonth + 1, inst]);
-	},
-
-	/* Determine the number of months to show. */
-	_getNumberOfMonths: function(inst) {
-		var numMonths = this._get(inst, 'numberOfMonths');
-		return (numMonths == null ? [1, 1] : (typeof numMonths == 'number' ? [1, numMonths] : numMonths));
-	},
-
-	/* Determine the current maximum date - ensure no time components are set. */
-	_getMinMaxDate: function(inst, minMax) {
-		return this._determineDate(inst, this._get(inst, minMax + 'Date'), null);
-	},
-
-	/* Find the number of days in a given month. */
-	_getDaysInMonth: function(year, month) {
-		return 32 - new Date(year, month, 32).getDate();
-	},
-
-	/* Find the day of the week of the first of a month. */
-	_getFirstDayOfMonth: function(year, month) {
-		return new Date(year, month, 1).getDay();
-	},
-
-	/* Determines if we should allow a "next/prev" month display change. */
-	_canAdjustMonth: function(inst, offset, curYear, curMonth) {
-		var numMonths = this._getNumberOfMonths(inst);
-		var date = this._daylightSavingAdjust(new Date(curYear,
-			curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1));
-		if (offset < 0)
-			date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()));
-		return this._isInRange(inst, date);
-	},
-
-	/* Is the given date in the accepted range? */
-	_isInRange: function(inst, date) {
-		var minDate = this._getMinMaxDate(inst, 'min');
-		var maxDate = this._getMinMaxDate(inst, 'max');
-		return ((!minDate || date >= minDate) && (!maxDate || date <= maxDate));
-	},
-
-	/* Provide the configuration settings for formatting/parsing. */
-	_getFormatConfig: function(inst) {
-		var shortYearCutoff = this._get(inst, 'shortYearCutoff');
-		shortYearCutoff = (typeof shortYearCutoff != 'string' ? shortYearCutoff :
-			new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10));
-		return {shortYearCutoff: shortYearCutoff,
-			dayNamesShort: this._get(inst, 'dayNamesShort'), dayNames: this._get(inst, 'dayNames'),
-			monthNamesShort: this._get(inst, 'monthNamesShort'), monthNames: this._get(inst, 'monthNames')};
-	},
-
-	/* Format the given date for display. */
-	_formatDate: function(inst, day, month, year) {
-		if (!day) {
-			inst.currentDay = inst.selectedDay;
-			inst.currentMonth = inst.selectedMonth;
-			inst.currentYear = inst.selectedYear;
-		}
-		var date = (day ? (typeof day == 'object' ? day :
-			this._daylightSavingAdjust(new Date(year, month, day))) :
-			this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay)));
-		return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst));
-	}
-});
-
-/* jQuery extend now ignores nulls! */
-function extendRemove(target, props) {
-	$.extend(target, props);
-	for (var name in props)
-		if (props[name] == null || props[name] == undefined)
-			target[name] = props[name];
-	return target;
-};
-
-/* Determine whether an object is an array. */
-function isArray(a) {
-	return (a && (($.browser.safari && typeof a == 'object' && a.length) ||
-		(a.constructor && a.constructor.toString().match(/\Array\(\)/))));
-};
-
-/* Invoke the datepicker functionality.
-   @param  options  string - a command, optionally followed by additional parameters or
-                    Object - settings for attaching new datepicker functionality
-   @return  jQuery object */
-$.fn.datepicker = function(options){
-
-	/* Initialise the date picker. */
-	if (!$.datepicker.initialized) {
-		$(document).mousedown($.datepicker._checkExternalClick).
-			find('body').append($.datepicker.dpDiv);
-		$.datepicker.initialized = true;
-	}
-
-	var otherArgs = Array.prototype.slice.call(arguments, 1);
-	if (typeof options == 'string' && (options == 'isDisabled' || options == 'getDate'))
-		return $.datepicker['_' + options + 'Datepicker'].
-			apply($.datepicker, [this[0]].concat(otherArgs));
-	if (options == 'option' && arguments.length == 2 && typeof arguments[1] == 'string')
-		return $.datepicker['_' + options + 'Datepicker'].
-			apply($.datepicker, [this[0]].concat(otherArgs));
-	return this.each(function() {
-		typeof options == 'string' ?
-			$.datepicker['_' + options + 'Datepicker'].
-				apply($.datepicker, [this].concat(otherArgs)) :
-			$.datepicker._attachDatepicker(this, options);
-	});
-};
-
-$.datepicker = new Datepicker(); // singleton instance
-$.datepicker.initialized = false;
-$.datepicker.uuid = new Date().getTime();
-$.datepicker.version = "@VERSION";
-
-// Workaround for #4055
-// Add another global to avoid noConflict issues with inline event handlers
-window.DP_jQuery = $;
-
-})(jQuery);
diff --git a/ui/ui.dialog.js b/ui/ui.dialog.js
deleted file mode 100644
index a84947194..000000000
--- a/ui/ui.dialog.js
+++ /dev/null
@@ -1,690 +0,0 @@
-/*
- * jQuery UI Dialog @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Dialog
- *
- * Depends:
- *	ui.core.js
- *	ui.draggable.js
- *	ui.position.js
- *	ui.resizable.js
- */
-(function($) {
-
-var setDataSwitch = {
-		maxHeight: "maxHeight.resizable",
-		maxWidth: "maxWidth.resizable",
-		minWidth: "minWidth.resizable"
-	},
-	
-	uiDialogClasses =
-		'ui-dialog ' +
-		'ui-widget ' +
-		'ui-widget-content ' +
-		'ui-corner-all ';
-
-$.widget("ui.dialog", {
-
-	_init: function() {
-		this.originalTitle = this.element.attr('title');
-
-		var self = this,
-			options = self.options,
-
-			title = options.title || self.originalTitle || '&nbsp;',
-			titleId = $.ui.dialog.getTitleId(self.element),
-
-			uiDialog = (self.uiDialog = $('<div></div>'))
-				.appendTo(document.body)
-				.hide()
-				.addClass(uiDialogClasses + options.dialogClass)
-				.css({
-					zIndex: options.zIndex
-				})
-				// setting tabIndex makes the div focusable
-				// setting outline to 0 prevents a border on focus in Mozilla
-				.attr('tabIndex', -1).css('outline', 0).keydown(function(event) {
-					(options.closeOnEscape && event.keyCode
-						&& event.keyCode == $.ui.keyCode.ESCAPE && self.close(event));
-				})
-				.attr({
-					role: 'dialog',
-					'aria-labelledby': titleId
-				})
-				.mousedown(function(event) {
-					self.moveToTop(false, event);
-				}),
-
-			uiDialogContent = self.element
-				.show()
-				.removeAttr('title')
-				.addClass(
-					'ui-dialog-content ' +
-					'ui-widget-content')
-				.appendTo(uiDialog),
-
-			uiDialogTitlebar = (self.uiDialogTitlebar = $('<div></div>'))
-				.addClass(
-					'ui-dialog-titlebar ' +
-					'ui-widget-header ' +
-					'ui-corner-all ' +
-					'ui-helper-clearfix'
-				)
-				.prependTo(uiDialog),
-
-			uiDialogTitlebarClose = $('<a href="#"></a>')
-				.addClass(
-					'ui-dialog-titlebar-close ' +
-					'ui-corner-all'
-				)
-				.attr('role', 'button')
-				.hover(
-					function() {
-						uiDialogTitlebarClose.addClass('ui-state-hover');
-					},
-					function() {
-						uiDialogTitlebarClose.removeClass('ui-state-hover');
-					}
-				)
-				.focus(function() {
-					uiDialogTitlebarClose.addClass('ui-state-focus');
-				})
-				.blur(function() {
-					uiDialogTitlebarClose.removeClass('ui-state-focus');
-				})
-				.mousedown(function(ev) {
-					ev.stopPropagation();
-				})
-				.click(function(event) {
-					self.close(event);
-					return false;
-				})
-				.appendTo(uiDialogTitlebar),
-
-			uiDialogTitlebarCloseText = (self.uiDialogTitlebarCloseText = $('<span></span>'))
-				.addClass(
-					'ui-icon ' +
-					'ui-icon-closethick'
-				)
-				.text(options.closeText)
-				.appendTo(uiDialogTitlebarClose),
-
-			uiDialogTitle = $('<span></span>')
-				.addClass('ui-dialog-title')
-				.attr('id', titleId)
-				.html(title)
-				.prependTo(uiDialogTitlebar);
-
-		uiDialogTitlebar.find("*").add(uiDialogTitlebar).disableSelection();
-
-		(options.draggable && $.fn.draggable && self._makeDraggable());
-		(options.resizable && $.fn.resizable && self._makeResizable());
-
-		self._createButtons(options.buttons);
-		self._isOpen = false;
-
-		(options.stackfix && $.fn.stackfix && uiDialog.stackfix());
-		(options.autoOpen && self.open());
-	},
-
-	destroy: function() {
-		var self = this;
-		
-		(self.overlay && self.overlay.destroy());
-		self.uiDialog.hide();
-		self.element
-			.unbind('.dialog')
-			.removeData('dialog')
-			.removeClass('ui-dialog-content ui-widget-content')
-			.hide().appendTo('body');
-		self.uiDialog.remove();
-
-		(self.originalTitle && self.element.attr('title', self.originalTitle));
-
-		return self;
-	},
-
-	close: function(event) {
-		var self = this;
-		
-		if (false === self._trigger('beforeClose', event)) {
-			return;
-		}
-
-		(self.overlay && self.overlay.destroy());
-		self.uiDialog.unbind('keypress.ui-dialog');
-
-		(self.options.hide
-			? self.uiDialog.hide(self.options.hide, function() {
-				self._trigger('close', event);
-			})
-			: self.uiDialog.hide() && self._trigger('close', event));
-
-		$.ui.dialog.overlay.resize();
-
-		self._isOpen = false;
-
-		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
-		if (self.options.modal) {
-			var maxZ = 0;
-			$('.ui-dialog').each(function() {
-				if (this != self.uiDialog[0]) {
-					maxZ = Math.max(maxZ, $(this).css('z-index'));
-				}
-			});
-			$.ui.dialog.maxZ = maxZ;
-		}
-
-		return self;
-	},
-
-	isOpen: function() {
-		return this._isOpen;
-	},
-
-	// the force parameter allows us to move modal dialogs to their correct
-	// position on open
-	moveToTop: function(force, event) {
-		var self = this,
-			options = self.options;
-		
-		if ((options.modal && !force)
-			|| (!options.stack && !options.modal)) {
-			return self._trigger('focus', event);
-		}
-		
-		if (options.zIndex > $.ui.dialog.maxZ) {
-			$.ui.dialog.maxZ = options.zIndex;
-		}
-		(self.overlay && self.overlay.$el.css('z-index', $.ui.dialog.overlay.maxZ = ++$.ui.dialog.maxZ));
-
-		//Save and then restore scroll since Opera 9.5+ resets when parent z-Index is changed.
-		//  http://ui.jquery.com/bugs/ticket/3193
-		var saveScroll = { scrollTop: self.element.attr('scrollTop'), scrollLeft: self.element.attr('scrollLeft') };
-		self.uiDialog.css('z-index', ++$.ui.dialog.maxZ);
-		self.element.attr(saveScroll);
-		self._trigger('focus', event);
-
-		return self;
-	},
-
-	open: function() {
-		if (this._isOpen) { return; }
-
-		var self = this,
-			options = self.options,
-			uiDialog = self.uiDialog;
-
-		self.overlay = options.modal ? new $.ui.dialog.overlay(self) : null;
-		(uiDialog.next().length && uiDialog.appendTo('body'));
-		self._size();
-		self._position(options.position);
-		uiDialog.show(options.show);
-		self.moveToTop(true);
-
-		// prevent tabbing out of modal dialogs
-		(options.modal && uiDialog.bind('keypress.ui-dialog', function(event) {
-			if (event.keyCode != $.ui.keyCode.TAB) {
-				return;
-			}
-
-			var tabbables = $(':tabbable', this),
-				first = tabbables.filter(':first'),
-				last  = tabbables.filter(':last');
-
-			if (event.target == last[0] && !event.shiftKey) {
-				first.focus(1);
-				return false;
-			} else if (event.target == first[0] && event.shiftKey) {
-				last.focus(1);
-				return false;
-			}
-		}));
-
-		// set focus to the first tabbable element in the content area or the first button
-		// if there are no tabbable elements, set focus on the dialog itself
-		$([])
-			.add(uiDialog.find('.ui-dialog-content :tabbable:first'))
-			.add(uiDialog.find('.ui-dialog-buttonpane :tabbable:first'))
-			.add(uiDialog)
-			.filter(':first')
-			.focus();
-
-		self._trigger('open');
-		self._isOpen = true;
-
-		return self;
-	},
-
-	_createButtons: function(buttons) {
-		var self = this,
-			hasButtons = false,
-			uiDialogButtonPane = $('<div></div>')
-				.addClass(
-					'ui-dialog-buttonpane ' +
-					'ui-widget-content ' +
-					'ui-helper-clearfix'
-				);
-
-		// if we already have a button pane, remove it
-		self.uiDialog.find('.ui-dialog-buttonpane').remove();
-
-		(typeof buttons == 'object' && buttons !== null &&
-			$.each(buttons, function() { return !(hasButtons = true); }));
-		if (hasButtons) {
-			$.each(buttons, function(name, fn) {
-				$('<button type="button"></button>')
-					.addClass(
-						'ui-state-default ' +
-						'ui-corner-all'
-					)
-					.text(name)
-					.click(function() { fn.apply(self.element[0], arguments); })
-					.hover(
-						function() {
-							$(this).addClass('ui-state-hover');
-						},
-						function() {
-							$(this).removeClass('ui-state-hover');
-						}
-					)
-					.focus(function() {
-						$(this).addClass('ui-state-focus');
-					})
-					.blur(function() {
-						$(this).removeClass('ui-state-focus');
-					})
-					.appendTo(uiDialogButtonPane);
-			});
-			uiDialogButtonPane.appendTo(self.uiDialog);
-		}
-	},
-
-	_makeDraggable: function() {
-		var self = this,
-			options = self.options,
-			doc = $(document),
-			heightBeforeDrag;
-
-		self.uiDialog.draggable({
-			cancel: '.ui-dialog-content',
-			handle: '.ui-dialog-titlebar',
-			containment: 'document',
-			start: function(event) {
-				heightBeforeDrag = options.height;
-				$(this).height($(this).height()).addClass("ui-dialog-dragging");
-				self._trigger('dragStart', event);
-			},
-			drag: function(event) {
-				self._trigger('drag', event);
-			},
-			stop: function(event, ui) {
-				options.position = [ui.position.left - doc.scrollLeft(),
-					ui.position.top - doc.scrollTop()];
-				$(this).removeClass("ui-dialog-dragging").height(heightBeforeDrag);
-				self._trigger('dragStop', event);
-				$.ui.dialog.overlay.resize();
-			}
-		});
-	},
-
-	_makeResizable: function(handles) {
-		handles = (handles === undefined ? this.options.resizable : handles);
-		var self = this,
-			options = self.options,
-			resizeHandles = typeof handles == 'string'
-				? handles
-				: 'n,e,s,w,se,sw,ne,nw';
-
-		self.uiDialog.resizable({
-			cancel: '.ui-dialog-content',
-			containment: 'document',
-			alsoResize: self.element,
-			maxWidth: options.maxWidth,
-			maxHeight: options.maxHeight,
-			minWidth: options.minWidth,
-			minHeight: self._minHeight(),
-			handles: resizeHandles,
-			start: function(event) {
-				$(this).addClass("ui-dialog-resizing");
-				self._trigger('resizeStart', event);
-			},
-			resize: function(event) {
-				self._trigger('resize', event);
-			},
-			stop: function(event) {
-				$(this).removeClass("ui-dialog-resizing");
-				options.height = $(this).height();
-				options.width = $(this).width();
-				self._trigger('resizeStop', event);
-				$.ui.dialog.overlay.resize();
-			}
-		})
-		.find('.ui-resizable-se').addClass('ui-icon ui-icon-grip-diagonal-se');
-	},
-
-	_minHeight: function() {
-		var options = this.options;
-
-		return (options.height == 'auto'
-			? options.minHeight
-			: Math.min(options.minHeight, options.height));
-	},
-
-	_position: function(position) {
-		var myAt = [],
-			offset = [0, 0];
-
-		// deep extending converts arrays to objects in jQuery <= 1.3.2 :-(
-//		if (typeof position == 'string' || $.isArray(position)) {
-//			myAt = $.isArray(position) ? position : position.split(' ');
-		if (typeof position == 'string' || '0' in position) {
-			myAt = position.split ? position.split(' ') : [position[0], position[1]];
-			if (myAt.length == 1) {
-				myAt[1] = myAt[0];
-			}
-
-			$.each(['left', 'top'], function(i, offsetPosition) {
-				if (+myAt[i] == myAt[i]) {
-					offset[i] = myAt[i];
-					myAt[i] = offsetPosition;
-				}
-			});
-		} else {
-			if ('left' in position) {
-				myAt[0] = 'left';
-				offset[0] = position.left;
-			} else if ('right' in position) {
-				myAt[0] = 'right';
-				offset[0] = -position.right;
-			}
-
-			if ('top' in position) {
-				myAt[1] = 'top';
-				offset[1] = position.top;
-			} else if ('bottom' in position) {
-				myAt[1] = 'bottom';
-				offset[1] = -position.bottom;
-			}
-		}
-
-		this.uiDialog.position({
-			my: myAt.join(' '),
-			at: myAt.join(' '),
-			offset: offset.join(' '),
-			of: window,
-			collision: 'fit'
-		});
-	},
-
-	_setData: function(key, value){
-		var self = this,
-			uiDialog = self.uiDialog,
-			resize = false;
-		
-		(setDataSwitch[key] && uiDialog.data(setDataSwitch[key], value));
-		switch (key) {
-			case "buttons":
-				self._createButtons(value);
-				break;
-			case "closeText":
-				// convert whatever was passed in o a string, for text() to not throw up
-				self.uiDialogTitlebarCloseText.text("" + value);
-				break;
-			case "dialogClass":
-				uiDialog
-					.removeClass(self.options.dialogClass)
-					.addClass(uiDialogClasses + value);
-				break;
-			case "draggable":
-				(value
-					? self._makeDraggable()
-					: uiDialog.draggable('destroy'));
-				break;
-			case "height":
-				resize = true;
-				break;
-			case "minHeight":
-				resize = true;
-				break;
-			case "position":
-				self._position(value);
-				break;
-			case "resizable":
-				var isResizable = uiDialog.is(':data(resizable)');
-
-				// currently resizable, becoming non-resizable
-				(isResizable && !value && uiDialog.resizable('destroy'));
-
-				// currently resizable, changing handles
-				(isResizable && typeof value == 'string' &&
-					uiDialog.resizable('option', 'handles', value));
-
-				// currently non-resizable, becoming resizable
-				(isResizable || (value !== false && self._makeResizable(value)));
-				break;
-			case "title":
-				$(".ui-dialog-title", self.uiDialogTitlebar).html(value || '&nbsp;');
-				break;
-			case "width":
-				resize = true;
-				break;
-		}
-
-		$.widget.prototype._setData.apply(self, arguments);
-		(resize && self._size());
-	},
-
-	_size: function() {
-		/* If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
-		 * divs will both have width and height set, so we need to reset them
-		 */
-		var options = this.options;
-
-		// reset content sizing
-		this.element.css({
-			height: 0,
-			minHeight: 0,
-			width: 'auto'
-		});
-
-		// reset wrapper sizing
-		// determine the height of all the non-content elements
-		var nonContentHeight = this.uiDialog.css({
-				height: 'auto',
-				width: options.width
-			})
-			.height();
-
-		this.element.css(options.height == 'auto'
-			? {
-				minHeight: Math.max(options.minHeight - nonContentHeight, 0),
-				height: 'auto'
-			}
-			: {
-				height: Math.max(options.height - nonContentHeight, 0)
-			});
-
-		(this.uiDialog.is(':data(resizable)') &&
-			this.uiDialog.resizable('option', 'minHeight', this._minHeight()));
-	}
-});
-
-$.extend($.ui.dialog, {
-	version: "@VERSION",
-	defaults: {
-		autoOpen: true,
-		stackfix: false,
-		buttons: {},
-		closeOnEscape: true,
-		closeText: 'close',
-		dialogClass: '',
-		draggable: true,
-		hide: null,
-		height: 'auto',
-		maxHeight: false,
-		maxWidth: false,
-		minHeight: 150,
-		minWidth: 150,
-		modal: false,
-		position: 'center',
-		resizable: true,
-		show: null,
-		stack: true,
-		title: '',
-		width: 300,
-		zIndex: 1000
-	},
-
-	uuid: 0,
-	maxZ: 0,
-
-	getTitleId: function($el) {
-		return 'ui-dialog-title-' + ($el.attr('id') || ++this.uuid);
-	},
-
-	overlay: function(dialog) {
-		this.$el = $.ui.dialog.overlay.create(dialog);
-	}
-});
-
-$.extend($.ui.dialog.overlay, {
-	instances: [],
-	maxZ: 0,
-	events: $.map('focus,mousedown,mouseup,keydown,keypress,click'.split(','),
-		function(event) { return event + '.dialog-overlay'; }).join(' '),
-	create: function(dialog) {
-		if (this.instances.length === 0) {
-			// prevent use of anchors and inputs
-			// we use a setTimeout in case the overlay is created from an
-			// event that we're going to be cancelling (see #2804)
-			setTimeout(function() {
-				// handle $(el).dialog().dialog('close') (see #4065)
-				if ($.ui.dialog.overlay.instances.length) {
-					$(document).bind($.ui.dialog.overlay.events, function(event) {
-						var dialogZ = $(event.target).parents('.ui-dialog').css('zIndex') || 0;
-						return (dialogZ > $.ui.dialog.overlay.maxZ);
-					});
-				}
-			}, 1);
-
-			// allow closing by pressing the escape key
-			$(document).bind('keydown.dialog-overlay', function(event) {
-				(dialog.options.closeOnEscape && event.keyCode
-						&& event.keyCode == $.ui.keyCode.ESCAPE && dialog.close(event));
-			});
-
-			// handle window resize
-			$(window).bind('resize.dialog-overlay', $.ui.dialog.overlay.resize);
-		}
-
-		var $el = $('<div></div>').appendTo(document.body)
-			.addClass('ui-widget-overlay').css({
-				width: this.width(),
-				height: this.height()
-			});
-
-		(dialog.options.stackfix && $.fn.stackfix && $el.stackfix());
-
-		this.instances.push($el);
-		return $el;
-	},
-
-	destroy: function($el) {
-		this.instances.splice($.inArray(this.instances, $el), 1);
-
-		if (this.instances.length === 0) {
-			$([document, window]).unbind('.dialog-overlay');
-		}
-
-		$el.remove();
-		
-		// adjust the maxZ to allow other modal dialogs to continue to work (see #4309)
-		var maxZ = 0;
-		$.each(this.instances, function() {
-			maxZ = Math.max(maxZ, this.css('z-index'));
-		});
-		this.maxZ = maxZ;
-	},
-
-	height: function() {
-		// handle IE 6
-		if ($.browser.msie && $.browser.version < 7) {
-			var scrollHeight = Math.max(
-				document.documentElement.scrollHeight,
-				document.body.scrollHeight
-			);
-			var offsetHeight = Math.max(
-				document.documentElement.offsetHeight,
-				document.body.offsetHeight
-			);
-
-			if (scrollHeight < offsetHeight) {
-				return $(window).height() + 'px';
-			} else {
-				return scrollHeight + 'px';
-			}
-		// handle "good" browsers
-		} else {
-			return $(document).height() + 'px';
-		}
-	},
-
-	width: function() {
-		// handle IE 6
-		if ($.browser.msie && $.browser.version < 7) {
-			var scrollWidth = Math.max(
-				document.documentElement.scrollWidth,
-				document.body.scrollWidth
-			);
-			var offsetWidth = Math.max(
-				document.documentElement.offsetWidth,
-				document.body.offsetWidth
-			);
-
-			if (scrollWidth < offsetWidth) {
-				return $(window).width() + 'px';
-			} else {
-				return scrollWidth + 'px';
-			}
-		// handle "good" browsers
-		} else {
-			return $(document).width() + 'px';
-		}
-	},
-
-	resize: function() {
-		/* If the dialog is draggable and the user drags it past the
-		 * right edge of the window, the document becomes wider so we
-		 * need to stretch the overlay. If the user then drags the
-		 * dialog back to the left, the document will become narrower,
-		 * so we need to shrink the overlay to the appropriate size.
-		 * This is handled by shrinking the overlay before setting it
-		 * to the full document size.
-		 */
-		var $overlays = $([]);
-		$.each($.ui.dialog.overlay.instances, function() {
-			$overlays = $overlays.add(this);
-		});
-
-		$overlays.css({
-			width: 0,
-			height: 0
-		}).css({
-			width: $.ui.dialog.overlay.width(),
-			height: $.ui.dialog.overlay.height()
-		});
-	}
-});
-
-$.extend($.ui.dialog.overlay.prototype, {
-	destroy: function() {
-		$.ui.dialog.overlay.destroy(this.$el);
-	}
-});
-
-})(jQuery);
diff --git a/ui/ui.draggable.js b/ui/ui.draggable.js
deleted file mode 100644
index b5e37502b..000000000
--- a/ui/ui.draggable.js
+++ /dev/null
@@ -1,784 +0,0 @@
-/*
- * jQuery UI Draggable @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Draggables
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.draggable", $.extend({}, $.ui.mouse, {
-
-	_init: function() {
-
-		if (this.options.helper == 'original' && !(/^(?:r|a|f)/).test(this.element.css("position")))
-			this.element[0].style.position = 'relative';
-
-		(this.options.addClasses && this.element.addClass("ui-draggable"));
-		(this.options.disabled && this.element.addClass("ui-draggable-disabled"));
-
-		this._mouseInit();
-
-	},
-
-	destroy: function() {
-		if(!this.element.data('draggable')) return;
-		this.element
-			.removeData("draggable")
-			.unbind(".draggable")
-			.removeClass("ui-draggable"
-				+ " ui-draggable-dragging"
-				+ " ui-draggable-disabled");
-		this._mouseDestroy();
-
-		return this;
-	},
-
-	_mouseCapture: function(event) {
-
-		var o = this.options;
-
-		// among others, prevent a drag on a resizable-handle
-		if (this.helper || o.disabled || $(event.target).is('.ui-resizable-handle'))
-			return false;
-
-		//Quit if we're not on a valid handle
-		this.handle = this._getHandle(event);
-		if (!this.handle)
-			return false;
-
-		return true;
-
-	},
-
-	_mouseStart: function(event) {
-
-		var o = this.options;
-
-		//Create and append the visible helper
-		this.helper = this._createHelper(event);
-
-		//Cache the helper size
-		this._cacheHelperProportions();
-
-		//If ddmanager is used for droppables, set the global draggable
-		if($.ui.ddmanager)
-			$.ui.ddmanager.current = this;
-
-		/*
-		 * - Position generation -
-		 * This block generates everything position related - it's the core of draggables.
-		 */
-
-		//Cache the margins of the original element
-		this._cacheMargins();
-
-		//Store the helper's css position
-		this.cssPosition = this.helper.css("position");
-		this.scrollParent = this.helper.scrollParent();
-
-		//The element's absolute position on the page minus margins
-		this.offset = this.positionAbs = this.element.offset();
-		this.offset = {
-			top: this.offset.top - this.margins.top,
-			left: this.offset.left - this.margins.left
-		};
-
-		$.extend(this.offset, {
-			click: { //Where the click happened, relative to the element
-				left: event.pageX - this.offset.left,
-				top: event.pageY - this.offset.top
-			},
-			parent: this._getParentOffset(),
-			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
-		});
-
-		//Generate the original position
-		this.originalPosition = this.position = this._generatePosition(event);
-		this.originalPageX = event.pageX;
-		this.originalPageY = event.pageY;
-
-		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
-		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
-
-		//Set a containment if given in the options
-		if(o.containment)
-			this._setContainment();
-
-		//Call plugins and callbacks
-		this._trigger("start", event);
-
-		//Recache the helper size
-		this._cacheHelperProportions();
-
-		//Prepare the droppable offsets
-		if ($.ui.ddmanager && !o.dropBehaviour)
-			$.ui.ddmanager.prepareOffsets(this, event);
-
-		this.helper.addClass("ui-draggable-dragging");
-		this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position
-		return true;
-	},
-
-	_mouseDrag: function(event, noPropagation) {
-
-		//Compute the helpers position
-		this.position = this._generatePosition(event);
-		this.positionAbs = this._convertPositionTo("absolute");
-
-		//Call plugins and callbacks and use the resulting position if something is returned
-		if (!noPropagation) {
-			var ui = this._uiHash();
-			this._trigger('drag', event, ui);
-			this.position = ui.position;
-		}
-
-		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
-		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
-		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
-		return false;
-	},
-
-	_mouseStop: function(event) {
-
-		//If we are using droppables, inform the manager about the drop
-		var dropped = false;
-		if ($.ui.ddmanager && !this.options.dropBehaviour)
-			dropped = $.ui.ddmanager.drop(this, event);
-
-		//if a drop comes from outside (a sortable)
-		if(this.dropped) {
-			dropped = this.dropped;
-			this.dropped = false;
-		}
-		
-		//if the original element is removed, don't bother to continue
-		if(!this.element[0] || !this.element[0].parentNode)
-			return false;
-
-		if((this.options.revert == "invalid" && !dropped) || (this.options.revert == "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) {
-			var self = this;
-			$(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() {
-				self._trigger("stop", event);
-				self._clear();
-			});
-		} else {
-			this._trigger("stop", event);
-			this._clear();
-		}
-
-		return false;
-	},
-
-	_getHandle: function(event) {
-
-		var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false;
-		$(this.options.handle, this.element)
-			.find("*")
-			.andSelf()
-			.each(function() {
-				if(this == event.target) handle = true;
-			});
-
-		return handle;
-
-	},
-
-	_createHelper: function(event) {
-
-		var o = this.options;
-		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper == 'clone' ? this.element.clone() : this.element);
-
-		if(!helper.parents('body').length)
-			helper.appendTo((o.appendTo == 'parent' ? this.element[0].parentNode : o.appendTo));
-
-		if(helper[0] != this.element[0] && !(/(fixed|absolute)/).test(helper.css("position")))
-			helper.css("position", "absolute");
-
-		return helper;
-
-	},
-
-	_adjustOffsetFromHelper: function(obj) {
-		if (typeof obj == 'string') {
-			obj = obj.split(' ');
-		}
-		if ($.isArray(obj)) {
-			obj = {left: +obj[0], top: +obj[1] || 0};
-		}
-		if ('left' in obj) {
-			this.offset.click.left = obj.left + this.margins.left;
-		}
-		if ('right' in obj) {
-			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
-		}
-		if ('top' in obj) {
-			this.offset.click.top = obj.top + this.margins.top;
-		}
-		if ('bottom' in obj) {
-			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
-		}
-	},
-
-	_getParentOffset: function() {
-
-		//Get the offsetParent and cache its position
-		this.offsetParent = this.helper.offsetParent();
-		var po = this.offsetParent.offset();
-
-		// This is a special case where we need to modify a offset calculated on start, since the following happened:
-		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
-		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
-		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
-		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
-			po.left += this.scrollParent.scrollLeft();
-			po.top += this.scrollParent.scrollTop();
-		}
-
-		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
-		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
-			po = { top: 0, left: 0 };
-
-		return {
-			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
-			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
-		};
-
-	},
-
-	_getRelativeOffset: function() {
-
-		if(this.cssPosition == "relative") {
-			var p = this.element.position();
-			return {
-				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
-				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
-			};
-		} else {
-			return { top: 0, left: 0 };
-		}
-
-	},
-
-	_cacheMargins: function() {
-		this.margins = {
-			left: (parseInt(this.element.css("marginLeft"),10) || 0),
-			top: (parseInt(this.element.css("marginTop"),10) || 0)
-		};
-	},
-
-	_cacheHelperProportions: function() {
-		this.helperProportions = {
-			width: this.helper.outerWidth(),
-			height: this.helper.outerHeight()
-		};
-	},
-
-	_setContainment: function() {
-
-		var o = this.options;
-		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
-		if(o.containment == 'document' || o.containment == 'window') this.containment = [
-			0 - this.offset.relative.left - this.offset.parent.left,
-			0 - this.offset.relative.top - this.offset.parent.top,
-			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
-			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
-		];
-
-		if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor != Array) {
-			var ce = $(o.containment)[0]; if(!ce) return;
-			var co = $(o.containment).offset();
-			var over = ($(ce).css("overflow") != 'hidden');
-
-			this.containment = [
-				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
-				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
-				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
-				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
-			];
-		} else if(o.containment.constructor == Array) {
-			this.containment = o.containment;
-		}
-
-	},
-
-	_convertPositionTo: function(d, pos) {
-
-		if(!pos) pos = this.position;
-		var mod = d == "absolute" ? 1 : -1;
-		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
-		return {
-			top: (
-				pos.top																	// The absolute mouse position
-				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
-				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
-			),
-			left: (
-				pos.left																// The absolute mouse position
-				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
-				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
-			)
-		};
-
-	},
-
-	_generatePosition: function(event) {
-
-		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
-		// This is another very weird special case that only happens for relative elements:
-		// 1. If the css position is relative
-		// 2. and the scroll parent is the document or similar to the offset parent
-		// we have to refresh the relative offset during the scroll so there are no jumps
-		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
-			this.offset.relative = this._getRelativeOffset();
-		}
-
-		var pageX = event.pageX;
-		var pageY = event.pageY;
-
-		/*
-		 * - Position constraining -
-		 * Constrain the position to a mix of grid, containment.
-		 */
-
-		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
-			if(this.containment) {
-				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
-				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
-				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
-				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
-			}
-
-			if(o.grid) {
-				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
-				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
-				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
-				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
-			}
-
-		}
-
-		return {
-			top: (
-				pageY																// The absolute mouse position
-				- this.offset.click.top													// Click offset (relative to the element)
-				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
-				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
-				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
-			),
-			left: (
-				pageX																// The absolute mouse position
-				- this.offset.click.left												// Click offset (relative to the element)
-				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
-				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
-				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
-			)
-		};
-
-	},
-
-	_clear: function() {
-		this.helper.removeClass("ui-draggable-dragging");
-		if(this.helper[0] != this.element[0] && !this.cancelHelperRemoval) this.helper.remove();
-		//if($.ui.ddmanager) $.ui.ddmanager.current = null;
-		this.helper = null;
-		this.cancelHelperRemoval = false;
-	},
-
-	// From now on bulk stuff - mainly helpers
-
-	_trigger: function(type, event, ui) {
-		ui = ui || this._uiHash();
-		$.ui.plugin.call(this, type, [event, ui]);
-		if(type == "drag") this.positionAbs = this._convertPositionTo("absolute"); //The absolute position has to be recalculated after plugins
-		return $.widget.prototype._trigger.call(this, type, event, ui);
-	},
-
-	plugins: {},
-
-	_uiHash: function(event) {
-		return {
-			helper: this.helper,
-			position: this.position,
-			originalPosition: this.originalPosition,
-			offset: this.positionAbs
-		};
-	}
-
-}));
-
-$.extend($.ui.draggable, {
-	version: "@VERSION",
-	eventPrefix: "drag",
-	defaults: $.extend({}, $.ui.mouse.defaults, {
-		addClasses: true,
-		appendTo: "parent",
-		axis: false,
-		connectToSortable: false,
-		containment: false,
-		cursor: "auto",
-		cursorAt: false,
-		grid: false,
-		handle: false,
-		helper: "original",
-		iframeFix: false,
-		opacity: false,
-		refreshPositions: false,
-		revert: false,
-		revertDuration: 500,
-		scope: "default",
-		scroll: true,
-		scrollSensitivity: 20,
-		scrollSpeed: 20,
-		snap: false,
-		snapMode: "both",
-		snapTolerance: 20,
-		stack: false,
-		zIndex: false
-	})
-});
-
-$.ui.plugin.add("draggable", "connectToSortable", {
-	start: function(event, ui) {
-
-		var inst = $(this).data("draggable"), o = inst.options,
-			uiSortable = $.extend({}, ui, { item: inst.element });
-		inst.sortables = [];
-		$(o.connectToSortable).each(function() {
-			var sortable = $.data(this, 'sortable');
-			if (sortable && !sortable.options.disabled) {
-				inst.sortables.push({
-					instance: sortable,
-					shouldRevert: sortable.options.revert
-				});
-				sortable._refreshItems();	//Do a one-time refresh at start to refresh the containerCache
-				sortable._trigger("activate", event, uiSortable);
-			}
-		});
-
-	},
-	stop: function(event, ui) {
-
-		//If we are still over the sortable, we fake the stop event of the sortable, but also remove helper
-		var inst = $(this).data("draggable"),
-			uiSortable = $.extend({}, ui, { item: inst.element });
-
-		$.each(inst.sortables, function() {
-			if(this.instance.isOver) {
-
-				this.instance.isOver = 0;
-
-				inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance
-				this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work)
-
-				//The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: 'valid/invalid'
-				if(this.shouldRevert) this.instance.options.revert = true;
-
-				//Trigger the stop of the sortable
-				this.instance._mouseStop(event);
-
-				this.instance.options.helper = this.instance.options._helper;
-
-				//If the helper has been the original item, restore properties in the sortable
-				if(inst.options.helper == 'original')
-					this.instance.currentItem.css({ top: 'auto', left: 'auto' });
-
-			} else {
-				this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance
-				this.instance._trigger("deactivate", event, uiSortable);
-			}
-
-		});
-
-	},
-	drag: function(event, ui) {
-
-		var inst = $(this).data("draggable"), self = this;
-
-		var checkPos = function(o) {
-			var dyClick = this.offset.click.top, dxClick = this.offset.click.left;
-			var helperTop = this.positionAbs.top, helperLeft = this.positionAbs.left;
-			var itemHeight = o.height, itemWidth = o.width;
-			var itemTop = o.top, itemLeft = o.left;
-
-			return $.ui.isOver(helperTop + dyClick, helperLeft + dxClick, itemTop, itemLeft, itemHeight, itemWidth);
-		};
-
-		$.each(inst.sortables, function(i) {
-			
-			//Copy over some variables to allow calling the sortable's native _intersectsWith
-			this.instance.positionAbs = inst.positionAbs;
-			this.instance.helperProportions = inst.helperProportions;
-			this.instance.offset.click = inst.offset.click;
-			
-			if(this.instance._intersectsWith(this.instance.containerCache)) {
-
-				//If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once
-				if(!this.instance.isOver) {
-
-					this.instance.isOver = 1;
-					//Now we fake the start of dragging for the sortable instance,
-					//by cloning the list group item, appending it to the sortable and using it as inst.currentItem
-					//We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one)
-					this.instance.currentItem = $(self).clone().appendTo(this.instance.element).data("sortable-item", true);
-					this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it
-					this.instance.options.helper = function() { return ui.helper[0]; };
-
-					event.target = this.instance.currentItem[0];
-					this.instance._mouseCapture(event, true);
-					this.instance._mouseStart(event, true, true);
-
-					//Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes
-					this.instance.offset.click.top = inst.offset.click.top;
-					this.instance.offset.click.left = inst.offset.click.left;
-					this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left;
-					this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top;
-
-					inst._trigger("toSortable", event);
-					inst.dropped = this.instance.element; //draggable revert needs that
-					//hack so receive/update callbacks work (mostly)
-					inst.currentItem = inst.element;
-					this.instance.fromOutside = inst;
-
-				}
-
-				//Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable
-				if(this.instance.currentItem) this.instance._mouseDrag(event);
-
-			} else {
-
-				//If it doesn't intersect with the sortable, and it intersected before,
-				//we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval
-				if(this.instance.isOver) {
-
-					this.instance.isOver = 0;
-					this.instance.cancelHelperRemoval = true;
-					
-					//Prevent reverting on this forced stop
-					this.instance.options.revert = false;
-					
-					// The out event needs to be triggered independently
-					this.instance._trigger('out', event, this.instance._uiHash(this.instance));
-					
-					this.instance._mouseStop(event, true);
-					this.instance.options.helper = this.instance.options._helper;
-
-					//Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size
-					this.instance.currentItem.remove();
-					if(this.instance.placeholder) this.instance.placeholder.remove();
-
-					inst._trigger("fromSortable", event);
-					inst.dropped = false; //draggable revert needs that
-				}
-
-			};
-
-		});
-
-	}
-});
-
-$.ui.plugin.add("draggable", "cursor", {
-	start: function(event, ui) {
-		var t = $('body'), o = $(this).data('draggable').options;
-		if (t.css("cursor")) o._cursor = t.css("cursor");
-		t.css("cursor", o.cursor);
-	},
-	stop: function(event, ui) {
-		var o = $(this).data('draggable').options;
-		if (o._cursor) $('body').css("cursor", o._cursor);
-	}
-});
-
-$.ui.plugin.add("draggable", "iframeFix", {
-	start: function(event, ui) {
-		var o = $(this).data('draggable').options;
-		$(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() {
-			$('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>')
-			.css({
-				width: this.offsetWidth+"px", height: this.offsetHeight+"px",
-				position: "absolute", opacity: "0.001", zIndex: 1000
-			})
-			.css($(this).offset())
-			.appendTo("body");
-		});
-	},
-	stop: function(event, ui) {
-		$("div.ui-draggable-iframeFix").each(function() { this.parentNode.removeChild(this); }); //Remove frame helpers
-	}
-});
-
-$.ui.plugin.add("draggable", "opacity", {
-	start: function(event, ui) {
-		var t = $(ui.helper), o = $(this).data('draggable').options;
-		if(t.css("opacity")) o._opacity = t.css("opacity");
-		t.css('opacity', o.opacity);
-	},
-	stop: function(event, ui) {
-		var o = $(this).data('draggable').options;
-		if(o._opacity) $(ui.helper).css('opacity', o._opacity);
-	}
-});
-
-$.ui.plugin.add("draggable", "scroll", {
-	start: function(event, ui) {
-		var i = $(this).data("draggable");
-		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') i.overflowOffset = i.scrollParent.offset();
-	},
-	drag: function(event, ui) {
-
-		var i = $(this).data("draggable"), o = i.options, scrolled = false;
-
-		if(i.scrollParent[0] != document && i.scrollParent[0].tagName != 'HTML') {
-
-			if(!o.axis || o.axis != 'x') {
-				if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
-					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed;
-				else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity)
-					i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed;
-			}
-
-			if(!o.axis || o.axis != 'y') {
-				if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
-					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed;
-				else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity)
-					i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed;
-			}
-
-		} else {
-
-			if(!o.axis || o.axis != 'x') {
-				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
-					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
-				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
-					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
-			}
-
-			if(!o.axis || o.axis != 'y') {
-				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
-					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
-				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
-					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
-			}
-
-		}
-
-		if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
-			$.ui.ddmanager.prepareOffsets(i, event);
-
-	}
-});
-
-$.ui.plugin.add("draggable", "snap", {
-	start: function(event, ui) {
-
-		var i = $(this).data("draggable"), o = i.options;
-		i.snapElements = [];
-
-		$(o.snap.constructor != String ? ( o.snap.items || ':data(draggable)' ) : o.snap).each(function() {
-			var $t = $(this); var $o = $t.offset();
-			if(this != i.element[0]) i.snapElements.push({
-				item: this,
-				width: $t.outerWidth(), height: $t.outerHeight(),
-				top: $o.top, left: $o.left
-			});
-		});
-
-	},
-	drag: function(event, ui) {
-
-		var inst = $(this).data("draggable"), o = inst.options;
-		var d = o.snapTolerance;
-
-		var x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width,
-			y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height;
-
-		for (var i = inst.snapElements.length - 1; i >= 0; i--){
-
-			var l = inst.snapElements[i].left, r = l + inst.snapElements[i].width,
-				t = inst.snapElements[i].top, b = t + inst.snapElements[i].height;
-
-			//Yes, I know, this is insane ;)
-			if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) {
-				if(inst.snapElements[i].snapping) (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
-				inst.snapElements[i].snapping = false;
-				continue;
-			}
-
-			if(o.snapMode != 'inner') {
-				var ts = Math.abs(t - y2) <= d;
-				var bs = Math.abs(b - y1) <= d;
-				var ls = Math.abs(l - x2) <= d;
-				var rs = Math.abs(r - x1) <= d;
-				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
-				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top;
-				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left;
-				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left;
-			}
-
-			var first = (ts || bs || ls || rs);
-
-			if(o.snapMode != 'outer') {
-				var ts = Math.abs(t - y1) <= d;
-				var bs = Math.abs(b - y2) <= d;
-				var ls = Math.abs(l - x1) <= d;
-				var rs = Math.abs(r - x2) <= d;
-				if(ts) ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top;
-				if(bs) ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top;
-				if(ls) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left;
-				if(rs) ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left;
-			}
-
-			if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first))
-				(inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })));
-			inst.snapElements[i].snapping = (ts || bs || ls || rs || first);
-
-		};
-
-	}
-});
-
-$.ui.plugin.add("draggable", "stack", {
-	start: function(event, ui) {
-
-		var o = $(this).data("draggable").options;
-
-		var group = $.makeArray($(o.stack)).sort(function(a,b) {
-			return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0);
-		});
-		
-		var min = parseInt(group[0].style.zIndex) || 0;
-		$(group).each(function(i) {
-			this.style.zIndex = min + i;
-		});
-
-		this[0].style.zIndex = min + group.length;
-
-	}
-});
-
-$.ui.plugin.add("draggable", "zIndex", {
-	start: function(event, ui) {
-		var t = $(ui.helper), o = $(this).data("draggable").options;
-		if(t.css("zIndex")) o._zIndex = t.css("zIndex");
-		t.css('zIndex', o.zIndex);
-	},
-	stop: function(event, ui) {
-		var o = $(this).data("draggable").options;
-		if(o._zIndex) $(ui.helper).css('zIndex', o._zIndex);
-	}
-});
-
-})(jQuery);
diff --git a/ui/ui.droppable.js b/ui/ui.droppable.js
deleted file mode 100644
index 4c359799c..000000000
--- a/ui/ui.droppable.js
+++ /dev/null
@@ -1,284 +0,0 @@
-/*
- * jQuery UI Droppable @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Droppables
- *
- * Depends:
- *	ui.core.js
- *	ui.draggable.js
- */
-(function($) {
-
-$.widget("ui.droppable", {
-
-	_init: function() {
-
-		var o = this.options, accept = o.accept;
-		this.isover = 0; this.isout = 1;
-
-		this.accept = $.isFunction(accept) ? accept : function(d) {
-			return d.is(accept);
-		};
-
-		//Store the droppable's proportions
-		this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight };
-
-		// Add the reference and positions to the manager
-		$.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || [];
-		$.ui.ddmanager.droppables[o.scope].push(this);
-
-		(o.addClasses && this.element.addClass("ui-droppable"));
-
-	},
-
-	destroy: function() {
-		var drop = $.ui.ddmanager.droppables[this.options.scope];
-		for ( var i = 0; i < drop.length; i++ )
-			if ( drop[i] == this )
-				drop.splice(i, 1);
-
-		this.element
-			.removeClass("ui-droppable ui-droppable-disabled")
-			.removeData("droppable")
-			.unbind(".droppable");
-
-		return this;
-	},
-
-	_setData: function(key, value) {
-
-		if(key == 'accept') {
-			this.accept = $.isFunction(value) ? value : function(d) {
-				return d.is(value);
-			};
-		}
-		$.widget.prototype._setData.apply(this, arguments);
-	},
-
-	_activate: function(event) {
-		var draggable = $.ui.ddmanager.current;
-		if(this.options.activeClass) this.element.addClass(this.options.activeClass);
-		(draggable && this._trigger('activate', event, this.ui(draggable)));
-	},
-
-	_deactivate: function(event) {
-		var draggable = $.ui.ddmanager.current;
-		if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
-		(draggable && this._trigger('deactivate', event, this.ui(draggable)));
-	},
-
-	_over: function(event) {
-
-		var draggable = $.ui.ddmanager.current;
-		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
-		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-			if(this.options.hoverClass) this.element.addClass(this.options.hoverClass);
-			this._trigger('over', event, this.ui(draggable));
-		}
-
-	},
-
-	_out: function(event) {
-
-		var draggable = $.ui.ddmanager.current;
-		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return; // Bail if draggable and droppable are same element
-
-		if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
-			this._trigger('out', event, this.ui(draggable));
-		}
-
-	},
-
-	_drop: function(event,custom) {
-
-		var draggable = custom || $.ui.ddmanager.current;
-		if (!draggable || (draggable.currentItem || draggable.element)[0] == this.element[0]) return false; // Bail if draggable and droppable are same element
-
-		var childrenIntersection = false;
-		this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function() {
-			var inst = $.data(this, 'droppable');
-			if(
-				inst.options.greedy
-				&& !inst.options.disabled
-				&& inst.options.scope == draggable.options.scope
-				&& inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element))
-				&& $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance)
-			) { childrenIntersection = true; return false; }
-		});
-		if(childrenIntersection) return false;
-
-		if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-			if(this.options.activeClass) this.element.removeClass(this.options.activeClass);
-			if(this.options.hoverClass) this.element.removeClass(this.options.hoverClass);
-			this._trigger('drop', event, this.ui(draggable));
-			return this.element;
-		}
-
-		return false;
-
-	},
-
-	ui: function(c) {
-		return {
-			draggable: (c.currentItem || c.element),
-			helper: c.helper,
-			position: c.position,
-			offset: c.positionAbs
-		};
-	}
-
-});
-
-$.extend($.ui.droppable, {
-	version: "@VERSION",
-	eventPrefix: 'drop',
-	defaults: {
-		accept: '*',
-		activeClass: false,
-		addClasses: true,
-		greedy: false,
-		hoverClass: false,
-		scope: 'default',
-		tolerance: 'intersect'
-	}
-});
-
-$.ui.intersect = function(draggable, droppable, toleranceMode) {
-
-	if (!droppable.offset) return false;
-
-	var x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width,
-		y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height;
-	var l = droppable.offset.left, r = l + droppable.proportions.width,
-		t = droppable.offset.top, b = t + droppable.proportions.height;
-
-	switch (toleranceMode) {
-		case 'fit':
-			return (l < x1 && x2 < r
-				&& t < y1 && y2 < b);
-			break;
-		case 'intersect':
-			return (l < x1 + (draggable.helperProportions.width / 2) // Right Half
-				&& x2 - (draggable.helperProportions.width / 2) < r // Left Half
-				&& t < y1 + (draggable.helperProportions.height / 2) // Bottom Half
-				&& y2 - (draggable.helperProportions.height / 2) < b ); // Top Half
-			break;
-		case 'pointer':
-			var draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left),
-				draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top),
-				isOver = $.ui.isOver(draggableTop, draggableLeft, t, l, droppable.proportions.height, droppable.proportions.width);
-			return isOver;
-			break;
-		case 'touch':
-			return (
-					(y1 >= t && y1 <= b) ||	// Top edge touching
-					(y2 >= t && y2 <= b) ||	// Bottom edge touching
-					(y1 < t && y2 > b)		// Surrounded vertically
-				) && (
-					(x1 >= l && x1 <= r) ||	// Left edge touching
-					(x2 >= l && x2 <= r) ||	// Right edge touching
-					(x1 < l && x2 > r)		// Surrounded horizontally
-				);
-			break;
-		default:
-			return false;
-			break;
-		}
-
-};
-
-/*
-	This manager tracks offsets of draggables and droppables
-*/
-$.ui.ddmanager = {
-	current: null,
-	droppables: { 'default': [] },
-	prepareOffsets: function(t, event) {
-
-		var m = $.ui.ddmanager.droppables[t.options.scope] || [];
-		var type = event ? event.type : null; // workaround for #2317
-		var list = (t.currentItem || t.element).find(":data(droppable)").andSelf();
-
-		droppablesLoop: for (var i = 0; i < m.length; i++) {
-
-			if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) continue;	//No disabled and non-accepted
-			for (var j=0; j < list.length; j++) { if(list[j] == m[i].element[0]) { m[i].proportions.height = 0; continue droppablesLoop; } }; //Filter out elements in the current dragged item
-			m[i].visible = m[i].element.css("display") != "none"; if(!m[i].visible) continue; 									//If the element is not visible, continue
-
-			m[i].offset = m[i].element.offset();
-			m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight };
-
-			if(type == "mousedown") m[i]._activate.call(m[i], event); //Activate the droppable if used directly from draggables
-
-		}
-
-	},
-	drop: function(draggable, event) {
-
-		var dropped = false;
-		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
-
-			if(!this.options) return;
-			if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance))
-				dropped = this._drop.call(this, event);
-
-			if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) {
-				this.isout = 1; this.isover = 0;
-				this._deactivate.call(this, event);
-			}
-
-		});
-		return dropped;
-
-	},
-	drag: function(draggable, event) {
-
-		//If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse.
-		if(draggable.options.refreshPositions) $.ui.ddmanager.prepareOffsets(draggable, event);
-
-		//Run through all droppables and check their positions based on specific tolerance options
-		$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() {
-
-			if(this.options.disabled || this.greedyChild || !this.visible) return;
-			var intersects = $.ui.intersect(draggable, this, this.options.tolerance);
-
-			var c = !intersects && this.isover == 1 ? 'isout' : (intersects && this.isover == 0 ? 'isover' : null);
-			if(!c) return;
-
-			var parentInstance;
-			if (this.options.greedy) {
-				var parent = this.element.parents(':data(droppable):eq(0)');
-				if (parent.length) {
-					parentInstance = $.data(parent[0], 'droppable');
-					parentInstance.greedyChild = (c == 'isover' ? 1 : 0);
-				}
-			}
-
-			// we just moved into a greedy child
-			if (parentInstance && c == 'isover') {
-				parentInstance['isover'] = 0;
-				parentInstance['isout'] = 1;
-				parentInstance._out.call(parentInstance, event);
-			}
-
-			this[c] = 1; this[c == 'isout' ? 'isover' : 'isout'] = 0;
-			this[c == "isover" ? "_over" : "_out"].call(this, event);
-
-			// we just moved out of a greedy child
-			if (parentInstance && c == 'isout') {
-				parentInstance['isout'] = 0;
-				parentInstance['isover'] = 1;
-				parentInstance._over.call(parentInstance, event);
-			}
-		});
-
-	}
-};
-
-})(jQuery);
diff --git a/ui/ui.position.js b/ui/ui.position.js
deleted file mode 100644
index 6c5250959..000000000
--- a/ui/ui.position.js
+++ /dev/null
@@ -1,227 +0,0 @@
-/*
- * jQuery UI Position @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Position
- */
-(function($) {
-
-$.ui = $.ui || {};
-
-var horizontalPositions = /left|center|right/,
-	horizontalDefault = 'center',
-	verticalPositions = /top|center|bottom/,
-	verticalDefault = 'center',
-	_position = $.fn.position;
-
-$.fn.position = function(options) {
-	if (!options || !options.of) {
-		return _position.apply(this, arguments);
-	}
-
-	var target = $(options.of),
-		collision = (options.collision || 'flip').split(' '),
-		offset = options.offset ? options.offset.split(' ') : [0, 0],
-		targetWidth,
-		targetHeight,
-		basePosition;
-
-	if (options.of == document) {
-		targetWidth = target.width();
-		targetHeight = target.height();
-		basePosition = { top: 0, left: 0 };
-	} else if (options.of == window) {
-		targetWidth = target.width();
-		targetHeight = target.height();
-		basePosition = { top: target.scrollTop(), left: target.scrollLeft() };
-	} else if (options.of.preventDefault) {
-		// force left top to allow flipping
-		options.at = 'left top';
-		targetWidth = targetHeight = 0;
-		basePosition = { top: options.of.pageY, left: options.of.pageX };
-	} else {
-		targetWidth = target.outerWidth();
-		targetHeight = target.outerHeight();
-		basePosition = target.offset();
-	}
-
-	// force my and at to have valid horizontal and veritcal positions
-	// if a value is missing or invalid, it will be converted to center 
-	$.each(['my', 'at'], function() {
-		var pos = (options[this] || '').split(' ');
-		pos = pos.length == 1
-			? horizontalPositions.test(pos[0])
-				? pos.concat([verticalDefault])
-				: verticalPositions.test(pos[0])
-					? [horizontalDefault].concat(pos)
-					: [horizontalDefault, verticalDefault]
-			: pos;
-		pos[0] = horizontalPositions.test(pos[0]) ? pos[0] : horizontalDefault;
-		pos[1] = verticalPositions.test(pos[1]) ? pos[1] : verticalDefault;
-		options[this] = pos;
-	});
-
-	// normalize collision option
-	if (collision.length == 1) {
-		collision[1] = collision[0];
-	}
-
-	// normalize offset option
-	offset[0] = parseInt(offset[0], 10) || 0;
-	if (offset.length == 1) {
-		offset[1] = offset[0];
-	}
-	offset[1] = parseInt(offset[1], 10) || 0;
-
-	switch (options.at[0]) {
-		case 'right':
-			basePosition.left += targetWidth;
-			break;
-		case horizontalDefault:
-			basePosition.left += targetWidth / 2;
-			break;
-	}
-
-	switch (options.at[1]) {
-		case 'bottom':
-			basePosition.top += targetHeight;
-			break;
-		case verticalDefault:
-			basePosition.top += targetHeight / 2;
-			break;
-	}
-
-	basePosition.left += offset[0];
-	basePosition.top += offset[1];
-
-	return this.each(function() {
-		var elem = $(this),
-			elemWidth = elem.outerWidth(),
-			elemHeight = elem.outerHeight(),
-			position = $.extend({}, basePosition),
-			over,
-			myOffset,
-			atOffset;
-
-		switch (options.my[0]) {
-			case 'right':
-				position.left -= elemWidth;
-				break;
-			case horizontalDefault:
-				position.left -= elemWidth / 2;
-				break;
-		}
-
-		switch (options.my[1]) {
-			case 'bottom':
-				position.top -= elemHeight;
-				break;
-			case verticalDefault:
-				position.top -= elemHeight / 2;
-				break;
-		}
-
-		$.each(['left', 'top'], function(i, dir) {
-			($.ui.position[collision[i]] &&
-				$.ui.position[collision[i]][dir](position, {
-					targetWidth: targetWidth,
-					targetHeight: targetHeight,
-					elemWidth: elemWidth,
-					elemHeight: elemHeight,
-					offset: offset,
-					my: options.my,
-					at: options.at
-				}));
-		});
-
-		(options.stackfix !== false && $.fn.stackfix && elem.stackfix());
-		// the by function is passed the offset values, not the position values
-		// we'll need the logic from the .offset() setter to be accessible for
-		// us to calculate the position values to make the by option more useful
-		($.isFunction(options.by) ? options.by.call(this, position) : elem.offset(position));
-	});
-};
-
-$.ui.position = {
-	fit: {
-		left: function(position, data) {
-			var over = position.left + data.elemWidth - $(window).width() - $(window).scrollLeft();
-			position.left = over > 0 ? position.left - over : Math.max(0, position.left);
-		},
-		top: function(position, data) {
-			var over = position.top + data.elemHeight - $(window).height() - $(window).scrollTop();
-			position.top = over > 0 ? position.top - over : Math.max(0, position.top);
-		}
-	},
-
-	flip: {
-		left: function(position, data) {
-			if (data.at[0] == 'center')
-				return;
-			var over = position.left + data.elemWidth - $(window).width() - $(window).scrollLeft(),
-				myOffset = data.my[0] == 'left' ? -data.elemWidth : data.my[0] == 'right' ? data.elemWidth : 0,
-				offset = -2 * data.offset[0];
-			position.left += position.left < 0 ? myOffset + data.targetWidth + offset : over > 0 ? myOffset - data.targetWidth + offset : 0;
-		},
-		top: function(position, data) {
-			if (data.at[1] == 'center')
-				return;
-			var over = position.top + data.elemHeight - $(window).height() - $(window).scrollTop(),
-				myOffset = data.my[1] == 'top' ? -data.elemHeight : data.my[1] == 'bottom' ? data.elemHeight : 0,
-				atOffset = data.at[1] == 'top' ? data.targetHeight : -data.targetHeight,
-				offset = -2 * data.offset[1];
-			position.top += position.top < 0 ? myOffset + data.targetHeight + offset : over > 0 ? myOffset + atOffset + offset : 0;
-		}
-	}
-};
-
-
-// the following functionality is planned for jQuery 1.4
-// based on http://plugins.jquery.com/files/offset.js.txt
-$.fn.extend({
-	_offset: $.fn.offset,
-	offset: function(newOffset) {
-	    return !newOffset ? this._offset() : this.each(function() {
-			var elem = $(this),
-				// we need to convert static positioning to relative positioning
-				isRelative = /relative|static/.test(elem.css('position')),
-				hide = elem.css('display') == 'none';
-
-			(isRelative && elem.css('position', 'relative'));
-			(hide && elem.show());
-
-			var offset = elem.offset(),
-				delta = {
-					left : parseInt(elem.css('left'), 10),
-					top: parseInt(elem.css('top'), 10)
-				};
-
-			// in case of 'auto'
-			delta.left = !isNaN(delta.left)
-				? delta.left
-				: isRelative
-					? 0
-					: this.offsetLeft;
-			delta.top = !isNaN(delta.top)
-				? delta.top
-				: isRelative
-					? 0
-					: this.offsetTop;
-
-			// allow setting only left or only top
-			if (newOffset.left || newOffset.left === 0) {
-				elem.css('left', newOffset.left - offset.left + delta.left);
-			}
-			if (newOffset.top || newOffset.top === 0) {
-				elem.css('top', newOffset.top - offset.top + delta.top);
-			}
-
-			(hide && elem.hide());
-		});
-	}
-});
-
-})(jQuery);
diff --git a/ui/ui.progressbar.js b/ui/ui.progressbar.js
deleted file mode 100644
index 328f8be42..000000000
--- a/ui/ui.progressbar.js
+++ /dev/null
@@ -1,119 +0,0 @@
-/*
- * jQuery UI Progressbar @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Progressbar
- *
- * Depends:
- *   ui.core.js
- */
-(function($) {
-
-$.widget("ui.progressbar", {
-
-	_init: function() {
-
-		this.element
-			.addClass("ui-progressbar"
-				+ " ui-widget"
-				+ " ui-widget-content"
-				+ " ui-corner-all")
-			.attr({
-				role: "progressbar",
-				"aria-valuemin": this._valueMin(),
-				"aria-valuemax": this._valueMax(),
-				"aria-valuenow": this._value()
-			});
-
-		this.valueDiv = $('<div class="ui-progressbar-value ui-widget-header ui-corner-left"></div>').appendTo(this.element);
-
-		this._refreshValue();
-
-	},
-
-	destroy: function() {
-
-		this.element
-			.removeClass("ui-progressbar"
-				+ " ui-widget"
-				+ " ui-widget-content"
-				+ " ui-corner-all")
-			.removeAttr("role")
-			.removeAttr("aria-valuemin")
-			.removeAttr("aria-valuemax")
-			.removeAttr("aria-valuenow")
-			.removeData("progressbar")
-			.unbind(".progressbar");
-
-		this.valueDiv.remove();
-
-		$.widget.prototype.destroy.apply(this, arguments);
-
-		return this;
-	},
-
-	value: function(newValue) {
-		if (newValue === undefined) {
-			return this._value();
-		}
-		
-		this._setData('value', newValue);
-		return this;
-	},
-
-	_setData: function(key, value) {
-
-		switch (key) {
-			case 'value':
-				this.options.value = value;
-				this._refreshValue();
-				this._trigger('change', null, {});
-				break;
-		}
-
-		$.widget.prototype._setData.apply(this, arguments);
-
-	},
-
-	_value: function() {
-		var val = this.options.value;
-		// normalize invalid value
-		if (typeof val != "number")
-			val = 0;
-		if (val < this._valueMin()) val = this._valueMin();
-		if (val > this._valueMax()) val = this._valueMax();
-
-		return val;
-
-	},
-
-	_valueMin: function() {
-		var valueMin = 0;
-		return valueMin;
-	},
-
-	_valueMax: function() {
-		var valueMax = 100;
-		return valueMax;
-	},
-
-	_refreshValue: function() {
-		var value = this.value();
-		this.valueDiv[value == this._valueMax() ? 'addClass' : 'removeClass']("ui-corner-right");
-		this.valueDiv.width(value + '%');
-		this.element.attr("aria-valuenow", value);
-	}
-
-});
-
-$.extend($.ui.progressbar, {
-	version: "@VERSION",
-	defaults: {
-		value: 0
-	}
-});
-
-})(jQuery);
diff --git a/ui/ui.resizable.js b/ui/ui.resizable.js
deleted file mode 100644
index a6fe65fff..000000000
--- a/ui/ui.resizable.js
+++ /dev/null
@@ -1,798 +0,0 @@
-/*
- * jQuery UI Resizable @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Resizables
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.resizable", $.extend({}, $.ui.mouse, {
-
-	_init: function() {
-
-		var self = this, o = this.options;
-		this.element.addClass("ui-resizable");
-
-		$.extend(this, {
-			_aspectRatio: !!(o.aspectRatio),
-			aspectRatio: o.aspectRatio,
-			originalElement: this.element,
-			_proportionallyResizeElements: [],
-			_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
-		});
-
-		//Wrap the element if it cannot hold child nodes
-		if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) {
-
-			//Opera fix for relative positioning
-			if (/relative/.test(this.element.css('position')) && $.browser.opera)
-				this.element.css({ position: 'relative', top: 'auto', left: 'auto' });
-
-			//Create a wrapper element and set the wrapper to the new current internal element
-			this.element.wrap(
-				$('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({
-					position: this.element.css('position'),
-					width: this.element.outerWidth(),
-					height: this.element.outerHeight(),
-					top: this.element.css('top'),
-					left: this.element.css('left')
-				})
-			);
-
-			//Overwrite the original this.element
-			this.element = this.element.parent().data(
-				"resizable", this.element.data('resizable')
-			);
-
-			this.elementIsWrapper = true;
-
-			//Move margins to the wrapper
-			this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") });
-			this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0});
-
-			//Prevent Safari textarea resize
-			this.originalResizeStyle = this.originalElement.css('resize');
-			this.originalElement.css('resize', 'none');
-
-			//Push the actual element to our proportionallyResize internal array
-			this._proportionallyResizeElements.push(this.originalElement.css({ position: 'static', zoom: 1, display: 'block' }));
-
-			// avoid IE jump (hard set the margin)
-			this.originalElement.css({ margin: this.originalElement.css('margin') });
-
-			// fix handlers offset
-			this._proportionallyResize();
-
-		}
-
-		this.handles = o.handles || (!$('.ui-resizable-handle', this.element).length ? "e,s,se" : { n: '.ui-resizable-n', e: '.ui-resizable-e', s: '.ui-resizable-s', w: '.ui-resizable-w', se: '.ui-resizable-se', sw: '.ui-resizable-sw', ne: '.ui-resizable-ne', nw: '.ui-resizable-nw' });
-		if(this.handles.constructor == String) {
-
-			if(this.handles == 'all') this.handles = 'n,e,s,w,se,sw,ne,nw';
-			var n = this.handles.split(","); this.handles = {};
-
-			for(var i = 0; i < n.length; i++) {
-
-				var handle = $.trim(n[i]), hname = 'ui-resizable-'+handle;
-				var axis = $('<div class="ui-resizable-handle ' + hname + '"></div>');
-
-				// increase zIndex of sw, se, ne, nw axis
-				//TODO : this modifies original option
-				if(/sw|se|ne|nw/.test(handle)) axis.css({ zIndex: ++o.zIndex });
-
-				//TODO : What's going on here?
-				if ('se' == handle) {
-					axis.addClass('ui-icon ui-icon-gripsmall-diagonal-se');
-				};
-
-				//Insert into internal handles object and append to element
-				this.handles[handle] = '.ui-resizable-'+handle;
-				this.element.append(axis);
-			}
-
-		}
-
-		this._renderAxis = function(target) {
-
-			target = target || this.element;
-
-			for(var i in this.handles) {
-
-				if(this.handles[i].constructor == String)
-					this.handles[i] = $(this.handles[i], this.element).show();
-
-				//Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls)
-				if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) {
-
-					var axis = $(this.handles[i], this.element), padWrapper = 0;
-
-					//Checking the correct pad and border
-					padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth();
-
-					//The padding type i have to apply...
-					var padPos = [ 'padding',
-						/ne|nw|n/.test(i) ? 'Top' :
-						/se|sw|s/.test(i) ? 'Bottom' :
-						/^e$/.test(i) ? 'Right' : 'Left' ].join("");
-
-					target.css(padPos, padWrapper);
-
-					this._proportionallyResize();
-
-				}
-
-				//TODO: What's that good for? There's not anything to be executed left
-				if(!$(this.handles[i]).length)
-					continue;
-
-			}
-		};
-
-		//TODO: make renderAxis a prototype function
-		this._renderAxis(this.element);
-
-		this._handles = $('.ui-resizable-handle', this.element)
-			.disableSelection();
-
-		//Matching axis name
-		this._handles.mouseover(function() {
-			if (!self.resizing) {
-				if (this.className)
-					var axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);
-				//Axis, default = se
-				self.axis = axis && axis[1] ? axis[1] : 'se';
-			}
-		});
-
-		//If we want to auto hide the elements
-		if (o.autoHide) {
-			this._handles.hide();
-			$(this.element)
-				.addClass("ui-resizable-autohide")
-				.hover(function() {
-					$(this).removeClass("ui-resizable-autohide");
-					self._handles.show();
-				},
-				function(){
-					if (!self.resizing) {
-						$(this).addClass("ui-resizable-autohide");
-						self._handles.hide();
-					}
-				});
-		}
-
-		//Initialize the mouse interaction
-		this._mouseInit();
-
-	},
-
-	destroy: function() {
-
-		this._mouseDestroy();
-
-		var _destroy = function(exp) {
-			$(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing")
-				.removeData("resizable").unbind(".resizable").find('.ui-resizable-handle').remove();
-		};
-
-		//TODO: Unwrap at same DOM position
-		if (this.elementIsWrapper) {
-			_destroy(this.element);
-			var wrapper = this.element;
-			wrapper.parent().append(
-				this.originalElement.css({
-					position: wrapper.css('position'),
-					width: wrapper.outerWidth(),
-					height: wrapper.outerHeight(),
-					top: wrapper.css('top'),
-					left: wrapper.css('left')
-				})
-			).end().remove();
-		}
-
-		this.originalElement.css('resize', this.originalResizeStyle);
-		_destroy(this.originalElement);
-
-		return this;
-	},
-
-	_mouseCapture: function(event) {
-		var handle = false;
-		for (var i in this.handles) {
-			if ($(this.handles[i])[0] == event.target) {
-				handle = true;
-			}
-		}
-
-		return !this.options.disabled && handle;
-	},
-
-	_mouseStart: function(event) {
-
-		var o = this.options, iniPos = this.element.position(), el = this.element;
-
-		this.resizing = true;
-		this.documentScroll = { top: $(document).scrollTop(), left: $(document).scrollLeft() };
-
-		// bugfix for http://dev.jquery.com/ticket/1749
-		if (el.is('.ui-draggable') || (/absolute/).test(el.css('position'))) {
-			el.css({ position: 'absolute', top: iniPos.top, left: iniPos.left });
-		}
-
-		//Opera fixing relative position
-		if ($.browser.opera && (/relative/).test(el.css('position')))
-			el.css({ position: 'relative', top: 'auto', left: 'auto' });
-
-		this._renderProxy();
-
-		var curleft = num(this.helper.css('left')), curtop = num(this.helper.css('top'));
-
-		if (o.containment) {
-			curleft += $(o.containment).scrollLeft() || 0;
-			curtop += $(o.containment).scrollTop() || 0;
-		}
-
-		//Store needed variables
-		this.offset = this.helper.offset();
-		this.position = { left: curleft, top: curtop };
-		this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
-		this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() };
-		this.originalPosition = { left: curleft, top: curtop };
-		this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() };
-		this.originalMousePosition = { left: event.pageX, top: event.pageY };
-
-		//Aspect Ratio
-		this.aspectRatio = (typeof o.aspectRatio == 'number') ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1);
-
-	    var cursor = $('.ui-resizable-' + this.axis).css('cursor');
-	    $('body').css('cursor', cursor == 'auto' ? this.axis + '-resize' : cursor);
-
-		el.addClass("ui-resizable-resizing");
-		this._propagate("start", event);
-		return true;
-	},
-
-	_mouseDrag: function(event) {
-
-		//Increase performance, avoid regex
-		var el = this.helper, o = this.options, props = {},
-			self = this, smp = this.originalMousePosition, a = this.axis;
-
-		var dx = (event.pageX-smp.left)||0, dy = (event.pageY-smp.top)||0;
-		var trigger = this._change[a];
-		if (!trigger) return false;
-
-		// Calculate the attrs that will be change
-		var data = trigger.apply(this, [event, dx, dy]), ie6 = $.browser.msie && $.browser.version < 7, csdif = this.sizeDiff;
-
-		if (this._aspectRatio || event.shiftKey)
-			data = this._updateRatio(data, event);
-
-		data = this._respectSize(data, event);
-
-		// plugins callbacks need to be called first
-		this._propagate("resize", event);
-
-		el.css({
-			top: this.position.top + "px", left: this.position.left + "px",
-			width: this.size.width + "px", height: this.size.height + "px"
-		});
-
-		if (!this._helper && this._proportionallyResizeElements.length)
-			this._proportionallyResize();
-
-		this._updateCache(data);
-
-		// calling the user callback at the end
-		this._trigger('resize', event, this.ui());
-
-		return false;
-	},
-
-	_mouseStop: function(event) {
-
-		this.resizing = false;
-		var o = this.options, self = this;
-
-		if(this._helper) {
-			var pr = this._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
-						soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
-							soffsetw = ista ? 0 : self.sizeDiff.width;
-
-			var s = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
-				left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
-				top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
-			if (!o.animate)
-				this.element.css($.extend(s, { top: top, left: left }));
-
-			self.helper.height(self.size.height);
-			self.helper.width(self.size.width);
-
-			if (this._helper && !o.animate) this._proportionallyResize();
-		}
-
-		$('body').css('cursor', 'auto');
-
-		this.element.removeClass("ui-resizable-resizing");
-
-		this._propagate("stop", event);
-
-		if (this._helper) this.helper.remove();
-		return false;
-
-	},
-
-	_updateCache: function(data) {
-		var o = this.options;
-		this.offset = this.helper.offset();
-		if (isNumber(data.left)) this.position.left = data.left;
-		if (isNumber(data.top)) this.position.top = data.top;
-		if (isNumber(data.height)) this.size.height = data.height;
-		if (isNumber(data.width)) this.size.width = data.width;
-	},
-
-	_updateRatio: function(data, event) {
-
-		var o = this.options, cpos = this.position, csize = this.size, a = this.axis;
-
-		if (data.height) data.width = (csize.height * this.aspectRatio);
-		else if (data.width) data.height = (csize.width / this.aspectRatio);
-
-		if (a == 'sw') {
-			data.left = cpos.left + (csize.width - data.width);
-			data.top = null;
-		}
-		if (a == 'nw') {
-			data.top = cpos.top + (csize.height - data.height);
-			data.left = cpos.left + (csize.width - data.width);
-		}
-
-		return data;
-	},
-
-	_respectSize: function(data, event) {
-
-		var el = this.helper, o = this.options, pRatio = this._aspectRatio || event.shiftKey, a = this.axis,
-				ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height),
-					isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height);
-
-		if (isminw) data.width = o.minWidth;
-		if (isminh) data.height = o.minHeight;
-		if (ismaxw) data.width = o.maxWidth;
-		if (ismaxh) data.height = o.maxHeight;
-
-		var dw = this.originalPosition.left + this.originalSize.width, dh = this.position.top + this.size.height;
-		var cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a);
-
-		if (isminw && cw) data.left = dw - o.minWidth;
-		if (ismaxw && cw) data.left = dw - o.maxWidth;
-		if (isminh && ch)	data.top = dh - o.minHeight;
-		if (ismaxh && ch)	data.top = dh - o.maxHeight;
-
-		// fixing jump error on top/left - bug #2330
-		var isNotwh = !data.width && !data.height;
-		if (isNotwh && !data.left && data.top) data.top = null;
-		else if (isNotwh && !data.top && data.left) data.left = null;
-
-		return data;
-	},
-
-	_proportionallyResize: function() {
-
-		var o = this.options;
-		if (!this._proportionallyResizeElements.length) return;
-		var element = this.helper || this.element;
-
-		for (var i=0; i < this._proportionallyResizeElements.length; i++) {
-
-			var prel = this._proportionallyResizeElements[i];
-
-			if (!this.borderDif) {
-				var b = [prel.css('borderTopWidth'), prel.css('borderRightWidth'), prel.css('borderBottomWidth'), prel.css('borderLeftWidth')],
-					p = [prel.css('paddingTop'), prel.css('paddingRight'), prel.css('paddingBottom'), prel.css('paddingLeft')];
-
-				this.borderDif = $.map(b, function(v, i) {
-					var border = parseInt(v,10)||0, padding = parseInt(p[i],10)||0;
-					return border + padding;
-				});
-			}
-
-			if ($.browser.msie && !(!($(element).is(':hidden') || $(element).parents(':hidden').length)))
-				continue;
-
-			prel.css({
-				height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0,
-				width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0
-			});
-
-		};
-
-	},
-
-	_renderProxy: function() {
-
-		var el = this.element, o = this.options;
-		this.elementOffset = el.offset();
-
-		if(this._helper) {
-
-			this.helper = this.helper || $('<div style="overflow:hidden;"></div>');
-
-			// fix ie6 offset TODO: This seems broken
-			var ie6 = $.browser.msie && $.browser.version < 7, ie6offset = (ie6 ? 1 : 0),
-			pxyoffset = ( ie6 ? 2 : -1 );
-
-			this.helper.addClass(this._helper).css({
-				width: this.element.outerWidth() + pxyoffset,
-				height: this.element.outerHeight() + pxyoffset,
-				position: 'absolute',
-				left: this.elementOffset.left - ie6offset +'px',
-				top: this.elementOffset.top - ie6offset +'px',
-				zIndex: ++o.zIndex //TODO: Don't modify option
-			});
-
-			this.helper
-				.appendTo("body")
-				.disableSelection();
-
-		} else {
-			this.helper = this.element;
-		}
-
-	},
-
-	_change: {
-		e: function(event, dx, dy) {
-			return { width: this.originalSize.width + dx };
-		},
-		w: function(event, dx, dy) {
-			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
-			return { left: sp.left + dx, width: cs.width - dx };
-		},
-		n: function(event, dx, dy) {
-			var o = this.options, cs = this.originalSize, sp = this.originalPosition;
-			return { top: sp.top + dy, height: cs.height - dy };
-		},
-		s: function(event, dx, dy) {
-			return { height: this.originalSize.height + dy };
-		},
-		se: function(event, dx, dy) {
-			return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
-		},
-		sw: function(event, dx, dy) {
-			return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
-		},
-		ne: function(event, dx, dy) {
-			return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy]));
-		},
-		nw: function(event, dx, dy) {
-			return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy]));
-		}
-	},
-
-	_propagate: function(n, event) {
-		$.ui.plugin.call(this, n, [event, this.ui()]);
-		(n != "resize" && this._trigger(n, event, this.ui()));
-	},
-
-	plugins: {},
-
-	ui: function() {
-		return {
-			originalElement: this.originalElement,
-			element: this.element,
-			helper: this.helper,
-			position: this.position,
-			size: this.size,
-			originalSize: this.originalSize,
-			originalPosition: this.originalPosition
-		};
-	}
-
-}));
-
-$.extend($.ui.resizable, {
-	version: "@VERSION",
-	eventPrefix: "resize",
-	defaults: $.extend({}, $.ui.mouse.defaults, {
-		alsoResize: false,
-		animate: false,
-		animateDuration: "slow",
-		animateEasing: "swing",
-		aspectRatio: false,
-		autoHide: false,
-		containment: false,
-		ghost: false,
-		grid: false,
-		handles: "e,s,se",
-		helper: false,
-		maxHeight: null,
-		maxWidth: null,
-		minHeight: 10,
-		minWidth: 10,
-		zIndex: 1000
-	})
-});
-
-/*
- * Resizable Extensions
- */
-
-$.ui.plugin.add("resizable", "alsoResize", {
-
-	start: function(event, ui) {
-
-		var self = $(this).data("resizable"), o = self.options;
-
-		var _store = function(exp) {
-			$(exp).each(function() {
-				$(this).data("resizable-alsoresize", {
-					width: parseInt($(this).width(), 10), height: parseInt($(this).height(), 10),
-					left: parseInt($(this).css('left'), 10), top: parseInt($(this).css('top'), 10)
-				});
-			});
-		};
-
-		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.parentNode) {
-			if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0];	_store(o.alsoResize); }
-			else { $.each(o.alsoResize, function(exp, c) { _store(exp); }); }
-		}else{
-			_store(o.alsoResize);
-		}
-	},
-
-	resize: function(event, ui){
-		var self = $(this).data("resizable"), o = self.options, os = self.originalSize, op = self.originalPosition;
-
-		var delta = {
-			height: (self.size.height - os.height) || 0, width: (self.size.width - os.width) || 0,
-			top: (self.position.top - op.top) || 0, left: (self.position.left - op.left) || 0
-		},
-
-		_alsoResize = function(exp, c) {
-			$(exp).each(function() {
-				var el = $(this), start = $(this).data("resizable-alsoresize"), style = {}, css = c && c.length ? c : ['width', 'height', 'top', 'left'];
-
-				$.each(css || ['width', 'height', 'top', 'left'], function(i, prop) {
-					var sum = (start[prop]||0) + (delta[prop]||0);
-					if (sum && sum >= 0)
-						style[prop] = sum || null;
-				});
-
-				//Opera fixing relative position
-				if (/relative/.test(el.css('position')) && $.browser.opera) {
-					self._revertToRelativePosition = true;
-					el.css({ position: 'absolute', top: 'auto', left: 'auto' });
-				}
-
-				el.css(style);
-			});
-		};
-
-		if (typeof(o.alsoResize) == 'object' && !o.alsoResize.nodeType) {
-			$.each(o.alsoResize, function(exp, c) { _alsoResize(exp, c); });
-		}else{
-			_alsoResize(o.alsoResize);
-		}
-	},
-
-	stop: function(event, ui){
-		var self = $(this).data("resizable");
-
-		//Opera fixing relative position
-		if (self._revertToRelativePosition && $.browser.opera) {
-			self._revertToRelativePosition = false;
-			el.css({ position: 'relative' });
-		}
-
-		$(this).removeData("resizable-alsoresize-start");
-	}
-});
-
-$.ui.plugin.add("resizable", "animate", {
-
-	stop: function(event, ui) {
-		var self = $(this).data("resizable"), o = self.options;
-
-		var pr = self._proportionallyResizeElements, ista = pr.length && (/textarea/i).test(pr[0].nodeName),
-					soffseth = ista && $.ui.hasScroll(pr[0], 'left') /* TODO - jump height */ ? 0 : self.sizeDiff.height,
-						soffsetw = ista ? 0 : self.sizeDiff.width;
-
-		var style = { width: (self.size.width - soffsetw), height: (self.size.height - soffseth) },
-					left = (parseInt(self.element.css('left'), 10) + (self.position.left - self.originalPosition.left)) || null,
-						top = (parseInt(self.element.css('top'), 10) + (self.position.top - self.originalPosition.top)) || null;
-
-		self.element.animate(
-			$.extend(style, top && left ? { top: top, left: left } : {}), {
-				duration: o.animateDuration,
-				easing: o.animateEasing,
-				step: function() {
-
-					var data = {
-						width: parseInt(self.element.css('width'), 10),
-						height: parseInt(self.element.css('height'), 10),
-						top: parseInt(self.element.css('top'), 10),
-						left: parseInt(self.element.css('left'), 10)
-					};
-
-					if (pr && pr.length) $(pr[0]).css({ width: data.width, height: data.height });
-
-					// propagating resize, and updating values for each animation step
-					self._updateCache(data);
-					self._propagate("resize", event);
-
-				}
-			}
-		);
-	}
-
-});
-
-$.ui.plugin.add("resizable", "containment", {
-
-	start: function(event, ui) {
-		var self = $(this).data("resizable"), o = self.options, el = self.element;
-		var oc = o.containment,	ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc;
-		if (!ce) return;
-
-		self.containerElement = $(ce);
-
-		if (/document/.test(oc) || oc == document) {
-			self.containerOffset = { left: 0, top: 0 };
-			self.containerPosition = { left: 0, top: 0 };
-
-			self.parentData = {
-				element: $(document), left: 0, top: 0,
-				width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight
-			};
-		}
-
-		// i'm a node, so compute top, left, right, bottom
-		else {
-			var element = $(ce), p = [];
-			$([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); });
-
-			self.containerOffset = element.offset();
-			self.containerPosition = element.position();
-			self.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) };
-
-			var co = self.containerOffset, ch = self.containerSize.height,	cw = self.containerSize.width,
-						width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ), height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch);
-
-			self.parentData = {
-				element: ce, left: co.left, top: co.top, width: width, height: height
-			};
-		}
-	},
-
-	resize: function(event, ui) {
-		var self = $(this).data("resizable"), o = self.options,
-				ps = self.containerSize, co = self.containerOffset, cs = self.size, cp = self.position,
-				pRatio = self._aspectRatio || event.shiftKey, cop = { top:0, left:0 }, ce = self.containerElement;
-
-		if (ce[0] != document && (/static/).test(ce.css('position'))) cop = co;
-
-		if (cp.left < (self._helper ? co.left : 0)) {
-			self.size.width = self.size.width + (self._helper ? (self.position.left - co.left) : (self.position.left - cop.left));
-			if (pRatio) self.size.height = self.size.width / o.aspectRatio;
-			self.position.left = o.helper ? co.left : 0;
-		}
-
-		if (cp.top < (self._helper ? co.top : 0)) {
-			self.size.height = self.size.height + (self._helper ? (self.position.top - co.top) : self.position.top);
-			if (pRatio) self.size.width = self.size.height * o.aspectRatio;
-			self.position.top = self._helper ? co.top : 0;
-		}
-
-		self.offset.left = self.parentData.left+self.position.left;
-		self.offset.top = self.parentData.top+self.position.top;
-
-		var woset = Math.abs( (self._helper ? self.offset.left - cop.left : (self.offset.left - cop.left)) + self.sizeDiff.width ),
-					hoset = Math.abs( (self._helper ? self.offset.top - cop.top : (self.offset.top - co.top)) + self.sizeDiff.height );
-
-		var isParent = self.containerElement.get(0) == self.element.parent().get(0),
-		    isOffsetRelative = /relative|absolute/.test(self.containerElement.css('position'));
-
-		if(isParent && isOffsetRelative) woset -= self.parentData.left;
-
-		if (woset + self.size.width >= self.parentData.width) {
-			self.size.width = self.parentData.width - woset;
-			if (pRatio) self.size.height = self.size.width / self.aspectRatio;
-		}
-
-		if (hoset + self.size.height >= self.parentData.height) {
-			self.size.height = self.parentData.height - hoset;
-			if (pRatio) self.size.width = self.size.height * self.aspectRatio;
-		}
-	},
-
-	stop: function(event, ui){
-		var self = $(this).data("resizable"), o = self.options, cp = self.position,
-				co = self.containerOffset, cop = self.containerPosition, ce = self.containerElement;
-
-		var helper = $(self.helper), ho = helper.offset(), w = helper.outerWidth() - self.sizeDiff.width, h = helper.outerHeight() - self.sizeDiff.height;
-
-		if (self._helper && !o.animate && (/relative/).test(ce.css('position')))
-			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
-		if (self._helper && !o.animate && (/static/).test(ce.css('position')))
-			$(this).css({ left: ho.left - cop.left - co.left, width: w, height: h });
-
-	}
-});
-
-$.ui.plugin.add("resizable", "ghost", {
-
-	start: function(event, ui) {
-
-		var self = $(this).data("resizable"), o = self.options, cs = self.size;
-
-		self.ghost = self.originalElement.clone();
-		self.ghost
-			.css({ opacity: .25, display: 'block', position: 'relative', height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 })
-			.addClass('ui-resizable-ghost')
-			.addClass(typeof o.ghost == 'string' ? o.ghost : '');
-
-		self.ghost.appendTo(self.helper);
-
-	},
-
-	resize: function(event, ui){
-		var self = $(this).data("resizable"), o = self.options;
-		if (self.ghost) self.ghost.css({ position: 'relative', height: self.size.height, width: self.size.width });
-	},
-
-	stop: function(event, ui){
-		var self = $(this).data("resizable"), o = self.options;
-		if (self.ghost && self.helper) self.helper.get(0).removeChild(self.ghost.get(0));
-	}
-
-});
-
-$.ui.plugin.add("resizable", "grid", {
-
-	resize: function(event, ui) {
-		var self = $(this).data("resizable"), o = self.options, cs = self.size, os = self.originalSize, op = self.originalPosition, a = self.axis, ratio = o._aspectRatio || event.shiftKey;
-		o.grid = typeof o.grid == "number" ? [o.grid, o.grid] : o.grid;
-		var ox = Math.round((cs.width - os.width) / (o.grid[0]||1)) * (o.grid[0]||1), oy = Math.round((cs.height - os.height) / (o.grid[1]||1)) * (o.grid[1]||1);
-
-		if (/^(se|s|e)$/.test(a)) {
-			self.size.width = os.width + ox;
-			self.size.height = os.height + oy;
-		}
-		else if (/^(ne)$/.test(a)) {
-			self.size.width = os.width + ox;
-			self.size.height = os.height + oy;
-			self.position.top = op.top - oy;
-		}
-		else if (/^(sw)$/.test(a)) {
-			self.size.width = os.width + ox;
-			self.size.height = os.height + oy;
-			self.position.left = op.left - ox;
-		}
-		else {
-			self.size.width = os.width + ox;
-			self.size.height = os.height + oy;
-			self.position.top = op.top - oy;
-			self.position.left = op.left - ox;
-		}
-	}
-
-});
-
-var num = function(v) {
-	return parseInt(v, 10) || 0;
-};
-
-var isNumber = function(value) {
-	return !isNaN(parseInt(value, 10));
-};
-
-})(jQuery);
diff --git a/ui/ui.selectable.js b/ui/ui.selectable.js
deleted file mode 100644
index 635f12602..000000000
--- a/ui/ui.selectable.js
+++ /dev/null
@@ -1,257 +0,0 @@
-/*
- * jQuery UI Selectable @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Selectables
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.selectable", $.extend({}, $.ui.mouse, {
-
-	_init: function() {
-		var self = this;
-
-		this.element.addClass("ui-selectable");
-
-		this.dragged = false;
-
-		// cache selectee children based on filter
-		var selectees;
-		this.refresh = function() {
-			selectees = $(self.options.filter, self.element[0]);
-			selectees.each(function() {
-				var $this = $(this);
-				var pos = $this.offset();
-				$.data(this, "selectable-item", {
-					element: this,
-					$element: $this,
-					left: pos.left,
-					top: pos.top,
-					right: pos.left + $this.outerWidth(),
-					bottom: pos.top + $this.outerHeight(),
-					startselected: false,
-					selected: $this.hasClass('ui-selected'),
-					selecting: $this.hasClass('ui-selecting'),
-					unselecting: $this.hasClass('ui-unselecting')
-				});
-			});
-		};
-		this.refresh();
-
-		this.selectees = selectees.addClass("ui-selectee");
-
-		this._mouseInit();
-
-		this.helper = $(document.createElement('div'))
-			.css({border:'1px dotted black'})
-			.addClass("ui-selectable-helper");
-	},
-
-	destroy: function() {
-		this.element
-			.removeClass("ui-selectable ui-selectable-disabled")
-			.removeData("selectable")
-			.unbind(".selectable");
-		this._mouseDestroy();
-
-		return this;
-	},
-
-	_mouseStart: function(event) {
-		var self = this;
-
-		this.opos = [event.pageX, event.pageY];
-
-		if (this.options.disabled)
-			return;
-
-		var options = this.options;
-
-		this.selectees = $(options.filter, this.element[0]);
-
-		this._trigger("start", event);
-
-		$(options.appendTo).append(this.helper);
-		// position helper (lasso)
-		this.helper.css({
-			"z-index": 100,
-			"position": "absolute",
-			"left": event.clientX,
-			"top": event.clientY,
-			"width": 0,
-			"height": 0
-		});
-
-		if (options.autoRefresh) {
-			this.refresh();
-		}
-
-		this.selectees.filter('.ui-selected').each(function() {
-			var selectee = $.data(this, "selectable-item");
-			selectee.startselected = true;
-			if (!event.metaKey) {
-				selectee.$element.removeClass('ui-selected');
-				selectee.selected = false;
-				selectee.$element.addClass('ui-unselecting');
-				selectee.unselecting = true;
-				// selectable UNSELECTING callback
-				self._trigger("unselecting", event, {
-					unselecting: selectee.element
-				});
-			}
-		});
-
-		$(event.target).parents().andSelf().each(function() {
-			var selectee = $.data(this, "selectable-item");
-			if (selectee) {
-				selectee.$element.removeClass("ui-unselecting").addClass('ui-selecting');
-				selectee.unselecting = false;
-				selectee.selecting = true;
-				selectee.selected = true;
-				// selectable SELECTING callback
-				self._trigger("selecting", event, {
-					selecting: selectee.element
-				});
-				return false;
-			}
-		});
-
-	},
-
-	_mouseDrag: function(event) {
-		var self = this;
-		this.dragged = true;
-
-		if (this.options.disabled)
-			return;
-
-		var options = this.options;
-
-		var x1 = this.opos[0], y1 = this.opos[1], x2 = event.pageX, y2 = event.pageY;
-		if (x1 > x2) { var tmp = x2; x2 = x1; x1 = tmp; }
-		if (y1 > y2) { var tmp = y2; y2 = y1; y1 = tmp; }
-		this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1});
-
-		this.selectees.each(function() {
-			var selectee = $.data(this, "selectable-item");
-			//prevent helper from being selected if appendTo: selectable
-			if (!selectee || selectee.element == self.element[0])
-				return;
-			var hit = false;
-			if (options.tolerance == 'touch') {
-				hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) );
-			} else if (options.tolerance == 'fit') {
-				hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2);
-			}
-
-			if (hit) {
-				// SELECT
-				if (selectee.selected) {
-					selectee.$element.removeClass('ui-selected');
-					selectee.selected = false;
-				}
-				if (selectee.unselecting) {
-					selectee.$element.removeClass('ui-unselecting');
-					selectee.unselecting = false;
-				}
-				if (!selectee.selecting) {
-					selectee.$element.addClass('ui-selecting');
-					selectee.selecting = true;
-					// selectable SELECTING callback
-					self._trigger("selecting", event, {
-						selecting: selectee.element
-					});
-				}
-			} else {
-				// UNSELECT
-				if (selectee.selecting) {
-					if (event.metaKey && selectee.startselected) {
-						selectee.$element.removeClass('ui-selecting');
-						selectee.selecting = false;
-						selectee.$element.addClass('ui-selected');
-						selectee.selected = true;
-					} else {
-						selectee.$element.removeClass('ui-selecting');
-						selectee.selecting = false;
-						if (selectee.startselected) {
-							selectee.$element.addClass('ui-unselecting');
-							selectee.unselecting = true;
-						}
-						// selectable UNSELECTING callback
-						self._trigger("unselecting", event, {
-							unselecting: selectee.element
-						});
-					}
-				}
-				if (selectee.selected) {
-					if (!event.metaKey && !selectee.startselected) {
-						selectee.$element.removeClass('ui-selected');
-						selectee.selected = false;
-
-						selectee.$element.addClass('ui-unselecting');
-						selectee.unselecting = true;
-						// selectable UNSELECTING callback
-						self._trigger("unselecting", event, {
-							unselecting: selectee.element
-						});
-					}
-				}
-			}
-		});
-
-		return false;
-	},
-
-	_mouseStop: function(event) {
-		var self = this;
-
-		this.dragged = false;
-
-		var options = this.options;
-
-		$('.ui-unselecting', this.element[0]).each(function() {
-			var selectee = $.data(this, "selectable-item");
-			selectee.$element.removeClass('ui-unselecting');
-			selectee.unselecting = false;
-			selectee.startselected = false;
-			self._trigger("unselected", event, {
-				unselected: selectee.element
-			});
-		});
-		$('.ui-selecting', this.element[0]).each(function() {
-			var selectee = $.data(this, "selectable-item");
-			selectee.$element.removeClass('ui-selecting').addClass('ui-selected');
-			selectee.selecting = false;
-			selectee.selected = true;
-			selectee.startselected = true;
-			self._trigger("selected", event, {
-				selected: selectee.element
-			});
-		});
-		this._trigger("stop", event);
-
-		this.helper.remove();
-
-		return false;
-	}
-
-}));
-
-$.extend($.ui.selectable, {
-	version: "@VERSION",
-	defaults: $.extend({}, $.ui.mouse.defaults, {
-		appendTo: 'body',
-		autoRefresh: true,
-		distance: 0,
-		filter: '*',
-		tolerance: 'touch'
-	})
-});
-
-})(jQuery);
diff --git a/ui/ui.slider.js b/ui/ui.slider.js
deleted file mode 100644
index 7c603c624..000000000
--- a/ui/ui.slider.js
+++ /dev/null
@@ -1,559 +0,0 @@
-/*
- * jQuery UI Slider @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Slider
- *
- * Depends:
- *	ui.core.js
- */
-
-(function($) {
-
-$.widget("ui.slider", $.extend({}, $.ui.mouse, {
-
-	_init: function() {
-
-		var self = this, o = this.options;
-		this._keySliding = false;
-		this._handleIndex = null;
-		this._detectOrientation();
-		this._mouseInit();
-
-		this.element
-			.addClass("ui-slider"
-				+ " ui-slider-" + this.orientation
-				+ " ui-widget"
-				+ " ui-widget-content"
-				+ " ui-corner-all");
-
-		this.range = $([]);
-
-		if (o.range) {
-
-			if (o.range === true) {
-				this.range = $('<div></div>');
-				if (!o.values) o.values = [this._valueMin(), this._valueMin()];
-				if (o.values.length && o.values.length != 2) {
-					o.values = [o.values[0], o.values[0]];
-				}
-			} else {
-				this.range = $('<div></div>');
-			}
-
-			this.range
-				.appendTo(this.element)
-				.addClass("ui-slider-range");
-
-			if (o.range == "min" || o.range == "max") {
-				this.range.addClass("ui-slider-range-" + o.range);
-			}
-
-			// note: this isn't the most fittingly semantic framework class for this element,
-			// but worked best visually with a variety of themes
-			this.range.addClass("ui-widget-header");
-
-		}
-
-		if ($(".ui-slider-handle", this.element).length == 0)
-			$('<a href="#"></a>')
-				.appendTo(this.element)
-				.addClass("ui-slider-handle");
-
-		if (o.values && o.values.length) {
-			while ($(".ui-slider-handle", this.element).length < o.values.length)
-				$('<a href="#"></a>')
-					.appendTo(this.element)
-					.addClass("ui-slider-handle");
-		}
-
-		this.handles = $(".ui-slider-handle", this.element)
-			.addClass("ui-state-default"
-				+ " ui-corner-all");
-
-		this.handle = this.handles.eq(0);
-
-		this.handles.add(this.range).filter("a")
-			.click(function(event) {
-				event.preventDefault();
-			})
-			.hover(function() {
-				if (!o.disabled) {
-					$(this).addClass('ui-state-hover');
-				}
-			}, function() {
-				$(this).removeClass('ui-state-hover');
-			})
-			.focus(function() {
-				if (!o.disabled) {
-					$(".ui-slider .ui-state-focus").removeClass('ui-state-focus'); $(this).addClass('ui-state-focus');
-				} else {
-					$(this).blur();
-				}
-			})
-			.blur(function() {
-				$(this).removeClass('ui-state-focus');
-			});
-
-		this.handles.each(function(i) {
-			$(this).data("index.ui-slider-handle", i);
-		});
-
-		this.handles.keydown(function(event) {
-
-			var ret = true;
-
-			var index = $(this).data("index.ui-slider-handle");
-
-			if (self.options.disabled)
-				return;
-
-			switch (event.keyCode) {
-				case $.ui.keyCode.HOME:
-				case $.ui.keyCode.END:
-				case $.ui.keyCode.UP:
-				case $.ui.keyCode.RIGHT:
-				case $.ui.keyCode.DOWN:
-				case $.ui.keyCode.LEFT:
-					ret = false;
-					if (!self._keySliding) {
-						self._keySliding = true;
-						$(this).addClass("ui-state-active");
-						self._start(event, index);
-					}
-					break;
-			}
-
-			var curVal, newVal, step = self._step();
-			if (self.options.values && self.options.values.length) {
-				curVal = newVal = self.values(index);
-			} else {
-				curVal = newVal = self.value();
-			}
-
-			switch (event.keyCode) {
-				case $.ui.keyCode.HOME:
-					newVal = self._valueMin();
-					break;
-				case $.ui.keyCode.END:
-					newVal = self._valueMax();
-					break;
-				case $.ui.keyCode.UP:
-				case $.ui.keyCode.RIGHT:
-					if(curVal == self._valueMax()) return;
-					newVal = curVal + step;
-					break;
-				case $.ui.keyCode.DOWN:
-				case $.ui.keyCode.LEFT:
-					if(curVal == self._valueMin()) return;
-					newVal = curVal - step;
-					break;
-			}
-
-			self._slide(event, index, newVal);
-
-			return ret;
-
-		}).keyup(function(event) {
-
-			var index = $(this).data("index.ui-slider-handle");
-
-			if (self._keySliding) {
-				self._stop(event, index);
-				self._change(event, index);
-				self._keySliding = false;
-				$(this).removeClass("ui-state-active");
-			}
-
-		});
-
-		this._refreshValue();
-
-	},
-
-	destroy: function() {
-
-		this.handles.remove();
-		this.range.remove();
-
-		this.element
-			.removeClass("ui-slider"
-				+ " ui-slider-horizontal"
-				+ " ui-slider-vertical"
-				+ " ui-slider-disabled"
-				+ " ui-widget"
-				+ " ui-widget-content"
-				+ " ui-corner-all")
-			.removeData("slider")
-			.unbind(".slider");
-
-		this._mouseDestroy();
-
-		return this;
-	},
-
-	_mouseCapture: function(event) {
-
-		var o = this.options;
-
-		if (o.disabled)
-			return false;
-
-		this.elementSize = {
-			width: this.element.outerWidth(),
-			height: this.element.outerHeight()
-		};
-		this.elementOffset = this.element.offset();
-
-		var position = { x: event.pageX, y: event.pageY };
-		var normValue = this._normValueFromMouse(position);
-
-		var distance = this._valueMax() - this._valueMin() + 1, closestHandle;
-		var self = this, index;
-		this.handles.each(function(i) {
-			var thisDistance = Math.abs(normValue - self.values(i));
-			if (distance > thisDistance) {
-				distance = thisDistance;
-				closestHandle = $(this);
-				index = i;
-			}
-		});
-
-		// workaround for bug #3736 (if both handles of a range are at 0,
-		// the first is always used as the one with least distance,
-		// and moving it is obviously prevented by preventing negative ranges)
-		if(o.range == true && this.values(1) == o.min) {
-			closestHandle = $(this.handles[++index]);
-		}
-
-		this._start(event, index);
-
-		self._handleIndex = index;
-
-		closestHandle
-			.addClass("ui-state-active")
-			.focus();
-		
-		var offset = closestHandle.offset();
-		var mouseOverHandle = !$(event.target).parents().andSelf().is('.ui-slider-handle');
-		this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : {
-			left: event.pageX - offset.left - (closestHandle.width() / 2),
-			top: event.pageY - offset.top
-				- (closestHandle.height() / 2)
-				- (parseInt(closestHandle.css('borderTopWidth'),10) || 0)
-				- (parseInt(closestHandle.css('borderBottomWidth'),10) || 0)
-				+ (parseInt(closestHandle.css('marginTop'),10) || 0)
-		};
-
-		normValue = this._normValueFromMouse(position);
-		this._slide(event, index, normValue);
-		return true;
-
-	},
-
-	_mouseStart: function(event) {
-		return true;
-	},
-
-	_mouseDrag: function(event) {
-
-		var position = { x: event.pageX, y: event.pageY };
-		var normValue = this._normValueFromMouse(position);
-		
-		this._slide(event, this._handleIndex, normValue);
-
-		return false;
-
-	},
-
-	_mouseStop: function(event) {
-
-		this.handles.removeClass("ui-state-active");
-		this._stop(event, this._handleIndex);
-		this._change(event, this._handleIndex);
-		this._handleIndex = null;
-		this._clickOffset = null;
-
-		return false;
-
-	},
-	
-	_detectOrientation: function() {
-		this.orientation = this.options.orientation == 'vertical' ? 'vertical' : 'horizontal';
-	},
-
-	_normValueFromMouse: function(position) {
-
-		var pixelTotal, pixelMouse;
-		if ('horizontal' == this.orientation) {
-			pixelTotal = this.elementSize.width;
-			pixelMouse = position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0);
-		} else {
-			pixelTotal = this.elementSize.height;
-			pixelMouse = position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0);
-		}
-
-		var percentMouse = (pixelMouse / pixelTotal);
-		if (percentMouse > 1) percentMouse = 1;
-		if (percentMouse < 0) percentMouse = 0;
-		if ('vertical' == this.orientation)
-			percentMouse = 1 - percentMouse;
-
-		var valueTotal = this._valueMax() - this._valueMin(),
-			valueMouse = percentMouse * valueTotal,
-			valueMouseModStep = valueMouse % this.options.step,
-			normValue = this._valueMin() + valueMouse - valueMouseModStep;
-
-		if (valueMouseModStep > (this.options.step / 2))
-			normValue += this.options.step;
-
-		// Since JavaScript has problems with large floats, round
-		// the final value to 5 digits after the decimal point (see #4124)
-		return parseFloat(normValue.toFixed(5));
-
-	},
-
-	_start: function(event, index) {
-		var uiHash = {
-			handle: this.handles[index],
-			value: this.value()
-		};
-		if (this.options.values && this.options.values.length) {
-			uiHash.value = this.values(index);
-			uiHash.values = this.values();
-		}
-		this._trigger("start", event, uiHash);
-	},
-
-	_slide: function(event, index, newVal) {
-
-		var handle = this.handles[index];
-
-		if (this.options.values && this.options.values.length) {
-
-			var otherVal = this.values(index ? 0 : 1);
-
-			if ((this.options.values.length == 2 && this.options.range === true) && 
-				((index == 0 && newVal > otherVal) || (index == 1 && newVal < otherVal))){
- 				newVal = otherVal;
-			}
-
-			if (newVal != this.values(index)) {
-				var newValues = this.values();
-				newValues[index] = newVal;
-				// A slide can be canceled by returning false from the slide callback
-				var allowed = this._trigger("slide", event, {
-					handle: this.handles[index],
-					value: newVal,
-					values: newValues
-				});
-				var otherVal = this.values(index ? 0 : 1);
-				if (allowed !== false) {
-					this.values(index, newVal, ( event.type == 'mousedown' && this.options.animate ), true);
-				}
-			}
-
-		} else {
-
-			if (newVal != this.value()) {
-				// A slide can be canceled by returning false from the slide callback
-				var allowed = this._trigger("slide", event, {
-					handle: this.handles[index],
-					value: newVal
-				});
-				if (allowed !== false) {
-					this._setData('value', newVal, ( event.type == 'mousedown' && this.options.animate ));
-				}
-					
-			}
-
-		}
-
-	},
-
-	_stop: function(event, index) {
-		var uiHash = {
-			handle: this.handles[index],
-			value: this.value()
-		};
-		if (this.options.values && this.options.values.length) {
-			uiHash.value = this.values(index);
-			uiHash.values = this.values();
-		}
-		this._trigger("stop", event, uiHash);
-	},
-
-	_change: function(event, index) {
-		var uiHash = {
-			handle: this.handles[index],
-			value: this.value()
-		};
-		if (this.options.values && this.options.values.length) {
-			uiHash.value = this.values(index);
-			uiHash.values = this.values();
-		}
-		this._trigger("change", event, uiHash);
-	},
-
-	value: function(newValue) {
-
-		if (arguments.length) {
-			this._setData("value", newValue);
-			this._change(null, 0);
-		}
-
-		return this._value();
-
-	},
-
-	values: function(index, newValue, animated, noPropagation) {
-
-		if (arguments.length > 1) {
-			this.options.values[index] = newValue;
-			this._refreshValue(animated);
-			if(!noPropagation) this._change(null, index);
-		}
-
-		if (arguments.length) {
-			if (this.options.values && this.options.values.length) {
-				return this._values(index);
-			} else {
-				return this.value();
-			}
-		} else {
-			return this._values();
-		}
-
-	},
-
-	_setData: function(key, value, animated) {
-
-		$.widget.prototype._setData.apply(this, arguments);
-
-		switch (key) {
-			case 'disabled':
-				if (value) {
-					this.handles.filter(".ui-state-focus").blur();
-					this.handles.removeClass("ui-state-hover");
-					this.handles.attr("disabled", "disabled");
-				} else {
-					this.handles.removeAttr("disabled");
-				}
-			case 'orientation':
-
-				this._detectOrientation();
-				
-				this.element
-					.removeClass("ui-slider-horizontal ui-slider-vertical")
-					.addClass("ui-slider-" + this.orientation);
-				this._refreshValue(animated);
-				break;
-			case 'value':
-				this._refreshValue(animated);
-				break;
-		}
-
-	},
-
-	_step: function() {
-		var step = this.options.step;
-		return step;
-	},
-
-	_value: function() {
-
-		var val = this.options.value;
-		if (val < this._valueMin()) val = this._valueMin();
-		if (val > this._valueMax()) val = this._valueMax();
-
-		return val;
-
-	},
-
-	_values: function(index) {
-
-		if (arguments.length) {
-			var val = this.options.values[index];
-			if (val < this._valueMin()) val = this._valueMin();
-			if (val > this._valueMax()) val = this._valueMax();
-
-			return val;
-		} else {
-			// .slice() creates a copy of the array
-			// this prevents outside manipulation of the internal state
-			return this.options.values.slice();
-		}
-
-	},
-
-	_valueMin: function() {
-		var valueMin = this.options.min;
-		return valueMin;
-	},
-
-	_valueMax: function() {
-		var valueMax = this.options.max;
-		return valueMax;
-	},
-
-	_refreshValue: function(animate) {
-
-		var oRange = this.options.range, o = this.options, self = this;
-
-		if (this.options.values && this.options.values.length) {
-			var vp0, vp1;
-			this.handles.each(function(i, j) {
-				var valPercent = (self.values(i) - self._valueMin()) / (self._valueMax() - self._valueMin()) * 100;
-				var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
-				$(this).stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
-				if (self.options.range === true) {
-					if (self.orientation == 'horizontal') {
-						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ left: valPercent + '%' }, o.animate);
-						(i == 1) && self.range[animate ? 'animate' : 'css']({ width: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
-					} else {
-						(i == 0) && self.range.stop(1,1)[animate ? 'animate' : 'css']({ bottom: (valPercent) + '%' }, o.animate);
-						(i == 1) && self.range[animate ? 'animate' : 'css']({ height: (valPercent - lastValPercent) + '%' }, { queue: false, duration: o.animate });
-					}
-				}
-				lastValPercent = valPercent;
-			});
-		} else {
-			var value = this.value(),
-				valueMin = this._valueMin(),
-				valueMax = this._valueMax(),
-				valPercent = valueMax != valueMin
-					? (value - valueMin) / (valueMax - valueMin) * 100
-					: 0;
-			var _set = {}; _set[self.orientation == 'horizontal' ? 'left' : 'bottom'] = valPercent + '%';
-			this.handle.stop(1,1)[animate ? 'animate' : 'css'](_set, o.animate);
-
-			(oRange == "min") && (this.orientation == "horizontal") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ width: valPercent + '%' }, o.animate);
-			(oRange == "max") && (this.orientation == "horizontal") && this.range[animate ? 'animate' : 'css']({ width: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
-			(oRange == "min") && (this.orientation == "vertical") && this.range.stop(1,1)[animate ? 'animate' : 'css']({ height: valPercent + '%' }, o.animate);
-			(oRange == "max") && (this.orientation == "vertical") && this.range[animate ? 'animate' : 'css']({ height: (100 - valPercent) + '%' }, { queue: false, duration: o.animate });
-		}
-
-	}
-	
-}));
-
-$.extend($.ui.slider, {
-	version: "@VERSION",
-	eventPrefix: "slide",
-	defaults: $.extend({}, $.ui.mouse.defaults, {
-		animate: false,
-		distance: 0,
-		max: 100,
-		min: 0,
-		orientation: 'horizontal',
-		range: false,
-		step: 1,
-		value: 0,
-		values: null
-	})
-});
-
-})(jQuery);
diff --git a/ui/ui.sortable.js b/ui/ui.sortable.js
deleted file mode 100644
index 0347f86b9..000000000
--- a/ui/ui.sortable.js
+++ /dev/null
@@ -1,1050 +0,0 @@
-/*
- * jQuery UI Sortable @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Sortables
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.sortable", $.extend({}, $.ui.mouse, {
-	_init: function() {
-
-		var o = this.options;
-		this.containerCache = {};
-		this.element.addClass("ui-sortable");
-
-		//Get the items
-		this.refresh();
-
-		//Let's determine if the items are floating
-		this.floating = this.items.length ? (/left|right/).test(this.items[0].item.css('float')) : false;
-
-		//Let's determine the parent's offset
-		this.offset = this.element.offset();
-
-		//Initialize mouse events for interaction
-		this._mouseInit();
-
-	},
-
-	destroy: function() {
-		this.element
-			.removeClass("ui-sortable ui-sortable-disabled")
-			.removeData("sortable")
-			.unbind(".sortable");
-		this._mouseDestroy();
-
-		for ( var i = this.items.length - 1; i >= 0; i-- )
-			this.items[i].item.removeData("sortable-item");
-
-		return this;
-	},
-
-	_mouseCapture: function(event, overrideHandle) {
-
-		if (this.reverting) {
-			return false;
-		}
-
-		if(this.options.disabled || this.options.type == 'static') return false;
-
-		//We have to refresh the items data once first
-		this._refreshItems(event);
-
-		//Find out if the clicked node (or one of its parents) is a actual item in this.items
-		var currentItem = null, self = this, nodes = $(event.target).parents().each(function() {
-			if($.data(this, 'sortable-item') == self) {
-				currentItem = $(this);
-				return false;
-			}
-		});
-		if($.data(event.target, 'sortable-item') == self) currentItem = $(event.target);
-
-		if(!currentItem) return false;
-		if(this.options.handle && !overrideHandle) {
-			var validHandle = false;
-
-			$(this.options.handle, currentItem).find("*").andSelf().each(function() { if(this == event.target) validHandle = true; });
-			if(!validHandle) return false;
-		}
-
-		this.currentItem = currentItem;
-		this._removeCurrentsFromItems();
-		return true;
-
-	},
-
-	_mouseStart: function(event, overrideHandle, noActivation) {
-
-		var o = this.options, self = this;
-		this.currentContainer = this;
-
-		//We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture
-		this.refreshPositions();
-
-		//Create and append the visible helper
-		this.helper = this._createHelper(event);
-
-		//Cache the helper size
-		this._cacheHelperProportions();
-
-		/*
-		 * - Position generation -
-		 * This block generates everything position related - it's the core of draggables.
-		 */
-
-		//Cache the margins of the original element
-		this._cacheMargins();
-
-		//Get the next scrolling parent
-		this.scrollParent = this.helper.scrollParent();
-
-		//The element's absolute position on the page minus margins
-		this.offset = this.currentItem.offset();
-		this.offset = {
-			top: this.offset.top - this.margins.top,
-			left: this.offset.left - this.margins.left
-		};
-
-		// Only after we got the offset, we can change the helper's position to absolute
-		// TODO: Still need to figure out a way to make relative sorting possible
-		this.helper.css("position", "absolute");
-		this.cssPosition = this.helper.css("position");
-
-		$.extend(this.offset, {
-			click: { //Where the click happened, relative to the element
-				left: event.pageX - this.offset.left,
-				top: event.pageY - this.offset.top
-			},
-			parent: this._getParentOffset(),
-			relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper
-		});
-
-		//Generate the original position
-		this.originalPosition = this._generatePosition(event);
-		this.originalPageX = event.pageX;
-		this.originalPageY = event.pageY;
-
-		//Adjust the mouse offset relative to the helper if 'cursorAt' is supplied
-		(o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt));
-
-		//Cache the former DOM position
-		this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] };
-
-		//If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way
-		if(this.helper[0] != this.currentItem[0]) {
-			this.currentItem.hide();
-		}
-
-		//Create the placeholder
-		this._createPlaceholder();
-
-		//Set a containment if given in the options
-		if(o.containment)
-			this._setContainment();
-
-		if(o.cursor) { // cursor option
-			if ($('body').css("cursor")) this._storedCursor = $('body').css("cursor");
-			$('body').css("cursor", o.cursor);
-		}
-
-		if(o.opacity) { // opacity option
-			if (this.helper.css("opacity")) this._storedOpacity = this.helper.css("opacity");
-			this.helper.css("opacity", o.opacity);
-		}
-
-		if(o.zIndex) { // zIndex option
-			if (this.helper.css("zIndex")) this._storedZIndex = this.helper.css("zIndex");
-			this.helper.css("zIndex", o.zIndex);
-		}
-
-		//Prepare scrolling
-		if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML')
-			this.overflowOffset = this.scrollParent.offset();
-
-		//Call callbacks
-		this._trigger("start", event, this._uiHash());
-
-		//Recache the helper size
-		if(!this._preserveHelperProportions)
-			this._cacheHelperProportions();
-
-
-		//Post 'activate' events to possible containers
-		if(!noActivation) {
-			 for (var i = this.containers.length - 1; i >= 0; i--) { this.containers[i]._trigger("activate", event, self._uiHash(this)); }
-		}
-
-		//Prepare possible droppables
-		if($.ui.ddmanager)
-			$.ui.ddmanager.current = this;
-
-		if ($.ui.ddmanager && !o.dropBehaviour)
-			$.ui.ddmanager.prepareOffsets(this, event);
-
-		this.dragging = true;
-
-		this.helper.addClass("ui-sortable-helper");
-		this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position
-		return true;
-
-	},
-
-	_mouseDrag: function(event) {
-
-		//Compute the helpers position
-		this.position = this._generatePosition(event);
-		this.positionAbs = this._convertPositionTo("absolute");
-
-		if (!this.lastPositionAbs) {
-			this.lastPositionAbs = this.positionAbs;
-		}
-
-		//Do scrolling
-		if(this.options.scroll) {
-			var o = this.options, scrolled = false;
-			if(this.scrollParent[0] != document && this.scrollParent[0].tagName != 'HTML') {
-
-				if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity)
-					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed;
-				else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity)
-					this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed;
-
-				if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity)
-					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed;
-				else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity)
-					this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed;
-
-			} else {
-
-				if(event.pageY - $(document).scrollTop() < o.scrollSensitivity)
-					scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed);
-				else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity)
-					scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed);
-
-				if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity)
-					scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed);
-				else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity)
-					scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed);
-
-			}
-
-			if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour)
-				$.ui.ddmanager.prepareOffsets(this, event);
-		}
-
-		//Regenerate the absolute position used for position checks
-		this.positionAbs = this._convertPositionTo("absolute");
-
-		//Set the helper position
-		if(!this.options.axis || this.options.axis != "y") this.helper[0].style.left = this.position.left+'px';
-		if(!this.options.axis || this.options.axis != "x") this.helper[0].style.top = this.position.top+'px';
-
-		//Rearrange
-		for (var i = this.items.length - 1; i >= 0; i--) {
-
-			//Cache variables and intersection, continue if no intersection
-			var item = this.items[i], itemElement = item.item[0], intersection = this._intersectsWithPointer(item);
-			if (!intersection) continue;
-
-			if(itemElement != this.currentItem[0] //cannot intersect with itself
-				&&	this.placeholder[intersection == 1 ? "next" : "prev"]()[0] != itemElement //no useless actions that have been done before
-				&&	!$.ui.contains(this.placeholder[0], itemElement) //no action if the item moved is the parent of the item checked
-				&& (this.options.type == 'semi-dynamic' ? !$.ui.contains(this.element[0], itemElement) : true)
-				//&& itemElement.parentNode == this.placeholder[0].parentNode // only rearrange items within the same container
-			) {
-
-				this.direction = intersection == 1 ? "down" : "up";
-
-				if (this.options.tolerance == "pointer" || this._intersectsWithSides(item)) {
-					this._rearrange(event, item);
-				} else {
-					break;
-				}
-
-				this._trigger("change", event, this._uiHash());
-				break;
-			}
-		}
-
-		//Post events to containers
-		this._contactContainers(event);
-
-		//Interconnect with droppables
-		if($.ui.ddmanager) $.ui.ddmanager.drag(this, event);
-
-		//Call callbacks
-		this._trigger('sort', event, this._uiHash());
-
-		this.lastPositionAbs = this.positionAbs;
-		return false;
-
-	},
-
-	_mouseStop: function(event, noPropagation) {
-
-		if(!event) return;
-
-		//If we are using droppables, inform the manager about the drop
-		if ($.ui.ddmanager && !this.options.dropBehaviour)
-			$.ui.ddmanager.drop(this, event);
-
-		if(this.options.revert) {
-			var self = this;
-			var cur = self.placeholder.offset();
-
-			self.reverting = true;
-
-			$(this.helper).animate({
-				left: cur.left - this.offset.parent.left - self.margins.left + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollLeft),
-				top: cur.top - this.offset.parent.top - self.margins.top + (this.offsetParent[0] == document.body ? 0 : this.offsetParent[0].scrollTop)
-			}, parseInt(this.options.revert, 10) || 500, function() {
-				self._clear(event);
-			});
-		} else {
-			this._clear(event, noPropagation);
-		}
-
-		return false;
-
-	},
-
-	cancel: function() {
-
-		var self = this;
-
-		if(this.dragging) {
-
-			this._mouseUp();
-
-			if(this.options.helper == "original")
-				this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
-			else
-				this.currentItem.show();
-
-			//Post deactivating events to containers
-			for (var i = this.containers.length - 1; i >= 0; i--){
-				this.containers[i]._trigger("deactivate", null, self._uiHash(this));
-				if(this.containers[i].containerCache.over) {
-					this.containers[i]._trigger("out", null, self._uiHash(this));
-					this.containers[i].containerCache.over = 0;
-				}
-			}
-
-		}
-
-		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
-		if(this.placeholder[0].parentNode) this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-		if(this.options.helper != "original" && this.helper && this.helper[0].parentNode) this.helper.remove();
-
-		$.extend(this, {
-			helper: null,
-			dragging: false,
-			reverting: false,
-			_noFinalSort: null
-		});
-
-		if(this.domPosition.prev) {
-			$(this.domPosition.prev).after(this.currentItem);
-		} else {
-			$(this.domPosition.parent).prepend(this.currentItem);
-		}
-
-		return this;
-
-	},
-
-	serialize: function(o) {
-
-		var items = this._getItemsAsjQuery(o && o.connected);
-		var str = []; o = o || {};
-
-		$(items).each(function() {
-			var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(o.expression || (/(.+)[-=_](.+)/));
-			if(res) str.push((o.key || res[1]+'[]')+'='+(o.key && o.expression ? res[1] : res[2]));
-		});
-
-		return str.join('&');
-
-	},
-
-	toArray: function(o) {
-
-		var items = this._getItemsAsjQuery(o && o.connected);
-		var ret = []; o = o || {};
-
-		items.each(function() { ret.push($(o.item || this).attr(o.attribute || 'id') || ''); });
-		return ret;
-
-	},
-
-	/* Be careful with the following core functions */
-	_intersectsWith: function(item) {
-
-		var x1 = this.positionAbs.left,
-			x2 = x1 + this.helperProportions.width,
-			y1 = this.positionAbs.top,
-			y2 = y1 + this.helperProportions.height;
-
-		var l = item.left,
-			r = l + item.width,
-			t = item.top,
-			b = t + item.height;
-
-		var dyClick = this.offset.click.top,
-			dxClick = this.offset.click.left;
-
-		var isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r;
-
-		if(	   this.options.tolerance == "pointer"
-			|| this.options.forcePointerForContainers
-			|| (this.options.tolerance != "pointer" && this.helperProportions[this.floating ? 'width' : 'height'] > item[this.floating ? 'width' : 'height'])
-		) {
-			return isOverElement;
-		} else {
-
-			return (l < x1 + (this.helperProportions.width / 2) // Right Half
-				&& x2 - (this.helperProportions.width / 2) < r // Left Half
-				&& t < y1 + (this.helperProportions.height / 2) // Bottom Half
-				&& y2 - (this.helperProportions.height / 2) < b ); // Top Half
-
-		}
-	},
-
-	_intersectsWithPointer: function(item) {
-
-		var isOverElementHeight = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
-			isOverElementWidth = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
-			isOverElement = isOverElementHeight && isOverElementWidth,
-			verticalDirection = this._getDragVerticalDirection(),
-			horizontalDirection = this._getDragHorizontalDirection();
-
-		if (!isOverElement)
-			return false;
-
-		return this.floating ?
-			( ((horizontalDirection && horizontalDirection == "right") || verticalDirection == "down") ? 2 : 1 )
-			: ( verticalDirection && (verticalDirection == "down" ? 2 : 1) );
-
-	},
-
-	_intersectsWithSides: function(item) {
-
-		var isOverBottomHalf = $.ui.isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height),
-			isOverRightHalf = $.ui.isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width),
-			verticalDirection = this._getDragVerticalDirection(),
-			horizontalDirection = this._getDragHorizontalDirection();
-
-		if (this.floating && horizontalDirection) {
-			return ((horizontalDirection == "right" && isOverRightHalf) || (horizontalDirection == "left" && !isOverRightHalf));
-		} else {
-			return verticalDirection && ((verticalDirection == "down" && isOverBottomHalf) || (verticalDirection == "up" && !isOverBottomHalf));
-		}
-
-	},
-
-	_getDragVerticalDirection: function() {
-		var delta = this.positionAbs.top - this.lastPositionAbs.top;
-		return delta != 0 && (delta > 0 ? "down" : "up");
-	},
-
-	_getDragHorizontalDirection: function() {
-		var delta = this.positionAbs.left - this.lastPositionAbs.left;
-		return delta != 0 && (delta > 0 ? "right" : "left");
-	},
-
-	refresh: function(event) {
-		this._refreshItems(event);
-		this.refreshPositions();
-		return this;
-	},
-
-	_connectWith: function() {
-		var options = this.options;
-		return options.connectWith.constructor == String
-			? [options.connectWith]
-			: options.connectWith;
-	},
-	
-	_getItemsAsjQuery: function(connected) {
-
-		var self = this;
-		var items = [];
-		var queries = [];
-		var connectWith = this._connectWith();
-
-		if(connectWith && connected) {
-			for (var i = connectWith.length - 1; i >= 0; i--){
-				var cur = $(connectWith[i]);
-				for (var j = cur.length - 1; j >= 0; j--){
-					var inst = $.data(cur[j], 'sortable');
-					if(inst && inst != this && !inst.options.disabled) {
-						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), inst]);
-					}
-				};
-			};
-		}
-
-		queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not('.ui-sortable-placeholder'), this]);
-
-		for (var i = queries.length - 1; i >= 0; i--){
-			queries[i][0].each(function() {
-				items.push(this);
-			});
-		};
-
-		return $(items);
-
-	},
-
-	_removeCurrentsFromItems: function() {
-
-		var list = this.currentItem.find(":data(sortable-item)");
-
-		for (var i=0; i < this.items.length; i++) {
-
-			for (var j=0; j < list.length; j++) {
-				if(list[j] == this.items[i].item[0])
-					this.items.splice(i,1);
-			};
-
-		};
-
-	},
-
-	_refreshItems: function(event) {
-
-		this.items = [];
-		this.containers = [this];
-		var items = this.items;
-		var self = this;
-		var queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]];
-		var connectWith = this._connectWith();
-
-		if(connectWith) {
-			for (var i = connectWith.length - 1; i >= 0; i--){
-				var cur = $(connectWith[i]);
-				for (var j = cur.length - 1; j >= 0; j--){
-					var inst = $.data(cur[j], 'sortable');
-					if(inst && inst != this && !inst.options.disabled) {
-						queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]);
-						this.containers.push(inst);
-					}
-				};
-			};
-		}
-
-		for (var i = queries.length - 1; i >= 0; i--) {
-			var targetData = queries[i][1];
-			var _queries = queries[i][0];
-
-			for (var j=0, queriesLength = _queries.length; j < queriesLength; j++) {
-				var item = $(_queries[j]);
-
-				item.data('sortable-item', targetData); // Data for target checking (mouse manager)
-
-				items.push({
-					item: item,
-					instance: targetData,
-					width: 0, height: 0,
-					left: 0, top: 0
-				});
-			};
-		};
-
-	},
-
-	refreshPositions: function(fast) {
-
-		//This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change
-		if(this.offsetParent && this.helper) {
-			this.offset.parent = this._getParentOffset();
-		}
-
-		for (var i = this.items.length - 1; i >= 0; i--){
-			var item = this.items[i];
-
-			var t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item;
-
-			if (!fast) {
-				item.width = t.outerWidth();
-				item.height = t.outerHeight();
-			}
-
-			var p = t.offset();
-			item.left = p.left;
-			item.top = p.top;
-		};
-
-		if(this.options.custom && this.options.custom.refreshContainers) {
-			this.options.custom.refreshContainers.call(this);
-		} else {
-			for (var i = this.containers.length - 1; i >= 0; i--){
-				var p = this.containers[i].element.offset();
-				this.containers[i].containerCache.left = p.left;
-				this.containers[i].containerCache.top = p.top;
-				this.containers[i].containerCache.width	= this.containers[i].element.outerWidth();
-				this.containers[i].containerCache.height = this.containers[i].element.outerHeight();
-			};
-		}
-
-		return this;
-	},
-
-	_createPlaceholder: function(that) {
-
-		var self = that || this, o = self.options;
-
-		if(!o.placeholder || o.placeholder.constructor == String) {
-			var className = o.placeholder;
-			o.placeholder = {
-				element: function() {
-
-					var el = $(document.createElement(self.currentItem[0].nodeName))
-						.addClass(className || self.currentItem[0].className+" ui-sortable-placeholder")
-						.removeClass("ui-sortable-helper")[0];
-
-					if(!className)
-						el.style.visibility = "hidden";
-
-					return el;
-				},
-				update: function(container, p) {
-
-					// 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that
-					// 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified
-					if(className && !o.forcePlaceholderSize) return;
-
-					//If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item
-					if(!p.height()) { p.height(self.currentItem.innerHeight() - parseInt(self.currentItem.css('paddingTop')||0, 10) - parseInt(self.currentItem.css('paddingBottom')||0, 10)); };
-					if(!p.width()) { p.width(self.currentItem.innerWidth() - parseInt(self.currentItem.css('paddingLeft')||0, 10) - parseInt(self.currentItem.css('paddingRight')||0, 10)); };
-				}
-			};
-		}
-
-		//Create the placeholder
-		self.placeholder = $(o.placeholder.element.call(self.element, self.currentItem));
-
-		//Append it after the actual current item
-		self.currentItem.after(self.placeholder);
-
-		//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
-		o.placeholder.update(self, self.placeholder);
-
-	},
-
-	_contactContainers: function(event) {
-		
-		// get innermost container that intersects with item 
-		var innermostContainer = null, innermostIndex = null;		
-		
-		
-		for (var i = this.containers.length - 1; i >= 0; i--){
-
-			// never consider a container that's located within the item itself 
-			if($.ui.contains(this.currentItem[0], this.containers[i].element[0]))
-				continue;
-
-			if(this._intersectsWith(this.containers[i].containerCache)) {
-
-				// if we've already found a container and it's more "inner" than this, then continue 
-				if(innermostContainer && $.ui.contains(this.containers[i].element[0], innermostContainer.element[0]))
-					continue;
-
-				innermostContainer = this.containers[i]; 
-				innermostIndex = i;
-					
-			} else {
-				// container doesn't intersect. trigger "out" event if necessary 
-				if(this.containers[i].containerCache.over) {
-					this.containers[i]._trigger("out", event, this._uiHash(this));
-					this.containers[i].containerCache.over = 0;
-				}
-			}
-
-		}
-		
-		// if no intersecting containers found, return 
-		if(!innermostContainer) return; 
-
-		// move the item into the container if it's not there already 
-		if(this.currentContainer != this.containers[innermostIndex]) { 
-
-			//When entering a new container, we will find the item with the least distance and append our item near it 
-			var dist = 10000; var itemWithLeastDistance = null; var base = this.positionAbs[this.containers[innermostIndex].floating ? 'left' : 'top']; 
-			for (var j = this.items.length - 1; j >= 0; j--) { 
-				if(!$.ui.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) continue; 
-				var cur = this.items[j][this.containers[innermostIndex].floating ? 'left' : 'top']; 
-				if(Math.abs(cur - base) < dist) { 
-					dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; 
-				} 
-			} 
-
-			if(!itemWithLeastDistance && !this.options.dropOnEmpty) //Check if dropOnEmpty is enabled 
-				return; 
-
-			this.currentContainer = this.containers[innermostIndex]; 
-			itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); 
-			this._trigger("change", event, this._uiHash()); 
-			this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); 
-
-			//Update the placeholder 
-			this.options.placeholder.update(this.currentContainer, this.placeholder); 
-		
-		} 
-	
-		this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); 
-		this.containers[innermostIndex].containerCache.over = 1;
-		
-	},
-
-	_createHelper: function(event) {
-
-		var o = this.options;
-		var helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper == 'clone' ? this.currentItem.clone() : this.currentItem);
-
-		if(!helper.parents('body').length) //Add the helper to the DOM if that didn't happen already
-			$(o.appendTo != 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]);
-
-		if(helper[0] == this.currentItem[0])
-			this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") };
-
-		if(helper[0].style.width == '' || o.forceHelperSize) helper.width(this.currentItem.width());
-		if(helper[0].style.height == '' || o.forceHelperSize) helper.height(this.currentItem.height());
-
-		return helper;
-
-	},
-
-	_adjustOffsetFromHelper: function(obj) {
-		if (typeof obj == 'string') {
-			obj = obj.split(' ');
-		}
-		if ($.isArray(obj)) {
-			obj = {left: +obj[0], top: +obj[1] || 0};
-		}
-		if ('left' in obj) {
-			this.offset.click.left = obj.left + this.margins.left;
-		}
-		if ('right' in obj) {
-			this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left;
-		}
-		if ('top' in obj) {
-			this.offset.click.top = obj.top + this.margins.top;
-		}
-		if ('bottom' in obj) {
-			this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top;
-		}
-	},
-
-	_getParentOffset: function() {
-
-
-		//Get the offsetParent and cache its position
-		this.offsetParent = this.helper.offsetParent();
-		var po = this.offsetParent.offset();
-
-		// This is a special case where we need to modify a offset calculated on start, since the following happened:
-		// 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent
-		// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that
-		//    the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag
-		if(this.cssPosition == 'absolute' && this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) {
-			po.left += this.scrollParent.scrollLeft();
-			po.top += this.scrollParent.scrollTop();
-		}
-
-		if((this.offsetParent[0] == document.body) //This needs to be actually done for all browsers, since pageX/pageY includes this information
-		|| (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() == 'html' && $.browser.msie)) //Ugly IE fix
-			po = { top: 0, left: 0 };
-
-		return {
-			top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0),
-			left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0)
-		};
-
-	},
-
-	_getRelativeOffset: function() {
-
-		if(this.cssPosition == "relative") {
-			var p = this.currentItem.position();
-			return {
-				top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(),
-				left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft()
-			};
-		} else {
-			return { top: 0, left: 0 };
-		}
-
-	},
-
-	_cacheMargins: function() {
-		this.margins = {
-			left: (parseInt(this.currentItem.css("marginLeft"),10) || 0),
-			top: (parseInt(this.currentItem.css("marginTop"),10) || 0)
-		};
-	},
-
-	_cacheHelperProportions: function() {
-		this.helperProportions = {
-			width: this.helper.outerWidth(),
-			height: this.helper.outerHeight()
-		};
-	},
-
-	_setContainment: function() {
-
-		var o = this.options;
-		if(o.containment == 'parent') o.containment = this.helper[0].parentNode;
-		if(o.containment == 'document' || o.containment == 'window') this.containment = [
-			0 - this.offset.relative.left - this.offset.parent.left,
-			0 - this.offset.relative.top - this.offset.parent.top,
-			$(o.containment == 'document' ? document : window).width() - this.helperProportions.width - this.margins.left,
-			($(o.containment == 'document' ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top
-		];
-
-		if(!(/^(document|window|parent)$/).test(o.containment)) {
-			var ce = $(o.containment)[0];
-			var co = $(o.containment).offset();
-			var over = ($(ce).css("overflow") != 'hidden');
-
-			this.containment = [
-				co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left,
-				co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top,
-				co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left,
-				co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top
-			];
-		}
-
-	},
-
-	_convertPositionTo: function(d, pos) {
-
-		if(!pos) pos = this.position;
-		var mod = d == "absolute" ? 1 : -1;
-		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
-		return {
-			top: (
-				pos.top																	// The absolute mouse position
-				+ this.offset.relative.top * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-				+ this.offset.parent.top * mod											// The offsetParent's offset without borders (offset + border)
-				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod)
-			),
-			left: (
-				pos.left																// The absolute mouse position
-				+ this.offset.relative.left * mod										// Only for relative positioned nodes: Relative offset from element to offset parent
-				+ this.offset.parent.left * mod											// The offsetParent's offset without borders (offset + border)
-				- ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod)
-			)
-		};
-
-	},
-
-	_generatePosition: function(event) {
-
-		var o = this.options, scroll = this.cssPosition == 'absolute' && !(this.scrollParent[0] != document && $.ui.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName);
-
-		// This is another very weird special case that only happens for relative elements:
-		// 1. If the css position is relative
-		// 2. and the scroll parent is the document or similar to the offset parent
-		// we have to refresh the relative offset during the scroll so there are no jumps
-		if(this.cssPosition == 'relative' && !(this.scrollParent[0] != document && this.scrollParent[0] != this.offsetParent[0])) {
-			this.offset.relative = this._getRelativeOffset();
-		}
-
-		var pageX = event.pageX;
-		var pageY = event.pageY;
-
-		/*
-		 * - Position constraining -
-		 * Constrain the position to a mix of grid, containment.
-		 */
-
-		if(this.originalPosition) { //If we are not dragging yet, we won't check for options
-
-			if(this.containment) {
-				if(event.pageX - this.offset.click.left < this.containment[0]) pageX = this.containment[0] + this.offset.click.left;
-				if(event.pageY - this.offset.click.top < this.containment[1]) pageY = this.containment[1] + this.offset.click.top;
-				if(event.pageX - this.offset.click.left > this.containment[2]) pageX = this.containment[2] + this.offset.click.left;
-				if(event.pageY - this.offset.click.top > this.containment[3]) pageY = this.containment[3] + this.offset.click.top;
-			}
-
-			if(o.grid) {
-				var top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1];
-				pageY = this.containment ? (!(top - this.offset.click.top < this.containment[1] || top - this.offset.click.top > this.containment[3]) ? top : (!(top - this.offset.click.top < this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top;
-
-				var left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0];
-				pageX = this.containment ? (!(left - this.offset.click.left < this.containment[0] || left - this.offset.click.left > this.containment[2]) ? left : (!(left - this.offset.click.left < this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left;
-			}
-
-		}
-
-		return {
-			top: (
-				pageY																// The absolute mouse position
-				- this.offset.click.top													// Click offset (relative to the element)
-				- this.offset.relative.top												// Only for relative positioned nodes: Relative offset from element to offset parent
-				- this.offset.parent.top												// The offsetParent's offset without borders (offset + border)
-				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ))
-			),
-			left: (
-				pageX																// The absolute mouse position
-				- this.offset.click.left												// Click offset (relative to the element)
-				- this.offset.relative.left												// Only for relative positioned nodes: Relative offset from element to offset parent
-				- this.offset.parent.left												// The offsetParent's offset without borders (offset + border)
-				+ ($.browser.safari && this.cssPosition == 'fixed' ? 0 : ( this.cssPosition == 'fixed' ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ))
-			)
-		};
-
-	},
-
-	_rearrange: function(event, i, a, hardRefresh) {
-
-		a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction == 'down' ? i.item[0] : i.item[0].nextSibling));
-
-		//Various things done here to improve the performance:
-		// 1. we create a setTimeout, that calls refreshPositions
-		// 2. on the instance, we have a counter variable, that get's higher after every append
-		// 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same
-		// 4. this lets only the last addition to the timeout stack through
-		this.counter = this.counter ? ++this.counter : 1;
-		var self = this, counter = this.counter;
-
-		window.setTimeout(function() {
-			if(counter == self.counter) self.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove
-		},0);
-
-	},
-
-	_clear: function(event, noPropagation) {
-
-		this.reverting = false;
-		// We delay all events that have to be triggered to after the point where the placeholder has been removed and
-		// everything else normalized again
-		var delayedTriggers = [], self = this;
-
-		// We first have to update the dom position of the actual currentItem
-		// Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088)
-		if(!this._noFinalSort && this.currentItem[0].parentNode) this.placeholder.before(this.currentItem);
-		this._noFinalSort = null;
-
-		if(this.helper[0] == this.currentItem[0]) {
-			for(var i in this._storedCSS) {
-				if(this._storedCSS[i] == 'auto' || this._storedCSS[i] == 'static') this._storedCSS[i] = '';
-			}
-			this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper");
-		} else {
-			this.currentItem.show();
-		}
-
-		if(this.fromOutside && !noPropagation) delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); });
-		if((this.fromOutside || this.domPosition.prev != this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent != this.currentItem.parent()[0]) && !noPropagation) delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed
-		if(!$.ui.contains(this.element[0], this.currentItem[0])) { //Node was moved out of the current element
-			if(!noPropagation) delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); });
-			for (var i = this.containers.length - 1; i >= 0; i--){
-				if($.ui.contains(this.containers[i].element[0], this.currentItem[0]) && !noPropagation) {
-					delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
-					delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this));  }; }).call(this, this.containers[i]));
-				}
-			};
-		};
-
-		//Post events to containers
-		for (var i = this.containers.length - 1; i >= 0; i--){
-			if(!noPropagation) delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
-			if(this.containers[i].containerCache.over) {
-				delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); };  }).call(this, this.containers[i]));
-				this.containers[i].containerCache.over = 0;
-			}
-		}
-
-		//Do what was originally in plugins
-		if(this._storedCursor) $('body').css("cursor", this._storedCursor); //Reset cursor
-		if(this._storedOpacity) this.helper.css("opacity", this._storedOpacity); //Reset opacity
-		if(this._storedZIndex) this.helper.css("zIndex", this._storedZIndex == 'auto' ? '' : this._storedZIndex); //Reset z-index
-
-		this.dragging = false;
-		if(this.cancelHelperRemoval) {
-			if(!noPropagation) {
-				this._trigger("beforeStop", event, this._uiHash());
-				for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
-				this._trigger("stop", event, this._uiHash());
-			}
-			return false;
-		}
-
-		if(!noPropagation) this._trigger("beforeStop", event, this._uiHash());
-
-		//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node!
-		this.placeholder[0].parentNode.removeChild(this.placeholder[0]);
-
-		if(this.helper[0] != this.currentItem[0]) this.helper.remove(); this.helper = null;
-
-		if(!noPropagation) {
-			for (var i=0; i < delayedTriggers.length; i++) { delayedTriggers[i].call(this, event); }; //Trigger all delayed events
-			this._trigger("stop", event, this._uiHash());
-		}
-
-		this.fromOutside = false;
-		return true;
-
-	},
-
-	_trigger: function() {
-		if ($.widget.prototype._trigger.apply(this, arguments) === false) {
-			this.cancel();
-		}
-	},
-
-	_uiHash: function(inst) {
-		var self = inst || this;
-		return {
-			helper: self.helper,
-			placeholder: self.placeholder || $([]),
-			position: self.position,
-			originalPosition: originalPosition,
-			offset: self.positionAbs,
-			item: self.currentItem,
-			sender: inst ? inst.element : null
-		};
-	}
-
-}));
-
-$.extend($.ui.sortable, {
-	version: "@VERSION",
-	eventPrefix: "sort",
-	defaults: $.extend({}, $.ui.mouse.defaults, {
-		appendTo: "parent",
-		axis: false,
-		connectWith: false,
-		containment: false,
-		cursor: 'auto',
-		cursorAt: false,
-		dropOnEmpty: true,
-		forcePlaceholderSize: false,
-		forceHelperSize: false,
-		grid: false,
-		handle: false,
-		helper: "original",
-		items: '> *',
-		opacity: false,
-		placeholder: false,
-		revert: false,
-		scroll: true,
-		scrollSensitivity: 20,
-		scrollSpeed: 20,
-		scope: "default",
-		tolerance: "intersect",
-		zIndex: 1000
-	})
-});
-
-})(jQuery);
diff --git a/ui/ui.stackfix.js b/ui/ui.stackfix.js
deleted file mode 100644
index 5631dc536..000000000
--- a/ui/ui.stackfix.js
+++ /dev/null
@@ -1,40 +0,0 @@
-/*
- * jQuery UI Stackfix @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Stackfix
- */
-
-(function($){
-
-// This is only for IE6
-$.fn.stackfix = $.browser.msie && /msie 6\.0/i.test(navigator.userAgent) ? function(s) {
-	s = $.extend({
-		top     : 'auto', // auto == .currentStyle.borderTopWidth
-		left    : 'auto', // auto == .currentStyle.borderLeftWidth
-		width   : 'auto', // auto == offsetWidth
-		height  : 'auto', // auto == offsetHeight
-		opacity : true,
-		src     : 'javascript:false;'
-	}, s || {});
-	var prop = function(n){return n&&n.constructor==Number?n+'px':n;},
-	    html = '<iframe class="ui-stackfix" frameborder="0" tabindex="-1" src="'+s.src+'" '+
-	               'style="display:block;position:absolute;z-index:-1;'+
-		               (s.opacity !== false?'filter:Alpha(Opacity=\'0\');':'')+
-				       'top:'+(s.top=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderTopWidth)||0)*-1)+\'px\')':prop(s.top))+';'+
-				       'left:'+(s.left=='auto'?'expression(((parseInt(this.parentNode.currentStyle.borderLeftWidth)||0)*-1)+\'px\')':prop(s.left))+';'+
-				       'width:'+(s.width=='auto'?'expression(this.parentNode.offsetWidth+\'px\')':prop(s.width))+';'+
-				       'height:'+(s.height=='auto'?'expression(this.parentNode.offsetHeight+\'px\')':prop(s.height))+';'+
-				'"/>';
-	return this.each(function() {
-		if ( $('> iframe.ui-stackfix', this).length == 0 )
-			this.insertBefore( document.createElement(html), this.firstChild );
-	});
-} : function() {
-	return this;
-};
-
-})(jQuery);
\ No newline at end of file
diff --git a/ui/ui.tabs.js b/ui/ui.tabs.js
deleted file mode 100644
index 83025120c..000000000
--- a/ui/ui.tabs.js
+++ /dev/null
@@ -1,708 +0,0 @@
-/*
- * jQuery UI Tabs @VERSION
- *
- * Copyright (c) 2009 AUTHORS.txt (http://jqueryui.com/about)
- * Dual licensed under the MIT (MIT-LICENSE.txt)
- * and GPL (GPL-LICENSE.txt) licenses.
- *
- * http://docs.jquery.com/UI/Tabs
- *
- * Depends:
- *	ui.core.js
- */
-(function($) {
-
-$.widget("ui.tabs", {
-
-	_init: function() {
-		if (this.options.deselectable !== undefined) {
-			this.options.collapsible = this.options.deselectable;
-		}
-		this._tabify(true);
-	},
-
-	_setData: function(key, value) {
-		if (key == 'selected') {
-			if (this.options.collapsible && value == this.options.selected) {
-				return;
-			}
-			this.select(value);
-		}
-		else {
-			this.options[key] = value;
-			if (key == 'deselectable') {
-				this.options.collapsible = value;
-			}
-			this._tabify();
-		}
-	},
-
-	_tabId: function(a) {
-		return a.title && a.title.replace(/\s/g, '_').replace(/[^A-Za-z0-9\-_:\.]/g, '') ||
-			this.options.idPrefix + $.data(a);
-	},
-
-	_sanitizeSelector: function(hash) {
-		return hash.replace(/:/g, '\\:'); // we need this because an id may contain a ":"
-	},
-
-	_cookie: function() {
-		var cookie = this.cookie || (this.cookie = this.options.cookie.name || 'ui-tabs-' + $.data(this.list[0]));
-		return $.cookie.apply(null, [cookie].concat($.makeArray(arguments)));
-	},
-
-	_ui: function(tab, panel) {
-		return {
-			tab: tab,
-			panel: panel,
-			index: this.anchors.index(tab)
-		};
-	},
-
-	_cleanup: function() {
-		// restore all former loading tabs labels
-		this.lis.filter('.ui-state-processing').removeClass('ui-state-processing')
-				.find('span:data(label.tabs)')
-				.each(function() {
-					var el = $(this);
-					el.html(el.data('label.tabs')).removeData('label.tabs');
-				});
-	},
-
-	_tabify: function(init) {
-
-		this.list = this.element.children('ul:first');
-		this.lis = $('li:has(a[href])', this.list);
-		this.anchors = this.lis.map(function() { return $('a', this)[0]; });
-		this.panels = $([]);
-
-		var self = this, o = this.options;
-
-		var fragmentId = /^#.+/; // Safari 2 reports '#' for an empty hash
-		this.anchors.each(function(i, a) {
-			var href = $(a).attr('href');
-
-			// For dynamically created HTML that contains a hash as href IE < 8 expands
-			// such href to the full page url with hash and then misinterprets tab as ajax.
-			// Same consideration applies for an added tab with a fragment identifier
-			// since a[href=#fragment-identifier] does unexpectedly not match.
-			// Thus normalize href attribute...
-			var hrefBase = href.split('#')[0], baseEl;
-			if (hrefBase && (hrefBase === location.toString().split('#')[0] ||
-					(baseEl = $('base')[0]) && hrefBase === baseEl.href)) {
-				href = a.hash;
-				a.href = href;
-			}
-
-			// inline tab
-			if (fragmentId.test(href)) {
-				self.panels = self.panels.add(self._sanitizeSelector(href));
-			}
-
-			// remote tab
-			else if (href != '#') { // prevent loading the page itself if href is just "#"
-				$.data(a, 'href.tabs', href); // required for restore on destroy
-
-				// TODO until #3808 is fixed strip fragment identifier from url
-				// (IE fails to load from such url)
-				$.data(a, 'load.tabs', href.replace(/#.*$/, '')); // mutable data
-
-				var id = self._tabId(a);
-				a.href = '#' + id;
-				var $panel = $('#' + id);
-				if (!$panel.length) {
-					$panel = $(o.panelTemplate).attr('id', id).addClass('ui-tabs-panel ui-widget-content ui-corner-bottom')
-						.insertAfter(self.panels[i - 1] || self.list);
-					$panel.data('destroy.tabs', true);
-				}
-				self.panels = self.panels.add($panel);
-			}
-
-			// invalid tab href
-			else {
-				o.disabled.push(i);
-			}
-		});
-
-		// initialization from scratch
-		if (init) {
-
-			// attach necessary classes for styling
-			this.element.addClass('ui-tabs ui-widget ui-widget-content ui-corner-all');
-			this.list.addClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
-			this.lis.addClass('ui-state-default ui-corner-top');
-			this.panels.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom');
-
-			// Selected tab
-			// use "selected" option or try to retrieve:
-			// 1. from fragment identifier in url
-			// 2. from cookie
-			// 3. from selected class attribute on <li>
-			if (o.selected === undefined) {
-				if (location.hash) {
-					this.anchors.each(function(i, a) {
-						if (a.hash == location.hash) {
-							o.selected = i;
-							return false; // break
-						}
-					});
-				}
-				if (typeof o.selected != 'number' && o.cookie) {
-					o.selected = parseInt(self._cookie(), 10);
-				}
-				if (typeof o.selected != 'number' && this.lis.filter('.ui-tabs-selected').length) {
-					o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
-				}
-				o.selected = o.selected || 0;
-			}
-			else if (o.selected === null) { // usage of null is deprecated, TODO remove in next release
-				o.selected = -1;
-			}
-
-			// sanity check - default to first tab...
-			o.selected = ((o.selected >= 0 && this.anchors[o.selected]) || o.selected < 0) ? o.selected : 0;
-
-			// Take disabling tabs via class attribute from HTML
-			// into account and update option properly.
-			// A selected tab cannot become disabled.
-			o.disabled = $.unique(o.disabled.concat(
-				$.map(this.lis.filter('.ui-state-disabled'),
-					function(n, i) { return self.lis.index(n); } )
-			)).sort();
-
-			if ($.inArray(o.selected, o.disabled) != -1) {
-				o.disabled.splice($.inArray(o.selected, o.disabled), 1);
-			}
-
-			// highlight selected tab
-			this.panels.addClass('ui-tabs-hide');
-			this.lis.removeClass('ui-tabs-selected ui-state-active');
-			if (o.selected >= 0 && this.anchors.length) { // check for length avoids error when initializing empty list
-				this.panels.eq(o.selected).removeClass('ui-tabs-hide');
-				this.lis.eq(o.selected).addClass('ui-tabs-selected ui-state-active');
-
-				// seems to be expected behavior that the show callback is fired
-				self.element.queue("tabs", function() {
-					self._trigger('show', null, self._ui(self.anchors[o.selected], self.panels[o.selected]));
-				});
-				
-				this.load(o.selected);
-			}
-
-			// clean up to avoid memory leaks in certain versions of IE 6
-			$(window).bind('unload', function() {
-				self.lis.add(self.anchors).unbind('.tabs');
-				self.lis = self.anchors = self.panels = null;
-			});
-
-		}
-		// update selected after add/remove
-		else {
-			o.selected = this.lis.index(this.lis.filter('.ui-tabs-selected'));
-		}
-
-		// update collapsible
-		this.element[o.collapsible ? 'addClass' : 'removeClass']('ui-tabs-collapsible');
-
-		// set or update cookie after init and add/remove respectively
-		if (o.cookie) {
-			this._cookie(o.selected, o.cookie);
-		}
-
-		// disable tabs
-		for (var i = 0, li; (li = this.lis[i]); i++) {
-			$(li)[$.inArray(i, o.disabled) != -1 &&
-				!$(li).hasClass('ui-tabs-selected') ? 'addClass' : 'removeClass']('ui-state-disabled');
-		}
-
-		// reset cache if switching from cached to not cached
-		if (o.cache === false) {
-			this.anchors.removeData('cache.tabs');
-		}
-
-		// remove all handlers before, tabify may run on existing tabs after add or option change
-		this.lis.add(this.anchors).unbind('.tabs');
-
-		if (o.event != 'mouseover') {
-			var addState = function(state, el) {
-				if (el.is(':not(.ui-state-disabled)')) {
-					el.addClass('ui-state-' + state);
-				}
-			};
-			var removeState = function(state, el) {
-				el.removeClass('ui-state-' + state);
-			};
-			this.lis.bind('mouseover.tabs', function() {
-				addState('hover', $(this));
-			});
-			this.lis.bind('mouseout.tabs', function() {
-				removeState('hover', $(this));
-			});
-			this.anchors.bind('focus.tabs', function() {
-				addState('focus', $(this).closest('li'));
-			});
-			this.anchors.bind('blur.tabs', function() {
-				removeState('focus', $(this).closest('li'));
-			});
-		}
-
-		// set up animations
-		var hideFx, showFx;
-		if (o.fx) {
-			if ($.isArray(o.fx)) {
-				hideFx = o.fx[0];
-				showFx = o.fx[1];
-			}
-			else {
-				hideFx = showFx = o.fx;
-			}
-		}
-
-		// Reset certain styles left over from animation
-		// and prevent IE's ClearType bug...
-		function resetStyle($el, fx) {
-			$el.css({ display: '' });
-			if (!$.support.opacity && fx.opacity) {
-				$el[0].style.removeAttribute('filter');
-			}
-		}
-
-		// Show a tab...
-		var showTab = showFx ?
-			function(clicked, $show) {
-				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
-				$show.hide().removeClass('ui-tabs-hide') // avoid flicker that way
-					.animate(showFx, showFx.duration || 'normal', function() {
-						resetStyle($show, showFx);
-						self._trigger('show', null, self._ui(clicked, $show[0]));
-					});
-			} :
-			function(clicked, $show) {
-				$(clicked).closest('li').removeClass('ui-state-default').addClass('ui-tabs-selected ui-state-active');
-				$show.removeClass('ui-tabs-hide');
-				self._trigger('show', null, self._ui(clicked, $show[0]));
-			};
-
-		// Hide a tab, $show is optional...
-		var hideTab = hideFx ?
-			function(clicked, $hide) {
-				$hide.animate(hideFx, hideFx.duration || 'normal', function() {
-					self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
-					$hide.addClass('ui-tabs-hide');
-					resetStyle($hide, hideFx);
-					self.element.dequeue("tabs");
-				});
-			} :
-			function(clicked, $hide, $show) {
-				self.lis.removeClass('ui-tabs-selected ui-state-active').addClass('ui-state-default');
-				$hide.addClass('ui-tabs-hide');
-				self.element.dequeue("tabs");
-			};
-
-		// attach tab event handler, unbind to avoid duplicates from former tabifying...
-		this.anchors.bind(o.event + '.tabs', function() {
-			var el = this, $li = $(this).closest('li'), $hide = self.panels.filter(':not(.ui-tabs-hide)'),
-					$show = $(self._sanitizeSelector(this.hash));
-
-			// If tab is already selected and not collapsible or tab disabled or
-			// or is already loading or click callback returns false stop here.
-			// Check if click handler returns false last so that it is not executed
-			// for a disabled or loading tab!
-			if (($li.hasClass('ui-tabs-selected') && !o.collapsible) ||
-				$li.hasClass('ui-state-disabled') ||
-				$li.hasClass('ui-state-processing') ||
-				self._trigger('select', null, self._ui(this, $show[0])) === false) {
-				this.blur();
-				return false;
-			}
-
-			o.selected = self.anchors.index(this);
-
-			self.abort();
-
-			// if tab may be closed
-			if (o.collapsible) {
-				if ($li.hasClass('ui-tabs-selected')) {
-					o.selected = -1;
-
-					if (o.cookie) {
-						self._cookie(o.selected, o.cookie);
-					}
-
-					self.element.queue("tabs", function() {
-						hideTab(el, $hide);
-					}).dequeue("tabs");
-					
-					this.blur();
-					return false;
-				}
-				else if (!$hide.length) {
-					if (o.cookie) {
-						self._cookie(o.selected, o.cookie);
-					}
-					
-					self.element.queue("tabs", function() {
-						showTab(el, $show);
-					});
-
-					self.load(self.anchors.index(this)); // TODO make passing in node possible, see also http://dev.jqueryui.com/ticket/3171
-					
-					this.blur();
-					return false;
-				}
-			}
-
-			if (o.cookie) {
-				self._cookie(o.selected, o.cookie);
-			}
-
-			// show new tab
-			if ($show.length) {
-				if ($hide.length) {
-					self.element.queue("tabs", function() {
-						hideTab(el, $hide);
-					});
-				}
-				self.element.queue("tabs", function() {
-					showTab(el, $show);
-				});
-				
-				self.load(self.anchors.index(this));
-			}
-			else {
-				throw 'jQuery UI Tabs: Mismatching fragment identifier.';
-			}
-
-			// Prevent IE from keeping other link focussed when using the back button
-			// and remove dotted border from clicked link. This is controlled via CSS
-			// in modern browsers; blur() removes focus from address bar in Firefox
-			// which can become a usability and annoying problem with tabs('rotate').
-			if ($.browser.msie) {
-				this.blur();
-			}
-
-		});
-
-		// disable click in any case
-		this.anchors.bind('click.tabs', function(){return false;});
-
-	},
-
-	destroy: function() {
-		var o = this.options;
-
-		this.abort();
-		
-		this.element.unbind('.tabs')
-			.removeClass('ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible')
-			.removeData('tabs');
-
-		this.list.removeClass('ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all');
-
-		this.anchors.each(function() {
-			var href = $.data(this, 'href.tabs');
-			if (href) {
-				this.href = href;
-			}
-			var $this = $(this).unbind('.tabs');
-			$.each(['href', 'load', 'cache'], function(i, prefix) {
-				$this.removeData(prefix + '.tabs');
-			});
-		});
-
-		this.lis.unbind('.tabs').add(this.panels).each(function() {
-			if ($.data(this, 'destroy.tabs')) {
-				$(this).remove();
-			}
-			else {
-				$(this).removeClass([
-					'ui-state-default',
-					'ui-corner-top',
-					'ui-tabs-selected',
-					'ui-state-active',
-					'ui-state-hover',
-					'ui-state-focus',
-					'ui-state-disabled',
-					'ui-tabs-panel',
-					'ui-widget-content',
-					'ui-corner-bottom',
-					'ui-tabs-hide'
-				].join(' '));
-			}
-		});
-
-		if (o.cookie) {
-			this._cookie(null, o.cookie);
-		}
-
-		return this;
-	},
-
-	add: function(url, label, index) {
-		if (index === undefined) {
-			index = this.anchors.length; // append by default
-		}
-
-		var self = this, o = this.options,
-			$li = $(o.tabTemplate.replace(/#\{href\}/g, url).replace(/#\{label\}/g, label)),
-			id = !url.indexOf('#') ? url.replace('#', '') : this._tabId($('a', $li)[0]);
-
-		$li.addClass('ui-state-default ui-corner-top').data('destroy.tabs', true);
-
-		// try to find an existing element before creating a new one
-		var $panel = $('#' + id);
-		if (!$panel.length) {
-			$panel = $(o.panelTemplate).attr('id', id).data('destroy.tabs', true);
-		}
-		$panel.addClass('ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide');
-
-		if (index >= this.lis.length) {
-			$li.appendTo(this.list);
-			$panel.appendTo(this.list[0].parentNode);
-		}
-		else {
-			$li.insertBefore(this.lis[index]);
-			$panel.insertBefore(this.panels[index]);
-		}
-
-		o.disabled = $.map(o.disabled,
-			function(n, i) { return n >= index ? ++n : n; });
-
-		this._tabify();
-
-		if (this.anchors.length == 1) { // after tabify
-			$li.addClass('ui-tabs-selected ui-state-active');
-			$panel.removeClass('ui-tabs-hide');
-			this.element.queue("tabs", function() {
-				self._trigger('show', null, self._ui(self.anchors[0], self.panels[0]));
-			});
-				
-			this.load(0);
-		}
-
-		// callback
-		this._trigger('add', null, this._ui(this.anchors[index], this.panels[index]));
-		return this;
-	},
-
-	remove: function(index) {
-		var o = this.options, $li = this.lis.eq(index).remove(),
-			$panel = this.panels.eq(index).remove();
-
-		// If selected tab was removed focus tab to the right or
-		// in case the last tab was removed the tab to the left.
-		if ($li.hasClass('ui-tabs-selected') && this.anchors.length > 1) {
-			this.select(index + (index + 1 < this.anchors.length ? 1 : -1));
-		}
-
-		o.disabled = $.map($.grep(o.disabled, function(n, i) { return n != index; }),
-			function(n, i) { return n >= index ? --n : n; });
-
-		this._tabify();
-
-		// callback
-		this._trigger('remove', null, this._ui($li.find('a')[0], $panel[0]));
-		return this;
-	},
-
-	enable: function(index) {
-		var o = this.options;
-		if ($.inArray(index, o.disabled) == -1) {
-			return;
-		}
-
-		this.lis.eq(index).removeClass('ui-state-disabled');
-		o.disabled = $.grep(o.disabled, function(n, i) { return n != index; });
-
-		// callback
-		this._trigger('enable', null, this._ui(this.anchors[index], this.panels[index]));
-		return this;
-	},
-
-	disable: function(index) {
-		var self = this, o = this.options;
-		if (index != o.selected) { // cannot disable already selected tab
-			this.lis.eq(index).addClass('ui-state-disabled');
-
-			o.disabled.push(index);
-			o.disabled.sort();
-
-			// callback
-			this._trigger('disable', null, this._ui(this.anchors[index], this.panels[index]));
-		}
-
-		return this;
-	},
-
-	select: function(index) {
-		if (typeof index == 'string') {
-			index = this.anchors.index(this.anchors.filter('[href$=' + index + ']'));
-		}
-		else if (index === null) { // usage of null is deprecated, TODO remove in next release
-			index = -1;
-		}
-		if (index == -1 && this.options.collapsible) {
-			index = this.options.selected;
-		}
-
-		this.anchors.eq(index).trigger(this.options.event + '.tabs');
-		return this;
-	},
-
-	load: function(index) {
-		var self = this, o = this.options, a = this.anchors.eq(index)[0], url = $.data(a, 'load.tabs');
-
-		this.abort();
-
-		// not remote or from cache
-		if (!url || this.element.queue("tabs").length !== 0 && $.data(a, 'cache.tabs')) {
-			this.element.dequeue("tabs");
-			return;
-		}
-
-		// load remote from here on
-		this.lis.eq(index).addClass('ui-state-processing');
-
-		if (o.spinner) {
-			var span = $('span', a);
-			span.data('label.tabs', span.html()).html(o.spinner);
-		}
-
-		this.xhr = $.ajax($.extend({}, o.ajaxOptions, {
-			url: url,
-			success: function(r, s) {
-				$(self._sanitizeSelector(a.hash)).html(r);
-
-				// take care of tab labels
-				self._cleanup();
-
-				if (o.cache) {
-					$.data(a, 'cache.tabs', true); // if loaded once do not load them again
-				}
-
-				// callbacks
-				self._trigger('load', null, self._ui(self.anchors[index], self.panels[index]));
-				try {
-					o.ajaxOptions.success(r, s);
-				}
-				catch (e) {}
-
-				// last, so that load event is fired before show...
-				self.element.dequeue("tabs");
-			}
-		}));
-
-		return this;
-	},
-
-	abort: function() {
-		// stop possibly running animations
-		this.element.queue([]);
-		this.panels.stop(false, true);
-
-		// "tabs" queue must not contain more than two elements,
-		// which are the callbacks for the latest clicked tab...
-		this.element.queue("tabs", this.element.queue("tabs").splice(-2, 2));
-
-		// terminate pending requests from other tabs
-		if (this.xhr) {
-			this.xhr.abort();
-			delete this.xhr;
-		}
-
-		// take care of tab labels
-		this._cleanup();
-		return this;
-	},
-
-	url: function(index, url) {
-		this.anchors.eq(index).removeData('cache.tabs').data('load.tabs', url);
-		return this;
-	},
-
-	length: function() {
-		return this.anchors.length;
-	}
-
-});
-
-$.extend($.ui.tabs, {
-	version: '@VERSION',
-	defaults: {
-		add: null,
-		ajaxOptions: null,
-		cache: false,
-		cookie: null, // e.g. { expires: 7, path: '/', domain: 'jquery.com', secure: true }
-		collapsible: false,
-		disable: null,
-		disabled: [],
-		enable: null,
-		event: 'click',
-		fx: null, // e.g. { height: 'toggle', opacity: 'toggle', duration: 200 }
-		idPrefix: 'ui-tabs-',
-		load: null,
-		panelTemplate: '<div></div>',
-		remove: null,
-		select: null,
-		show: null,
-		spinner: '<em>Loading&#8230;</em>',
-		tabTemplate: '<li><a href="#{href}"><span>#{label}</span></a></li>'
-	}
-});
-
-/*
- * Tabs Extensions
- */
-
-/*
- * Rotate
- */
-$.extend($.ui.tabs.prototype, {
-	rotation: null,
-	rotate: function(ms, continuing) {
-
-		var self = this, o = this.options;
-		
-		var rotate = self._rotate || (self._rotate = function(e) {
-			clearTimeout(self.rotation);
-			self.rotation = setTimeout(function() {
-				var t = o.selected;
-				self.select( ++t < self.anchors.length ? t : 0 );
-			}, ms);
-			
-			if (e) {
-				e.stopPropagation();
-			}
-		});
-		
-		var stop = self._unrotate || (self._unrotate = !continuing ?
-			function(e) {
-				if (e.clientX) { // in case of a true click
-					self.rotate(null);
-				}
-			} :
-			function(e) {
-				t = o.selected;
-				rotate();
-			});
-
-		// start rotation
-		if (ms) {
-			this.element.bind('tabsshow', rotate);
-			this.anchors.bind(o.event + '.tabs', stop);
-			rotate();
-		}
-		// stop rotation
-		else {
-			clearTimeout(self.rotation);
-			this.element.unbind('tabsshow', rotate);
-			this.anchors.unbind(o.event + '.tabs', stop);
-			delete this._rotate;
-			delete this._unrotate;
-		}
-
-		return this;
-	}
-});
-
-})(jQuery);
-- 
cgit v1.2.3