diff options
Diffstat (limited to 'core')
97 files changed, 17147 insertions, 1692 deletions
diff --git a/core/ajax/share.php b/core/ajax/share.php index 72ffc52e997..077baa8ba56 100644 --- a/core/ajax/share.php +++ b/core/ajax/share.php @@ -98,7 +98,7 @@ if (isset($_POST['action']) && isset($_POST['itemType']) && isset($_POST['itemSo OCP\Util::sendMail($to_address, $to_address, $subject, $text, $from_address, $user); OCP\JSON::success(); } catch (Exception $exception) { - OCP\JSON::error(array('data' => array('message' => $exception->getMessage()))); + OCP\JSON::error(array('data' => array('message' => OC_Util::sanitizeHTML($exception->getMessage())))); } break; } diff --git a/core/ajax/update.php b/core/ajax/update.php new file mode 100644 index 00000000000..20ab045c892 --- /dev/null +++ b/core/ajax/update.php @@ -0,0 +1,67 @@ +<?php +set_time_limit(0); +$RUNTIME_NOAPPS = true; +require_once '../../lib/base.php'; + +if (OC::checkUpgrade(false)) { + $updateEventSource = new OC_EventSource(); + $watcher = new UpdateWatcher($updateEventSource); + OC_Hook::connect('update', 'success', $watcher, 'success'); + OC_Hook::connect('update', 'error', $watcher, 'error'); + OC_Hook::connect('update', 'error', $watcher, 'failure'); + $watcher->success('Turned on maintenance mode'); + try { + $result = OC_DB::updateDbFromStructure(OC::$SERVERROOT.'/db_structure.xml'); + $watcher->success('Updated database'); + } catch (Exception $exception) { + $watcher->failure($exception->getMessage()); + } + $minimizerCSS = new OC_Minimizer_CSS(); + $minimizerCSS->clearCache(); + $minimizerJS = new OC_Minimizer_JS(); + $minimizerJS->clearCache(); + OC_Config::setValue('version', implode('.', OC_Util::getVersion())); + OC_App::checkAppsRequirements(); + // load all apps to also upgrade enabled apps + OC_App::loadApps(); + OC_Config::setValue('maintenance', false); + $watcher->success('Turned off maintenance mode'); + $watcher->done(); +} + +class UpdateWatcher { + /** + * @var \OC_EventSource $eventSource; + */ + private $eventSource; + + public function __construct($eventSource) { + $this->eventSource = $eventSource; + } + + public function success($message) { + OC_Util::obEnd(); + $this->eventSource->send('success', $message); + ob_start(); + } + + public function error($message) { + OC_Util::obEnd(); + $this->eventSource->send('error', $message); + ob_start(); + } + + public function failure($message) { + OC_Util::obEnd(); + $this->eventSource->send('failure', $message); + $this->eventSource->close(); + die(); + } + + public function done() { + OC_Util::obEnd(); + $this->eventSource->send('done', ''); + $this->eventSource->close(); + } + +}
\ No newline at end of file diff --git a/core/css/images/animated-overlay.gif b/core/css/images/animated-overlay.gif Binary files differnew file mode 100644 index 00000000000..d441f75ebfb --- /dev/null +++ b/core/css/images/animated-overlay.gif diff --git a/core/css/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/core/css/images/ui-bg_diagonals-thick_18_b81900_40x40.png Binary files differnew file mode 100644 index 00000000000..954e22dbd99 --- /dev/null +++ b/core/css/images/ui-bg_diagonals-thick_18_b81900_40x40.png diff --git a/core/css/images/ui-bg_diagonals-thick_20_666666_40x40.png b/core/css/images/ui-bg_diagonals-thick_20_666666_40x40.png Binary files differnew file mode 100644 index 00000000000..64ece5707d9 --- /dev/null +++ b/core/css/images/ui-bg_diagonals-thick_20_666666_40x40.png diff --git a/core/css/images/ui-bg_flat_100_ffffff_40x100.png b/core/css/images/ui-bg_flat_100_ffffff_40x100.png Binary files differnew file mode 100644 index 00000000000..ac8b229af95 --- /dev/null +++ b/core/css/images/ui-bg_flat_100_ffffff_40x100.png diff --git a/core/css/images/ui-bg_flat_10_000000_40x100.png b/core/css/images/ui-bg_flat_10_000000_40x100.png Binary files differnew file mode 100644 index 00000000000..abdc01082bf --- /dev/null +++ b/core/css/images/ui-bg_flat_10_000000_40x100.png diff --git a/core/css/images/ui-bg_flat_35_1d2d44_40x100.png b/core/css/images/ui-bg_flat_35_1d2d44_40x100.png Binary files differnew file mode 100644 index 00000000000..904ef14c37d --- /dev/null +++ b/core/css/images/ui-bg_flat_35_1d2d44_40x100.png diff --git a/core/css/images/ui-bg_glass_100_f8f8f8_1x400.png b/core/css/images/ui-bg_glass_100_f8f8f8_1x400.png Binary files differnew file mode 100644 index 00000000000..cd79e9f1966 --- /dev/null +++ b/core/css/images/ui-bg_glass_100_f8f8f8_1x400.png diff --git a/core/css/images/ui-bg_highlight-hard_100_f8f8f8_1x100.png b/core/css/images/ui-bg_highlight-hard_100_f8f8f8_1x100.png Binary files differnew file mode 100644 index 00000000000..268e650935d --- /dev/null +++ b/core/css/images/ui-bg_highlight-hard_100_f8f8f8_1x100.png diff --git a/core/css/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/core/css/images/ui-bg_highlight-soft_100_eeeeee_1x100.png Binary files differnew file mode 100644 index 00000000000..f1273672d25 --- /dev/null +++ b/core/css/images/ui-bg_highlight-soft_100_eeeeee_1x100.png diff --git a/core/css/images/ui-icons_1d2d44_256x240.png b/core/css/images/ui-icons_1d2d44_256x240.png Binary files differnew file mode 100644 index 00000000000..2a857e4da57 --- /dev/null +++ b/core/css/images/ui-icons_1d2d44_256x240.png diff --git a/core/css/images/ui-icons_222222_256x240.png b/core/css/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 00000000000..b273ff111d2 --- /dev/null +++ b/core/css/images/ui-icons_222222_256x240.png diff --git a/core/css/images/ui-icons_ffd27a_256x240.png b/core/css/images/ui-icons_ffd27a_256x240.png Binary files differnew file mode 100644 index 00000000000..e117effa3dc --- /dev/null +++ b/core/css/images/ui-icons_ffd27a_256x240.png diff --git a/core/css/images/ui-icons_ffffff_256x240.png b/core/css/images/ui-icons_ffffff_256x240.png Binary files differnew file mode 100644 index 00000000000..42f8f992c72 --- /dev/null +++ b/core/css/images/ui-icons_ffffff_256x240.png diff --git a/core/css/jquery-ui-1.10.0.custom.css b/core/css/jquery-ui-1.10.0.custom.css new file mode 100644 index 00000000000..a1e9895c776 --- /dev/null +++ b/core/css/jquery-ui-1.10.0.custom.css @@ -0,0 +1,1174 @@ +/*! jQuery UI - v1.10.0 - 2013-01-22 +* http://jqueryui.com +* Includes: jquery.ui.core.css, jquery.ui.resizable.css, jquery.ui.selectable.css, jquery.ui.accordion.css, jquery.ui.autocomplete.css, jquery.ui.button.css, jquery.ui.datepicker.css, jquery.ui.dialog.css, jquery.ui.menu.css, jquery.ui.progressbar.css, jquery.ui.slider.css, jquery.ui.spinner.css, jquery.ui.tabs.css, jquery.ui.tooltip.css +* To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=%22Lucida%20Grande%22%2C%20Arial%2C%20Verdana%2C%20sans-serif&fwDefault=bold&fsDefault=1em&cornerRadius=4px&bgColorHeader=1d2d44&bgTextureHeader=01_flat.png&bgImgOpacityHeader=35&borderColorHeader=1d2d44&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f8f8f8&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=ddd&fcDefault=555&iconColorDefault=1d2d44&bgColorHover=ffffff&bgTextureHover=01_flat.png&bgImgOpacityHover=100&borderColorHover=ddd&fcHover=333&iconColorHover=1d2d44&bgColorActive=f8f8f8&bgTextureActive=02_glass.png&bgImgOpacityActive=100&borderColorActive=1d2d44&fcActive=1d2d44&iconColorActive=1d2d44&bgColorHighlight=f8f8f8&bgTextureHighlight=04_highlight_hard.png&bgImgOpacityHighlight=100&borderColorHighlight=ddd&fcHighlight=555&iconColorHighlight=ffffff&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px +* Copyright (c) 2013 jQuery Foundation and other contributors Licensed MIT */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { + display: none; +} +.ui-helper-hidden-accessible { + border: 0; + clip: rect(0 0 0 0); + height: 1px; + margin: -1px; + overflow: hidden; + padding: 0; + position: absolute; + width: 1px; +} +.ui-helper-reset { + margin: 0; + padding: 0; + border: 0; + outline: 0; + line-height: 1.3; + text-decoration: none; + font-size: 100%; + list-style: none; +} +.ui-helper-clearfix:before, +.ui-helper-clearfix:after { + content: ""; + display: table; +} +.ui-helper-clearfix:after { + clear: both; +} +.ui-helper-clearfix { + min-height: 0; /* support: IE7 */ +} +.ui-helper-zfix { + width: 100%; + height: 100%; + top: 0; + left: 0; + position: absolute; + opacity: 0; + filter:Alpha(Opacity=0); +} + +.ui-front { + z-index: 100; +} + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { + cursor: default !important; +} + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { + display: block; + text-indent: -99999px; + overflow: hidden; + background-repeat: no-repeat; +} + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { + position: fixed; + top: 0; + left: 0; + width: 100%; + height: 100%; +} +.ui-resizable { + position: relative; +} +.ui-resizable-handle { + position: absolute; + font-size: 0.1px; + display: block; +} +.ui-resizable-disabled .ui-resizable-handle, +.ui-resizable-autohide .ui-resizable-handle { + display: none; +} +.ui-resizable-n { + cursor: n-resize; + height: 7px; + width: 100%; + top: -5px; + left: 0; +} +.ui-resizable-s { + cursor: s-resize; + height: 7px; + width: 100%; + bottom: -5px; + left: 0; +} +.ui-resizable-e { + cursor: e-resize; + width: 7px; + right: -5px; + top: 0; + height: 100%; +} +.ui-resizable-w { + cursor: w-resize; + width: 7px; + left: -5px; + top: 0; + height: 100%; +} +.ui-resizable-se { + cursor: se-resize; + width: 12px; + height: 12px; + right: 1px; + bottom: 1px; +} +.ui-resizable-sw { + cursor: sw-resize; + width: 9px; + height: 9px; + left: -5px; + bottom: -5px; +} +.ui-resizable-nw { + cursor: nw-resize; + width: 9px; + height: 9px; + left: -5px; + top: -5px; +} +.ui-resizable-ne { + cursor: ne-resize; + width: 9px; + height: 9px; + right: -5px; + top: -5px; +} +.ui-selectable-helper { + position: absolute; + z-index: 100; + border: 1px dotted black; +} +.ui-accordion .ui-accordion-header { + display: block; + cursor: pointer; + position: relative; + margin-top: 2px; + padding: .5em .5em .5em .7em; + min-height: 0; /* support: IE7 */ +} +.ui-accordion .ui-accordion-icons { + padding-left: 2.2em; +} +.ui-accordion .ui-accordion-noicons { + padding-left: .7em; +} +.ui-accordion .ui-accordion-icons .ui-accordion-icons { + padding-left: 2.2em; +} +.ui-accordion .ui-accordion-header .ui-accordion-header-icon { + position: absolute; + left: .5em; + top: 50%; + margin-top: -8px; +} +.ui-accordion .ui-accordion-content { + padding: 1em 2.2em; + border-top: 0; + overflow: auto; +} +.ui-autocomplete { + position: absolute; + top: 0; + left: 0; + cursor: default; +} +.ui-button { + display: inline-block; + position: relative; + padding: 0; + line-height: normal; + margin-right: .1em; + cursor: pointer; + vertical-align: middle; + text-align: center; + overflow: visible; /* removes extra width in IE */ +} +.ui-button, +.ui-button:link, +.ui-button:visited, +.ui-button:hover, +.ui-button:active { + text-decoration: none; +} +/* to make room for the icon, a width needs to be set here */ +.ui-button-icon-only { + width: 2.2em; +} +/* button elements seem to need a little more width */ +button.ui-button-icon-only { + width: 2.4em; +} +.ui-button-icons-only { + width: 3.4em; +} +button.ui-button-icons-only { + width: 3.7em; +} + +/* button text element */ +.ui-button .ui-button-text { + display: block; + line-height: normal; +} +.ui-button-text-only .ui-button-text { + padding: .4em 1em; +} +.ui-button-icon-only .ui-button-text, +.ui-button-icons-only .ui-button-text { + padding: .4em; + text-indent: -9999999px; +} +.ui-button-text-icon-primary .ui-button-text, +.ui-button-text-icons .ui-button-text { + padding: .4em 1em .4em 2.1em; +} +.ui-button-text-icon-secondary .ui-button-text, +.ui-button-text-icons .ui-button-text { + padding: .4em 2.1em .4em 1em; +} +.ui-button-text-icons .ui-button-text { + padding-left: 2.1em; + padding-right: 2.1em; +} +/* no icon support for input elements, provide padding by default */ +input.ui-button { + padding: .4em 1em; +} + +/* button icon element(s) */ +.ui-button-icon-only .ui-icon, +.ui-button-text-icon-primary .ui-icon, +.ui-button-text-icon-secondary .ui-icon, +.ui-button-text-icons .ui-icon, +.ui-button-icons-only .ui-icon { + position: absolute; + top: 50%; + margin-top: -8px; +} +.ui-button-icon-only .ui-icon { + left: 50%; + margin-left: -8px; +} +.ui-button-text-icon-primary .ui-button-icon-primary, +.ui-button-text-icons .ui-button-icon-primary, +.ui-button-icons-only .ui-button-icon-primary { + left: .5em; +} +.ui-button-text-icon-secondary .ui-button-icon-secondary, +.ui-button-text-icons .ui-button-icon-secondary, +.ui-button-icons-only .ui-button-icon-secondary { + right: .5em; +} + +/* button sets */ +.ui-buttonset { + margin-right: 7px; +} +.ui-buttonset .ui-button { + margin-left: 0; + margin-right: -.3em; +} + +/* workarounds */ +/* reset extra padding in Firefox, see h5bp.com/l */ +input.ui-button::-moz-focus-inner, +button.ui-button::-moz-focus-inner { + border: 0; + padding: 0; +} +.ui-datepicker { + width: 17em; + padding: .2em .2em 0; + display: none; +} +.ui-datepicker .ui-datepicker-header { + position: relative; + padding: .2em 0; +} +.ui-datepicker .ui-datepicker-prev, +.ui-datepicker .ui-datepicker-next { + position: absolute; + top: 2px; + width: 1.8em; + height: 1.8em; +} +.ui-datepicker .ui-datepicker-prev-hover, +.ui-datepicker .ui-datepicker-next-hover { + top: 1px; +} +.ui-datepicker .ui-datepicker-prev { + left: 2px; +} +.ui-datepicker .ui-datepicker-next { + right: 2px; +} +.ui-datepicker .ui-datepicker-prev-hover { + left: 1px; +} +.ui-datepicker .ui-datepicker-next-hover { + right: 1px; +} +.ui-datepicker .ui-datepicker-prev span, +.ui-datepicker .ui-datepicker-next span { + display: block; + position: absolute; + left: 50%; + margin-left: -8px; + top: 50%; + margin-top: -8px; +} +.ui-datepicker .ui-datepicker-title { + margin: 0 2.3em; + line-height: 1.8em; + text-align: center; +} +.ui-datepicker .ui-datepicker-title select { + font-size: 1em; + margin: 1px 0; +} +.ui-datepicker select.ui-datepicker-month-year { + width: 100%; +} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { + width: 49%; +} +.ui-datepicker table { + width: 100%; + font-size: .9em; + border-collapse: collapse; + margin: 0 0 .4em; +} +.ui-datepicker th { + padding: .7em .3em; + text-align: center; + font-weight: bold; + border: 0; +} +.ui-datepicker td { + border: 0; + padding: 1px; +} +.ui-datepicker td span, +.ui-datepicker td a { + display: block; + padding: .2em; + text-align: right; + text-decoration: none; +} +.ui-datepicker .ui-datepicker-buttonpane { + background-image: none; + margin: .7em 0 0 0; + padding: 0 .2em; + border-left: 0; + border-right: 0; + border-bottom: 0; +} +.ui-datepicker .ui-datepicker-buttonpane button { + float: right; + margin: .5em .2em .4em; + cursor: pointer; + padding: .2em .6em .3em .6em; + width: auto; + overflow: visible; +} +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { + float: left; +} + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { + width: auto; +} +.ui-datepicker-multi .ui-datepicker-group { + float: left; +} +.ui-datepicker-multi .ui-datepicker-group table { + width: 95%; + margin: 0 auto .4em; +} +.ui-datepicker-multi-2 .ui-datepicker-group { + width: 50%; +} +.ui-datepicker-multi-3 .ui-datepicker-group { + width: 33.3%; +} +.ui-datepicker-multi-4 .ui-datepicker-group { + width: 25%; +} +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { + border-left-width: 0; +} +.ui-datepicker-multi .ui-datepicker-buttonpane { + clear: left; +} +.ui-datepicker-row-break { + clear: both; + width: 100%; + font-size: 0; +} + +/* RTL support */ +.ui-datepicker-rtl { + direction: rtl; +} +.ui-datepicker-rtl .ui-datepicker-prev { + right: 2px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next { + left: 2px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-prev:hover { + right: 1px; + left: auto; +} +.ui-datepicker-rtl .ui-datepicker-next:hover { + left: 1px; + right: auto; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane { + clear: right; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button { + float: left; +} +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, +.ui-datepicker-rtl .ui-datepicker-group { + float: right; +} +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { + border-right-width: 0; + border-left-width: 1px; +} +.ui-dialog { + position: absolute; + top: 0; + left: 0; + padding: .2em; + outline: 0; +} +.ui-dialog .ui-dialog-titlebar { + padding: .4em 1em; + position: relative; +} +.ui-dialog .ui-dialog-title { + float: left; + margin: .1em 0; + white-space: nowrap; + width: 90%; + overflow: hidden; + text-overflow: ellipsis; +} +.ui-dialog .ui-dialog-titlebar-close { + position: absolute; + right: .3em; + top: 50%; + width: 21px; + margin: -10px 0 0 0; + padding: 1px; + height: 20px; +} +.ui-dialog .ui-dialog-content { + position: relative; + border: 0; + padding: .5em 1em; + background: none; + overflow: auto; +} +.ui-dialog .ui-dialog-buttonpane { + text-align: left; + border-width: 1px 0 0 0; + background-image: none; + margin-top: .5em; + padding: .3em 1em .5em .4em; +} +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { + float: right; +} +.ui-dialog .ui-dialog-buttonpane button { + margin: .5em .4em .5em 0; + cursor: pointer; +} +.ui-dialog .ui-resizable-se { + width: 12px; + height: 12px; + right: -5px; + bottom: -5px; + background-position: 16px 16px; +} +.ui-draggable .ui-dialog-titlebar { + cursor: move; +} +.ui-menu { + list-style: none; + padding: 2px; + margin: 0; + display: block; + outline: none; +} +.ui-menu .ui-menu { + margin-top: -3px; + position: absolute; +} +.ui-menu .ui-menu-item { + margin: 0; + padding: 0; + width: 100%; +} +.ui-menu .ui-menu-divider { + margin: 5px -2px 5px -2px; + height: 0; + font-size: 0; + line-height: 0; + border-width: 1px 0 0 0; +} +.ui-menu .ui-menu-item a { + text-decoration: none; + display: block; + padding: 2px .4em; + line-height: 1.5; + min-height: 0; /* support: IE7 */ + font-weight: normal; +} +.ui-menu .ui-menu-item a.ui-state-focus, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} + +.ui-menu .ui-state-disabled { + font-weight: normal; + margin: .4em 0 .2em; + line-height: 1.5; +} +.ui-menu .ui-state-disabled a { + cursor: default; +} + +/* icon support */ +.ui-menu-icons { + position: relative; +} +.ui-menu-icons .ui-menu-item a { + position: relative; + padding-left: 2em; +} + +/* left-aligned */ +.ui-menu .ui-icon { + position: absolute; + top: .2em; + left: .2em; +} + +/* right-aligned */ +.ui-menu .ui-menu-icon { + position: static; + float: right; +} +.ui-progressbar { + height: 2em; + text-align: left; + overflow: hidden; +} +.ui-progressbar .ui-progressbar-value { + margin: -1px; + height: 100%; +} +.ui-progressbar .ui-progressbar-overlay { + background: url("images/animated-overlay.gif"); + height: 100%; + filter: alpha(opacity=25); + opacity: 0.25; +} +.ui-progressbar-indeterminate .ui-progressbar-value { + background-image: none; +} +.ui-slider { + position: relative; + text-align: left; +} +.ui-slider .ui-slider-handle { + position: absolute; + z-index: 2; + width: 1.2em; + height: 1.2em; + cursor: default; +} +.ui-slider .ui-slider-range { + position: absolute; + z-index: 1; + font-size: .7em; + display: block; + border: 0; + background-position: 0 0; +} + +/* For IE8 - See #6727 */ +.ui-slider.ui-state-disabled .ui-slider-handle, +.ui-slider.ui-state-disabled .ui-slider-range { + filter: inherit; +} + +.ui-slider-horizontal { + height: .8em; +} +.ui-slider-horizontal .ui-slider-handle { + top: -.3em; + margin-left: -.6em; +} +.ui-slider-horizontal .ui-slider-range { + top: 0; + height: 100%; +} +.ui-slider-horizontal .ui-slider-range-min { + left: 0; +} +.ui-slider-horizontal .ui-slider-range-max { + right: 0; +} + +.ui-slider-vertical { + width: .8em; + height: 100px; +} +.ui-slider-vertical .ui-slider-handle { + left: -.3em; + margin-left: 0; + margin-bottom: -.6em; +} +.ui-slider-vertical .ui-slider-range { + left: 0; + width: 100%; +} +.ui-slider-vertical .ui-slider-range-min { + bottom: 0; +} +.ui-slider-vertical .ui-slider-range-max { + top: 0; +} +.ui-spinner { + position: relative; + display: inline-block; + overflow: hidden; + padding: 0; + vertical-align: middle; +} +.ui-spinner-input { + border: none; + background: none; + color: inherit; + padding: 0; + margin: .2em 0; + vertical-align: middle; + margin-left: .4em; + margin-right: 22px; +} +.ui-spinner-button { + width: 16px; + height: 50%; + font-size: .5em; + padding: 0; + margin: 0; + text-align: center; + position: absolute; + cursor: default; + display: block; + overflow: hidden; + right: 0; +} +/* more specificity required here to overide default borders */ +.ui-spinner a.ui-spinner-button { + border-top: none; + border-bottom: none; + border-right: none; +} +/* vertical centre icon */ +.ui-spinner .ui-icon { + position: absolute; + margin-top: -8px; + top: 50%; + left: 0; +} +.ui-spinner-up { + top: 0; +} +.ui-spinner-down { + bottom: 0; +} + +/* TR overrides */ +.ui-spinner .ui-icon-triangle-1-s { + /* need to fix icons sprite */ + background-position: -65px -16px; +} +.ui-tabs { + position: relative;/* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ + padding: .2em; +} +.ui-tabs .ui-tabs-nav { + margin: 0; + padding: .2em .2em 0; +} +.ui-tabs .ui-tabs-nav li { + list-style: none; + float: left; + position: relative; + top: 0; + margin: 1px .2em 0 0; + border-bottom: 0; + padding: 0; + white-space: nowrap; +} +.ui-tabs .ui-tabs-nav li a { + float: left; + padding: .5em 1em; + text-decoration: none; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active { + margin-bottom: -1px; + padding-bottom: 1px; +} +.ui-tabs .ui-tabs-nav li.ui-tabs-active a, +.ui-tabs .ui-tabs-nav li.ui-state-disabled a, +.ui-tabs .ui-tabs-nav li.ui-tabs-loading a { + cursor: text; +} +.ui-tabs .ui-tabs-nav li a, /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active a { + cursor: pointer; +} +.ui-tabs .ui-tabs-panel { + display: block; + border-width: 0; + padding: 1em 1.4em; + background: none; +} +.ui-tooltip { + padding: 8px; + position: absolute; + z-index: 9999; + max-width: 300px; + -webkit-box-shadow: 0 0 5px #aaa; + box-shadow: 0 0 5px #aaa; +} +body .ui-tooltip { + border-width: 2px; +} + +/* Component containers +----------------------------------*/ +.ui-widget { + font-family: "Lucida Grande", Arial, Verdana, sans-serif; + font-size: 1em; +} +.ui-widget .ui-widget { + font-size: 1em; +} +.ui-widget input, +.ui-widget select, +.ui-widget textarea, +.ui-widget button { + font-family: "Lucida Grande", Arial, Verdana, sans-serif; + font-size: 1em; +} +.ui-widget-content { + border: 1px solid #dddddd; + background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; + color: #333333; +} +.ui-widget-content a { + color: #333333; +} +.ui-widget-header { + border: 1px solid #1d2d44; + background: #1d2d44 url(images/ui-bg_flat_35_1d2d44_40x100.png) 50% 50% repeat-x; + color: #ffffff; + font-weight: bold; +} +.ui-widget-header a { + color: #ffffff; +} + +/* Interaction states +----------------------------------*/ +.ui-state-default, +.ui-widget-content .ui-state-default, +.ui-widget-header .ui-state-default { + border: 1px solid #ddd; + background: #f8f8f8 url(images/ui-bg_glass_100_f8f8f8_1x400.png) 50% 50% repeat-x; + font-weight: bold; + color: #555; +} +.ui-state-default a, +.ui-state-default a:link, +.ui-state-default a:visited { + color: #555; + text-decoration: none; +} +.ui-state-hover, +.ui-widget-content .ui-state-hover, +.ui-widget-header .ui-state-hover, +.ui-state-focus, +.ui-widget-content .ui-state-focus, +.ui-widget-header .ui-state-focus { + border: 1px solid #ddd; + background: #ffffff url(images/ui-bg_flat_100_ffffff_40x100.png) 50% 50% repeat-x; + font-weight: bold; + color: #333; +} +.ui-state-hover a, +.ui-state-hover a:hover, +.ui-state-hover a:link, +.ui-state-hover a:visited { + color: #333; + text-decoration: none; +} +.ui-state-active, +.ui-widget-content .ui-state-active, +.ui-widget-header .ui-state-active { + border: 1px solid #1d2d44; + background: #f8f8f8 url(images/ui-bg_glass_100_f8f8f8_1x400.png) 50% 50% repeat-x; + font-weight: bold; + color: #1d2d44; +} +.ui-state-active a, +.ui-state-active a:link, +.ui-state-active a:visited { + color: #1d2d44; + text-decoration: none; +} + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, +.ui-widget-content .ui-state-highlight, +.ui-widget-header .ui-state-highlight { + border: 1px solid #ddd; + background: #f8f8f8 url(images/ui-bg_highlight-hard_100_f8f8f8_1x100.png) 50% top repeat-x; + color: #555; +} +.ui-state-highlight a, +.ui-widget-content .ui-state-highlight a, +.ui-widget-header .ui-state-highlight a { + color: #555; +} +.ui-state-error, +.ui-widget-content .ui-state-error, +.ui-widget-header .ui-state-error { + border: 1px solid #cd0a0a; + background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; + color: #ffffff; +} +.ui-state-error a, +.ui-widget-content .ui-state-error a, +.ui-widget-header .ui-state-error a { + color: #ffffff; +} +.ui-state-error-text, +.ui-widget-content .ui-state-error-text, +.ui-widget-header .ui-state-error-text { + color: #ffffff; +} +.ui-priority-primary, +.ui-widget-content .ui-priority-primary, +.ui-widget-header .ui-priority-primary { + font-weight: bold; +} +.ui-priority-secondary, +.ui-widget-content .ui-priority-secondary, +.ui-widget-header .ui-priority-secondary { + opacity: .7; + filter:Alpha(Opacity=70); + font-weight: normal; +} +.ui-state-disabled, +.ui-widget-content .ui-state-disabled, +.ui-widget-header .ui-state-disabled { + opacity: .35; + filter:Alpha(Opacity=35); + background-image: none; +} +.ui-state-disabled .ui-icon { + filter:Alpha(Opacity=35); /* For IE8 - See #6059 */ +} + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { + width: 16px; + height: 16px; + background-position: 16px 16px; +} +.ui-icon, +.ui-widget-content .ui-icon { + background-image: url(images/ui-icons_222222_256x240.png); +} +.ui-widget-header .ui-icon { + background-image: url(images/ui-icons_222222_256x240.png); +} +.ui-state-default .ui-icon { + background-image: url(images/ui-icons_1d2d44_256x240.png); +} +.ui-state-hover .ui-icon, +.ui-state-focus .ui-icon { + background-image: url(images/ui-icons_1d2d44_256x240.png); +} +.ui-state-active .ui-icon { + background-image: url(images/ui-icons_1d2d44_256x240.png); +} +.ui-state-highlight .ui-icon { + background-image: url(images/ui-icons_ffffff_256x240.png); +} +.ui-state-error .ui-icon, +.ui-state-error-text .ui-icon { + background-image: url(images/ui-icons_ffd27a_256x240.png); +} + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-on { background-position: -96px -144px; } +.ui-icon-radio-off { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-all, +.ui-corner-top, +.ui-corner-left, +.ui-corner-tl { + border-top-left-radius: 4px; +} +.ui-corner-all, +.ui-corner-top, +.ui-corner-right, +.ui-corner-tr { + border-top-right-radius: 4px; +} +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-left, +.ui-corner-bl { + border-bottom-left-radius: 4px; +} +.ui-corner-all, +.ui-corner-bottom, +.ui-corner-right, +.ui-corner-br { + border-bottom-right-radius: 4px; +} + +/* Overlays */ +.ui-widget-overlay { + background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; + opacity: .5; + filter: Alpha(Opacity=50); +} +.ui-widget-shadow { + margin: -5px 0 0 -5px; + padding: 5px; + background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; + opacity: .2; + filter: Alpha(Opacity=20); + border-radius: 5px; +} diff --git a/core/css/jquery-ui-1.8.16.custom.css b/core/css/jquery-ui-1.8.16.custom.css deleted file mode 100644 index add1c6af08c..00000000000 --- a/core/css/jquery-ui-1.8.16.custom.css +++ /dev/null @@ -1,362 +0,0 @@ -/* - * jQuery UI CSS Framework 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - */ - -/* Layout helpers -----------------------------------*/ -.ui-helper-hidden { display: none; } -.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } -.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } -.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } -.ui-helper-clearfix { display: inline-block; } -/* required comment for clearfix to work in Opera \*/ -* html .ui-helper-clearfix { height:1%; } -.ui-helper-clearfix { display:block; } -/* end clearfix */ -.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } - - -/* Interaction Cues -----------------------------------*/ -.ui-state-disabled { cursor: default !important; } - - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } - - -/* Misc visuals -----------------------------------*/ - -/* Overlays */ -.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } - - -/* - * jQuery UI CSS Framework 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Theming/API - * - * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault="Lucida%20Grande",%20Arial,%20Verdana,%20sans-serif&fwDefault=bold&fsDefault=1em&cornerRadius=4px&bgColorHeader=1d2d44&bgTextureHeader=01_flat.png&bgImgOpacityHeader=35&borderColorHeader=1d2d44&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f8f8f8&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=ddd&fcDefault=555&iconColorDefault=1d2d44&bgColorHover=ffffff&bgTextureHover=01_flat.png&bgImgOpacityHover=100&borderColorHover=ddd&fcHover=333&iconColorHover=1d2d44&bgColorActive=f8f8f8&bgTextureActive=02_glass.png&bgImgOpacityActive=100&borderColorActive=1d2d44&fcActive=1d2d44&iconColorActive=1d2d44&bgColorHighlight=f8f8f8&bgTextureHighlight=04_highlight_hard.png&bgImgOpacityHighlight=100&borderColorHighlight=ddd&fcHighlight=555&iconColorHighlight=ffffff&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px - */ - - -/* Component containers -----------------------------------*/ -.ui-widget { font-family: \\\"Lucida Grande\\\", Arial, Verdana, sans-serif; font-size: 1em; } -.ui-widget .ui-widget { font-size: 1em; } -.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: \\\"Lucida Grande\\\", Arial, Verdana, sans-serif; font-size: 1em; } -.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee; color: #333333; } -.ui-widget-content a { color: #333333; } -.ui-widget-header { border: 1px solid #1d2d44; background: #1d2d44; color: #ffffff; font-weight: bold; } -.ui-widget-header a { color: #ffffff; } - -/* Interaction states -----------------------------------*/ -.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #ddd; background: #f8f8f8; font-weight: bold; color: #555; } -.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #555; text-decoration: none; } -.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #ddd; background: #ffffff; font-weight: bold; color: #333; } -.ui-state-hover a, .ui-state-hover a:hover { color: #333; text-decoration: none; } -.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #1d2d44; background: #f8f8f8; font-weight: bold; color: #1d2d44; } -.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #1d2d44; text-decoration: none; } -.ui-widget :active { outline: none; } - -/* Interaction Cues -----------------------------------*/ -.ui-state-disabled { cursor: default !important; } - -/* Icons -----------------------------------*/ - -/* states and images */ -.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } - -/* states and images */ -.ui-icon { width: 16px; height: 16px; } -.ui-icon-closethick { background-image: url(../img/actions/delete.png); } - - -/* Misc visuals -----------------------------------*/ - -/* Corner radius */ -.ui-corner-all, .ui-corner-top, .ui-corner-left, .ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; -khtml-border-top-left-radius: 4px; border-top-left-radius: 4px; } -.ui-corner-all, .ui-corner-top, .ui-corner-right, .ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; -khtml-border-top-right-radius: 4px; border-top-right-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-left, .ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; -khtml-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } -.ui-corner-all, .ui-corner-bottom, .ui-corner-right, .ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; -khtml-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } - -/* Overlays */ -.ui-widget-overlay { background: #666666; opacity: .50;filter:Alpha(Opacity=50); } -.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -khtml-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* - * jQuery UI Resizable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizable#theming - */ -.ui-resizable { position: relative;} -.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block; } -.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } -.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } -.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } -.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } -.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } -.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } -.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } -.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } -.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectable#theming - */ -.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } -/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete#theming - */ -.ui-autocomplete { position: absolute; cursor: default; } - -/* workarounds */ -* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ - -/* - * jQuery UI Menu 1.8.16 - * - * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Menu#theming - */ -.ui-menu { - list-style:none; - padding: 2px; - margin: 0; - display:block; - float: left; -} -.ui-menu .ui-menu { - margin-top: -3px; -} -.ui-menu .ui-menu-item { - margin:0; - padding: 0; - zoom: 1; - float: left; - clear: left; - width: 100%; -} -.ui-menu .ui-menu-item a { - text-decoration:none; - display:block; - padding:.2em .4em; - line-height:1.5; - zoom:1; -} -.ui-menu .ui-menu-item a.ui-state-hover, -.ui-menu .ui-menu-item a.ui-state-active { - font-weight: normal; - margin: -1px; -} -/* - * jQuery UI Button 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button#theming - */ -.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ -.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ -button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ -.ui-button-icons-only { width: 3.4em; } -button.ui-button-icons-only { width: 3.7em; } - -/*button text element */ -.ui-button .ui-button-text { display: block; line-height: 1.4; } -.ui-button-text-only .ui-button-text { padding: .4em 1em; } -.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } -.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } -.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } -.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } -/* no icon support for input elements, provide padding by default */ -input.ui-button { padding: .4em 1em; } - -/*button icon element(s) */ -.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } -.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } -.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } -.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } -.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } - -/*button sets*/ -.ui-buttonset { margin-right: 7px; } -.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } - -/* workarounds */ -button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ -/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog#theming - */ -.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } -.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } -.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } -.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; background-color: #EEE;} -.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } -.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } -.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } -.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } -.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } -.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } -.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } -.ui-draggable .ui-dialog-titlebar { cursor: move; } -/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider#theming - */ -.ui-slider { position: relative; text-align: left; } -.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } -.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } - -.ui-slider-horizontal { height: .8em; } -.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } -.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } -.ui-slider-horizontal .ui-slider-range-min { left: 0; } -.ui-slider-horizontal .ui-slider-range-max { right: 0; } - -.ui-slider-vertical { width: .8em; height: 100px; } -.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } -.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } -.ui-slider-vertical .ui-slider-range-min { bottom: 0; } -.ui-slider-vertical .ui-slider-range-max { top: 0; }/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs#theming - */ -.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ -.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } -.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } -.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } -.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } -.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ -.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } -.ui-tabs .ui-tabs-hide { display: none !important; } -/* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker#theming - */ -.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } -.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } -.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } -.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } -.ui-datepicker .ui-datepicker-prev { left:2px; } -.ui-datepicker .ui-datepicker-next { right:2px; } -.ui-datepicker .ui-datepicker-prev-hover { left:1px; } -.ui-datepicker .ui-datepicker-next-hover { right:1px; } -.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } -.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } -.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } -.ui-datepicker select.ui-datepicker-month-year {width: 100%;} -.ui-datepicker select.ui-datepicker-month, -.ui-datepicker select.ui-datepicker-year { width: 49%;} -.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } -.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } -.ui-datepicker td { border: 0; padding: 1px; } -.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } -.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } -.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } -.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } - -/* with multiple calendars */ -.ui-datepicker.ui-datepicker-multi { width:auto; } -.ui-datepicker-multi .ui-datepicker-group { float:left; } -.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } -.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } -.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } -.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } -.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } -.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } -.ui-datepicker-row-break { clear:both; width:100%; font-size:0em; } - -/* RTL support */ -.ui-datepicker-rtl { direction: rtl; } -.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } -.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } -.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } -.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } -.ui-datepicker-rtl .ui-datepicker-group { float:right; } -.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } -.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } - -/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ -.ui-datepicker-cover { - display: none; /*sorry for IE5*/ - display/**/: block; /*sorry for IE5*/ - position: absolute; /*must have*/ - z-index: -1; /*must have*/ - filter: mask(); /*must have*/ - top: -4px; /*must have*/ - left: -4px; /*must have*/ - width: 200px; /*must have*/ - height: 200px; /*must have*/ -}/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar#theming - */ -.ui-progressbar { height:2em; text-align: left; } -.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/core/css/multiselect.css b/core/css/multiselect.css index 99f0e039334..31c8ef88eb9 100644 --- a/core/css/multiselect.css +++ b/core/css/multiselect.css @@ -5,15 +5,25 @@ ul.multiselectoptions { background-color:#fff; border:1px solid #ddd; - border-bottom-left-radius:.5em; - border-bottom-right-radius:.5em; border-top:none; box-shadow:0 1px 1px #ddd; padding-top:.5em; position:absolute; + max-height: 20em; + overflow-y: auto; z-index:49; } + ul.multiselectoptions.down { + border-bottom-left-radius:.5em; + border-bottom-right-radius:.5em; + } + + ul.multiselectoptions.up { + border-top-left-radius:.5em; + border-top-right-radius:.5em; + } + ul.multiselectoptions>li { overflow:hidden; white-space:nowrap; @@ -30,11 +40,20 @@ div.multiselect.active { background-color:#fff; + position:relative; + z-index:50; + } + + div.multiselect.up { + border-top:0 none; + border-top-left-radius:0; + border-top-right-radius:0; + } + + div.multiselect.down { border-bottom:none; border-bottom-left-radius:0; border-bottom-right-radius:0; - position:relative; - z-index:50; } div.multiselect>span:first-child { diff --git a/core/css/styles.css b/core/css/styles.css index d635916b5ae..022acab4d8a 100644 --- a/core/css/styles.css +++ b/core/css/styles.css @@ -34,7 +34,7 @@ filter:progid:DXImageTransform.Microsoft.gradient( startColorstr='#35537a', endC /* INPUTS */ input[type="text"], input[type="password"] { cursor:text; } -input:not([type="checkbox"]), textarea, select, button, .button, #quota, div.jp-progress, .pager li a { +input, textarea, select, button, .button, #quota, div.jp-progress, .pager li a { width:10em; margin:.3em; padding:.6em .5em .4em; font-size:1em; font-family:Arial, Verdana, sans-serif; background:#fff; color:#333; border:1px solid #ddd; outline:none; @@ -56,7 +56,7 @@ input[type="checkbox"]:hover+label, input[type="checkbox"]:focus+label { color:# /* BUTTONS */ input[type="submit"], input[type="button"], button, .button, #quota, div.jp-progress, select, .pager li a { width:auto; padding:.4em; - background-color:rgba(230,230,230,.5); font-weight:bold; color:#555; text-shadow:#fff 0 1px 0; border:1px solid rgba(180,180,180,.5); cursor:pointer; + background-color:rgba(230,230,230,.5); font-weight:bold; color:#555; text-shadow:#fff 0 1px 0; border:1px solid #bbb; border:1px solid rgba(180,180,180,.5); cursor:pointer; -moz-box-shadow:0 1px 1px #fff, 0 1px 1px #fff inset; -webkit-box-shadow:0 1px 1px #fff, 0 1px 1px #fff inset; box-shadow:0 1px 1px #fff, 0 1px 1px #fff inset; -moz-border-radius:.5em; -webkit-border-radius:.5em; border-radius:.5em; } @@ -94,8 +94,9 @@ input[type="submit"].enabled { background:#66f866; border:1px solid #5e5; -moz-b /* CONTENT ------------------------------------------------------------------ */ #controls { padding:0 0.5em; width:100%; top:3.5em; height:2.8em; margin:0; background:#f7f7f7; border-bottom:1px solid #eee; position:fixed; z-index:50; -moz-box-shadow:0 -3px 7px #000; -webkit-box-shadow:0 -3px 7px #000; box-shadow:0 -3px 7px #000; } #controls .button { display:inline-block; } -#content { top:3.5em; left:12.5em; position:absolute; } -#leftcontent, .leftcontent { position:fixed; overflow:auto; top:6.4em; width:20em; background:#f8f8f8; border-right:1px solid #ddd; } +#content { height: 100%; width: 100%; position: relative; } +#content-wrapper { height: 100%; width: 100%; padding-top: 3.5em; padding-left: 12.5em; box-sizing: border-box; -moz-box-sizing: border-box; position: absolute;} +#leftcontent, .leftcontent { position:fixed; top: 0; overflow:auto; width:20em; background:#f8f8f8; border-right:1px solid #ddd; box-sizing: border-box; -moz-box-sizing: border-box; height: 100%; padding-top: 6.4em } #leftcontent li, .leftcontent li { background:#f8f8f8; padding:.5em .8em; white-space:nowrap; overflow:hidden; text-overflow:ellipsis; -webkit-transition:background-color 200ms; -moz-transition:background-color 200ms; -o-transition:background-color 200ms; transition:background-color 200ms; } #leftcontent li:hover, #leftcontent li:active, #leftcontent li.active, .leftcontent li:hover, .leftcontent li:active, .leftcontent li.active { background:#eee; } #leftcontent li.active, .leftcontent li.active { font-weight:bold; } @@ -190,7 +191,8 @@ fieldset.warning legend { color:#b94a48 !important; } .bold { font-weight:bold; } .center { text-align:center; } -#notification { z-index:101; background-color:#fc4; border:0; padding:0 .7em .3em; display:none; position:fixed; left:50%; top:0; -moz-border-radius-bottomleft:1em; -webkit-border-bottom-left-radius:1em; border-bottom-left-radius:1em; -moz-border-radius-bottomright:1em; -webkit-border-bottom-right-radius:1em; border-bottom-right-radius:1em; } +#notification-container { position: fixed; top: 0px; width: 100%; text-align: center; z-index: 101; line-height: 1.2;} +#notification { z-index:101; background-color:#fc4; border:0; padding:0 .7em .3em; display:none; position: relative; top:0; -moz-border-radius-bottomleft:1em; -webkit-border-bottom-left-radius:1em; border-bottom-left-radius:1em; -moz-border-radius-bottomright:1em; -webkit-border-bottom-right-radius:1em; border-bottom-right-radius:1em; } #notification span { cursor:pointer; font-weight:bold; margin-left:1em; } tr .action, .selectedActions a { -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)"; filter:alpha(opacity=0); opacity:0; } @@ -214,7 +216,8 @@ div.jp-play-bar, div.jp-seek-bar { padding:0; } .pager { list-style:none; float:right; display:inline; margin:.7em 13em 0 0; } .pager li { display:inline-block; } -li.error { width:640px; margin:4em auto; padding:1em 1em 1em 4em; background:#ffe .8em .8em no-repeat; color:#FF3B3B; border:1px solid #ccc; -moz-border-radius:10px; -webkit-border-radius:10px; border-radius:10px; } +li.update, li.error { width:640px; margin:4em auto; padding:1em 1em 1em 4em; background:#ffe .8em .8em no-repeat; border:1px solid #ccc; -moz-border-radius:10px; -webkit-border-radius:10px; border-radius:10px; cursor:default; } +.error { color:#FF3B3B; } .ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { overflow:hidden; text-overflow:ellipsis; } .hint { background-image:url('../img/actions/info.png'); background-repeat:no-repeat; color:#777777; padding-left:25px; background-position:0 0.3em;} .separator { display:inline; border-left:1px solid #d3d3d3; border-right:1px solid #fff; height:10px; width:0px; margin:4px; } diff --git a/core/js/config.js b/core/js/config.js index f7a29276f7d..563df4e6632 100644 --- a/core/js/config.js +++ b/core/js/config.js @@ -50,6 +50,6 @@ OC.AppConfig={ }, deleteApp:function(app){ OC.AppConfig.postCall('deleteApp',{app:app}); - }, + } }; //TODO OC.Preferences diff --git a/core/js/config.php b/core/js/config.php new file mode 100644 index 00000000000..e838fb1cd04 --- /dev/null +++ b/core/js/config.php @@ -0,0 +1,37 @@ +<?php +/** + * Copyright (c) 2013 Lukas Reschke <lukas@statuscode.ch> + * This file is licensed under the Affero General Public License version 3 or + * later. + * See the COPYING-README file. + */ + +// Set the content type to Javascript +header("Content-type: text/javascript"); + +// Disallow caching +header("Cache-Control: no-cache, must-revalidate"); +header("Expires: Sat, 26 Jul 1997 05:00:00 GMT"); + +// Enable l10n support +$l = OC_L10N::get('core'); + +// Get the config +$debug = (defined('DEBUG') && DEBUG) ? 'true' : 'false'; +$array = array( + "oc_debug" => $debug, + "oc_webroot" => "\"".OC::$WEBROOT."\"", + "oc_appswebroots" => "\"".$_['apps_paths']. "\"", + "oc_current_user" => "\"".OC_User::getUser(). "\"", + "oc_requesttoken" => "\"".OC_Util::callRegister(). "\"", + "datepickerFormatDate" => json_encode($l->l('jsdate', 'jsdate')), + "dayNames" => json_encode(array((string)$l->t('Sunday'), (string)$l->t('Monday'), (string)$l->t('Tuesday'), (string)$l->t('Wednesday'), (string)$l->t('Thursday'), (string)$l->t('Friday'), (string)$l->t('Saturday'))), + "monthNames" => json_encode(array((string)$l->t('January'), (string)$l->t('February'), (string)$l->t('March'), (string)$l->t('April'), (string)$l->t('May'), (string)$l->t('June'), (string)$l->t('July'), (string)$l->t('August'), (string)$l->t('September'), (string)$l->t('October'), (string)$l->t('November'), (string)$l->t('December'))), + "firstDay" => json_encode($l->l('firstday', 'firstday')) , + ); + +// Echo it +foreach ($array as $setting => $value) { + echo("var ". $setting ."=".$value.";\n"); +} +?>
\ No newline at end of file diff --git a/core/js/jquery-ui-1.10.0.custom.js b/core/js/jquery-ui-1.10.0.custom.js new file mode 100644 index 00000000000..ca57f47ede4 --- /dev/null +++ b/core/js/jquery-ui-1.10.0.custom.js @@ -0,0 +1,14850 @@ +/*! jQuery UI - v1.10.0 - 2013-01-22 +* http://jqueryui.com +* Includes: jquery.ui.core.js, jquery.ui.widget.js, jquery.ui.mouse.js, jquery.ui.position.js, jquery.ui.draggable.js, jquery.ui.droppable.js, jquery.ui.resizable.js, jquery.ui.selectable.js, jquery.ui.sortable.js, jquery.ui.accordion.js, jquery.ui.autocomplete.js, jquery.ui.button.js, jquery.ui.datepicker.js, jquery.ui.dialog.js, jquery.ui.menu.js, jquery.ui.progressbar.js, jquery.ui.slider.js, jquery.ui.spinner.js, jquery.ui.tabs.js, jquery.ui.tooltip.js, jquery.ui.effect.js, jquery.ui.effect-blind.js, jquery.ui.effect-bounce.js, jquery.ui.effect-clip.js, jquery.ui.effect-drop.js, jquery.ui.effect-explode.js, jquery.ui.effect-fade.js, jquery.ui.effect-fold.js, jquery.ui.effect-highlight.js, jquery.ui.effect-pulsate.js, jquery.ui.effect-scale.js, jquery.ui.effect-shake.js, jquery.ui.effect-slide.js, jquery.ui.effect-transfer.js +* Copyright (c) 2013 jQuery Foundation and other contributors Licensed MIT */ + +(function( $, undefined ) { + +var uuid = 0, + runiqueId = /^ui-id-\d+$/; + +// prevent duplicate loading +// this is only a problem because we proxy existing functions +// and we don't want to double proxy them +$.ui = $.ui || {}; +if ( $.ui.version ) { + return; +} + +$.extend( $.ui, { + version: "1.10.0", + + keyCode: { + BACKSPACE: 8, + COMMA: 188, + DELETE: 46, + DOWN: 40, + END: 35, + ENTER: 13, + ESCAPE: 27, + HOME: 36, + LEFT: 37, + NUMPAD_ADD: 107, + NUMPAD_DECIMAL: 110, + NUMPAD_DIVIDE: 111, + NUMPAD_ENTER: 108, + NUMPAD_MULTIPLY: 106, + NUMPAD_SUBTRACT: 109, + PAGE_DOWN: 34, + PAGE_UP: 33, + PERIOD: 190, + RIGHT: 39, + SPACE: 32, + TAB: 9, + UP: 38 + } +}); + +// plugins +$.fn.extend({ + _focus: $.fn.focus, + focus: function( delay, fn ) { + return typeof delay === "number" ? + this.each(function() { + var elem = this; + setTimeout(function() { + $( elem ).focus(); + if ( fn ) { + fn.call( elem ); + } + }, delay ); + }) : + this._focus.apply( this, arguments ); + }, + + scrollParent: function() { + var scrollParent; + if (($.ui.ie && (/(static|relative)/).test(this.css("position"))) || (/absolute/).test(this.css("position"))) { + scrollParent = this.parents().filter(function() { + return (/(relative|absolute|fixed)/).test($.css(this,"position")) && (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x")); + }).eq(0); + } else { + scrollParent = this.parents().filter(function() { + return (/(auto|scroll)/).test($.css(this,"overflow")+$.css(this,"overflow-y")+$.css(this,"overflow-x")); + }).eq(0); + } + + return (/fixed/).test(this.css("position")) || !scrollParent.length ? $(document) : scrollParent; + }, + + zIndex: function( zIndex ) { + if ( zIndex !== undefined ) { + return this.css( "zIndex", zIndex ); + } + + if ( this.length ) { + var elem = $( this[ 0 ] ), position, value; + while ( elem.length && elem[ 0 ] !== document ) { + // Ignore z-index if position is set to a value where z-index is ignored by the browser + // This makes behavior of this function consistent across browsers + // WebKit always returns auto if the element is positioned + position = elem.css( "position" ); + if ( position === "absolute" || position === "relative" || position === "fixed" ) { + // IE returns 0 when zIndex is not specified + // other browsers return a string + // we ignore the case of nested elements with an explicit value of 0 + // <div style="z-index: -10;"><div style="z-index: 0;"></div></div> + value = parseInt( elem.css( "zIndex" ), 10 ); + if ( !isNaN( value ) && value !== 0 ) { + return value; + } + } + elem = elem.parent(); + } + } + + return 0; + }, + + uniqueId: function() { + return this.each(function() { + if ( !this.id ) { + this.id = "ui-id-" + (++uuid); + } + }); + }, + + removeUniqueId: function() { + return this.each(function() { + if ( runiqueId.test( this.id ) ) { + $( this ).removeAttr( "id" ); + } + }); + } +}); + +// selectors +function focusable( element, isTabIndexNotNaN ) { + var map, mapName, img, + nodeName = element.nodeName.toLowerCase(); + if ( "area" === nodeName ) { + map = element.parentNode; + mapName = map.name; + if ( !element.href || !mapName || map.nodeName.toLowerCase() !== "map" ) { + return false; + } + img = $( "img[usemap=#" + mapName + "]" )[0]; + return !!img && visible( img ); + } + return ( /input|select|textarea|button|object/.test( nodeName ) ? + !element.disabled : + "a" === nodeName ? + element.href || isTabIndexNotNaN : + isTabIndexNotNaN) && + // the element and all of its ancestors must be visible + visible( element ); +} + +function visible( element ) { + return $.expr.filters.visible( element ) && + !$( element ).parents().addBack().filter(function() { + return $.css( this, "visibility" ) === "hidden"; + }).length; +} + +$.extend( $.expr[ ":" ], { + data: $.expr.createPseudo ? + $.expr.createPseudo(function( dataName ) { + return function( elem ) { + return !!$.data( elem, dataName ); + }; + }) : + // support: jQuery <1.8 + function( elem, i, match ) { + return !!$.data( elem, match[ 3 ] ); + }, + + focusable: function( element ) { + return focusable( element, !isNaN( $.attr( element, "tabindex" ) ) ); + }, + + tabbable: function( element ) { + var tabIndex = $.attr( element, "tabindex" ), + isTabIndexNaN = isNaN( tabIndex ); + return ( isTabIndexNaN || tabIndex >= 0 ) && focusable( element, !isTabIndexNaN ); + } +}); + +// support: jQuery <1.8 +if ( !$( "<a>" ).outerWidth( 1 ).jquery ) { + $.each( [ "Width", "Height" ], function( i, name ) { + var side = name === "Width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ], + type = name.toLowerCase(), + orig = { + innerWidth: $.fn.innerWidth, + innerHeight: $.fn.innerHeight, + outerWidth: $.fn.outerWidth, + outerHeight: $.fn.outerHeight + }; + + function reduce( elem, size, border, margin ) { + $.each( side, function() { + size -= parseFloat( $.css( elem, "padding" + this ) ) || 0; + if ( border ) { + size -= parseFloat( $.css( elem, "border" + this + "Width" ) ) || 0; + } + if ( margin ) { + size -= parseFloat( $.css( elem, "margin" + this ) ) || 0; + } + }); + return size; + } + + $.fn[ "inner" + name ] = function( size ) { + if ( size === undefined ) { + return orig[ "inner" + name ].call( this ); + } + + return this.each(function() { + $( this ).css( type, reduce( this, size ) + "px" ); + }); + }; + + $.fn[ "outer" + name] = function( size, margin ) { + if ( typeof size !== "number" ) { + return orig[ "outer" + name ].call( this, size ); + } + + return this.each(function() { + $( this).css( type, reduce( this, size, true, margin ) + "px" ); + }); + }; + }); +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +// support: jQuery 1.6.1, 1.6.2 (http://bugs.jquery.com/ticket/9413) +if ( $( "<a>" ).data( "a-b", "a" ).removeData( "a-b" ).data( "a-b" ) ) { + $.fn.removeData = (function( removeData ) { + return function( key ) { + if ( arguments.length ) { + return removeData.call( this, $.camelCase( key ) ); + } else { + return removeData.call( this ); + } + }; + })( $.fn.removeData ); +} + + + + + +// deprecated +$.ui.ie = !!/msie [\w.]+/.exec( navigator.userAgent.toLowerCase() ); + +$.support.selectstart = "onselectstart" in document.createElement( "div" ); +$.fn.extend({ + disableSelection: function() { + return this.bind( ( $.support.selectstart ? "selectstart" : "mousedown" ) + + ".ui-disableSelection", function( event ) { + event.preventDefault(); + }); + }, + + enableSelection: function() { + return this.unbind( ".ui-disableSelection" ); + } +}); + +$.extend( $.ui, { + // $.ui.plugin is deprecated. Use the proxy pattern instead. + plugin: { + add: function( module, option, set ) { + var i, + proto = $.ui[ module ].prototype; + for ( i in set ) { + proto.plugins[ i ] = proto.plugins[ i ] || []; + proto.plugins[ i ].push( [ option, set[ i ] ] ); + } + }, + call: function( instance, name, args ) { + var i, + set = instance.plugins[ name ]; + if ( !set || !instance.element[ 0 ].parentNode || instance.element[ 0 ].parentNode.nodeType === 11 ) { + return; + } + + for ( i = 0; i < set.length; i++ ) { + if ( instance.options[ set[ i ][ 0 ] ] ) { + set[ i ][ 1 ].apply( instance.element, args ); + } + } + } + }, + + // only used by resizable + hasScroll: function( el, a ) { + + //If overflow is hidden, the element might have extra content, but the user wants to hide it + if ( $( el ).css( "overflow" ) === "hidden") { + return false; + } + + var scroll = ( a && a === "left" ) ? "scrollLeft" : "scrollTop", + has = false; + + if ( el[ scroll ] > 0 ) { + return true; + } + + // TODO: determine which cases actually cause this to happen + // if the element doesn't have the scroll set, see if it's possible to + // set the scroll + el[ scroll ] = 1; + has = ( el[ scroll ] > 0 ); + el[ scroll ] = 0; + return has; + } +}); + +})( jQuery ); +(function( $, undefined ) { + +var uuid = 0, + slice = Array.prototype.slice, + _cleanData = $.cleanData; +$.cleanData = function( elems ) { + for ( var i = 0, elem; (elem = elems[i]) != null; i++ ) { + try { + $( elem ).triggerHandler( "remove" ); + // http://bugs.jquery.com/ticket/8235 + } catch( e ) {} + } + _cleanData( elems ); +}; + +$.widget = function( name, base, prototype ) { + var fullName, existingConstructor, constructor, basePrototype, + // proxiedPrototype allows the provided prototype to remain unmodified + // so that it can be used as a mixin for multiple widgets (#8876) + proxiedPrototype = {}, + namespace = name.split( "." )[ 0 ]; + + name = name.split( "." )[ 1 ]; + fullName = namespace + "-" + name; + + if ( !prototype ) { + prototype = base; + base = $.Widget; + } + + // create selector for plugin + $.expr[ ":" ][ fullName.toLowerCase() ] = function( elem ) { + return !!$.data( elem, fullName ); + }; + + $[ namespace ] = $[ namespace ] || {}; + existingConstructor = $[ namespace ][ name ]; + constructor = $[ namespace ][ name ] = function( options, element ) { + // allow instantiation without "new" keyword + if ( !this._createWidget ) { + return new constructor( options, element ); + } + + // allow instantiation without initializing for simple inheritance + // must use "new" keyword (the code above always passes args) + if ( arguments.length ) { + this._createWidget( options, element ); + } + }; + // extend with the existing constructor to carry over any static properties + $.extend( constructor, existingConstructor, { + version: prototype.version, + // copy the object used to create the prototype in case we need to + // redefine the widget later + _proto: $.extend( {}, prototype ), + // track widgets that inherit from this widget in case this widget is + // redefined after a widget inherits from it + _childConstructors: [] + }); + + basePrototype = new base(); + // we need to make the options hash a property directly on the new instance + // otherwise we'll modify the options hash on the prototype that we're + // inheriting from + basePrototype.options = $.widget.extend( {}, basePrototype.options ); + $.each( prototype, function( prop, value ) { + if ( !$.isFunction( value ) ) { + proxiedPrototype[ prop ] = value; + return; + } + proxiedPrototype[ prop ] = (function() { + var _super = function() { + return base.prototype[ prop ].apply( this, arguments ); + }, + _superApply = function( args ) { + return base.prototype[ prop ].apply( this, args ); + }; + return function() { + var __super = this._super, + __superApply = this._superApply, + returnValue; + + this._super = _super; + this._superApply = _superApply; + + returnValue = value.apply( this, arguments ); + + this._super = __super; + this._superApply = __superApply; + + return returnValue; + }; + })(); + }); + constructor.prototype = $.widget.extend( basePrototype, { + // TODO: remove support for widgetEventPrefix + // always use the name + a colon as the prefix, e.g., draggable:start + // don't prefix for widgets that aren't DOM-based + widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix : name + }, proxiedPrototype, { + constructor: constructor, + namespace: namespace, + widgetName: name, + widgetFullName: fullName + }); + + // If this widget is being redefined then we need to find all widgets that + // are inheriting from it and redefine all of them so that they inherit from + // the new version of this widget. We're essentially trying to replace one + // level in the prototype chain. + if ( existingConstructor ) { + $.each( existingConstructor._childConstructors, function( i, child ) { + var childPrototype = child.prototype; + + // redefine the child widget using the same prototype that was + // originally used, but inherit from the new version of the base + $.widget( childPrototype.namespace + "." + childPrototype.widgetName, constructor, child._proto ); + }); + // remove the list of existing child constructors from the old constructor + // so the old child constructors can be garbage collected + delete existingConstructor._childConstructors; + } else { + base._childConstructors.push( constructor ); + } + + $.widget.bridge( name, constructor ); +}; + +$.widget.extend = function( target ) { + var input = slice.call( arguments, 1 ), + inputIndex = 0, + inputLength = input.length, + key, + value; + for ( ; inputIndex < inputLength; inputIndex++ ) { + for ( key in input[ inputIndex ] ) { + value = input[ inputIndex ][ key ]; + if ( input[ inputIndex ].hasOwnProperty( key ) && value !== undefined ) { + // Clone objects + if ( $.isPlainObject( value ) ) { + target[ key ] = $.isPlainObject( target[ key ] ) ? + $.widget.extend( {}, target[ key ], value ) : + // Don't extend strings, arrays, etc. with objects + $.widget.extend( {}, value ); + // Copy everything else by reference + } else { + target[ key ] = value; + } + } + } + } + return target; +}; + +$.widget.bridge = function( name, object ) { + var fullName = object.prototype.widgetFullName || name; + $.fn[ name ] = function( options ) { + var isMethodCall = typeof options === "string", + args = slice.call( arguments, 1 ), + returnValue = this; + + // allow multiple hashes to be passed on init + options = !isMethodCall && args.length ? + $.widget.extend.apply( null, [ options ].concat(args) ) : + options; + + if ( isMethodCall ) { + this.each(function() { + var methodValue, + instance = $.data( this, fullName ); + if ( !instance ) { + return $.error( "cannot call methods on " + name + " prior to initialization; " + + "attempted to call method '" + options + "'" ); + } + if ( !$.isFunction( instance[options] ) || options.charAt( 0 ) === "_" ) { + return $.error( "no such method '" + options + "' for " + name + " widget instance" ); + } + methodValue = instance[ options ].apply( instance, args ); + if ( methodValue !== instance && methodValue !== undefined ) { + returnValue = methodValue && methodValue.jquery ? + returnValue.pushStack( methodValue.get() ) : + methodValue; + return false; + } + }); + } else { + this.each(function() { + var instance = $.data( this, fullName ); + if ( instance ) { + instance.option( options || {} )._init(); + } else { + $.data( this, fullName, new object( options, this ) ); + } + }); + } + + return returnValue; + }; +}; + +$.Widget = function( /* options, element */ ) {}; +$.Widget._childConstructors = []; + +$.Widget.prototype = { + widgetName: "widget", + widgetEventPrefix: "", + defaultElement: "<div>", + options: { + disabled: false, + + // callbacks + create: null + }, + _createWidget: function( options, element ) { + element = $( element || this.defaultElement || this )[ 0 ]; + this.element = $( element ); + this.uuid = uuid++; + this.eventNamespace = "." + this.widgetName + this.uuid; + this.options = $.widget.extend( {}, + this.options, + this._getCreateOptions(), + options ); + + this.bindings = $(); + this.hoverable = $(); + this.focusable = $(); + + if ( element !== this ) { + $.data( element, this.widgetFullName, this ); + this._on( true, this.element, { + remove: function( event ) { + if ( event.target === element ) { + this.destroy(); + } + } + }); + this.document = $( element.style ? + // element within the document + element.ownerDocument : + // element is window or document + element.document || element ); + this.window = $( this.document[0].defaultView || this.document[0].parentWindow ); + } + + this._create(); + this._trigger( "create", null, this._getCreateEventData() ); + this._init(); + }, + _getCreateOptions: $.noop, + _getCreateEventData: $.noop, + _create: $.noop, + _init: $.noop, + + destroy: function() { + this._destroy(); + // we can probably remove the unbind calls in 2.0 + // all event bindings should go through this._on() + this.element + .unbind( this.eventNamespace ) + // 1.9 BC for #7810 + // TODO remove dual storage + .removeData( this.widgetName ) + .removeData( this.widgetFullName ) + // support: jquery <1.6.3 + // http://bugs.jquery.com/ticket/9413 + .removeData( $.camelCase( this.widgetFullName ) ); + this.widget() + .unbind( this.eventNamespace ) + .removeAttr( "aria-disabled" ) + .removeClass( + this.widgetFullName + "-disabled " + + "ui-state-disabled" ); + + // clean up events and states + this.bindings.unbind( this.eventNamespace ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + }, + _destroy: $.noop, + + widget: function() { + return this.element; + }, + + option: function( key, value ) { + var options = key, + parts, + curOption, + i; + + if ( arguments.length === 0 ) { + // don't return a reference to the internal hash + return $.widget.extend( {}, this.options ); + } + + if ( typeof key === "string" ) { + // handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } } + options = {}; + parts = key.split( "." ); + key = parts.shift(); + if ( parts.length ) { + curOption = options[ key ] = $.widget.extend( {}, this.options[ key ] ); + for ( i = 0; i < parts.length - 1; i++ ) { + curOption[ parts[ i ] ] = curOption[ parts[ i ] ] || {}; + curOption = curOption[ parts[ i ] ]; + } + key = parts.pop(); + if ( value === undefined ) { + return curOption[ key ] === undefined ? null : curOption[ key ]; + } + curOption[ key ] = value; + } else { + if ( value === undefined ) { + return this.options[ key ] === undefined ? null : this.options[ key ]; + } + options[ key ] = value; + } + } + + this._setOptions( options ); + + return this; + }, + _setOptions: function( options ) { + var key; + + for ( key in options ) { + this._setOption( key, options[ key ] ); + } + + return this; + }, + _setOption: function( key, value ) { + this.options[ key ] = value; + + if ( key === "disabled" ) { + this.widget() + .toggleClass( this.widgetFullName + "-disabled ui-state-disabled", !!value ) + .attr( "aria-disabled", value ); + this.hoverable.removeClass( "ui-state-hover" ); + this.focusable.removeClass( "ui-state-focus" ); + } + + return this; + }, + + enable: function() { + return this._setOption( "disabled", false ); + }, + disable: function() { + return this._setOption( "disabled", true ); + }, + + _on: function( suppressDisabledCheck, element, handlers ) { + var delegateElement, + instance = this; + + // no suppressDisabledCheck flag, shuffle arguments + if ( typeof suppressDisabledCheck !== "boolean" ) { + handlers = element; + element = suppressDisabledCheck; + suppressDisabledCheck = false; + } + + // no element argument, shuffle and use this.element + if ( !handlers ) { + handlers = element; + element = this.element; + delegateElement = this.widget(); + } else { + // accept selectors, DOM elements + element = delegateElement = $( element ); + this.bindings = this.bindings.add( element ); + } + + $.each( handlers, function( event, handler ) { + function handlerProxy() { + // allow widgets to customize the disabled handling + // - disabled as an array instead of boolean + // - disabled class as method for disabling individual parts + if ( !suppressDisabledCheck && + ( instance.options.disabled === true || + $( this ).hasClass( "ui-state-disabled" ) ) ) { + return; + } + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + + // copy the guid so direct unbinding works + if ( typeof handler !== "string" ) { + handlerProxy.guid = handler.guid = + handler.guid || handlerProxy.guid || $.guid++; + } + + var match = event.match( /^(\w+)\s*(.*)$/ ), + eventName = match[1] + instance.eventNamespace, + selector = match[2]; + if ( selector ) { + delegateElement.delegate( selector, eventName, handlerProxy ); + } else { + element.bind( eventName, handlerProxy ); + } + }); + }, + + _off: function( element, eventName ) { + eventName = (eventName || "").split( " " ).join( this.eventNamespace + " " ) + this.eventNamespace; + element.unbind( eventName ).undelegate( eventName ); + }, + + _delay: function( handler, delay ) { + function handlerProxy() { + return ( typeof handler === "string" ? instance[ handler ] : handler ) + .apply( instance, arguments ); + } + var instance = this; + return setTimeout( handlerProxy, delay || 0 ); + }, + + _hoverable: function( element ) { + this.hoverable = this.hoverable.add( element ); + this._on( element, { + mouseenter: function( event ) { + $( event.currentTarget ).addClass( "ui-state-hover" ); + }, + mouseleave: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-hover" ); + } + }); + }, + + _focusable: function( element ) { + this.focusable = this.focusable.add( element ); + this._on( element, { + focusin: function( event ) { + $( event.currentTarget ).addClass( "ui-state-focus" ); + }, + focusout: function( event ) { + $( event.currentTarget ).removeClass( "ui-state-focus" ); + } + }); + }, + + _trigger: function( type, event, data ) { + var prop, orig, + callback = this.options[ type ]; + + data = data || {}; + event = $.Event( event ); + event.type = ( type === this.widgetEventPrefix ? + type : + this.widgetEventPrefix + type ).toLowerCase(); + // the original event may come from any element + // so we need to reset the target on the new event + event.target = this.element[ 0 ]; + + // copy original event properties over to the new event + orig = event.originalEvent; + if ( orig ) { + for ( prop in orig ) { + if ( !( prop in event ) ) { + event[ prop ] = orig[ prop ]; + } + } + } + + this.element.trigger( event, data ); + return !( $.isFunction( callback ) && + callback.apply( this.element[0], [ event ].concat( data ) ) === false || + event.isDefaultPrevented() ); + } +}; + +$.each( { show: "fadeIn", hide: "fadeOut" }, function( method, defaultEffect ) { + $.Widget.prototype[ "_" + method ] = function( element, options, callback ) { + if ( typeof options === "string" ) { + options = { effect: options }; + } + var hasOptions, + effectName = !options ? + method : + options === true || typeof options === "number" ? + defaultEffect : + options.effect || defaultEffect; + options = options || {}; + if ( typeof options === "number" ) { + options = { duration: options }; + } + hasOptions = !$.isEmptyObject( options ); + options.complete = callback; + if ( options.delay ) { + element.delay( options.delay ); + } + if ( hasOptions && $.effects && $.effects.effect[ effectName ] ) { + element[ method ]( options ); + } else if ( effectName !== method && element[ effectName ] ) { + element[ effectName ]( options.duration, options.easing, callback ); + } else { + element.queue(function( next ) { + $( this )[ method ](); + if ( callback ) { + callback.call( element[ 0 ] ); + } + next(); + }); + } + }; +}); + +})( jQuery ); +(function( $, undefined ) { + +var mouseHandled = false; +$( document ).mouseup( function() { + mouseHandled = false; +}); + +$.widget("ui.mouse", { + version: "1.10.0", + options: { + cancel: "input,textarea,button,select,option", + distance: 1, + delay: 0 + }, + _mouseInit: function() { + var that = this; + + this.element + .bind("mousedown."+this.widgetName, function(event) { + return that._mouseDown(event); + }) + .bind("click."+this.widgetName, function(event) { + if (true === $.data(event.target, that.widgetName + ".preventClickEvent")) { + $.removeData(event.target, that.widgetName + ".preventClickEvent"); + event.stopImmediatePropagation(); + return false; + } + }); + + this.started = false; + }, + + // TODO: make sure destroying one instance of mouse doesn't mess with + // other instances of mouse + _mouseDestroy: function() { + this.element.unbind("."+this.widgetName); + if ( this._mouseMoveDelegate ) { + $(document) + .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup."+this.widgetName, this._mouseUpDelegate); + } + }, + + _mouseDown: function(event) { + // don't let more than one widget handle mouseStart + if( mouseHandled ) { return; } + + // we may have missed mouseup (out of window) + (this._mouseStarted && this._mouseUp(event)); + + this._mouseDownEvent = event; + + var that = this, + btnIsLeft = (event.which === 1), + // event.target.nodeName works around a bug in IE 8 with + // disabled inputs (#7620) + elIsCancel = (typeof this.options.cancel === "string" && event.target.nodeName ? $(event.target).closest(this.options.cancel).length : false); + if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) { + return true; + } + + this.mouseDelayMet = !this.options.delay; + if (!this.mouseDelayMet) { + this._mouseDelayTimer = setTimeout(function() { + that.mouseDelayMet = true; + }, this.options.delay); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = (this._mouseStart(event) !== false); + if (!this._mouseStarted) { + event.preventDefault(); + return true; + } + } + + // Click event may never have fired (Gecko & Opera) + if (true === $.data(event.target, this.widgetName + ".preventClickEvent")) { + $.removeData(event.target, this.widgetName + ".preventClickEvent"); + } + + // these delegates are required to keep context + this._mouseMoveDelegate = function(event) { + return that._mouseMove(event); + }; + this._mouseUpDelegate = function(event) { + return that._mouseUp(event); + }; + $(document) + .bind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .bind("mouseup."+this.widgetName, this._mouseUpDelegate); + + event.preventDefault(); + + mouseHandled = true; + return true; + }, + + _mouseMove: function(event) { + // IE mouseup check - mouseup happened when mouse was out of window + if ($.ui.ie && ( !document.documentMode || document.documentMode < 9 ) && !event.button) { + return this._mouseUp(event); + } + + if (this._mouseStarted) { + this._mouseDrag(event); + return event.preventDefault(); + } + + if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) { + this._mouseStarted = + (this._mouseStart(this._mouseDownEvent, event) !== false); + (this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)); + } + + return !this._mouseStarted; + }, + + _mouseUp: function(event) { + $(document) + .unbind("mousemove."+this.widgetName, this._mouseMoveDelegate) + .unbind("mouseup."+this.widgetName, this._mouseUpDelegate); + + if (this._mouseStarted) { + this._mouseStarted = false; + + if (event.target === this._mouseDownEvent.target) { + $.data(event.target, this.widgetName + ".preventClickEvent", true); + } + + this._mouseStop(event); + } + + return false; + }, + + _mouseDistanceMet: function(event) { + return (Math.max( + Math.abs(this._mouseDownEvent.pageX - event.pageX), + Math.abs(this._mouseDownEvent.pageY - event.pageY) + ) >= this.options.distance + ); + }, + + _mouseDelayMet: function(/* event */) { + return this.mouseDelayMet; + }, + + // These are placeholder methods, to be overriden by extending plugin + _mouseStart: function(/* event */) {}, + _mouseDrag: function(/* event */) {}, + _mouseStop: function(/* event */) {}, + _mouseCapture: function(/* event */) { return true; } +}); + +})(jQuery); +(function( $, undefined ) { + +$.ui = $.ui || {}; + +var cachedScrollbarWidth, + max = Math.max, + abs = Math.abs, + round = Math.round, + rhorizontal = /left|center|right/, + rvertical = /top|center|bottom/, + roffset = /[\+\-]\d+%?/, + rposition = /^\w+/, + rpercent = /%$/, + _position = $.fn.position; + +function getOffsets( offsets, width, height ) { + return [ + parseInt( offsets[ 0 ], 10 ) * ( rpercent.test( offsets[ 0 ] ) ? width / 100 : 1 ), + parseInt( offsets[ 1 ], 10 ) * ( rpercent.test( offsets[ 1 ] ) ? height / 100 : 1 ) + ]; +} + +function parseCss( element, property ) { + return parseInt( $.css( element, property ), 10 ) || 0; +} + +function getDimensions( elem ) { + var raw = elem[0]; + if ( raw.nodeType === 9 ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: 0, left: 0 } + }; + } + if ( $.isWindow( raw ) ) { + return { + width: elem.width(), + height: elem.height(), + offset: { top: elem.scrollTop(), left: elem.scrollLeft() } + }; + } + if ( raw.preventDefault ) { + return { + width: 0, + height: 0, + offset: { top: raw.pageY, left: raw.pageX } + }; + } + return { + width: elem.outerWidth(), + height: elem.outerHeight(), + offset: elem.offset() + }; +} + +$.position = { + scrollbarWidth: function() { + if ( cachedScrollbarWidth !== undefined ) { + return cachedScrollbarWidth; + } + var w1, w2, + div = $( "<div style='display:block;width:50px;height:50px;overflow:hidden;'><div style='height:100px;width:auto;'></div></div>" ), + innerDiv = div.children()[0]; + + $( "body" ).append( div ); + w1 = innerDiv.offsetWidth; + div.css( "overflow", "scroll" ); + + w2 = innerDiv.offsetWidth; + + if ( w1 === w2 ) { + w2 = div[0].clientWidth; + } + + div.remove(); + + return (cachedScrollbarWidth = w1 - w2); + }, + getScrollInfo: function( within ) { + var overflowX = within.isWindow ? "" : within.element.css( "overflow-x" ), + overflowY = within.isWindow ? "" : within.element.css( "overflow-y" ), + hasOverflowX = overflowX === "scroll" || + ( overflowX === "auto" && within.width < within.element[0].scrollWidth ), + hasOverflowY = overflowY === "scroll" || + ( overflowY === "auto" && within.height < within.element[0].scrollHeight ); + return { + width: hasOverflowX ? $.position.scrollbarWidth() : 0, + height: hasOverflowY ? $.position.scrollbarWidth() : 0 + }; + }, + getWithinInfo: function( element ) { + var withinElement = $( element || window ), + isWindow = $.isWindow( withinElement[0] ); + return { + element: withinElement, + isWindow: isWindow, + offset: withinElement.offset() || { left: 0, top: 0 }, + scrollLeft: withinElement.scrollLeft(), + scrollTop: withinElement.scrollTop(), + width: isWindow ? withinElement.width() : withinElement.outerWidth(), + height: isWindow ? withinElement.height() : withinElement.outerHeight() + }; + } +}; + +$.fn.position = function( options ) { + if ( !options || !options.of ) { + return _position.apply( this, arguments ); + } + + // make a copy, we don't want to modify arguments + options = $.extend( {}, options ); + + var atOffset, targetWidth, targetHeight, targetOffset, basePosition, dimensions, + target = $( options.of ), + within = $.position.getWithinInfo( options.within ), + scrollInfo = $.position.getScrollInfo( within ), + collision = ( options.collision || "flip" ).split( " " ), + offsets = {}; + + dimensions = getDimensions( target ); + if ( target[0].preventDefault ) { + // force left top to allow flipping + options.at = "left top"; + } + targetWidth = dimensions.width; + targetHeight = dimensions.height; + targetOffset = dimensions.offset; + // clone to reuse original targetOffset later + basePosition = $.extend( {}, targetOffset ); + + // force my and at to have valid horizontal and vertical positions + // if a value is missing or invalid, it will be converted to center + $.each( [ "my", "at" ], function() { + var pos = ( options[ this ] || "" ).split( " " ), + horizontalOffset, + verticalOffset; + + if ( pos.length === 1) { + pos = rhorizontal.test( pos[ 0 ] ) ? + pos.concat( [ "center" ] ) : + rvertical.test( pos[ 0 ] ) ? + [ "center" ].concat( pos ) : + [ "center", "center" ]; + } + pos[ 0 ] = rhorizontal.test( pos[ 0 ] ) ? pos[ 0 ] : "center"; + pos[ 1 ] = rvertical.test( pos[ 1 ] ) ? pos[ 1 ] : "center"; + + // calculate offsets + horizontalOffset = roffset.exec( pos[ 0 ] ); + verticalOffset = roffset.exec( pos[ 1 ] ); + offsets[ this ] = [ + horizontalOffset ? horizontalOffset[ 0 ] : 0, + verticalOffset ? verticalOffset[ 0 ] : 0 + ]; + + // reduce to just the positions without the offsets + options[ this ] = [ + rposition.exec( pos[ 0 ] )[ 0 ], + rposition.exec( pos[ 1 ] )[ 0 ] + ]; + }); + + // normalize collision option + if ( collision.length === 1 ) { + collision[ 1 ] = collision[ 0 ]; + } + + if ( options.at[ 0 ] === "right" ) { + basePosition.left += targetWidth; + } else if ( options.at[ 0 ] === "center" ) { + basePosition.left += targetWidth / 2; + } + + if ( options.at[ 1 ] === "bottom" ) { + basePosition.top += targetHeight; + } else if ( options.at[ 1 ] === "center" ) { + basePosition.top += targetHeight / 2; + } + + atOffset = getOffsets( offsets.at, targetWidth, targetHeight ); + basePosition.left += atOffset[ 0 ]; + basePosition.top += atOffset[ 1 ]; + + return this.each(function() { + var collisionPosition, using, + elem = $( this ), + elemWidth = elem.outerWidth(), + elemHeight = elem.outerHeight(), + marginLeft = parseCss( this, "marginLeft" ), + marginTop = parseCss( this, "marginTop" ), + collisionWidth = elemWidth + marginLeft + parseCss( this, "marginRight" ) + scrollInfo.width, + collisionHeight = elemHeight + marginTop + parseCss( this, "marginBottom" ) + scrollInfo.height, + position = $.extend( {}, basePosition ), + myOffset = getOffsets( offsets.my, elem.outerWidth(), elem.outerHeight() ); + + if ( options.my[ 0 ] === "right" ) { + position.left -= elemWidth; + } else if ( options.my[ 0 ] === "center" ) { + position.left -= elemWidth / 2; + } + + if ( options.my[ 1 ] === "bottom" ) { + position.top -= elemHeight; + } else if ( options.my[ 1 ] === "center" ) { + position.top -= elemHeight / 2; + } + + position.left += myOffset[ 0 ]; + position.top += myOffset[ 1 ]; + + // if the browser doesn't support fractions, then round for consistent results + if ( !$.support.offsetFractions ) { + position.left = round( position.left ); + position.top = round( position.top ); + } + + collisionPosition = { + marginLeft: marginLeft, + marginTop: marginTop + }; + + $.each( [ "left", "top" ], function( i, dir ) { + if ( $.ui.position[ collision[ i ] ] ) { + $.ui.position[ collision[ i ] ][ dir ]( position, { + targetWidth: targetWidth, + targetHeight: targetHeight, + elemWidth: elemWidth, + elemHeight: elemHeight, + collisionPosition: collisionPosition, + collisionWidth: collisionWidth, + collisionHeight: collisionHeight, + offset: [ atOffset[ 0 ] + myOffset[ 0 ], atOffset [ 1 ] + myOffset[ 1 ] ], + my: options.my, + at: options.at, + within: within, + elem : elem + }); + } + }); + + if ( options.using ) { + // adds feedback as second argument to using callback, if present + using = function( props ) { + var left = targetOffset.left - position.left, + right = left + targetWidth - elemWidth, + top = targetOffset.top - position.top, + bottom = top + targetHeight - elemHeight, + feedback = { + target: { + element: target, + left: targetOffset.left, + top: targetOffset.top, + width: targetWidth, + height: targetHeight + }, + element: { + element: elem, + left: position.left, + top: position.top, + width: elemWidth, + height: elemHeight + }, + horizontal: right < 0 ? "left" : left > 0 ? "right" : "center", + vertical: bottom < 0 ? "top" : top > 0 ? "bottom" : "middle" + }; + if ( targetWidth < elemWidth && abs( left + right ) < targetWidth ) { + feedback.horizontal = "center"; + } + if ( targetHeight < elemHeight && abs( top + bottom ) < targetHeight ) { + feedback.vertical = "middle"; + } + if ( max( abs( left ), abs( right ) ) > max( abs( top ), abs( bottom ) ) ) { + feedback.important = "horizontal"; + } else { + feedback.important = "vertical"; + } + options.using.call( this, props, feedback ); + }; + } + + elem.offset( $.extend( position, { using: using } ) ); + }); +}; + +$.ui.position = { + fit: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollLeft : within.offset.left, + outerWidth = within.width, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = withinOffset - collisionPosLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset, + newOverRight; + + // element is wider than within + if ( data.collisionWidth > outerWidth ) { + // element is initially over the left side of within + if ( overLeft > 0 && overRight <= 0 ) { + newOverRight = position.left + overLeft + data.collisionWidth - outerWidth - withinOffset; + position.left += overLeft - newOverRight; + // element is initially over right side of within + } else if ( overRight > 0 && overLeft <= 0 ) { + position.left = withinOffset; + // element is initially over both left and right sides of within + } else { + if ( overLeft > overRight ) { + position.left = withinOffset + outerWidth - data.collisionWidth; + } else { + position.left = withinOffset; + } + } + // too far left -> align with left edge + } else if ( overLeft > 0 ) { + position.left += overLeft; + // too far right -> align with right edge + } else if ( overRight > 0 ) { + position.left -= overRight; + // adjust based on position and margin + } else { + position.left = max( position.left - collisionPosLeft, position.left ); + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.isWindow ? within.scrollTop : within.offset.top, + outerHeight = data.within.height, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = withinOffset - collisionPosTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset, + newOverBottom; + + // element is taller than within + if ( data.collisionHeight > outerHeight ) { + // element is initially over the top of within + if ( overTop > 0 && overBottom <= 0 ) { + newOverBottom = position.top + overTop + data.collisionHeight - outerHeight - withinOffset; + position.top += overTop - newOverBottom; + // element is initially over bottom of within + } else if ( overBottom > 0 && overTop <= 0 ) { + position.top = withinOffset; + // element is initially over both top and bottom of within + } else { + if ( overTop > overBottom ) { + position.top = withinOffset + outerHeight - data.collisionHeight; + } else { + position.top = withinOffset; + } + } + // too far up -> align with top + } else if ( overTop > 0 ) { + position.top += overTop; + // too far down -> align with bottom edge + } else if ( overBottom > 0 ) { + position.top -= overBottom; + // adjust based on position and margin + } else { + position.top = max( position.top - collisionPosTop, position.top ); + } + } + }, + flip: { + left: function( position, data ) { + var within = data.within, + withinOffset = within.offset.left + within.scrollLeft, + outerWidth = within.width, + offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left, + collisionPosLeft = position.left - data.collisionPosition.marginLeft, + overLeft = collisionPosLeft - offsetLeft, + overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft, + myOffset = data.my[ 0 ] === "left" ? + -data.elemWidth : + data.my[ 0 ] === "right" ? + data.elemWidth : + 0, + atOffset = data.at[ 0 ] === "left" ? + data.targetWidth : + data.at[ 0 ] === "right" ? + -data.targetWidth : + 0, + offset = -2 * data.offset[ 0 ], + newOverRight, + newOverLeft; + + if ( overLeft < 0 ) { + newOverRight = position.left + myOffset + atOffset + offset + data.collisionWidth - outerWidth - withinOffset; + if ( newOverRight < 0 || newOverRight < abs( overLeft ) ) { + position.left += myOffset + atOffset + offset; + } + } + else if ( overRight > 0 ) { + newOverLeft = position.left - data.collisionPosition.marginLeft + myOffset + atOffset + offset - offsetLeft; + if ( newOverLeft > 0 || abs( newOverLeft ) < overRight ) { + position.left += myOffset + atOffset + offset; + } + } + }, + top: function( position, data ) { + var within = data.within, + withinOffset = within.offset.top + within.scrollTop, + outerHeight = within.height, + offsetTop = within.isWindow ? within.scrollTop : within.offset.top, + collisionPosTop = position.top - data.collisionPosition.marginTop, + overTop = collisionPosTop - offsetTop, + overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop, + top = data.my[ 1 ] === "top", + myOffset = top ? + -data.elemHeight : + data.my[ 1 ] === "bottom" ? + data.elemHeight : + 0, + atOffset = data.at[ 1 ] === "top" ? + data.targetHeight : + data.at[ 1 ] === "bottom" ? + -data.targetHeight : + 0, + offset = -2 * data.offset[ 1 ], + newOverTop, + newOverBottom; + if ( overTop < 0 ) { + newOverBottom = position.top + myOffset + atOffset + offset + data.collisionHeight - outerHeight - withinOffset; + if ( ( position.top + myOffset + atOffset + offset) > overTop && ( newOverBottom < 0 || newOverBottom < abs( overTop ) ) ) { + position.top += myOffset + atOffset + offset; + } + } + else if ( overBottom > 0 ) { + newOverTop = position.top - data.collisionPosition.marginTop + myOffset + atOffset + offset - offsetTop; + if ( ( position.top + myOffset + atOffset + offset) > overBottom && ( newOverTop > 0 || abs( newOverTop ) < overBottom ) ) { + position.top += myOffset + atOffset + offset; + } + } + } + }, + flipfit: { + left: function() { + $.ui.position.flip.left.apply( this, arguments ); + $.ui.position.fit.left.apply( this, arguments ); + }, + top: function() { + $.ui.position.flip.top.apply( this, arguments ); + $.ui.position.fit.top.apply( this, arguments ); + } + } +}; + +// fraction support test +(function () { + var testElement, testElementParent, testElementStyle, offsetLeft, i, + body = document.getElementsByTagName( "body" )[ 0 ], + div = document.createElement( "div" ); + + //Create a "fake body" for testing based on method used in jQuery.support + testElement = document.createElement( body ? "div" : "body" ); + testElementStyle = { + visibility: "hidden", + width: 0, + height: 0, + border: 0, + margin: 0, + background: "none" + }; + if ( body ) { + $.extend( testElementStyle, { + position: "absolute", + left: "-1000px", + top: "-1000px" + }); + } + for ( i in testElementStyle ) { + testElement.style[ i ] = testElementStyle[ i ]; + } + testElement.appendChild( div ); + testElementParent = body || document.documentElement; + testElementParent.insertBefore( testElement, testElementParent.firstChild ); + + div.style.cssText = "position: absolute; left: 10.7432222px;"; + + offsetLeft = $( div ).offset().left; + $.support.offsetFractions = offsetLeft > 10 && offsetLeft < 11; + + testElement.innerHTML = ""; + testElementParent.removeChild( testElement ); +})(); + +}( jQuery ) ); +(function( $, undefined ) { + +$.widget("ui.draggable", $.ui.mouse, { + version: "1.10.0", + widgetEventPrefix: "drag", + options: { + addClasses: true, + appendTo: "parent", + axis: false, + connectToSortable: false, + containment: false, + cursor: "auto", + cursorAt: false, + grid: false, + handle: false, + helper: "original", + iframeFix: false, + opacity: false, + refreshPositions: false, + revert: false, + revertDuration: 500, + scope: "default", + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + snap: false, + snapMode: "both", + snapTolerance: 20, + stack: false, + zIndex: false, + + // callbacks + drag: null, + start: null, + stop: null + }, + _create: function() { + + if (this.options.helper === "original" && !(/^(?:r|a|f)/).test(this.element.css("position"))) { + this.element[0].style.position = "relative"; + } + if (this.options.addClasses){ + this.element.addClass("ui-draggable"); + } + if (this.options.disabled){ + this.element.addClass("ui-draggable-disabled"); + } + + this._mouseInit(); + + }, + + _destroy: function() { + this.element.removeClass( "ui-draggable ui-draggable-dragging ui-draggable-disabled" ); + this._mouseDestroy(); + }, + + _mouseCapture: function(event) { + + var o = this.options; + + // among others, prevent a drag on a resizable-handle + if (this.helper || o.disabled || $(event.target).closest(".ui-resizable-handle").length > 0) { + return false; + } + + //Quit if we're not on a valid handle + this.handle = this._getHandle(event); + if (!this.handle) { + return false; + } + + $(o.iframeFix === true ? "iframe" : o.iframeFix).each(function() { + $("<div class='ui-draggable-iframeFix' style='background: #fff;'></div>") + .css({ + width: this.offsetWidth+"px", height: this.offsetHeight+"px", + position: "absolute", opacity: "0.001", zIndex: 1000 + }) + .css($(this).offset()) + .appendTo("body"); + }); + + return true; + + }, + + _mouseStart: function(event) { + + var o = this.options; + + //Create and append the visible helper + this.helper = this._createHelper(event); + + this.helper.addClass("ui-draggable-dragging"); + + //Cache the helper size + this._cacheHelperProportions(); + + //If ddmanager is used for droppables, set the global draggable + if($.ui.ddmanager) { + $.ui.ddmanager.current = this; + } + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Store the helper's css position + this.cssPosition = this.helper.css("position"); + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.positionAbs = this.element.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + //Generate the original position + this.originalPosition = this.position = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Set a containment if given in the options + if(o.containment) { + this._setContainment(); + } + + //Trigger event + callbacks + if(this._trigger("start", event) === false) { + this._clear(); + return false; + } + + //Recache the helper size + this._cacheHelperProportions(); + + //Prepare the droppable offsets + if ($.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + + + this._mouseDrag(event, true); //Execute the drag once - this causes the helper not to be visible before getting its correct position + + //If the ddmanager is used for droppables, inform the manager that dragging has started (see #5003) + if ( $.ui.ddmanager ) { + $.ui.ddmanager.dragStart(this, event); + } + + return true; + }, + + _mouseDrag: function(event, noPropagation) { + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + //Call plugins and callbacks and use the resulting position if something is returned + if (!noPropagation) { + var ui = this._uiHash(); + if(this._trigger("drag", event, ui) === false) { + this._mouseUp({}); + return false; + } + this.position = ui.position; + } + + if(!this.options.axis || this.options.axis !== "y") { + this.helper[0].style.left = this.position.left+"px"; + } + if(!this.options.axis || this.options.axis !== "x") { + this.helper[0].style.top = this.position.top+"px"; + } + if($.ui.ddmanager) { + $.ui.ddmanager.drag(this, event); + } + + return false; + }, + + _mouseStop: function(event) { + + //If we are using droppables, inform the manager about the drop + var element, + that = this, + elementInDom = false, + dropped = false; + if ($.ui.ddmanager && !this.options.dropBehaviour) { + dropped = $.ui.ddmanager.drop(this, event); + } + + //if a drop comes from outside (a sortable) + if(this.dropped) { + dropped = this.dropped; + this.dropped = false; + } + + //if the original element is no longer in the DOM don't bother to continue (see #8269) + element = this.element[0]; + while ( element && (element = element.parentNode) ) { + if (element === document ) { + elementInDom = true; + } + } + if ( !elementInDom && this.options.helper === "original" ) { + return false; + } + + if((this.options.revert === "invalid" && !dropped) || (this.options.revert === "valid" && dropped) || this.options.revert === true || ($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))) { + $(this.helper).animate(this.originalPosition, parseInt(this.options.revertDuration, 10), function() { + if(that._trigger("stop", event) !== false) { + that._clear(); + } + }); + } else { + if(this._trigger("stop", event) !== false) { + this._clear(); + } + } + + return false; + }, + + _mouseUp: function(event) { + //Remove frame helpers + $("div.ui-draggable-iframeFix").each(function() { + this.parentNode.removeChild(this); + }); + + //If the ddmanager is used for droppables, inform the manager that dragging has stopped (see #5003) + if( $.ui.ddmanager ) { + $.ui.ddmanager.dragStop(this, event); + } + + return $.ui.mouse.prototype._mouseUp.call(this, event); + }, + + cancel: function() { + + if(this.helper.is(".ui-draggable-dragging")) { + this._mouseUp({}); + } else { + this._clear(); + } + + return this; + + }, + + _getHandle: function(event) { + + var handle = !this.options.handle || !$(this.options.handle, this.element).length ? true : false; + $(this.options.handle, this.element) + .find("*") + .addBack() + .each(function() { + if(this === event.target) { + handle = true; + } + }); + + return handle; + + }, + + _createHelper: function(event) { + + var o = this.options, + helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event])) : (o.helper === "clone" ? this.element.clone().removeAttr("id") : this.element); + + if(!helper.parents("body").length) { + helper.appendTo((o.appendTo === "parent" ? this.element[0].parentNode : o.appendTo)); + } + + if(helper[0] !== this.element[0] && !(/(fixed|absolute)/).test(helper.css("position"))) { + helper.css("position", "absolute"); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj === "string") { + obj = obj.split(" "); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ("left" in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ("right" in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ("top" in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ("bottom" in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + //This needs to be actually done for all browsers, since pageX/pageY includes this information + //Ugly IE fix + if((this.offsetParent[0] === document.body) || + (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition === "relative") { + var p = this.element.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.element.css("marginLeft"),10) || 0), + top: (parseInt(this.element.css("marginTop"),10) || 0), + right: (parseInt(this.element.css("marginRight"),10) || 0), + bottom: (parseInt(this.element.css("marginBottom"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var over, c, ce, + o = this.options; + + if(o.containment === "parent") { + o.containment = this.helper[0].parentNode; + } + if(o.containment === "document" || o.containment === "window") { + this.containment = [ + o.containment === "document" ? 0 : $(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left, + o.containment === "document" ? 0 : $(window).scrollTop() - this.offset.relative.top - this.offset.parent.top, + (o.containment === "document" ? 0 : $(window).scrollLeft()) + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left, + (o.containment === "document" ? 0 : $(window).scrollTop()) + ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + } + + if(!(/^(document|window|parent)$/).test(o.containment) && o.containment.constructor !== Array) { + c = $(o.containment); + ce = c[0]; + + if(!ce) { + return; + } + + over = ($(ce).css("overflow") !== "hidden"); + + this.containment = [ + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0), + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0), + (over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left - this.margins.right, + (over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top - this.margins.bottom + ]; + this.relative_container = c; + + } else if(o.containment.constructor === Array) { + this.containment = o.containment; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) { + pos = this.position; + } + + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top + // The absolute mouse position + this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left + // The absolute mouse position + this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var containment, co, top, left, + o = this.options, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, + scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName), + pageX = event.pageX, + pageY = event.pageY; + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + if(this.containment) { + if (this.relative_container){ + co = this.relative_container.offset(); + containment = [ this.containment[0] + co.left, + this.containment[1] + co.top, + this.containment[2] + co.left, + this.containment[3] + co.top ]; + } + else { + containment = this.containment; + } + + if(event.pageX - this.offset.click.left < containment[0]) { + pageX = containment[0] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top < containment[1]) { + pageY = containment[1] + this.offset.click.top; + } + if(event.pageX - this.offset.click.left > containment[2]) { + pageX = containment[2] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top > containment[3]) { + pageY = containment[3] + this.offset.click.top; + } + } + + if(o.grid) { + //Check for grid elements set to 0 to prevent divide by 0 error causing invalid argument errors in IE (see ticket #6950) + top = o.grid[1] ? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1] : this.originalPageY; + pageY = containment ? ((top - this.offset.click.top >= containment[1] || top - this.offset.click.top > containment[3]) ? top : ((top - this.offset.click.top >= containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + left = o.grid[0] ? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0] : this.originalPageX; + pageX = containment ? ((left - this.offset.click.left >= containment[0] || left - this.offset.click.left > containment[2]) ? left : ((left - this.offset.click.left >= containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY - // The absolute mouse position + this.offset.click.top - // Click offset (relative to the element) + this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX - // The absolute mouse position + this.offset.click.left - // Click offset (relative to the element) + this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _clear: function() { + this.helper.removeClass("ui-draggable-dragging"); + if(this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) { + this.helper.remove(); + } + this.helper = null; + this.cancelHelperRemoval = false; + }, + + // From now on bulk stuff - mainly helpers + + _trigger: function(type, event, ui) { + ui = ui || this._uiHash(); + $.ui.plugin.call(this, type, [event, ui]); + //The absolute position has to be recalculated after plugins + if(type === "drag") { + this.positionAbs = this._convertPositionTo("absolute"); + } + return $.Widget.prototype._trigger.call(this, type, event, ui); + }, + + plugins: {}, + + _uiHash: function() { + return { + helper: this.helper, + position: this.position, + originalPosition: this.originalPosition, + offset: this.positionAbs + }; + } + +}); + +$.ui.plugin.add("draggable", "connectToSortable", { + start: function(event, ui) { + + var inst = $(this).data("ui-draggable"), o = inst.options, + uiSortable = $.extend({}, ui, { item: inst.element }); + inst.sortables = []; + $(o.connectToSortable).each(function() { + var sortable = $.data(this, "ui-sortable"); + if (sortable && !sortable.options.disabled) { + inst.sortables.push({ + instance: sortable, + shouldRevert: sortable.options.revert + }); + sortable.refreshPositions(); // Call the sortable's refreshPositions at drag start to refresh the containerCache since the sortable container cache is used in drag and needs to be up to date (this will ensure it's initialised as well as being kept in step with any changes that might have happened on the page). + sortable._trigger("activate", event, uiSortable); + } + }); + + }, + stop: function(event, ui) { + + //If we are still over the sortable, we fake the stop event of the sortable, but also remove helper + var inst = $(this).data("ui-draggable"), + uiSortable = $.extend({}, ui, { item: inst.element }); + + $.each(inst.sortables, function() { + if(this.instance.isOver) { + + this.instance.isOver = 0; + + inst.cancelHelperRemoval = true; //Don't remove the helper in the draggable instance + this.instance.cancelHelperRemoval = false; //Remove it in the sortable instance (so sortable plugins like revert still work) + + //The sortable revert is supported, and we have to set a temporary dropped variable on the draggable to support revert: "valid/invalid" + if(this.shouldRevert) { + this.instance.options.revert = true; + } + + //Trigger the stop of the sortable + this.instance._mouseStop(event); + + this.instance.options.helper = this.instance.options._helper; + + //If the helper has been the original item, restore properties in the sortable + if(inst.options.helper === "original") { + this.instance.currentItem.css({ top: "auto", left: "auto" }); + } + + } else { + this.instance.cancelHelperRemoval = false; //Remove the helper in the sortable instance + this.instance._trigger("deactivate", event, uiSortable); + } + + }); + + }, + drag: function(event, ui) { + + var inst = $(this).data("ui-draggable"), that = this; + + $.each(inst.sortables, function() { + + var innermostIntersecting = false, + thisSortable = this; + + //Copy over some variables to allow calling the sortable's native _intersectsWith + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + + if(this.instance._intersectsWith(this.instance.containerCache)) { + innermostIntersecting = true; + $.each(inst.sortables, function () { + this.instance.positionAbs = inst.positionAbs; + this.instance.helperProportions = inst.helperProportions; + this.instance.offset.click = inst.offset.click; + if (this !== thisSortable && + this.instance._intersectsWith(this.instance.containerCache) && + $.ui.contains(thisSortable.instance.element[0], this.instance.element[0]) + ) { + innermostIntersecting = false; + } + return innermostIntersecting; + }); + } + + + if(innermostIntersecting) { + //If it intersects, we use a little isOver variable and set it once, so our move-in stuff gets fired only once + if(!this.instance.isOver) { + + this.instance.isOver = 1; + //Now we fake the start of dragging for the sortable instance, + //by cloning the list group item, appending it to the sortable and using it as inst.currentItem + //We can then fire the start event of the sortable with our passed browser event, and our own helper (so it doesn't create a new one) + this.instance.currentItem = $(that).clone().removeAttr("id").appendTo(this.instance.element).data("ui-sortable-item", true); + this.instance.options._helper = this.instance.options.helper; //Store helper option to later restore it + this.instance.options.helper = function() { return ui.helper[0]; }; + + event.target = this.instance.currentItem[0]; + this.instance._mouseCapture(event, true); + this.instance._mouseStart(event, true, true); + + //Because the browser event is way off the new appended portlet, we modify a couple of variables to reflect the changes + this.instance.offset.click.top = inst.offset.click.top; + this.instance.offset.click.left = inst.offset.click.left; + this.instance.offset.parent.left -= inst.offset.parent.left - this.instance.offset.parent.left; + this.instance.offset.parent.top -= inst.offset.parent.top - this.instance.offset.parent.top; + + inst._trigger("toSortable", event); + inst.dropped = this.instance.element; //draggable revert needs that + //hack so receive/update callbacks work (mostly) + inst.currentItem = inst.element; + this.instance.fromOutside = inst; + + } + + //Provided we did all the previous steps, we can fire the drag event of the sortable on every draggable drag, when it intersects with the sortable + if(this.instance.currentItem) { + this.instance._mouseDrag(event); + } + + } else { + + //If it doesn't intersect with the sortable, and it intersected before, + //we fake the drag stop of the sortable, but make sure it doesn't remove the helper by using cancelHelperRemoval + if(this.instance.isOver) { + + this.instance.isOver = 0; + this.instance.cancelHelperRemoval = true; + + //Prevent reverting on this forced stop + this.instance.options.revert = false; + + // The out event needs to be triggered independently + this.instance._trigger("out", event, this.instance._uiHash(this.instance)); + + this.instance._mouseStop(event, true); + this.instance.options.helper = this.instance.options._helper; + + //Now we remove our currentItem, the list group clone again, and the placeholder, and animate the helper back to it's original size + this.instance.currentItem.remove(); + if(this.instance.placeholder) { + this.instance.placeholder.remove(); + } + + inst._trigger("fromSortable", event); + inst.dropped = false; //draggable revert needs that + } + + } + + }); + + } +}); + +$.ui.plugin.add("draggable", "cursor", { + start: function() { + var t = $("body"), o = $(this).data("ui-draggable").options; + if (t.css("cursor")) { + o._cursor = t.css("cursor"); + } + t.css("cursor", o.cursor); + }, + stop: function() { + var o = $(this).data("ui-draggable").options; + if (o._cursor) { + $("body").css("cursor", o._cursor); + } + } +}); + +$.ui.plugin.add("draggable", "opacity", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("ui-draggable").options; + if(t.css("opacity")) { + o._opacity = t.css("opacity"); + } + t.css("opacity", o.opacity); + }, + stop: function(event, ui) { + var o = $(this).data("ui-draggable").options; + if(o._opacity) { + $(ui.helper).css("opacity", o._opacity); + } + } +}); + +$.ui.plugin.add("draggable", "scroll", { + start: function() { + var i = $(this).data("ui-draggable"); + if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") { + i.overflowOffset = i.scrollParent.offset(); + } + }, + drag: function( event ) { + + var i = $(this).data("ui-draggable"), o = i.options, scrolled = false; + + if(i.scrollParent[0] !== document && i.scrollParent[0].tagName !== "HTML") { + + if(!o.axis || o.axis !== "x") { + if((i.overflowOffset.top + i.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) { + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop + o.scrollSpeed; + } else if(event.pageY - i.overflowOffset.top < o.scrollSensitivity) { + i.scrollParent[0].scrollTop = scrolled = i.scrollParent[0].scrollTop - o.scrollSpeed; + } + } + + if(!o.axis || o.axis !== "y") { + if((i.overflowOffset.left + i.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) { + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft + o.scrollSpeed; + } else if(event.pageX - i.overflowOffset.left < o.scrollSensitivity) { + i.scrollParent[0].scrollLeft = scrolled = i.scrollParent[0].scrollLeft - o.scrollSpeed; + } + } + + } else { + + if(!o.axis || o.axis !== "x") { + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + } + + if(!o.axis || o.axis !== "y") { + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(i, event); + } + + } +}); + +$.ui.plugin.add("draggable", "snap", { + start: function() { + + var i = $(this).data("ui-draggable"), + o = i.options; + + i.snapElements = []; + + $(o.snap.constructor !== String ? ( o.snap.items || ":data(ui-draggable)" ) : o.snap).each(function() { + var $t = $(this), + $o = $t.offset(); + if(this !== i.element[0]) { + i.snapElements.push({ + item: this, + width: $t.outerWidth(), height: $t.outerHeight(), + top: $o.top, left: $o.left + }); + } + }); + + }, + drag: function(event, ui) { + + var ts, bs, ls, rs, l, r, t, b, i, first, + inst = $(this).data("ui-draggable"), + o = inst.options, + d = o.snapTolerance, + x1 = ui.offset.left, x2 = x1 + inst.helperProportions.width, + y1 = ui.offset.top, y2 = y1 + inst.helperProportions.height; + + for (i = inst.snapElements.length - 1; i >= 0; i--){ + + l = inst.snapElements[i].left; + r = l + inst.snapElements[i].width; + t = inst.snapElements[i].top; + b = t + inst.snapElements[i].height; + + //Yes, I know, this is insane ;) + if(!((l-d < x1 && x1 < r+d && t-d < y1 && y1 < b+d) || (l-d < x1 && x1 < r+d && t-d < y2 && y2 < b+d) || (l-d < x2 && x2 < r+d && t-d < y1 && y1 < b+d) || (l-d < x2 && x2 < r+d && t-d < y2 && y2 < b+d))) { + if(inst.snapElements[i].snapping) { + (inst.options.snap.release && inst.options.snap.release.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + } + inst.snapElements[i].snapping = false; + continue; + } + + if(o.snapMode !== "inner") { + ts = Math.abs(t - y2) <= d; + bs = Math.abs(b - y1) <= d; + ls = Math.abs(l - x2) <= d; + rs = Math.abs(r - x1) <= d; + if(ts) { + ui.position.top = inst._convertPositionTo("relative", { top: t - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + } + if(bs) { + ui.position.top = inst._convertPositionTo("relative", { top: b, left: 0 }).top - inst.margins.top; + } + if(ls) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l - inst.helperProportions.width }).left - inst.margins.left; + } + if(rs) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r }).left - inst.margins.left; + } + } + + first = (ts || bs || ls || rs); + + if(o.snapMode !== "outer") { + ts = Math.abs(t - y1) <= d; + bs = Math.abs(b - y2) <= d; + ls = Math.abs(l - x1) <= d; + rs = Math.abs(r - x2) <= d; + if(ts) { + ui.position.top = inst._convertPositionTo("relative", { top: t, left: 0 }).top - inst.margins.top; + } + if(bs) { + ui.position.top = inst._convertPositionTo("relative", { top: b - inst.helperProportions.height, left: 0 }).top - inst.margins.top; + } + if(ls) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: l }).left - inst.margins.left; + } + if(rs) { + ui.position.left = inst._convertPositionTo("relative", { top: 0, left: r - inst.helperProportions.width }).left - inst.margins.left; + } + } + + if(!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) { + (inst.options.snap.snap && inst.options.snap.snap.call(inst.element, event, $.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item }))); + } + inst.snapElements[i].snapping = (ts || bs || ls || rs || first); + + } + + } +}); + +$.ui.plugin.add("draggable", "stack", { + start: function() { + + var min, + o = $(this).data("ui-draggable").options, + group = $.makeArray($(o.stack)).sort(function(a,b) { + return (parseInt($(a).css("zIndex"),10) || 0) - (parseInt($(b).css("zIndex"),10) || 0); + }); + + if (!group.length) { return; } + + min = parseInt(group[0].style.zIndex, 10) || 0; + $(group).each(function(i) { + this.style.zIndex = min + i; + }); + + this[0].style.zIndex = min + group.length; + + } +}); + +$.ui.plugin.add("draggable", "zIndex", { + start: function(event, ui) { + var t = $(ui.helper), o = $(this).data("ui-draggable").options; + if(t.css("zIndex")) { + o._zIndex = t.css("zIndex"); + } + t.css("zIndex", o.zIndex); + }, + stop: function(event, ui) { + var o = $(this).data("ui-draggable").options; + if(o._zIndex) { + $(ui.helper).css("zIndex", o._zIndex); + } + } +}); + +})(jQuery); +(function( $, undefined ) { + +function isOverAxis( x, reference, size ) { + return ( x > reference ) && ( x < ( reference + size ) ); +} + +$.widget("ui.droppable", { + version: "1.10.0", + widgetEventPrefix: "drop", + options: { + accept: "*", + activeClass: false, + addClasses: true, + greedy: false, + hoverClass: false, + scope: "default", + tolerance: "intersect", + + // callbacks + activate: null, + deactivate: null, + drop: null, + out: null, + over: null + }, + _create: function() { + + var o = this.options, + accept = o.accept; + + this.isover = false; + this.isout = true; + + this.accept = $.isFunction(accept) ? accept : function(d) { + return d.is(accept); + }; + + //Store the droppable's proportions + this.proportions = { width: this.element[0].offsetWidth, height: this.element[0].offsetHeight }; + + // Add the reference and positions to the manager + $.ui.ddmanager.droppables[o.scope] = $.ui.ddmanager.droppables[o.scope] || []; + $.ui.ddmanager.droppables[o.scope].push(this); + + (o.addClasses && this.element.addClass("ui-droppable")); + + }, + + _destroy: function() { + var i = 0, + drop = $.ui.ddmanager.droppables[this.options.scope]; + + for ( ; i < drop.length; i++ ) { + if ( drop[i] === this ) { + drop.splice(i, 1); + } + } + + this.element.removeClass("ui-droppable ui-droppable-disabled"); + }, + + _setOption: function(key, value) { + + if(key === "accept") { + this.accept = $.isFunction(value) ? value : function(d) { + return d.is(value); + }; + } + $.Widget.prototype._setOption.apply(this, arguments); + }, + + _activate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) { + this.element.addClass(this.options.activeClass); + } + if(draggable){ + this._trigger("activate", event, this.ui(draggable)); + } + }, + + _deactivate: function(event) { + var draggable = $.ui.ddmanager.current; + if(this.options.activeClass) { + this.element.removeClass(this.options.activeClass); + } + if(draggable){ + this._trigger("deactivate", event, this.ui(draggable)); + } + }, + + _over: function(event) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return; + } + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) { + this.element.addClass(this.options.hoverClass); + } + this._trigger("over", event, this.ui(draggable)); + } + + }, + + _out: function(event) { + + var draggable = $.ui.ddmanager.current; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return; + } + + if (this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.hoverClass) { + this.element.removeClass(this.options.hoverClass); + } + this._trigger("out", event, this.ui(draggable)); + } + + }, + + _drop: function(event,custom) { + + var draggable = custom || $.ui.ddmanager.current, + childrenIntersection = false; + + // Bail if draggable and droppable are same element + if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) { + return false; + } + + this.element.find(":data(ui-droppable)").not(".ui-draggable-dragging").each(function() { + var inst = $.data(this, "ui-droppable"); + if( + inst.options.greedy && + !inst.options.disabled && + inst.options.scope === draggable.options.scope && + inst.accept.call(inst.element[0], (draggable.currentItem || draggable.element)) && + $.ui.intersect(draggable, $.extend(inst, { offset: inst.element.offset() }), inst.options.tolerance) + ) { childrenIntersection = true; return false; } + }); + if(childrenIntersection) { + return false; + } + + if(this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + if(this.options.activeClass) { + this.element.removeClass(this.options.activeClass); + } + if(this.options.hoverClass) { + this.element.removeClass(this.options.hoverClass); + } + this._trigger("drop", event, this.ui(draggable)); + return this.element; + } + + return false; + + }, + + ui: function(c) { + return { + draggable: (c.currentItem || c.element), + helper: c.helper, + position: c.position, + offset: c.positionAbs + }; + } + +}); + +$.ui.intersect = function(draggable, droppable, toleranceMode) { + + if (!droppable.offset) { + return false; + } + + var draggableLeft, draggableTop, + x1 = (draggable.positionAbs || draggable.position.absolute).left, x2 = x1 + draggable.helperProportions.width, + y1 = (draggable.positionAbs || draggable.position.absolute).top, y2 = y1 + draggable.helperProportions.height, + l = droppable.offset.left, r = l + droppable.proportions.width, + t = droppable.offset.top, b = t + droppable.proportions.height; + + switch (toleranceMode) { + case "fit": + return (l <= x1 && x2 <= r && t <= y1 && y2 <= b); + case "intersect": + return (l < x1 + (draggable.helperProportions.width / 2) && // Right Half + x2 - (draggable.helperProportions.width / 2) < r && // Left Half + t < y1 + (draggable.helperProportions.height / 2) && // Bottom Half + y2 - (draggable.helperProportions.height / 2) < b ); // Top Half + case "pointer": + draggableLeft = ((draggable.positionAbs || draggable.position.absolute).left + (draggable.clickOffset || draggable.offset.click).left); + draggableTop = ((draggable.positionAbs || draggable.position.absolute).top + (draggable.clickOffset || draggable.offset.click).top); + return isOverAxis( draggableTop, t, droppable.proportions.height ) && isOverAxis( draggableLeft, l, droppable.proportions.width ); + case "touch": + return ( + (y1 >= t && y1 <= b) || // Top edge touching + (y2 >= t && y2 <= b) || // Bottom edge touching + (y1 < t && y2 > b) // Surrounded vertically + ) && ( + (x1 >= l && x1 <= r) || // Left edge touching + (x2 >= l && x2 <= r) || // Right edge touching + (x1 < l && x2 > r) // Surrounded horizontally + ); + default: + return false; + } + +}; + +/* + This manager tracks offsets of draggables and droppables +*/ +$.ui.ddmanager = { + current: null, + droppables: { "default": [] }, + prepareOffsets: function(t, event) { + + var i, j, + m = $.ui.ddmanager.droppables[t.options.scope] || [], + type = event ? event.type : null, // workaround for #2317 + list = (t.currentItem || t.element).find(":data(ui-droppable)").addBack(); + + droppablesLoop: for (i = 0; i < m.length; i++) { + + //No disabled and non-accepted + if(m[i].options.disabled || (t && !m[i].accept.call(m[i].element[0],(t.currentItem || t.element)))) { + continue; + } + + // Filter out elements in the current dragged item + for (j=0; j < list.length; j++) { + if(list[j] === m[i].element[0]) { + m[i].proportions.height = 0; + continue droppablesLoop; + } + } + + m[i].visible = m[i].element.css("display") !== "none"; + if(!m[i].visible) { + continue; + } + + //Activate the droppable if used directly from draggables + if(type === "mousedown") { + m[i]._activate.call(m[i], event); + } + + m[i].offset = m[i].element.offset(); + m[i].proportions = { width: m[i].element[0].offsetWidth, height: m[i].element[0].offsetHeight }; + + } + + }, + drop: function(draggable, event) { + + var dropped = false; + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(!this.options) { + return; + } + if (!this.options.disabled && this.visible && $.ui.intersect(draggable, this, this.options.tolerance)) { + dropped = this._drop.call(this, event) || dropped; + } + + if (!this.options.disabled && this.visible && this.accept.call(this.element[0],(draggable.currentItem || draggable.element))) { + this.isout = true; + this.isover = false; + this._deactivate.call(this, event); + } + + }); + return dropped; + + }, + dragStart: function( draggable, event ) { + //Listen for scrolling so that if the dragging causes scrolling the position of the droppables can be recalculated (see #5003) + draggable.element.parentsUntil( "body" ).bind( "scroll.droppable", function() { + if( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + }); + }, + drag: function(draggable, event) { + + //If you have a highly dynamic page, you might try this option. It renders positions every time you move the mouse. + if(draggable.options.refreshPositions) { + $.ui.ddmanager.prepareOffsets(draggable, event); + } + + //Run through all droppables and check their positions based on specific tolerance options + $.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function() { + + if(this.options.disabled || this.greedyChild || !this.visible) { + return; + } + + var parentInstance, scope, parent, + intersects = $.ui.intersect(draggable, this, this.options.tolerance), + c = !intersects && this.isover ? "isout" : (intersects && !this.isover ? "isover" : null); + if(!c) { + return; + } + + if (this.options.greedy) { + // find droppable parents with same scope + scope = this.options.scope; + parent = this.element.parents(":data(ui-droppable)").filter(function () { + return $.data(this, "ui-droppable").options.scope === scope; + }); + + if (parent.length) { + parentInstance = $.data(parent[0], "ui-droppable"); + parentInstance.greedyChild = (c === "isover"); + } + } + + // we just moved into a greedy child + if (parentInstance && c === "isover") { + parentInstance.isover = false; + parentInstance.isout = true; + parentInstance._out.call(parentInstance, event); + } + + this[c] = true; + this[c === "isout" ? "isover" : "isout"] = false; + this[c === "isover" ? "_over" : "_out"].call(this, event); + + // we just moved out of a greedy child + if (parentInstance && c === "isout") { + parentInstance.isout = false; + parentInstance.isover = true; + parentInstance._over.call(parentInstance, event); + } + }); + + }, + dragStop: function( draggable, event ) { + draggable.element.parentsUntil( "body" ).unbind( "scroll.droppable" ); + //Call prepareOffsets one final time since IE does not fire return scroll events when overflow was caused by drag (see #5003) + if( !draggable.options.refreshPositions ) { + $.ui.ddmanager.prepareOffsets( draggable, event ); + } + } +}; + +})(jQuery); +(function( $, undefined ) { + +function num(v) { + return parseInt(v, 10) || 0; +} + +function isNumber(value) { + return !isNaN(parseInt(value, 10)); +} + +$.widget("ui.resizable", $.ui.mouse, { + version: "1.10.0", + widgetEventPrefix: "resize", + options: { + alsoResize: false, + animate: false, + animateDuration: "slow", + animateEasing: "swing", + aspectRatio: false, + autoHide: false, + containment: false, + ghost: false, + grid: false, + handles: "e,s,se", + helper: false, + maxHeight: null, + maxWidth: null, + minHeight: 10, + minWidth: 10, + // See #7960 + zIndex: 90, + + // callbacks + resize: null, + start: null, + stop: null + }, + _create: function() { + + var n, i, handle, axis, hname, + that = this, + o = this.options; + this.element.addClass("ui-resizable"); + + $.extend(this, { + _aspectRatio: !!(o.aspectRatio), + aspectRatio: o.aspectRatio, + originalElement: this.element, + _proportionallyResizeElements: [], + _helper: o.helper || o.ghost || o.animate ? o.helper || "ui-resizable-helper" : null + }); + + //Wrap the element if it cannot hold child nodes + if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)) { + + //Create a wrapper element and set the wrapper to the new current internal element + this.element.wrap( + $("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({ + position: this.element.css("position"), + width: this.element.outerWidth(), + height: this.element.outerHeight(), + top: this.element.css("top"), + left: this.element.css("left") + }) + ); + + //Overwrite the original this.element + this.element = this.element.parent().data( + "ui-resizable", this.element.data("ui-resizable") + ); + + this.elementIsWrapper = true; + + //Move margins to the wrapper + this.element.css({ marginLeft: this.originalElement.css("marginLeft"), marginTop: this.originalElement.css("marginTop"), marginRight: this.originalElement.css("marginRight"), marginBottom: this.originalElement.css("marginBottom") }); + this.originalElement.css({ marginLeft: 0, marginTop: 0, marginRight: 0, marginBottom: 0}); + + //Prevent Safari textarea resize + this.originalResizeStyle = this.originalElement.css("resize"); + this.originalElement.css("resize", "none"); + + //Push the actual element to our proportionallyResize internal array + this._proportionallyResizeElements.push(this.originalElement.css({ position: "static", zoom: 1, display: "block" })); + + // avoid IE jump (hard set the margin) + this.originalElement.css({ margin: this.originalElement.css("margin") }); + + // fix handlers offset + this._proportionallyResize(); + + } + + this.handles = o.handles || (!$(".ui-resizable-handle", this.element).length ? "e,s,se" : { n: ".ui-resizable-n", e: ".ui-resizable-e", s: ".ui-resizable-s", w: ".ui-resizable-w", se: ".ui-resizable-se", sw: ".ui-resizable-sw", ne: ".ui-resizable-ne", nw: ".ui-resizable-nw" }); + if(this.handles.constructor === String) { + + if ( this.handles === "all") { + this.handles = "n,e,s,w,se,sw,ne,nw"; + } + + n = this.handles.split(","); + this.handles = {}; + + for(i = 0; i < n.length; i++) { + + handle = $.trim(n[i]); + hname = "ui-resizable-"+handle; + axis = $("<div class='ui-resizable-handle " + hname + "'></div>"); + + // Apply zIndex to all handles - see #7960 + axis.css({ zIndex: o.zIndex }); + + //TODO : What's going on here? + if ("se" === handle) { + axis.addClass("ui-icon ui-icon-gripsmall-diagonal-se"); + } + + //Insert into internal handles object and append to element + this.handles[handle] = ".ui-resizable-"+handle; + this.element.append(axis); + } + + } + + this._renderAxis = function(target) { + + var i, axis, padPos, padWrapper; + + target = target || this.element; + + for(i in this.handles) { + + if(this.handles[i].constructor === String) { + this.handles[i] = $(this.handles[i], this.element).show(); + } + + //Apply pad to wrapper element, needed to fix axis position (textarea, inputs, scrolls) + if (this.elementIsWrapper && this.originalElement[0].nodeName.match(/textarea|input|select|button/i)) { + + axis = $(this.handles[i], this.element); + + //Checking the correct pad and border + padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth(); + + //The padding type i have to apply... + padPos = [ "padding", + /ne|nw|n/.test(i) ? "Top" : + /se|sw|s/.test(i) ? "Bottom" : + /^e$/.test(i) ? "Right" : "Left" ].join(""); + + target.css(padPos, padWrapper); + + this._proportionallyResize(); + + } + + //TODO: What's that good for? There's not anything to be executed left + if(!$(this.handles[i]).length) { + continue; + } + } + }; + + //TODO: make renderAxis a prototype function + this._renderAxis(this.element); + + this._handles = $(".ui-resizable-handle", this.element) + .disableSelection(); + + //Matching axis name + this._handles.mouseover(function() { + if (!that.resizing) { + if (this.className) { + axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i); + } + //Axis, default = se + that.axis = axis && axis[1] ? axis[1] : "se"; + } + }); + + //If we want to auto hide the elements + if (o.autoHide) { + this._handles.hide(); + $(this.element) + .addClass("ui-resizable-autohide") + .mouseenter(function() { + if (o.disabled) { + return; + } + $(this).removeClass("ui-resizable-autohide"); + that._handles.show(); + }) + .mouseleave(function(){ + if (o.disabled) { + return; + } + if (!that.resizing) { + $(this).addClass("ui-resizable-autohide"); + that._handles.hide(); + } + }); + } + + //Initialize the mouse interaction + this._mouseInit(); + + }, + + _destroy: function() { + + this._mouseDestroy(); + + var wrapper, + _destroy = function(exp) { + $(exp).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing") + .removeData("resizable").removeData("ui-resizable").unbind(".resizable").find(".ui-resizable-handle").remove(); + }; + + //TODO: Unwrap at same DOM position + if (this.elementIsWrapper) { + _destroy(this.element); + wrapper = this.element; + this.originalElement.css({ + position: wrapper.css("position"), + width: wrapper.outerWidth(), + height: wrapper.outerHeight(), + top: wrapper.css("top"), + left: wrapper.css("left") + }).insertAfter( wrapper ); + wrapper.remove(); + } + + this.originalElement.css("resize", this.originalResizeStyle); + _destroy(this.originalElement); + + return this; + }, + + _mouseCapture: function(event) { + var i, handle, + capture = false; + + for (i in this.handles) { + handle = $(this.handles[i])[0]; + if (handle === event.target || $.contains(handle, event.target)) { + capture = true; + } + } + + return !this.options.disabled && capture; + }, + + _mouseStart: function(event) { + + var curleft, curtop, cursor, + o = this.options, + iniPos = this.element.position(), + el = this.element; + + this.resizing = true; + + // bugfix for http://dev.jquery.com/ticket/1749 + if ( (/absolute/).test( el.css("position") ) ) { + el.css({ position: "absolute", top: el.css("top"), left: el.css("left") }); + } else if (el.is(".ui-draggable")) { + el.css({ position: "absolute", top: iniPos.top, left: iniPos.left }); + } + + this._renderProxy(); + + curleft = num(this.helper.css("left")); + curtop = num(this.helper.css("top")); + + if (o.containment) { + curleft += $(o.containment).scrollLeft() || 0; + curtop += $(o.containment).scrollTop() || 0; + } + + //Store needed variables + this.offset = this.helper.offset(); + this.position = { left: curleft, top: curtop }; + this.size = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalSize = this._helper ? { width: el.outerWidth(), height: el.outerHeight() } : { width: el.width(), height: el.height() }; + this.originalPosition = { left: curleft, top: curtop }; + this.sizeDiff = { width: el.outerWidth() - el.width(), height: el.outerHeight() - el.height() }; + this.originalMousePosition = { left: event.pageX, top: event.pageY }; + + //Aspect Ratio + this.aspectRatio = (typeof o.aspectRatio === "number") ? o.aspectRatio : ((this.originalSize.width / this.originalSize.height) || 1); + + cursor = $(".ui-resizable-" + this.axis).css("cursor"); + $("body").css("cursor", cursor === "auto" ? this.axis + "-resize" : cursor); + + el.addClass("ui-resizable-resizing"); + this._propagate("start", event); + return true; + }, + + _mouseDrag: function(event) { + + //Increase performance, avoid regex + var data, + el = this.helper, props = {}, + smp = this.originalMousePosition, + a = this.axis, + prevTop = this.position.top, + prevLeft = this.position.left, + prevWidth = this.size.width, + prevHeight = this.size.height, + dx = (event.pageX-smp.left)||0, + dy = (event.pageY-smp.top)||0, + trigger = this._change[a]; + + if (!trigger) { + return false; + } + + // Calculate the attrs that will be change + data = trigger.apply(this, [event, dx, dy]); + + // Put this in the mouseDrag handler since the user can start pressing shift while resizing + this._updateVirtualBoundaries(event.shiftKey); + if (this._aspectRatio || event.shiftKey) { + data = this._updateRatio(data, event); + } + + data = this._respectSize(data, event); + + this._updateCache(data); + + // plugins callbacks need to be called first + this._propagate("resize", event); + + if (this.position.top !== prevTop) { + props.top = this.position.top + "px"; + } + if (this.position.left !== prevLeft) { + props.left = this.position.left + "px"; + } + if (this.size.width !== prevWidth) { + props.width = this.size.width + "px"; + } + if (this.size.height !== prevHeight) { + props.height = this.size.height + "px"; + } + el.css(props); + + if (!this._helper && this._proportionallyResizeElements.length) { + this._proportionallyResize(); + } + + // Call the user callback if the element was resized + if ( ! $.isEmptyObject(props) ) { + this._trigger("resize", event, this.ui()); + } + + return false; + }, + + _mouseStop: function(event) { + + this.resizing = false; + var pr, ista, soffseth, soffsetw, s, left, top, + o = this.options, that = this; + + if(this._helper) { + + pr = this._proportionallyResizeElements; + ista = pr.length && (/textarea/i).test(pr[0].nodeName); + soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height; + soffsetw = ista ? 0 : that.sizeDiff.width; + + s = { width: (that.helper.width() - soffsetw), height: (that.helper.height() - soffseth) }; + left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null; + top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null; + + if (!o.animate) { + this.element.css($.extend(s, { top: top, left: left })); + } + + that.helper.height(that.size.height); + that.helper.width(that.size.width); + + if (this._helper && !o.animate) { + this._proportionallyResize(); + } + } + + $("body").css("cursor", "auto"); + + this.element.removeClass("ui-resizable-resizing"); + + this._propagate("stop", event); + + if (this._helper) { + this.helper.remove(); + } + + return false; + + }, + + _updateVirtualBoundaries: function(forceAspectRatio) { + var pMinWidth, pMaxWidth, pMinHeight, pMaxHeight, b, + o = this.options; + + b = { + minWidth: isNumber(o.minWidth) ? o.minWidth : 0, + maxWidth: isNumber(o.maxWidth) ? o.maxWidth : Infinity, + minHeight: isNumber(o.minHeight) ? o.minHeight : 0, + maxHeight: isNumber(o.maxHeight) ? o.maxHeight : Infinity + }; + + if(this._aspectRatio || forceAspectRatio) { + // We want to create an enclosing box whose aspect ration is the requested one + // First, compute the "projected" size for each dimension based on the aspect ratio and other dimension + pMinWidth = b.minHeight * this.aspectRatio; + pMinHeight = b.minWidth / this.aspectRatio; + pMaxWidth = b.maxHeight * this.aspectRatio; + pMaxHeight = b.maxWidth / this.aspectRatio; + + if(pMinWidth > b.minWidth) { + b.minWidth = pMinWidth; + } + if(pMinHeight > b.minHeight) { + b.minHeight = pMinHeight; + } + if(pMaxWidth < b.maxWidth) { + b.maxWidth = pMaxWidth; + } + if(pMaxHeight < b.maxHeight) { + b.maxHeight = pMaxHeight; + } + } + this._vBoundaries = b; + }, + + _updateCache: function(data) { + this.offset = this.helper.offset(); + if (isNumber(data.left)) { + this.position.left = data.left; + } + if (isNumber(data.top)) { + this.position.top = data.top; + } + if (isNumber(data.height)) { + this.size.height = data.height; + } + if (isNumber(data.width)) { + this.size.width = data.width; + } + }, + + _updateRatio: function( data ) { + + var cpos = this.position, + csize = this.size, + a = this.axis; + + if (isNumber(data.height)) { + data.width = (data.height * this.aspectRatio); + } else if (isNumber(data.width)) { + data.height = (data.width / this.aspectRatio); + } + + if (a === "sw") { + data.left = cpos.left + (csize.width - data.width); + data.top = null; + } + if (a === "nw") { + data.top = cpos.top + (csize.height - data.height); + data.left = cpos.left + (csize.width - data.width); + } + + return data; + }, + + _respectSize: function( data ) { + + var o = this._vBoundaries, + a = this.axis, + ismaxw = isNumber(data.width) && o.maxWidth && (o.maxWidth < data.width), ismaxh = isNumber(data.height) && o.maxHeight && (o.maxHeight < data.height), + isminw = isNumber(data.width) && o.minWidth && (o.minWidth > data.width), isminh = isNumber(data.height) && o.minHeight && (o.minHeight > data.height), + dw = this.originalPosition.left + this.originalSize.width, + dh = this.position.top + this.size.height, + cw = /sw|nw|w/.test(a), ch = /nw|ne|n/.test(a); + if (isminw) { + data.width = o.minWidth; + } + if (isminh) { + data.height = o.minHeight; + } + if (ismaxw) { + data.width = o.maxWidth; + } + if (ismaxh) { + data.height = o.maxHeight; + } + + if (isminw && cw) { + data.left = dw - o.minWidth; + } + if (ismaxw && cw) { + data.left = dw - o.maxWidth; + } + if (isminh && ch) { + data.top = dh - o.minHeight; + } + if (ismaxh && ch) { + data.top = dh - o.maxHeight; + } + + // fixing jump error on top/left - bug #2330 + if (!data.width && !data.height && !data.left && data.top) { + data.top = null; + } else if (!data.width && !data.height && !data.top && data.left) { + data.left = null; + } + + return data; + }, + + _proportionallyResize: function() { + + if (!this._proportionallyResizeElements.length) { + return; + } + + var i, j, borders, paddings, prel, + element = this.helper || this.element; + + for ( i=0; i < this._proportionallyResizeElements.length; i++) { + + prel = this._proportionallyResizeElements[i]; + + if (!this.borderDif) { + this.borderDif = []; + borders = [prel.css("borderTopWidth"), prel.css("borderRightWidth"), prel.css("borderBottomWidth"), prel.css("borderLeftWidth")]; + paddings = [prel.css("paddingTop"), prel.css("paddingRight"), prel.css("paddingBottom"), prel.css("paddingLeft")]; + + for ( j = 0; j < borders.length; j++ ) { + this.borderDif[ j ] = ( parseInt( borders[ j ], 10 ) || 0 ) + ( parseInt( paddings[ j ], 10 ) || 0 ); + } + } + + prel.css({ + height: (element.height() - this.borderDif[0] - this.borderDif[2]) || 0, + width: (element.width() - this.borderDif[1] - this.borderDif[3]) || 0 + }); + + } + + }, + + _renderProxy: function() { + + var el = this.element, o = this.options; + this.elementOffset = el.offset(); + + if(this._helper) { + + this.helper = this.helper || $("<div style='overflow:hidden;'></div>"); + + this.helper.addClass(this._helper).css({ + width: this.element.outerWidth() - 1, + height: this.element.outerHeight() - 1, + position: "absolute", + left: this.elementOffset.left +"px", + top: this.elementOffset.top +"px", + zIndex: ++o.zIndex //TODO: Don't modify option + }); + + this.helper + .appendTo("body") + .disableSelection(); + + } else { + this.helper = this.element; + } + + }, + + _change: { + e: function(event, dx) { + return { width: this.originalSize.width + dx }; + }, + w: function(event, dx) { + var cs = this.originalSize, sp = this.originalPosition; + return { left: sp.left + dx, width: cs.width - dx }; + }, + n: function(event, dx, dy) { + var cs = this.originalSize, sp = this.originalPosition; + return { top: sp.top + dy, height: cs.height - dy }; + }, + s: function(event, dx, dy) { + return { height: this.originalSize.height + dy }; + }, + se: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + sw: function(event, dx, dy) { + return $.extend(this._change.s.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + }, + ne: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.e.apply(this, [event, dx, dy])); + }, + nw: function(event, dx, dy) { + return $.extend(this._change.n.apply(this, arguments), this._change.w.apply(this, [event, dx, dy])); + } + }, + + _propagate: function(n, event) { + $.ui.plugin.call(this, n, [event, this.ui()]); + (n !== "resize" && this._trigger(n, event, this.ui())); + }, + + plugins: {}, + + ui: function() { + return { + originalElement: this.originalElement, + element: this.element, + helper: this.helper, + position: this.position, + size: this.size, + originalSize: this.originalSize, + originalPosition: this.originalPosition + }; + } + +}); + +/* + * Resizable Extensions + */ + +$.ui.plugin.add("resizable", "animate", { + + stop: function( event ) { + var that = $(this).data("ui-resizable"), + o = that.options, + pr = that._proportionallyResizeElements, + ista = pr.length && (/textarea/i).test(pr[0].nodeName), + soffseth = ista && $.ui.hasScroll(pr[0], "left") /* TODO - jump height */ ? 0 : that.sizeDiff.height, + soffsetw = ista ? 0 : that.sizeDiff.width, + style = { width: (that.size.width - soffsetw), height: (that.size.height - soffseth) }, + left = (parseInt(that.element.css("left"), 10) + (that.position.left - that.originalPosition.left)) || null, + top = (parseInt(that.element.css("top"), 10) + (that.position.top - that.originalPosition.top)) || null; + + that.element.animate( + $.extend(style, top && left ? { top: top, left: left } : {}), { + duration: o.animateDuration, + easing: o.animateEasing, + step: function() { + + var data = { + width: parseInt(that.element.css("width"), 10), + height: parseInt(that.element.css("height"), 10), + top: parseInt(that.element.css("top"), 10), + left: parseInt(that.element.css("left"), 10) + }; + + if (pr && pr.length) { + $(pr[0]).css({ width: data.width, height: data.height }); + } + + // propagating resize, and updating values for each animation step + that._updateCache(data); + that._propagate("resize", event); + + } + } + ); + } + +}); + +$.ui.plugin.add("resizable", "containment", { + + start: function() { + var element, p, co, ch, cw, width, height, + that = $(this).data("ui-resizable"), + o = that.options, + el = that.element, + oc = o.containment, + ce = (oc instanceof $) ? oc.get(0) : (/parent/.test(oc)) ? el.parent().get(0) : oc; + + if (!ce) { + return; + } + + that.containerElement = $(ce); + + if (/document/.test(oc) || oc === document) { + that.containerOffset = { left: 0, top: 0 }; + that.containerPosition = { left: 0, top: 0 }; + + that.parentData = { + element: $(document), left: 0, top: 0, + width: $(document).width(), height: $(document).height() || document.body.parentNode.scrollHeight + }; + } + + // i'm a node, so compute top, left, right, bottom + else { + element = $(ce); + p = []; + $([ "Top", "Right", "Left", "Bottom" ]).each(function(i, name) { p[i] = num(element.css("padding" + name)); }); + + that.containerOffset = element.offset(); + that.containerPosition = element.position(); + that.containerSize = { height: (element.innerHeight() - p[3]), width: (element.innerWidth() - p[1]) }; + + co = that.containerOffset; + ch = that.containerSize.height; + cw = that.containerSize.width; + width = ($.ui.hasScroll(ce, "left") ? ce.scrollWidth : cw ); + height = ($.ui.hasScroll(ce) ? ce.scrollHeight : ch); + + that.parentData = { + element: ce, left: co.left, top: co.top, width: width, height: height + }; + } + }, + + resize: function( event ) { + var woset, hoset, isParent, isOffsetRelative, + that = $(this).data("ui-resizable"), + o = that.options, + co = that.containerOffset, cp = that.position, + pRatio = that._aspectRatio || event.shiftKey, + cop = { top:0, left:0 }, ce = that.containerElement; + + if (ce[0] !== document && (/static/).test(ce.css("position"))) { + cop = co; + } + + if (cp.left < (that._helper ? co.left : 0)) { + that.size.width = that.size.width + (that._helper ? (that.position.left - co.left) : (that.position.left - cop.left)); + if (pRatio) { + that.size.height = that.size.width / that.aspectRatio; + } + that.position.left = o.helper ? co.left : 0; + } + + if (cp.top < (that._helper ? co.top : 0)) { + that.size.height = that.size.height + (that._helper ? (that.position.top - co.top) : that.position.top); + if (pRatio) { + that.size.width = that.size.height * that.aspectRatio; + } + that.position.top = that._helper ? co.top : 0; + } + + that.offset.left = that.parentData.left+that.position.left; + that.offset.top = that.parentData.top+that.position.top; + + woset = Math.abs( (that._helper ? that.offset.left - cop.left : (that.offset.left - cop.left)) + that.sizeDiff.width ); + hoset = Math.abs( (that._helper ? that.offset.top - cop.top : (that.offset.top - co.top)) + that.sizeDiff.height ); + + isParent = that.containerElement.get(0) === that.element.parent().get(0); + isOffsetRelative = /relative|absolute/.test(that.containerElement.css("position")); + + if(isParent && isOffsetRelative) { + woset -= that.parentData.left; + } + + if (woset + that.size.width >= that.parentData.width) { + that.size.width = that.parentData.width - woset; + if (pRatio) { + that.size.height = that.size.width / that.aspectRatio; + } + } + + if (hoset + that.size.height >= that.parentData.height) { + that.size.height = that.parentData.height - hoset; + if (pRatio) { + that.size.width = that.size.height * that.aspectRatio; + } + } + }, + + stop: function(){ + var that = $(this).data("ui-resizable"), + o = that.options, + co = that.containerOffset, + cop = that.containerPosition, + ce = that.containerElement, + helper = $(that.helper), + ho = helper.offset(), + w = helper.outerWidth() - that.sizeDiff.width, + h = helper.outerHeight() - that.sizeDiff.height; + + if (that._helper && !o.animate && (/relative/).test(ce.css("position"))) { + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + } + + if (that._helper && !o.animate && (/static/).test(ce.css("position"))) { + $(this).css({ left: ho.left - cop.left - co.left, width: w, height: h }); + } + + } +}); + +$.ui.plugin.add("resizable", "alsoResize", { + + start: function () { + var that = $(this).data("ui-resizable"), + o = that.options, + _store = function (exp) { + $(exp).each(function() { + var el = $(this); + el.data("ui-resizable-alsoresize", { + width: parseInt(el.width(), 10), height: parseInt(el.height(), 10), + left: parseInt(el.css("left"), 10), top: parseInt(el.css("top"), 10) + }); + }); + }; + + if (typeof(o.alsoResize) === "object" && !o.alsoResize.parentNode) { + if (o.alsoResize.length) { o.alsoResize = o.alsoResize[0]; _store(o.alsoResize); } + else { $.each(o.alsoResize, function (exp) { _store(exp); }); } + }else{ + _store(o.alsoResize); + } + }, + + resize: function (event, ui) { + var that = $(this).data("ui-resizable"), + o = that.options, + os = that.originalSize, + op = that.originalPosition, + delta = { + height: (that.size.height - os.height) || 0, width: (that.size.width - os.width) || 0, + top: (that.position.top - op.top) || 0, left: (that.position.left - op.left) || 0 + }, + + _alsoResize = function (exp, c) { + $(exp).each(function() { + var el = $(this), start = $(this).data("ui-resizable-alsoresize"), style = {}, + css = c && c.length ? c : el.parents(ui.originalElement[0]).length ? ["width", "height"] : ["width", "height", "top", "left"]; + + $.each(css, function (i, prop) { + var sum = (start[prop]||0) + (delta[prop]||0); + if (sum && sum >= 0) { + style[prop] = sum || null; + } + }); + + el.css(style); + }); + }; + + if (typeof(o.alsoResize) === "object" && !o.alsoResize.nodeType) { + $.each(o.alsoResize, function (exp, c) { _alsoResize(exp, c); }); + }else{ + _alsoResize(o.alsoResize); + } + }, + + stop: function () { + $(this).removeData("resizable-alsoresize"); + } +}); + +$.ui.plugin.add("resizable", "ghost", { + + start: function() { + + var that = $(this).data("ui-resizable"), o = that.options, cs = that.size; + + that.ghost = that.originalElement.clone(); + that.ghost + .css({ opacity: 0.25, display: "block", position: "relative", height: cs.height, width: cs.width, margin: 0, left: 0, top: 0 }) + .addClass("ui-resizable-ghost") + .addClass(typeof o.ghost === "string" ? o.ghost : ""); + + that.ghost.appendTo(that.helper); + + }, + + resize: function(){ + var that = $(this).data("ui-resizable"); + if (that.ghost) { + that.ghost.css({ position: "relative", height: that.size.height, width: that.size.width }); + } + }, + + stop: function() { + var that = $(this).data("ui-resizable"); + if (that.ghost && that.helper) { + that.helper.get(0).removeChild(that.ghost.get(0)); + } + } + +}); + +$.ui.plugin.add("resizable", "grid", { + + resize: function() { + var that = $(this).data("ui-resizable"), + o = that.options, + cs = that.size, + os = that.originalSize, + op = that.originalPosition, + a = that.axis, + grid = typeof o.grid === "number" ? [o.grid, o.grid] : o.grid, + gridX = (grid[0]||1), + gridY = (grid[1]||1), + ox = Math.round((cs.width - os.width) / gridX) * gridX, + oy = Math.round((cs.height - os.height) / gridY) * gridY, + newWidth = os.width + ox, + newHeight = os.height + oy, + isMaxWidth = o.maxWidth && (o.maxWidth < newWidth), + isMaxHeight = o.maxHeight && (o.maxHeight < newHeight), + isMinWidth = o.minWidth && (o.minWidth > newWidth), + isMinHeight = o.minHeight && (o.minHeight > newHeight); + + o.grid = grid; + + if (isMinWidth) { + newWidth = newWidth + gridX; + } + if (isMinHeight) { + newHeight = newHeight + gridY; + } + if (isMaxWidth) { + newWidth = newWidth - gridX; + } + if (isMaxHeight) { + newHeight = newHeight - gridY; + } + + if (/^(se|s|e)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + } else if (/^(ne)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + } else if (/^(sw)$/.test(a)) { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.left = op.left - ox; + } else { + that.size.width = newWidth; + that.size.height = newHeight; + that.position.top = op.top - oy; + that.position.left = op.left - ox; + } + } + +}); + +})(jQuery); +(function( $, undefined ) { + +$.widget("ui.selectable", $.ui.mouse, { + version: "1.10.0", + options: { + appendTo: "body", + autoRefresh: true, + distance: 0, + filter: "*", + tolerance: "touch", + + // callbacks + selected: null, + selecting: null, + start: null, + stop: null, + unselected: null, + unselecting: null + }, + _create: function() { + var selectees, + that = this; + + this.element.addClass("ui-selectable"); + + this.dragged = false; + + // cache selectee children based on filter + this.refresh = function() { + selectees = $(that.options.filter, that.element[0]); + selectees.addClass("ui-selectee"); + selectees.each(function() { + var $this = $(this), + pos = $this.offset(); + $.data(this, "selectable-item", { + element: this, + $element: $this, + left: pos.left, + top: pos.top, + right: pos.left + $this.outerWidth(), + bottom: pos.top + $this.outerHeight(), + startselected: false, + selected: $this.hasClass("ui-selected"), + selecting: $this.hasClass("ui-selecting"), + unselecting: $this.hasClass("ui-unselecting") + }); + }); + }; + this.refresh(); + + this.selectees = selectees.addClass("ui-selectee"); + + this._mouseInit(); + + this.helper = $("<div class='ui-selectable-helper'></div>"); + }, + + _destroy: function() { + this.selectees + .removeClass("ui-selectee") + .removeData("selectable-item"); + this.element + .removeClass("ui-selectable ui-selectable-disabled"); + this._mouseDestroy(); + }, + + _mouseStart: function(event) { + var that = this, + options = this.options; + + this.opos = [event.pageX, event.pageY]; + + if (this.options.disabled) { + return; + } + + this.selectees = $(options.filter, this.element[0]); + + this._trigger("start", event); + + $(options.appendTo).append(this.helper); + // position helper (lasso) + this.helper.css({ + "left": event.pageX, + "top": event.pageY, + "width": 0, + "height": 0 + }); + + if (options.autoRefresh) { + this.refresh(); + } + + this.selectees.filter(".ui-selected").each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.startselected = true; + if (!event.metaKey && !event.ctrlKey) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + }); + + $(event.target).parents().addBack().each(function() { + var doSelect, + selectee = $.data(this, "selectable-item"); + if (selectee) { + doSelect = (!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass("ui-selected"); + selectee.$element + .removeClass(doSelect ? "ui-unselecting" : "ui-selected") + .addClass(doSelect ? "ui-selecting" : "ui-unselecting"); + selectee.unselecting = !doSelect; + selectee.selecting = doSelect; + selectee.selected = doSelect; + // selectable (UN)SELECTING callback + if (doSelect) { + that._trigger("selecting", event, { + selecting: selectee.element + }); + } else { + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + return false; + } + }); + + }, + + _mouseDrag: function(event) { + + this.dragged = true; + + if (this.options.disabled) { + return; + } + + var tmp, + that = this, + options = this.options, + x1 = this.opos[0], + y1 = this.opos[1], + x2 = event.pageX, + y2 = event.pageY; + + if (x1 > x2) { tmp = x2; x2 = x1; x1 = tmp; } + if (y1 > y2) { tmp = y2; y2 = y1; y1 = tmp; } + this.helper.css({left: x1, top: y1, width: x2-x1, height: y2-y1}); + + this.selectees.each(function() { + var selectee = $.data(this, "selectable-item"), + hit = false; + + //prevent helper from being selected if appendTo: selectable + if (!selectee || selectee.element === that.element[0]) { + return; + } + + if (options.tolerance === "touch") { + hit = ( !(selectee.left > x2 || selectee.right < x1 || selectee.top > y2 || selectee.bottom < y1) ); + } else if (options.tolerance === "fit") { + hit = (selectee.left > x1 && selectee.right < x2 && selectee.top > y1 && selectee.bottom < y2); + } + + if (hit) { + // SELECT + if (selectee.selected) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + } + if (selectee.unselecting) { + selectee.$element.removeClass("ui-unselecting"); + selectee.unselecting = false; + } + if (!selectee.selecting) { + selectee.$element.addClass("ui-selecting"); + selectee.selecting = true; + // selectable SELECTING callback + that._trigger("selecting", event, { + selecting: selectee.element + }); + } + } else { + // UNSELECT + if (selectee.selecting) { + if ((event.metaKey || event.ctrlKey) && selectee.startselected) { + selectee.$element.removeClass("ui-selecting"); + selectee.selecting = false; + selectee.$element.addClass("ui-selected"); + selectee.selected = true; + } else { + selectee.$element.removeClass("ui-selecting"); + selectee.selecting = false; + if (selectee.startselected) { + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + } + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + if (selectee.selected) { + if (!event.metaKey && !event.ctrlKey && !selectee.startselected) { + selectee.$element.removeClass("ui-selected"); + selectee.selected = false; + + selectee.$element.addClass("ui-unselecting"); + selectee.unselecting = true; + // selectable UNSELECTING callback + that._trigger("unselecting", event, { + unselecting: selectee.element + }); + } + } + } + }); + + return false; + }, + + _mouseStop: function(event) { + var that = this; + + this.dragged = false; + + $(".ui-unselecting", this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass("ui-unselecting"); + selectee.unselecting = false; + selectee.startselected = false; + that._trigger("unselected", event, { + unselected: selectee.element + }); + }); + $(".ui-selecting", this.element[0]).each(function() { + var selectee = $.data(this, "selectable-item"); + selectee.$element.removeClass("ui-selecting").addClass("ui-selected"); + selectee.selecting = false; + selectee.selected = true; + selectee.startselected = true; + that._trigger("selected", event, { + selected: selectee.element + }); + }); + this._trigger("stop", event); + + this.helper.remove(); + + return false; + } + +}); + +})(jQuery); +(function( $, undefined ) { + +/*jshint loopfunc: true */ + +function isOverAxis( x, reference, size ) { + return ( x > reference ) && ( x < ( reference + size ) ); +} + +$.widget("ui.sortable", $.ui.mouse, { + version: "1.10.0", + widgetEventPrefix: "sort", + ready: false, + options: { + appendTo: "parent", + axis: false, + connectWith: false, + containment: false, + cursor: "auto", + cursorAt: false, + dropOnEmpty: true, + forcePlaceholderSize: false, + forceHelperSize: false, + grid: false, + handle: false, + helper: "original", + items: "> *", + opacity: false, + placeholder: false, + revert: false, + scroll: true, + scrollSensitivity: 20, + scrollSpeed: 20, + scope: "default", + tolerance: "intersect", + zIndex: 1000, + + // callbacks + activate: null, + beforeStop: null, + change: null, + deactivate: null, + out: null, + over: null, + receive: null, + remove: null, + sort: null, + start: null, + stop: null, + update: null + }, + _create: function() { + + var o = this.options; + this.containerCache = {}; + this.element.addClass("ui-sortable"); + + //Get the items + this.refresh(); + + //Let's determine if the items are being displayed horizontally + this.floating = this.items.length ? o.axis === "x" || (/left|right/).test(this.items[0].item.css("float")) || (/inline|table-cell/).test(this.items[0].item.css("display")) : false; + + //Let's determine the parent's offset + this.offset = this.element.offset(); + + //Initialize mouse events for interaction + this._mouseInit(); + + //We're ready to go + this.ready = true; + + }, + + _destroy: function() { + this.element + .removeClass("ui-sortable ui-sortable-disabled"); + this._mouseDestroy(); + + for ( var i = this.items.length - 1; i >= 0; i-- ) { + this.items[i].item.removeData(this.widgetName + "-item"); + } + + return this; + }, + + _setOption: function(key, value){ + if ( key === "disabled" ) { + this.options[ key ] = value; + + this.widget().toggleClass( "ui-sortable-disabled", !!value ); + } else { + // Don't call widget base _setOption for disable as it adds ui-state-disabled class + $.Widget.prototype._setOption.apply(this, arguments); + } + }, + + _mouseCapture: function(event, overrideHandle) { + var currentItem = null, + validHandle = false, + that = this; + + if (this.reverting) { + return false; + } + + if(this.options.disabled || this.options.type === "static") { + return false; + } + + //We have to refresh the items data once first + this._refreshItems(event); + + //Find out if the clicked node (or one of its parents) is a actual item in this.items + $(event.target).parents().each(function() { + if($.data(this, that.widgetName + "-item") === that) { + currentItem = $(this); + return false; + } + }); + if($.data(event.target, that.widgetName + "-item") === that) { + currentItem = $(event.target); + } + + if(!currentItem) { + return false; + } + if(this.options.handle && !overrideHandle) { + $(this.options.handle, currentItem).find("*").addBack().each(function() { + if(this === event.target) { + validHandle = true; + } + }); + if(!validHandle) { + return false; + } + } + + this.currentItem = currentItem; + this._removeCurrentsFromItems(); + return true; + + }, + + _mouseStart: function(event, overrideHandle, noActivation) { + + var i, + o = this.options; + + this.currentContainer = this; + + //We only need to call refreshPositions, because the refreshItems call has been moved to mouseCapture + this.refreshPositions(); + + //Create and append the visible helper + this.helper = this._createHelper(event); + + //Cache the helper size + this._cacheHelperProportions(); + + /* + * - Position generation - + * This block generates everything position related - it's the core of draggables. + */ + + //Cache the margins of the original element + this._cacheMargins(); + + //Get the next scrolling parent + this.scrollParent = this.helper.scrollParent(); + + //The element's absolute position on the page minus margins + this.offset = this.currentItem.offset(); + this.offset = { + top: this.offset.top - this.margins.top, + left: this.offset.left - this.margins.left + }; + + $.extend(this.offset, { + click: { //Where the click happened, relative to the element + left: event.pageX - this.offset.left, + top: event.pageY - this.offset.top + }, + parent: this._getParentOffset(), + relative: this._getRelativeOffset() //This is a relative to absolute position minus the actual position calculation - only used for relative positioned helper + }); + + // Only after we got the offset, we can change the helper's position to absolute + // TODO: Still need to figure out a way to make relative sorting possible + this.helper.css("position", "absolute"); + this.cssPosition = this.helper.css("position"); + + //Generate the original position + this.originalPosition = this._generatePosition(event); + this.originalPageX = event.pageX; + this.originalPageY = event.pageY; + + //Adjust the mouse offset relative to the helper if "cursorAt" is supplied + (o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)); + + //Cache the former DOM position + this.domPosition = { prev: this.currentItem.prev()[0], parent: this.currentItem.parent()[0] }; + + //If the helper is not the original, hide the original so it's not playing any role during the drag, won't cause anything bad this way + if(this.helper[0] !== this.currentItem[0]) { + this.currentItem.hide(); + } + + //Create the placeholder + this._createPlaceholder(); + + //Set a containment if given in the options + if(o.containment) { + this._setContainment(); + } + + if(o.cursor) { // cursor option + if ($("body").css("cursor")) { + this._storedCursor = $("body").css("cursor"); + } + $("body").css("cursor", o.cursor); + } + + if(o.opacity) { // opacity option + if (this.helper.css("opacity")) { + this._storedOpacity = this.helper.css("opacity"); + } + this.helper.css("opacity", o.opacity); + } + + if(o.zIndex) { // zIndex option + if (this.helper.css("zIndex")) { + this._storedZIndex = this.helper.css("zIndex"); + } + this.helper.css("zIndex", o.zIndex); + } + + //Prepare scrolling + if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") { + this.overflowOffset = this.scrollParent.offset(); + } + + //Call callbacks + this._trigger("start", event, this._uiHash()); + + //Recache the helper size + if(!this._preserveHelperProportions) { + this._cacheHelperProportions(); + } + + + //Post "activate" events to possible containers + if( !noActivation ) { + for ( i = this.containers.length - 1; i >= 0; i-- ) { + this.containers[ i ]._trigger( "activate", event, this._uiHash( this ) ); + } + } + + //Prepare possible droppables + if($.ui.ddmanager) { + $.ui.ddmanager.current = this; + } + + if ($.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + + this.dragging = true; + + this.helper.addClass("ui-sortable-helper"); + this._mouseDrag(event); //Execute the drag once - this causes the helper not to be visible before getting its correct position + return true; + + }, + + _mouseDrag: function(event) { + var i, item, itemElement, intersection, + o = this.options, + scrolled = false; + + //Compute the helpers position + this.position = this._generatePosition(event); + this.positionAbs = this._convertPositionTo("absolute"); + + if (!this.lastPositionAbs) { + this.lastPositionAbs = this.positionAbs; + } + + //Do scrolling + if(this.options.scroll) { + if(this.scrollParent[0] !== document && this.scrollParent[0].tagName !== "HTML") { + + if((this.overflowOffset.top + this.scrollParent[0].offsetHeight) - event.pageY < o.scrollSensitivity) { + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop + o.scrollSpeed; + } else if(event.pageY - this.overflowOffset.top < o.scrollSensitivity) { + this.scrollParent[0].scrollTop = scrolled = this.scrollParent[0].scrollTop - o.scrollSpeed; + } + + if((this.overflowOffset.left + this.scrollParent[0].offsetWidth) - event.pageX < o.scrollSensitivity) { + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft + o.scrollSpeed; + } else if(event.pageX - this.overflowOffset.left < o.scrollSensitivity) { + this.scrollParent[0].scrollLeft = scrolled = this.scrollParent[0].scrollLeft - o.scrollSpeed; + } + + } else { + + if(event.pageY - $(document).scrollTop() < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed); + } else if($(window).height() - (event.pageY - $(document).scrollTop()) < o.scrollSensitivity) { + scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed); + } + + if(event.pageX - $(document).scrollLeft() < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed); + } else if($(window).width() - (event.pageX - $(document).scrollLeft()) < o.scrollSensitivity) { + scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed); + } + + } + + if(scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) { + $.ui.ddmanager.prepareOffsets(this, event); + } + } + + //Regenerate the absolute position used for position checks + this.positionAbs = this._convertPositionTo("absolute"); + + //Set the helper position + if(!this.options.axis || this.options.axis !== "y") { + this.helper[0].style.left = this.position.left+"px"; + } + if(!this.options.axis || this.options.axis !== "x") { + this.helper[0].style.top = this.position.top+"px"; + } + + //Rearrange + for (i = this.items.length - 1; i >= 0; i--) { + + //Cache variables and intersection, continue if no intersection + item = this.items[i]; + itemElement = item.item[0]; + intersection = this._intersectsWithPointer(item); + if (!intersection) { + continue; + } + + // Only put the placeholder inside the current Container, skip all + // items form other containers. This works because when moving + // an item from one container to another the + // currentContainer is switched before the placeholder is moved. + // + // Without this moving items in "sub-sortables" can cause the placeholder to jitter + // beetween the outer and inner container. + if (item.instance !== this.currentContainer) { + continue; + } + + // cannot intersect with itself + // no useless actions that have been done before + // no action if the item moved is the parent of the item checked + if (itemElement !== this.currentItem[0] && + this.placeholder[intersection === 1 ? "next" : "prev"]()[0] !== itemElement && + !$.contains(this.placeholder[0], itemElement) && + (this.options.type === "semi-dynamic" ? !$.contains(this.element[0], itemElement) : true) + ) { + + this.direction = intersection === 1 ? "down" : "up"; + + if (this.options.tolerance === "pointer" || this._intersectsWithSides(item)) { + this._rearrange(event, item); + } else { + break; + } + + this._trigger("change", event, this._uiHash()); + break; + } + } + + //Post events to containers + this._contactContainers(event); + + //Interconnect with droppables + if($.ui.ddmanager) { + $.ui.ddmanager.drag(this, event); + } + + //Call callbacks + this._trigger("sort", event, this._uiHash()); + + this.lastPositionAbs = this.positionAbs; + return false; + + }, + + _mouseStop: function(event, noPropagation) { + + if(!event) { + return; + } + + //If we are using droppables, inform the manager about the drop + if ($.ui.ddmanager && !this.options.dropBehaviour) { + $.ui.ddmanager.drop(this, event); + } + + if(this.options.revert) { + var that = this, + cur = this.placeholder.offset(); + + this.reverting = true; + + $(this.helper).animate({ + left: cur.left - this.offset.parent.left - this.margins.left + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollLeft), + top: cur.top - this.offset.parent.top - this.margins.top + (this.offsetParent[0] === document.body ? 0 : this.offsetParent[0].scrollTop) + }, parseInt(this.options.revert, 10) || 500, function() { + that._clear(event); + }); + } else { + this._clear(event, noPropagation); + } + + return false; + + }, + + cancel: function() { + + if(this.dragging) { + + this._mouseUp({ target: null }); + + if(this.options.helper === "original") { + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + //Post deactivating events to containers + for (var i = this.containers.length - 1; i >= 0; i--){ + this.containers[i]._trigger("deactivate", null, this._uiHash(this)); + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", null, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + if (this.placeholder) { + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + if(this.placeholder[0].parentNode) { + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + } + if(this.options.helper !== "original" && this.helper && this.helper[0].parentNode) { + this.helper.remove(); + } + + $.extend(this, { + helper: null, + dragging: false, + reverting: false, + _noFinalSort: null + }); + + if(this.domPosition.prev) { + $(this.domPosition.prev).after(this.currentItem); + } else { + $(this.domPosition.parent).prepend(this.currentItem); + } + } + + return this; + + }, + + serialize: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected), + str = []; + o = o || {}; + + $(items).each(function() { + var res = ($(o.item || this).attr(o.attribute || "id") || "").match(o.expression || (/(.+)[\-=_](.+)/)); + if (res) { + str.push((o.key || res[1]+"[]")+"="+(o.key && o.expression ? res[1] : res[2])); + } + }); + + if(!str.length && o.key) { + str.push(o.key + "="); + } + + return str.join("&"); + + }, + + toArray: function(o) { + + var items = this._getItemsAsjQuery(o && o.connected), + ret = []; + + o = o || {}; + + items.each(function() { ret.push($(o.item || this).attr(o.attribute || "id") || ""); }); + return ret; + + }, + + /* Be careful with the following core functions */ + _intersectsWith: function(item) { + + var x1 = this.positionAbs.left, + x2 = x1 + this.helperProportions.width, + y1 = this.positionAbs.top, + y2 = y1 + this.helperProportions.height, + l = item.left, + r = l + item.width, + t = item.top, + b = t + item.height, + dyClick = this.offset.click.top, + dxClick = this.offset.click.left, + isOverElement = (y1 + dyClick) > t && (y1 + dyClick) < b && (x1 + dxClick) > l && (x1 + dxClick) < r; + + if ( this.options.tolerance === "pointer" || + this.options.forcePointerForContainers || + (this.options.tolerance !== "pointer" && this.helperProportions[this.floating ? "width" : "height"] > item[this.floating ? "width" : "height"]) + ) { + return isOverElement; + } else { + + return (l < x1 + (this.helperProportions.width / 2) && // Right Half + x2 - (this.helperProportions.width / 2) < r && // Left Half + t < y1 + (this.helperProportions.height / 2) && // Bottom Half + y2 - (this.helperProportions.height / 2) < b ); // Top Half + + } + }, + + _intersectsWithPointer: function(item) { + + var isOverElementHeight = (this.options.axis === "x") || isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height), + isOverElementWidth = (this.options.axis === "y") || isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width), + isOverElement = isOverElementHeight && isOverElementWidth, + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (!isOverElement) { + return false; + } + + return this.floating ? + ( ((horizontalDirection && horizontalDirection === "right") || verticalDirection === "down") ? 2 : 1 ) + : ( verticalDirection && (verticalDirection === "down" ? 2 : 1) ); + + }, + + _intersectsWithSides: function(item) { + + var isOverBottomHalf = isOverAxis(this.positionAbs.top + this.offset.click.top, item.top + (item.height/2), item.height), + isOverRightHalf = isOverAxis(this.positionAbs.left + this.offset.click.left, item.left + (item.width/2), item.width), + verticalDirection = this._getDragVerticalDirection(), + horizontalDirection = this._getDragHorizontalDirection(); + + if (this.floating && horizontalDirection) { + return ((horizontalDirection === "right" && isOverRightHalf) || (horizontalDirection === "left" && !isOverRightHalf)); + } else { + return verticalDirection && ((verticalDirection === "down" && isOverBottomHalf) || (verticalDirection === "up" && !isOverBottomHalf)); + } + + }, + + _getDragVerticalDirection: function() { + var delta = this.positionAbs.top - this.lastPositionAbs.top; + return delta !== 0 && (delta > 0 ? "down" : "up"); + }, + + _getDragHorizontalDirection: function() { + var delta = this.positionAbs.left - this.lastPositionAbs.left; + return delta !== 0 && (delta > 0 ? "right" : "left"); + }, + + refresh: function(event) { + this._refreshItems(event); + this.refreshPositions(); + return this; + }, + + _connectWith: function() { + var options = this.options; + return options.connectWith.constructor === String ? [options.connectWith] : options.connectWith; + }, + + _getItemsAsjQuery: function(connected) { + + var i, j, cur, inst, + items = [], + queries = [], + connectWith = this._connectWith(); + + if(connectWith && connected) { + for (i = connectWith.length - 1; i >= 0; i--){ + cur = $(connectWith[i]); + for ( j = cur.length - 1; j >= 0; j--){ + inst = $.data(cur[j], this.widgetFullName); + if(inst && inst !== this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element) : $(inst.options.items, inst.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), inst]); + } + } + } + } + + queries.push([$.isFunction(this.options.items) ? this.options.items.call(this.element, null, { options: this.options, item: this.currentItem }) : $(this.options.items, this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), this]); + + for (i = queries.length - 1; i >= 0; i--){ + queries[i][0].each(function() { + items.push(this); + }); + } + + return $(items); + + }, + + _removeCurrentsFromItems: function() { + + var list = this.currentItem.find(":data(" + this.widgetName + "-item)"); + + this.items = $.grep(this.items, function (item) { + for (var j=0; j < list.length; j++) { + if(list[j] === item.item[0]) { + return false; + } + } + return true; + }); + + }, + + _refreshItems: function(event) { + + this.items = []; + this.containers = [this]; + + var i, j, cur, inst, targetData, _queries, item, queriesLength, + items = this.items, + queries = [[$.isFunction(this.options.items) ? this.options.items.call(this.element[0], event, { item: this.currentItem }) : $(this.options.items, this.element), this]], + connectWith = this._connectWith(); + + if(connectWith && this.ready) { //Shouldn't be run the first time through due to massive slow-down + for (i = connectWith.length - 1; i >= 0; i--){ + cur = $(connectWith[i]); + for (j = cur.length - 1; j >= 0; j--){ + inst = $.data(cur[j], this.widgetFullName); + if(inst && inst !== this && !inst.options.disabled) { + queries.push([$.isFunction(inst.options.items) ? inst.options.items.call(inst.element[0], event, { item: this.currentItem }) : $(inst.options.items, inst.element), inst]); + this.containers.push(inst); + } + } + } + } + + for (i = queries.length - 1; i >= 0; i--) { + targetData = queries[i][1]; + _queries = queries[i][0]; + + for (j=0, queriesLength = _queries.length; j < queriesLength; j++) { + item = $(_queries[j]); + + item.data(this.widgetName + "-item", targetData); // Data for target checking (mouse manager) + + items.push({ + item: item, + instance: targetData, + width: 0, height: 0, + left: 0, top: 0 + }); + } + } + + }, + + refreshPositions: function(fast) { + + //This has to be redone because due to the item being moved out/into the offsetParent, the offsetParent's position will change + if(this.offsetParent && this.helper) { + this.offset.parent = this._getParentOffset(); + } + + var i, item, t, p; + + for (i = this.items.length - 1; i >= 0; i--){ + item = this.items[i]; + + //We ignore calculating positions of all connected containers when we're not over them + if(item.instance !== this.currentContainer && this.currentContainer && item.item[0] !== this.currentItem[0]) { + continue; + } + + t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item; + + if (!fast) { + item.width = t.outerWidth(); + item.height = t.outerHeight(); + } + + p = t.offset(); + item.left = p.left; + item.top = p.top; + } + + if(this.options.custom && this.options.custom.refreshContainers) { + this.options.custom.refreshContainers.call(this); + } else { + for (i = this.containers.length - 1; i >= 0; i--){ + p = this.containers[i].element.offset(); + this.containers[i].containerCache.left = p.left; + this.containers[i].containerCache.top = p.top; + this.containers[i].containerCache.width = this.containers[i].element.outerWidth(); + this.containers[i].containerCache.height = this.containers[i].element.outerHeight(); + } + } + + return this; + }, + + _createPlaceholder: function(that) { + that = that || this; + var className, + o = that.options; + + if(!o.placeholder || o.placeholder.constructor === String) { + className = o.placeholder; + o.placeholder = { + element: function() { + + var el = $(document.createElement(that.currentItem[0].nodeName)) + .addClass(className || that.currentItem[0].className+" ui-sortable-placeholder") + .removeClass("ui-sortable-helper")[0]; + + if(!className) { + el.style.visibility = "hidden"; + } + + return el; + }, + update: function(container, p) { + + // 1. If a className is set as 'placeholder option, we don't force sizes - the class is responsible for that + // 2. The option 'forcePlaceholderSize can be enabled to force it even if a class name is specified + if(className && !o.forcePlaceholderSize) { + return; + } + + //If the element doesn't have a actual height by itself (without styles coming from a stylesheet), it receives the inline height from the dragged item + if(!p.height()) { p.height(that.currentItem.innerHeight() - parseInt(that.currentItem.css("paddingTop")||0, 10) - parseInt(that.currentItem.css("paddingBottom")||0, 10)); } + if(!p.width()) { p.width(that.currentItem.innerWidth() - parseInt(that.currentItem.css("paddingLeft")||0, 10) - parseInt(that.currentItem.css("paddingRight")||0, 10)); } + } + }; + } + + //Create the placeholder + that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem)); + + //Append it after the actual current item + that.currentItem.after(that.placeholder); + + //Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317) + o.placeholder.update(that, that.placeholder); + + }, + + _contactContainers: function(event) { + var i, j, dist, itemWithLeastDistance, posProperty, sizeProperty, base, cur, nearBottom, + innermostContainer = null, + innermostIndex = null; + + // get innermost container that intersects with item + for (i = this.containers.length - 1; i >= 0; i--) { + + // never consider a container that's located within the item itself + if($.contains(this.currentItem[0], this.containers[i].element[0])) { + continue; + } + + if(this._intersectsWith(this.containers[i].containerCache)) { + + // if we've already found a container and it's more "inner" than this, then continue + if(innermostContainer && $.contains(this.containers[i].element[0], innermostContainer.element[0])) { + continue; + } + + innermostContainer = this.containers[i]; + innermostIndex = i; + + } else { + // container doesn't intersect. trigger "out" event if necessary + if(this.containers[i].containerCache.over) { + this.containers[i]._trigger("out", event, this._uiHash(this)); + this.containers[i].containerCache.over = 0; + } + } + + } + + // if no intersecting containers found, return + if(!innermostContainer) { + return; + } + + // move the item into the container if it's not there already + if(this.containers.length === 1) { + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } else { + + //When entering a new container, we will find the item with the least distance and append our item near it + dist = 10000; + itemWithLeastDistance = null; + posProperty = this.containers[innermostIndex].floating ? "left" : "top"; + sizeProperty = this.containers[innermostIndex].floating ? "width" : "height"; + base = this.positionAbs[posProperty] + this.offset.click[posProperty]; + for (j = this.items.length - 1; j >= 0; j--) { + if(!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) { + continue; + } + if(this.items[j].item[0] === this.currentItem[0]) { + continue; + } + cur = this.items[j].item.offset()[posProperty]; + nearBottom = false; + if(Math.abs(cur - base) > Math.abs(cur + this.items[j][sizeProperty] - base)){ + nearBottom = true; + cur += this.items[j][sizeProperty]; + } + + if(Math.abs(cur - base) < dist) { + dist = Math.abs(cur - base); itemWithLeastDistance = this.items[j]; + this.direction = nearBottom ? "up": "down"; + } + } + + //Check if dropOnEmpty is enabled + if(!itemWithLeastDistance && !this.options.dropOnEmpty) { + return; + } + + this.currentContainer = this.containers[innermostIndex]; + itemWithLeastDistance ? this._rearrange(event, itemWithLeastDistance, null, true) : this._rearrange(event, null, this.containers[innermostIndex].element, true); + this._trigger("change", event, this._uiHash()); + this.containers[innermostIndex]._trigger("change", event, this._uiHash(this)); + + //Update the placeholder + this.options.placeholder.update(this.currentContainer, this.placeholder); + + this.containers[innermostIndex]._trigger("over", event, this._uiHash(this)); + this.containers[innermostIndex].containerCache.over = 1; + } + + + }, + + _createHelper: function(event) { + + var o = this.options, + helper = $.isFunction(o.helper) ? $(o.helper.apply(this.element[0], [event, this.currentItem])) : (o.helper === "clone" ? this.currentItem.clone() : this.currentItem); + + //Add the helper to the DOM if that didn't happen already + if(!helper.parents("body").length) { + $(o.appendTo !== "parent" ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(helper[0]); + } + + if(helper[0] === this.currentItem[0]) { + this._storedCSS = { width: this.currentItem[0].style.width, height: this.currentItem[0].style.height, position: this.currentItem.css("position"), top: this.currentItem.css("top"), left: this.currentItem.css("left") }; + } + + if(!helper[0].style.width || o.forceHelperSize) { + helper.width(this.currentItem.width()); + } + if(!helper[0].style.height || o.forceHelperSize) { + helper.height(this.currentItem.height()); + } + + return helper; + + }, + + _adjustOffsetFromHelper: function(obj) { + if (typeof obj === "string") { + obj = obj.split(" "); + } + if ($.isArray(obj)) { + obj = {left: +obj[0], top: +obj[1] || 0}; + } + if ("left" in obj) { + this.offset.click.left = obj.left + this.margins.left; + } + if ("right" in obj) { + this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left; + } + if ("top" in obj) { + this.offset.click.top = obj.top + this.margins.top; + } + if ("bottom" in obj) { + this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top; + } + }, + + _getParentOffset: function() { + + + //Get the offsetParent and cache its position + this.offsetParent = this.helper.offsetParent(); + var po = this.offsetParent.offset(); + + // This is a special case where we need to modify a offset calculated on start, since the following happened: + // 1. The position of the helper is absolute, so it's position is calculated based on the next positioned parent + // 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't the document, which means that + // the scroll is included in the initial calculation of the offset of the parent, and never recalculated upon drag + if(this.cssPosition === "absolute" && this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) { + po.left += this.scrollParent.scrollLeft(); + po.top += this.scrollParent.scrollTop(); + } + + // This needs to be actually done for all browsers, since pageX/pageY includes this information + // with an ugly IE fix + if( this.offsetParent[0] === document.body || (this.offsetParent[0].tagName && this.offsetParent[0].tagName.toLowerCase() === "html" && $.ui.ie)) { + po = { top: 0, left: 0 }; + } + + return { + top: po.top + (parseInt(this.offsetParent.css("borderTopWidth"),10) || 0), + left: po.left + (parseInt(this.offsetParent.css("borderLeftWidth"),10) || 0) + }; + + }, + + _getRelativeOffset: function() { + + if(this.cssPosition === "relative") { + var p = this.currentItem.position(); + return { + top: p.top - (parseInt(this.helper.css("top"),10) || 0) + this.scrollParent.scrollTop(), + left: p.left - (parseInt(this.helper.css("left"),10) || 0) + this.scrollParent.scrollLeft() + }; + } else { + return { top: 0, left: 0 }; + } + + }, + + _cacheMargins: function() { + this.margins = { + left: (parseInt(this.currentItem.css("marginLeft"),10) || 0), + top: (parseInt(this.currentItem.css("marginTop"),10) || 0) + }; + }, + + _cacheHelperProportions: function() { + this.helperProportions = { + width: this.helper.outerWidth(), + height: this.helper.outerHeight() + }; + }, + + _setContainment: function() { + + var ce, co, over, + o = this.options; + if(o.containment === "parent") { + o.containment = this.helper[0].parentNode; + } + if(o.containment === "document" || o.containment === "window") { + this.containment = [ + 0 - this.offset.relative.left - this.offset.parent.left, + 0 - this.offset.relative.top - this.offset.parent.top, + $(o.containment === "document" ? document : window).width() - this.helperProportions.width - this.margins.left, + ($(o.containment === "document" ? document : window).height() || document.body.parentNode.scrollHeight) - this.helperProportions.height - this.margins.top + ]; + } + + if(!(/^(document|window|parent)$/).test(o.containment)) { + ce = $(o.containment)[0]; + co = $(o.containment).offset(); + over = ($(ce).css("overflow") !== "hidden"); + + this.containment = [ + co.left + (parseInt($(ce).css("borderLeftWidth"),10) || 0) + (parseInt($(ce).css("paddingLeft"),10) || 0) - this.margins.left, + co.top + (parseInt($(ce).css("borderTopWidth"),10) || 0) + (parseInt($(ce).css("paddingTop"),10) || 0) - this.margins.top, + co.left+(over ? Math.max(ce.scrollWidth,ce.offsetWidth) : ce.offsetWidth) - (parseInt($(ce).css("borderLeftWidth"),10) || 0) - (parseInt($(ce).css("paddingRight"),10) || 0) - this.helperProportions.width - this.margins.left, + co.top+(over ? Math.max(ce.scrollHeight,ce.offsetHeight) : ce.offsetHeight) - (parseInt($(ce).css("borderTopWidth"),10) || 0) - (parseInt($(ce).css("paddingBottom"),10) || 0) - this.helperProportions.height - this.margins.top + ]; + } + + }, + + _convertPositionTo: function(d, pos) { + + if(!pos) { + pos = this.position; + } + var mod = d === "absolute" ? 1 : -1, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, + scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + return { + top: ( + pos.top + // The absolute mouse position + this.offset.relative.top * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) ) * mod) + ), + left: ( + pos.left + // The absolute mouse position + this.offset.relative.left * mod + // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left * mod - // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() ) * mod) + ) + }; + + }, + + _generatePosition: function(event) { + + var top, left, + o = this.options, + pageX = event.pageX, + pageY = event.pageY, + scroll = this.cssPosition === "absolute" && !(this.scrollParent[0] !== document && $.contains(this.scrollParent[0], this.offsetParent[0])) ? this.offsetParent : this.scrollParent, scrollIsRootNode = (/(html|body)/i).test(scroll[0].tagName); + + // This is another very weird special case that only happens for relative elements: + // 1. If the css position is relative + // 2. and the scroll parent is the document or similar to the offset parent + // we have to refresh the relative offset during the scroll so there are no jumps + if(this.cssPosition === "relative" && !(this.scrollParent[0] !== document && this.scrollParent[0] !== this.offsetParent[0])) { + this.offset.relative = this._getRelativeOffset(); + } + + /* + * - Position constraining - + * Constrain the position to a mix of grid, containment. + */ + + if(this.originalPosition) { //If we are not dragging yet, we won't check for options + + if(this.containment) { + if(event.pageX - this.offset.click.left < this.containment[0]) { + pageX = this.containment[0] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top < this.containment[1]) { + pageY = this.containment[1] + this.offset.click.top; + } + if(event.pageX - this.offset.click.left > this.containment[2]) { + pageX = this.containment[2] + this.offset.click.left; + } + if(event.pageY - this.offset.click.top > this.containment[3]) { + pageY = this.containment[3] + this.offset.click.top; + } + } + + if(o.grid) { + top = this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]; + pageY = this.containment ? ( (top - this.offset.click.top >= this.containment[1] && top - this.offset.click.top <= this.containment[3]) ? top : ((top - this.offset.click.top >= this.containment[1]) ? top - o.grid[1] : top + o.grid[1])) : top; + + left = this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]; + pageX = this.containment ? ( (left - this.offset.click.left >= this.containment[0] && left - this.offset.click.left <= this.containment[2]) ? left : ((left - this.offset.click.left >= this.containment[0]) ? left - o.grid[0] : left + o.grid[0])) : left; + } + + } + + return { + top: ( + pageY - // The absolute mouse position + this.offset.click.top - // Click offset (relative to the element) + this.offset.relative.top - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.top + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollTop() : ( scrollIsRootNode ? 0 : scroll.scrollTop() ) )) + ), + left: ( + pageX - // The absolute mouse position + this.offset.click.left - // Click offset (relative to the element) + this.offset.relative.left - // Only for relative positioned nodes: Relative offset from element to offset parent + this.offset.parent.left + // The offsetParent's offset without borders (offset + border) + ( ( this.cssPosition === "fixed" ? -this.scrollParent.scrollLeft() : scrollIsRootNode ? 0 : scroll.scrollLeft() )) + ) + }; + + }, + + _rearrange: function(event, i, a, hardRefresh) { + + a ? a[0].appendChild(this.placeholder[0]) : i.item[0].parentNode.insertBefore(this.placeholder[0], (this.direction === "down" ? i.item[0] : i.item[0].nextSibling)); + + //Various things done here to improve the performance: + // 1. we create a setTimeout, that calls refreshPositions + // 2. on the instance, we have a counter variable, that get's higher after every append + // 3. on the local scope, we copy the counter variable, and check in the timeout, if it's still the same + // 4. this lets only the last addition to the timeout stack through + this.counter = this.counter ? ++this.counter : 1; + var counter = this.counter; + + this._delay(function() { + if(counter === this.counter) { + this.refreshPositions(!hardRefresh); //Precompute after each DOM insertion, NOT on mousemove + } + }); + + }, + + _clear: function(event, noPropagation) { + + this.reverting = false; + // We delay all events that have to be triggered to after the point where the placeholder has been removed and + // everything else normalized again + var i, + delayedTriggers = []; + + // We first have to update the dom position of the actual currentItem + // Note: don't do it if the current item is already removed (by a user), or it gets reappended (see #4088) + if(!this._noFinalSort && this.currentItem.parent().length) { + this.placeholder.before(this.currentItem); + } + this._noFinalSort = null; + + if(this.helper[0] === this.currentItem[0]) { + for(i in this._storedCSS) { + if(this._storedCSS[i] === "auto" || this._storedCSS[i] === "static") { + this._storedCSS[i] = ""; + } + } + this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"); + } else { + this.currentItem.show(); + } + + if(this.fromOutside && !noPropagation) { + delayedTriggers.push(function(event) { this._trigger("receive", event, this._uiHash(this.fromOutside)); }); + } + if((this.fromOutside || this.domPosition.prev !== this.currentItem.prev().not(".ui-sortable-helper")[0] || this.domPosition.parent !== this.currentItem.parent()[0]) && !noPropagation) { + delayedTriggers.push(function(event) { this._trigger("update", event, this._uiHash()); }); //Trigger update callback if the DOM position has changed + } + + // Check if the items Container has Changed and trigger appropriate + // events. + if (this !== this.currentContainer) { + if(!noPropagation) { + delayedTriggers.push(function(event) { this._trigger("remove", event, this._uiHash()); }); + delayedTriggers.push((function(c) { return function(event) { c._trigger("receive", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + delayedTriggers.push((function(c) { return function(event) { c._trigger("update", event, this._uiHash(this)); }; }).call(this, this.currentContainer)); + } + } + + + //Post events to containers + for (i = this.containers.length - 1; i >= 0; i--){ + if(!noPropagation) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("deactivate", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + } + if(this.containers[i].containerCache.over) { + delayedTriggers.push((function(c) { return function(event) { c._trigger("out", event, this._uiHash(this)); }; }).call(this, this.containers[i])); + this.containers[i].containerCache.over = 0; + } + } + + //Do what was originally in plugins + if(this._storedCursor) { + $("body").css("cursor", this._storedCursor); + } + if(this._storedOpacity) { + this.helper.css("opacity", this._storedOpacity); + } + if(this._storedZIndex) { + this.helper.css("zIndex", this._storedZIndex === "auto" ? "" : this._storedZIndex); + } + + this.dragging = false; + if(this.cancelHelperRemoval) { + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + for (i=0; i < delayedTriggers.length; i++) { + delayedTriggers[i].call(this, event); + } //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return false; + } + + if(!noPropagation) { + this._trigger("beforeStop", event, this._uiHash()); + } + + //$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately, it unbinds ALL events from the original node! + this.placeholder[0].parentNode.removeChild(this.placeholder[0]); + + if(this.helper[0] !== this.currentItem[0]) { + this.helper.remove(); + } + this.helper = null; + + if(!noPropagation) { + for (i=0; i < delayedTriggers.length; i++) { + delayedTriggers[i].call(this, event); + } //Trigger all delayed events + this._trigger("stop", event, this._uiHash()); + } + + this.fromOutside = false; + return true; + + }, + + _trigger: function() { + if ($.Widget.prototype._trigger.apply(this, arguments) === false) { + this.cancel(); + } + }, + + _uiHash: function(_inst) { + var inst = _inst || this; + return { + helper: inst.helper, + placeholder: inst.placeholder || $([]), + position: inst.position, + originalPosition: inst.originalPosition, + offset: inst.positionAbs, + item: inst.currentItem, + sender: _inst ? _inst.element : null + }; + } + +}); + +})(jQuery); +(function( $, undefined ) { + +var uid = 0, + hideProps = {}, + showProps = {}; + +hideProps.height = hideProps.paddingTop = hideProps.paddingBottom = + hideProps.borderTopWidth = hideProps.borderBottomWidth = "hide"; +showProps.height = showProps.paddingTop = showProps.paddingBottom = + showProps.borderTopWidth = showProps.borderBottomWidth = "show"; + +$.widget( "ui.accordion", { + version: "1.10.0", + options: { + active: 0, + animate: {}, + collapsible: false, + event: "click", + header: "> li > :first-child,> :not(li):even", + heightStyle: "auto", + icons: { + activeHeader: "ui-icon-triangle-1-s", + header: "ui-icon-triangle-1-e" + }, + + // callbacks + activate: null, + beforeActivate: null + }, + + _create: function() { + var options = this.options; + this.prevShow = this.prevHide = $(); + this.element.addClass( "ui-accordion ui-widget ui-helper-reset" ) + // ARIA + .attr( "role", "tablist" ); + + // don't allow collapsible: false and active: false / null + if ( !options.collapsible && (options.active === false || options.active == null) ) { + options.active = 0; + } + + this._processPanels(); + // handle negative values + if ( options.active < 0 ) { + options.active += this.headers.length; + } + this._refresh(); + }, + + _getCreateEventData: function() { + return { + header: this.active, + content: !this.active.length ? $() : this.active.next() + }; + }, + + _createIcons: function() { + var icons = this.options.icons; + if ( icons ) { + $( "<span>" ) + .addClass( "ui-accordion-header-icon ui-icon " + icons.header ) + .prependTo( this.headers ); + this.active.children( ".ui-accordion-header-icon" ) + .removeClass( icons.header ) + .addClass( icons.activeHeader ); + this.headers.addClass( "ui-accordion-icons" ); + } + }, + + _destroyIcons: function() { + this.headers + .removeClass( "ui-accordion-icons" ) + .children( ".ui-accordion-header-icon" ) + .remove(); + }, + + _destroy: function() { + var contents; + + // clean up main element + this.element + .removeClass( "ui-accordion ui-widget ui-helper-reset" ) + .removeAttr( "role" ); + + // clean up headers + this.headers + .removeClass( "ui-accordion-header ui-accordion-header-active ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top" ) + .removeAttr( "role" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-controls" ) + .removeAttr( "tabIndex" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + this._destroyIcons(); + + // clean up content panels + contents = this.headers.next() + .css( "display", "" ) + .removeAttr( "role" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-labelledby" ) + .removeClass( "ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-state-disabled" ) + .each(function() { + if ( /^ui-accordion/.test( this.id ) ) { + this.removeAttribute( "id" ); + } + }); + if ( this.options.heightStyle !== "content" ) { + contents.css( "height", "" ); + } + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "event" ) { + if ( this.options.event ) { + this._off( this.headers, this.options.event ); + } + this._setupEvents( value ); + } + + this._super( key, value ); + + // setting collapsible: false while collapsed; open first panel + if ( key === "collapsible" && !value && this.options.active === false ) { + this._activate( 0 ); + } + + if ( key === "icons" ) { + this._destroyIcons(); + if ( value ) { + this._createIcons(); + } + } + + // #5332 - opacity doesn't cascade to positioned elements in IE + // so we need to add the disabled class to the headers and panels + if ( key === "disabled" ) { + this.headers.add( this.headers.next() ) + .toggleClass( "ui-state-disabled", !!value ); + } + }, + + _keydown: function( event ) { + /*jshint maxcomplexity:15*/ + if ( event.altKey || event.ctrlKey ) { + return; + } + + var keyCode = $.ui.keyCode, + length = this.headers.length, + currentIndex = this.headers.index( event.target ), + toFocus = false; + + switch ( event.keyCode ) { + case keyCode.RIGHT: + case keyCode.DOWN: + toFocus = this.headers[ ( currentIndex + 1 ) % length ]; + break; + case keyCode.LEFT: + case keyCode.UP: + toFocus = this.headers[ ( currentIndex - 1 + length ) % length ]; + break; + case keyCode.SPACE: + case keyCode.ENTER: + this._eventHandler( event ); + break; + case keyCode.HOME: + toFocus = this.headers[ 0 ]; + break; + case keyCode.END: + toFocus = this.headers[ length - 1 ]; + break; + } + + if ( toFocus ) { + $( event.target ).attr( "tabIndex", -1 ); + $( toFocus ).attr( "tabIndex", 0 ); + toFocus.focus(); + event.preventDefault(); + } + }, + + _panelKeyDown : function( event ) { + if ( event.keyCode === $.ui.keyCode.UP && event.ctrlKey ) { + $( event.currentTarget ).prev().focus(); + } + }, + + refresh: function() { + var options = this.options; + this._processPanels(); + + // was collapsed or no panel + if ( ( options.active === false && options.collapsible === true ) || !this.headers.length ) { + options.active = false; + this.active = $(); + // active false only when collapsible is true + } if ( options.active === false ) { + this._activate( 0 ); + // was active, but active panel is gone + } else if ( this.active.length && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + // all remaining panel are disabled + if ( this.headers.length === this.headers.find(".ui-state-disabled").length ) { + options.active = false; + this.active = $(); + // activate previous panel + } else { + this._activate( Math.max( 0, options.active - 1 ) ); + } + // was active, active panel still exists + } else { + // make sure active index is correct + options.active = this.headers.index( this.active ); + } + + this._destroyIcons(); + + this._refresh(); + }, + + _processPanels: function() { + this.headers = this.element.find( this.options.header ) + .addClass( "ui-accordion-header ui-helper-reset ui-state-default ui-corner-all" ); + + this.headers.next() + .addClass( "ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom" ) + .filter(":not(.ui-accordion-content-active)") + .hide(); + }, + + _refresh: function() { + var maxHeight, + options = this.options, + heightStyle = options.heightStyle, + parent = this.element.parent(), + accordionId = this.accordionId = "ui-accordion-" + + (this.element.attr( "id" ) || ++uid); + + this.active = this._findActive( options.active ) + .addClass( "ui-accordion-header-active ui-state-active" ) + .toggleClass( "ui-corner-all ui-corner-top" ); + this.active.next() + .addClass( "ui-accordion-content-active" ) + .show(); + + this.headers + .attr( "role", "tab" ) + .each(function( i ) { + var header = $( this ), + headerId = header.attr( "id" ), + panel = header.next(), + panelId = panel.attr( "id" ); + if ( !headerId ) { + headerId = accordionId + "-header-" + i; + header.attr( "id", headerId ); + } + if ( !panelId ) { + panelId = accordionId + "-panel-" + i; + panel.attr( "id", panelId ); + } + header.attr( "aria-controls", panelId ); + panel.attr( "aria-labelledby", headerId ); + }) + .next() + .attr( "role", "tabpanel" ); + + this.headers + .not( this.active ) + .attr({ + "aria-selected": "false", + tabIndex: -1 + }) + .next() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }) + .hide(); + + // make sure at least one header is in the tab order + if ( !this.active.length ) { + this.headers.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active.attr({ + "aria-selected": "true", + tabIndex: 0 + }) + .next() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + + this._createIcons(); + + this._setupEvents( options.event ); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.headers.each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.headers.next() + .each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.headers.next() + .each(function() { + maxHeight = Math.max( maxHeight, $( this ).css( "height", "" ).height() ); + }) + .height( maxHeight ); + } + }, + + _activate: function( index ) { + var active = this._findActive( index )[ 0 ]; + + // trying to activate the already active panel + if ( active === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the currently active header + active = active || this.active[ 0 ]; + + this._eventHandler({ + target: active, + currentTarget: active, + preventDefault: $.noop + }); + }, + + _findActive: function( selector ) { + return typeof selector === "number" ? this.headers.eq( selector ) : $(); + }, + + _setupEvents: function( event ) { + var events = { + keydown: "_keydown" + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.headers.add( this.headers.next() ) ); + this._on( this.headers, events ); + this._on( this.headers.next(), { keydown: "_panelKeyDown" }); + this._hoverable( this.headers ); + this._focusable( this.headers ); + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + clicked = $( event.currentTarget ), + clickedIsActive = clicked[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : clicked.next(), + toHide = active.next(), + eventData = { + oldHeader: active, + oldPanel: toHide, + newHeader: collapsing ? $() : clicked, + newPanel: toShow + }; + + event.preventDefault(); + + if ( + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.headers.index( clicked ); + + // when the call to ._toggle() comes after the class changes + // it causes a very odd bug in IE 8 (see #6720) + this.active = clickedIsActive ? $() : clicked; + this._toggle( eventData ); + + // switch classes + // corner classes on the previously active header stay after the animation + active.removeClass( "ui-accordion-header-active ui-state-active" ); + if ( options.icons ) { + active.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.activeHeader ) + .addClass( options.icons.header ); + } + + if ( !clickedIsActive ) { + clicked + .removeClass( "ui-corner-all" ) + .addClass( "ui-accordion-header-active ui-state-active ui-corner-top" ); + if ( options.icons ) { + clicked.children( ".ui-accordion-header-icon" ) + .removeClass( options.icons.header ) + .addClass( options.icons.activeHeader ); + } + + clicked + .next() + .addClass( "ui-accordion-content-active" ); + } + }, + + _toggle: function( data ) { + var toShow = data.newPanel, + toHide = this.prevShow.length ? this.prevShow : data.oldPanel; + + // handle activating a panel during the animation for another activation + this.prevShow.add( this.prevHide ).stop( true, true ); + this.prevShow = toShow; + this.prevHide = toHide; + + if ( this.options.animate ) { + this._animate( toShow, toHide, data ); + } else { + toHide.hide(); + toShow.show(); + this._toggleComplete( data ); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + toHide.prev().attr( "aria-selected", "false" ); + // if we're switching panels, remove the old header from the tab order + // if we're opening from collapsed state, remove the previous header from the tab order + // if we're collapsing, then keep the collapsing header in the tab order + if ( toShow.length && toHide.length ) { + toHide.prev().attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.headers.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }) + .prev() + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _animate: function( toShow, toHide, data ) { + var total, easing, duration, + that = this, + adjust = 0, + down = toShow.length && + ( !toHide.length || ( toShow.index() < toHide.index() ) ), + animate = this.options.animate || {}, + options = down && animate.down || animate, + complete = function() { + that._toggleComplete( data ); + }; + + if ( typeof options === "number" ) { + duration = options; + } + if ( typeof options === "string" ) { + easing = options; + } + // fall back from options to animation in case of partial down settings + easing = easing || options.easing || animate.easing; + duration = duration || options.duration || animate.duration; + + if ( !toHide.length ) { + return toShow.animate( showProps, duration, easing, complete ); + } + if ( !toShow.length ) { + return toHide.animate( hideProps, duration, easing, complete ); + } + + total = toShow.show().outerHeight(); + toHide.animate( hideProps, { + duration: duration, + easing: easing, + step: function( now, fx ) { + fx.now = Math.round( now ); + } + }); + toShow + .hide() + .animate( showProps, { + duration: duration, + easing: easing, + complete: complete, + step: function( now, fx ) { + fx.now = Math.round( now ); + if ( fx.prop !== "height" ) { + adjust += fx.now; + } else if ( that.options.heightStyle !== "content" ) { + fx.now = Math.round( total - toHide.outerHeight() - adjust ); + adjust = 0; + } + } + }); + }, + + _toggleComplete: function( data ) { + var toHide = data.oldPanel; + + toHide + .removeClass( "ui-accordion-content-active" ) + .prev() + .removeClass( "ui-corner-top" ) + .addClass( "ui-corner-all" ); + + // Work around for rendering bug in IE (#5421) + if ( toHide.length ) { + toHide.parent()[0].className = toHide.parent()[0].className; + } + + this._trigger( "activate", null, data ); + } +}); + +})( jQuery ); +(function( $, undefined ) { + +// used to prevent race conditions with remote data sources +var requestIndex = 0; + +$.widget( "ui.autocomplete", { + version: "1.10.0", + defaultElement: "<input>", + options: { + appendTo: null, + autoFocus: false, + delay: 300, + minLength: 1, + position: { + my: "left top", + at: "left bottom", + collision: "none" + }, + source: null, + + // callbacks + change: null, + close: null, + focus: null, + open: null, + response: null, + search: null, + select: null + }, + + pending: 0, + + _create: function() { + // Some browsers only repeat keydown events, not keypress events, + // so we use the suppressKeyPress flag to determine if we've already + // handled the keydown event. #7269 + // Unfortunately the code for & in keypress is the same as the up arrow, + // so we use the suppressKeyPressRepeat flag to avoid handling keypress + // events when we know the keydown event was used to modify the + // search term. #7799 + var suppressKeyPress, suppressKeyPressRepeat, suppressInput; + + this.isMultiLine = this._isMultiLine(); + this.valueMethod = this.element[ this.element.is( "input,textarea" ) ? "val" : "text" ]; + this.isNewMenu = true; + + this.element + .addClass( "ui-autocomplete-input" ) + .attr( "autocomplete", "off" ); + + this._on( this.element, { + keydown: function( event ) { + /*jshint maxcomplexity:15*/ + if ( this.element.prop( "readOnly" ) ) { + suppressKeyPress = true; + suppressInput = true; + suppressKeyPressRepeat = true; + return; + } + + suppressKeyPress = false; + suppressInput = false; + suppressKeyPressRepeat = false; + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + suppressKeyPress = true; + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + suppressKeyPress = true; + this._move( "nextPage", event ); + break; + case keyCode.UP: + suppressKeyPress = true; + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + suppressKeyPress = true; + this._keyEvent( "next", event ); + break; + case keyCode.ENTER: + case keyCode.NUMPAD_ENTER: + // when menu is open and has focus + if ( this.menu.active ) { + // #6055 - Opera still allows the keypress to occur + // which causes forms to submit + suppressKeyPress = true; + event.preventDefault(); + this.menu.select( event ); + } + break; + case keyCode.TAB: + if ( this.menu.active ) { + this.menu.select( event ); + } + break; + case keyCode.ESCAPE: + if ( this.menu.element.is( ":visible" ) ) { + this._value( this.term ); + this.close( event ); + // Different browsers have different default behavior for escape + // Single press can mean undo or clear + // Double press in IE means clear the whole form + event.preventDefault(); + } + break; + default: + suppressKeyPressRepeat = true; + // search timeout should be triggered before the input value is changed + this._searchTimeout( event ); + break; + } + }, + keypress: function( event ) { + if ( suppressKeyPress ) { + suppressKeyPress = false; + event.preventDefault(); + return; + } + if ( suppressKeyPressRepeat ) { + return; + } + + // replicate some key handlers to allow them to repeat in Firefox and Opera + var keyCode = $.ui.keyCode; + switch( event.keyCode ) { + case keyCode.PAGE_UP: + this._move( "previousPage", event ); + break; + case keyCode.PAGE_DOWN: + this._move( "nextPage", event ); + break; + case keyCode.UP: + this._keyEvent( "previous", event ); + break; + case keyCode.DOWN: + this._keyEvent( "next", event ); + break; + } + }, + input: function( event ) { + if ( suppressInput ) { + suppressInput = false; + event.preventDefault(); + return; + } + this._searchTimeout( event ); + }, + focus: function() { + this.selectedItem = null; + this.previous = this._value(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + clearTimeout( this.searching ); + this.close( event ); + this._change( event ); + } + }); + + this._initSource(); + this.menu = $( "<ul>" ) + .addClass( "ui-autocomplete" ) + .appendTo( this._appendTo() ) + .menu({ + // custom key handling for now + input: $(), + // disable ARIA support, the live region takes care of that + role: null + }) + .zIndex( this.element.zIndex() + 1 ) + .hide() + .data( "ui-menu" ); + + this._on( this.menu.element, { + mousedown: function( event ) { + // prevent moving focus out of the text field + event.preventDefault(); + + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + }); + + // clicking on the scrollbar causes focus to shift to the body + // but we can't detect a mouseup or a click immediately afterward + // so we have to track the next mousedown and close the menu if + // the user clicks somewhere outside of the autocomplete + var menuElement = this.menu.element[ 0 ]; + if ( !$( event.target ).closest( ".ui-menu-item" ).length ) { + this._delay(function() { + var that = this; + this.document.one( "mousedown", function( event ) { + if ( event.target !== that.element[ 0 ] && + event.target !== menuElement && + !$.contains( menuElement, event.target ) ) { + that.close(); + } + }); + }); + } + }, + menufocus: function( event, ui ) { + // #7024 - Prevent accidental activation of menu items in Firefox + if ( this.isNewMenu ) { + this.isNewMenu = false; + if ( event.originalEvent && /^mouse/.test( event.originalEvent.type ) ) { + this.menu.blur(); + + this.document.one( "mousemove", function() { + $( event.target ).trigger( event.originalEvent ); + }); + + return; + } + } + + var item = ui.item.data( "ui-autocomplete-item" ); + if ( false !== this._trigger( "focus", event, { item: item } ) ) { + // use value to match what will end up in the input, if it was a key event + if ( event.originalEvent && /^key/.test( event.originalEvent.type ) ) { + this._value( item.value ); + } + } else { + // Normally the input is populated with the item's value as the + // menu is navigated, causing screen readers to notice a change and + // announce the item. Since the focus event was canceled, this doesn't + // happen, so we update the live region so that screen readers can + // still notice the change and announce it. + this.liveRegion.text( item.value ); + } + }, + menuselect: function( event, ui ) { + var item = ui.item.data( "ui-autocomplete-item" ), + previous = this.previous; + + // only trigger when focus was lost (click on menu) + if ( this.element[0] !== this.document[0].activeElement ) { + this.element.focus(); + this.previous = previous; + // #6109 - IE triggers two focus events and the second + // is asynchronous, so we need to reset the previous + // term synchronously and asynchronously :-( + this._delay(function() { + this.previous = previous; + this.selectedItem = item; + }); + } + + if ( false !== this._trigger( "select", event, { item: item } ) ) { + this._value( item.value ); + } + // reset the term after the select event + // this allows custom select handling to work properly + this.term = this._value(); + + this.close( event ); + this.selectedItem = item; + } + }); + + this.liveRegion = $( "<span>", { + role: "status", + "aria-live": "polite" + }) + .addClass( "ui-helper-hidden-accessible" ) + .insertAfter( this.element ); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _destroy: function() { + clearTimeout( this.searching ); + this.element + .removeClass( "ui-autocomplete-input" ) + .removeAttr( "autocomplete" ); + this.menu.element.remove(); + this.liveRegion.remove(); + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "source" ) { + this._initSource(); + } + if ( key === "appendTo" ) { + this.menu.element.appendTo( this._appendTo() ); + } + if ( key === "disabled" && value && this.xhr ) { + this.xhr.abort(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + + if ( element ) { + element = element.jquery || element.nodeType ? + $( element ) : + this.document.find( element ).eq( 0 ); + } + + if ( !element ) { + element = this.element.closest( ".ui-front" ); + } + + if ( !element.length ) { + element = this.document[0].body; + } + + return element; + }, + + _isMultiLine: function() { + // Textareas are always multi-line + if ( this.element.is( "textarea" ) ) { + return true; + } + // Inputs are always single-line, even if inside a contentEditable element + // IE also treats inputs as contentEditable + if ( this.element.is( "input" ) ) { + return false; + } + // All other element types are determined by whether or not they're contentEditable + return this.element.prop( "isContentEditable" ); + }, + + _initSource: function() { + var array, url, + that = this; + if ( $.isArray(this.options.source) ) { + array = this.options.source; + this.source = function( request, response ) { + response( $.ui.autocomplete.filter( array, request.term ) ); + }; + } else if ( typeof this.options.source === "string" ) { + url = this.options.source; + this.source = function( request, response ) { + if ( that.xhr ) { + that.xhr.abort(); + } + that.xhr = $.ajax({ + url: url, + data: request, + dataType: "json", + success: function( data ) { + response( data ); + }, + error: function() { + response( [] ); + } + }); + }; + } else { + this.source = this.options.source; + } + }, + + _searchTimeout: function( event ) { + clearTimeout( this.searching ); + this.searching = this._delay(function() { + // only search if the value has changed + if ( this.term !== this._value() ) { + this.selectedItem = null; + this.search( null, event ); + } + }, this.options.delay ); + }, + + search: function( value, event ) { + value = value != null ? value : this._value(); + + // always save the actual value, not the one passed as an argument + this.term = this._value(); + + if ( value.length < this.options.minLength ) { + return this.close( event ); + } + + if ( this._trigger( "search", event ) === false ) { + return; + } + + return this._search( value ); + }, + + _search: function( value ) { + this.pending++; + this.element.addClass( "ui-autocomplete-loading" ); + this.cancelSearch = false; + + this.source( { term: value }, this._response() ); + }, + + _response: function() { + var that = this, + index = ++requestIndex; + + return function( content ) { + if ( index === requestIndex ) { + that.__response( content ); + } + + that.pending--; + if ( !that.pending ) { + that.element.removeClass( "ui-autocomplete-loading" ); + } + }; + }, + + __response: function( content ) { + if ( content ) { + content = this._normalize( content ); + } + this._trigger( "response", null, { content: content } ); + if ( !this.options.disabled && content && content.length && !this.cancelSearch ) { + this._suggest( content ); + this._trigger( "open" ); + } else { + // use ._close() instead of .close() so we don't cancel future searches + this._close(); + } + }, + + close: function( event ) { + this.cancelSearch = true; + this._close( event ); + }, + + _close: function( event ) { + if ( this.menu.element.is( ":visible" ) ) { + this.menu.element.hide(); + this.menu.blur(); + this.isNewMenu = true; + this._trigger( "close", event ); + } + }, + + _change: function( event ) { + if ( this.previous !== this._value() ) { + this._trigger( "change", event, { item: this.selectedItem } ); + } + }, + + _normalize: function( items ) { + // assume all items have the right format when the first item is complete + if ( items.length && items[0].label && items[0].value ) { + return items; + } + return $.map( items, function( item ) { + if ( typeof item === "string" ) { + return { + label: item, + value: item + }; + } + return $.extend({ + label: item.label || item.value, + value: item.value || item.label + }, item ); + }); + }, + + _suggest: function( items ) { + var ul = this.menu.element + .empty() + .zIndex( this.element.zIndex() + 1 ); + this._renderMenu( ul, items ); + this.menu.refresh(); + + // size and position menu + ul.show(); + this._resizeMenu(); + ul.position( $.extend({ + of: this.element + }, this.options.position )); + + if ( this.options.autoFocus ) { + this.menu.next(); + } + }, + + _resizeMenu: function() { + var ul = this.menu.element; + ul.outerWidth( Math.max( + // Firefox wraps long text (possibly a rounding bug) + // so we add 1px to avoid the wrapping (#7513) + ul.width( "" ).outerWidth() + 1, + this.element.outerWidth() + ) ); + }, + + _renderMenu: function( ul, items ) { + var that = this; + $.each( items, function( index, item ) { + that._renderItemData( ul, item ); + }); + }, + + _renderItemData: function( ul, item ) { + return this._renderItem( ul, item ).data( "ui-autocomplete-item", item ); + }, + + _renderItem: function( ul, item ) { + return $( "<li>" ) + .append( $( "<a>" ).text( item.label ) ) + .appendTo( ul ); + }, + + _move: function( direction, event ) { + if ( !this.menu.element.is( ":visible" ) ) { + this.search( null, event ); + return; + } + if ( this.menu.isFirstItem() && /^previous/.test( direction ) || + this.menu.isLastItem() && /^next/.test( direction ) ) { + this._value( this.term ); + this.menu.blur(); + return; + } + this.menu[ direction ]( event ); + }, + + widget: function() { + return this.menu.element; + }, + + _value: function() { + return this.valueMethod.apply( this.element, arguments ); + }, + + _keyEvent: function( keyEvent, event ) { + if ( !this.isMultiLine || this.menu.element.is( ":visible" ) ) { + this._move( keyEvent, event ); + + // prevents moving cursor to beginning/end of the text field in some browsers + event.preventDefault(); + } + } +}); + +$.extend( $.ui.autocomplete, { + escapeRegex: function( value ) { + return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&"); + }, + filter: function(array, term) { + var matcher = new RegExp( $.ui.autocomplete.escapeRegex(term), "i" ); + return $.grep( array, function(value) { + return matcher.test( value.label || value.value || value ); + }); + } +}); + + +// live region extension, adding a `messages` option +// NOTE: This is an experimental API. We are still investigating +// a full solution for string manipulation and internationalization. +$.widget( "ui.autocomplete", $.ui.autocomplete, { + options: { + messages: { + noResults: "No search results.", + results: function( amount ) { + return amount + ( amount > 1 ? " results are" : " result is" ) + + " available, use up and down arrow keys to navigate."; + } + } + }, + + __response: function( content ) { + var message; + this._superApply( arguments ); + if ( this.options.disabled || this.cancelSearch ) { + return; + } + if ( content && content.length ) { + message = this.options.messages.results( content.length ); + } else { + message = this.options.messages.noResults; + } + this.liveRegion.text( message ); + } +}); + +}( jQuery )); +(function( $, undefined ) { + +var lastActive, startXPos, startYPos, clickDragged, + baseClasses = "ui-button ui-widget ui-state-default ui-corner-all", + stateClasses = "ui-state-hover ui-state-active ", + typeClasses = "ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only", + formResetHandler = function() { + var buttons = $( this ).find( ":ui-button" ); + setTimeout(function() { + buttons.button( "refresh" ); + }, 1 ); + }, + radioGroup = function( radio ) { + var name = radio.name, + form = radio.form, + radios = $( [] ); + if ( name ) { + name = name.replace( /'/g, "\\'" ); + if ( form ) { + radios = $( form ).find( "[name='" + name + "']" ); + } else { + radios = $( "[name='" + name + "']", radio.ownerDocument ) + .filter(function() { + return !this.form; + }); + } + } + return radios; + }; + +$.widget( "ui.button", { + version: "1.10.0", + defaultElement: "<button>", + options: { + disabled: null, + text: true, + label: null, + icons: { + primary: null, + secondary: null + } + }, + _create: function() { + this.element.closest( "form" ) + .unbind( "reset" + this.eventNamespace ) + .bind( "reset" + this.eventNamespace, formResetHandler ); + + if ( typeof this.options.disabled !== "boolean" ) { + this.options.disabled = !!this.element.prop( "disabled" ); + } else { + this.element.prop( "disabled", this.options.disabled ); + } + + this._determineButtonType(); + this.hasTitle = !!this.buttonElement.attr( "title" ); + + var that = this, + options = this.options, + toggleButton = this.type === "checkbox" || this.type === "radio", + activeClass = !toggleButton ? "ui-state-active" : "", + focusClass = "ui-state-focus"; + + if ( options.label === null ) { + options.label = (this.type === "input" ? this.buttonElement.val() : this.buttonElement.html()); + } + + this._hoverable( this.buttonElement ); + + this.buttonElement + .addClass( baseClasses ) + .attr( "role", "button" ) + .bind( "mouseenter" + this.eventNamespace, function() { + if ( options.disabled ) { + return; + } + if ( this === lastActive ) { + $( this ).addClass( "ui-state-active" ); + } + }) + .bind( "mouseleave" + this.eventNamespace, function() { + if ( options.disabled ) { + return; + } + $( this ).removeClass( activeClass ); + }) + .bind( "click" + this.eventNamespace, function( event ) { + if ( options.disabled ) { + event.preventDefault(); + event.stopImmediatePropagation(); + } + }); + + this.element + .bind( "focus" + this.eventNamespace, function() { + // no need to check disabled, focus won't be triggered anyway + that.buttonElement.addClass( focusClass ); + }) + .bind( "blur" + this.eventNamespace, function() { + that.buttonElement.removeClass( focusClass ); + }); + + if ( toggleButton ) { + this.element.bind( "change" + this.eventNamespace, function() { + if ( clickDragged ) { + return; + } + that.refresh(); + }); + // if mouse moves between mousedown and mouseup (drag) set clickDragged flag + // prevents issue where button state changes but checkbox/radio checked state + // does not in Firefox (see ticket #6970) + this.buttonElement + .bind( "mousedown" + this.eventNamespace, function( event ) { + if ( options.disabled ) { + return; + } + clickDragged = false; + startXPos = event.pageX; + startYPos = event.pageY; + }) + .bind( "mouseup" + this.eventNamespace, function( event ) { + if ( options.disabled ) { + return; + } + if ( startXPos !== event.pageX || startYPos !== event.pageY ) { + clickDragged = true; + } + }); + } + + if ( this.type === "checkbox" ) { + this.buttonElement.bind( "click" + this.eventNamespace, function() { + if ( options.disabled || clickDragged ) { + return false; + } + }); + } else if ( this.type === "radio" ) { + this.buttonElement.bind( "click" + this.eventNamespace, function() { + if ( options.disabled || clickDragged ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + that.buttonElement.attr( "aria-pressed", "true" ); + + var radio = that.element[ 0 ]; + radioGroup( radio ) + .not( radio ) + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + }); + } else { + this.buttonElement + .bind( "mousedown" + this.eventNamespace, function() { + if ( options.disabled ) { + return false; + } + $( this ).addClass( "ui-state-active" ); + lastActive = this; + that.document.one( "mouseup", function() { + lastActive = null; + }); + }) + .bind( "mouseup" + this.eventNamespace, function() { + if ( options.disabled ) { + return false; + } + $( this ).removeClass( "ui-state-active" ); + }) + .bind( "keydown" + this.eventNamespace, function(event) { + if ( options.disabled ) { + return false; + } + if ( event.keyCode === $.ui.keyCode.SPACE || event.keyCode === $.ui.keyCode.ENTER ) { + $( this ).addClass( "ui-state-active" ); + } + }) + // see #8559, we bind to blur here in case the button element loses + // focus between keydown and keyup, it would be left in an "active" state + .bind( "keyup" + this.eventNamespace + " blur" + this.eventNamespace, function() { + $( this ).removeClass( "ui-state-active" ); + }); + + if ( this.buttonElement.is("a") ) { + this.buttonElement.keyup(function(event) { + if ( event.keyCode === $.ui.keyCode.SPACE ) { + // TODO pass through original event correctly (just as 2nd argument doesn't work) + $( this ).click(); + } + }); + } + } + + // TODO: pull out $.Widget's handling for the disabled option into + // $.Widget.prototype._setOptionDisabled so it's easy to proxy and can + // be overridden by individual plugins + this._setOption( "disabled", options.disabled ); + this._resetButton(); + }, + + _determineButtonType: function() { + var ancestor, labelSelector, checked; + + if ( this.element.is("[type=checkbox]") ) { + this.type = "checkbox"; + } else if ( this.element.is("[type=radio]") ) { + this.type = "radio"; + } else if ( this.element.is("input") ) { + this.type = "input"; + } else { + this.type = "button"; + } + + if ( this.type === "checkbox" || this.type === "radio" ) { + // we don't search against the document in case the element + // is disconnected from the DOM + ancestor = this.element.parents().last(); + labelSelector = "label[for='" + this.element.attr("id") + "']"; + this.buttonElement = ancestor.find( labelSelector ); + if ( !this.buttonElement.length ) { + ancestor = ancestor.length ? ancestor.siblings() : this.element.siblings(); + this.buttonElement = ancestor.filter( labelSelector ); + if ( !this.buttonElement.length ) { + this.buttonElement = ancestor.find( labelSelector ); + } + } + this.element.addClass( "ui-helper-hidden-accessible" ); + + checked = this.element.is( ":checked" ); + if ( checked ) { + this.buttonElement.addClass( "ui-state-active" ); + } + this.buttonElement.prop( "aria-pressed", checked ); + } else { + this.buttonElement = this.element; + } + }, + + widget: function() { + return this.buttonElement; + }, + + _destroy: function() { + this.element + .removeClass( "ui-helper-hidden-accessible" ); + this.buttonElement + .removeClass( baseClasses + " " + stateClasses + " " + typeClasses ) + .removeAttr( "role" ) + .removeAttr( "aria-pressed" ) + .html( this.buttonElement.find(".ui-button-text").html() ); + + if ( !this.hasTitle ) { + this.buttonElement.removeAttr( "title" ); + } + }, + + _setOption: function( key, value ) { + this._super( key, value ); + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + } else { + this.element.prop( "disabled", false ); + } + return; + } + this._resetButton(); + }, + + refresh: function() { + //See #8237 & #8828 + var isDisabled = this.element.is( "input, button" ) ? this.element.is( ":disabled" ) : this.element.hasClass( "ui-button-disabled" ); + + if ( isDisabled !== this.options.disabled ) { + this._setOption( "disabled", isDisabled ); + } + if ( this.type === "radio" ) { + radioGroup( this.element[0] ).each(function() { + if ( $( this ).is( ":checked" ) ) { + $( this ).button( "widget" ) + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + $( this ).button( "widget" ) + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + }); + } else if ( this.type === "checkbox" ) { + if ( this.element.is( ":checked" ) ) { + this.buttonElement + .addClass( "ui-state-active" ) + .attr( "aria-pressed", "true" ); + } else { + this.buttonElement + .removeClass( "ui-state-active" ) + .attr( "aria-pressed", "false" ); + } + } + }, + + _resetButton: function() { + if ( this.type === "input" ) { + if ( this.options.label ) { + this.element.val( this.options.label ); + } + return; + } + var buttonElement = this.buttonElement.removeClass( typeClasses ), + buttonText = $( "<span></span>", this.document[0] ) + .addClass( "ui-button-text" ) + .html( this.options.label ) + .appendTo( buttonElement.empty() ) + .text(), + icons = this.options.icons, + multipleIcons = icons.primary && icons.secondary, + buttonClasses = []; + + if ( icons.primary || icons.secondary ) { + if ( this.options.text ) { + buttonClasses.push( "ui-button-text-icon" + ( multipleIcons ? "s" : ( icons.primary ? "-primary" : "-secondary" ) ) ); + } + + if ( icons.primary ) { + buttonElement.prepend( "<span class='ui-button-icon-primary ui-icon " + icons.primary + "'></span>" ); + } + + if ( icons.secondary ) { + buttonElement.append( "<span class='ui-button-icon-secondary ui-icon " + icons.secondary + "'></span>" ); + } + + if ( !this.options.text ) { + buttonClasses.push( multipleIcons ? "ui-button-icons-only" : "ui-button-icon-only" ); + + if ( !this.hasTitle ) { + buttonElement.attr( "title", $.trim( buttonText ) ); + } + } + } else { + buttonClasses.push( "ui-button-text-only" ); + } + buttonElement.addClass( buttonClasses.join( " " ) ); + } +}); + +$.widget( "ui.buttonset", { + version: "1.10.0", + options: { + items: "button, input[type=button], input[type=submit], input[type=reset], input[type=checkbox], input[type=radio], a, :data(ui-button)" + }, + + _create: function() { + this.element.addClass( "ui-buttonset" ); + }, + + _init: function() { + this.refresh(); + }, + + _setOption: function( key, value ) { + if ( key === "disabled" ) { + this.buttons.button( "option", key, value ); + } + + this._super( key, value ); + }, + + refresh: function() { + var rtl = this.element.css( "direction" ) === "rtl"; + + this.buttons = this.element.find( this.options.items ) + .filter( ":ui-button" ) + .button( "refresh" ) + .end() + .not( ":ui-button" ) + .button() + .end() + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-all ui-corner-left ui-corner-right" ) + .filter( ":first" ) + .addClass( rtl ? "ui-corner-right" : "ui-corner-left" ) + .end() + .filter( ":last" ) + .addClass( rtl ? "ui-corner-left" : "ui-corner-right" ) + .end() + .end(); + }, + + _destroy: function() { + this.element.removeClass( "ui-buttonset" ); + this.buttons + .map(function() { + return $( this ).button( "widget" )[ 0 ]; + }) + .removeClass( "ui-corner-left ui-corner-right" ) + .end() + .button( "destroy" ); + } +}); + +}( jQuery ) ); +(function( $, undefined ) { + +$.extend($.ui, { datepicker: { version: "1.10.0" } }); + +var PROP_NAME = "datepicker", + dpuuid = new Date().getTime(), + instActive; + +/* Date picker manager. + Use the singleton instance of this class, $.datepicker, to interact with the date picker. + Settings for (groups of) date pickers are maintained in an instance object, + allowing multiple different settings on the same page. */ + +function Datepicker() { + this._curInst = null; // The current instance in use + this._keyEvent = false; // If the last event was a key event + this._disabledInputs = []; // List of date picker inputs that have been disabled + this._datepickerShowing = false; // True if the popup picker is showing , false if not + this._inDialog = false; // True if showing within a "dialog", false if not + this._mainDivId = "ui-datepicker-div"; // The ID of the main datepicker division + this._inlineClass = "ui-datepicker-inline"; // The name of the inline marker class + this._appendClass = "ui-datepicker-append"; // The name of the append marker class + this._triggerClass = "ui-datepicker-trigger"; // The name of the trigger marker class + this._dialogClass = "ui-datepicker-dialog"; // The name of the dialog marker class + this._disableClass = "ui-datepicker-disabled"; // The name of the disabled covering marker class + this._unselectableClass = "ui-datepicker-unselectable"; // The name of the unselectable cell marker class + this._currentClass = "ui-datepicker-current-day"; // The name of the current day marker class + this._dayOverClass = "ui-datepicker-days-cell-over"; // The name of the day hover marker class + this.regional = []; // Available regional settings, indexed by language code + this.regional[""] = { // Default regional settings + closeText: "Done", // Display text for close link + prevText: "Prev", // Display text for previous month link + nextText: "Next", // Display text for next month link + currentText: "Today", // Display text for current month link + monthNames: ["January","February","March","April","May","June", + "July","August","September","October","November","December"], // Names of months for drop-down and formatting + monthNamesShort: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"], // For formatting + dayNames: ["Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"], // For formatting + dayNamesShort: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"], // For formatting + dayNamesMin: ["Su","Mo","Tu","We","Th","Fr","Sa"], // Column headings for days starting at Sunday + weekHeader: "Wk", // Column header for week of the year + dateFormat: "mm/dd/yy", // See format options on parseDate + firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ... + isRTL: false, // True if right-to-left language, false if left-to-right + showMonthAfterYear: false, // True if the year select precedes month, false for month then year + yearSuffix: "" // Additional text to append to the year in the month headers + }; + this._defaults = { // Global defaults for all the date picker instances + showOn: "focus", // "focus" for popup on focus, + // "button" for trigger button, or "both" for either + showAnim: "fadeIn", // Name of jQuery animation for popup + showOptions: {}, // Options for enhanced animations + defaultDate: null, // Used when field is blank: actual date, + // +/-number for offset from today, null for today + appendText: "", // Display text following the input box, e.g. showing the format + buttonText: "...", // Text for trigger button + buttonImage: "", // URL for trigger button image + buttonImageOnly: false, // True if the image appears alone, false if it appears on a button + hideIfNoPrevNext: false, // True to hide next/previous month links + // if not applicable, false to just disable them + navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links + gotoCurrent: false, // True if today link goes back to current selection instead + changeMonth: false, // True if month can be selected directly, false if only prev/next + changeYear: false, // True if year can be selected directly, false if only prev/next + yearRange: "c-10:c+10", // Range of years to display in drop-down, + // either relative to today's year (-nn:+nn), relative to currently displayed year + // (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n) + showOtherMonths: false, // True to show dates in other months, false to leave blank + selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable + showWeek: false, // True to show week of the year, false to not show it + calculateWeek: this.iso8601Week, // How to calculate the week of the year, + // takes a Date and returns the number of the week for it + shortYearCutoff: "+10", // Short year values < this are in the current century, + // > this are in the previous century, + // string value starting with "+" for current year + value + minDate: null, // The earliest selectable date, or null for no limit + maxDate: null, // The latest selectable date, or null for no limit + duration: "fast", // Duration of display/closure + beforeShowDay: null, // Function that takes a date and returns an array with + // [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "", + // [2] = cell title (optional), e.g. $.datepicker.noWeekends + beforeShow: null, // Function that takes an input field and + // returns a set of custom settings for the date picker + onSelect: null, // Define a callback function when a date is selected + onChangeMonthYear: null, // Define a callback function when the month or year is changed + onClose: null, // Define a callback function when the datepicker is closed + numberOfMonths: 1, // Number of months to show at a time + showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0) + stepMonths: 1, // Number of months to step back/forward + stepBigMonths: 12, // Number of months to step back/forward for the big links + altField: "", // Selector for an alternate field to store selected dates into + altFormat: "", // The date format to use for the alternate field + constrainInput: true, // The input is constrained by the current date format + showButtonPanel: false, // True to show button panel, false to not show it + autoSize: false, // True to size the input for the date format, false to leave as is + disabled: false // The initial disabled state + }; + $.extend(this._defaults, this.regional[""]); + this.dpDiv = bindHover($("<div id='" + this._mainDivId + "' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")); +} + +$.extend(Datepicker.prototype, { + /* Class name added to elements to indicate already configured with a date picker. */ + markerClassName: "hasDatepicker", + + //Keep track of the maximum number of rows displayed (see #7043) + maxRows: 4, + + // TODO rename to "widget" when switching to widget factory + _widgetDatepicker: function() { + return this.dpDiv; + }, + + /* Override the default settings for all instances of the date picker. + * @param settings object - the new settings to use as defaults (anonymous object) + * @return the manager object + */ + setDefaults: function(settings) { + extendRemove(this._defaults, settings || {}); + return this; + }, + + /* Attach the date picker to a jQuery selection. + * @param target element - the target input field or division or span + * @param settings object - the new settings to use for this date picker instance (anonymous) + */ + _attachDatepicker: function(target, settings) { + var nodeName, inline, inst; + nodeName = target.nodeName.toLowerCase(); + inline = (nodeName === "div" || nodeName === "span"); + if (!target.id) { + this.uuid += 1; + target.id = "dp" + this.uuid; + } + inst = this._newInst($(target), inline); + inst.settings = $.extend({}, settings || {}); + if (nodeName === "input") { + this._connectDatepicker(target, inst); + } else if (inline) { + this._inlineDatepicker(target, inst); + } + }, + + /* Create a new instance object. */ + _newInst: function(target, inline) { + var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, "\\\\$1"); // escape jQuery meta chars + return {id: id, input: target, // associated target + selectedDay: 0, selectedMonth: 0, selectedYear: 0, // current selection + drawMonth: 0, drawYear: 0, // month being drawn + inline: inline, // is datepicker inline or not + dpDiv: (!inline ? this.dpDiv : // presentation div + bindHover($("<div class='" + this._inlineClass + " ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>")))}; + }, + + /* Attach the date picker to an input field. */ + _connectDatepicker: function(target, inst) { + var input = $(target); + inst.append = $([]); + inst.trigger = $([]); + if (input.hasClass(this.markerClassName)) { + return; + } + this._attachments(input, inst); + input.addClass(this.markerClassName).keydown(this._doKeyDown). + keypress(this._doKeyPress).keyup(this._doKeyUp); + this._autoSize(inst); + $.data(target, PROP_NAME, inst); + //If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + }, + + /* Make attachments based on settings. */ + _attachments: function(input, inst) { + var showOn, buttonText, buttonImage, + appendText = this._get(inst, "appendText"), + isRTL = this._get(inst, "isRTL"); + + if (inst.append) { + inst.append.remove(); + } + if (appendText) { + inst.append = $("<span class='" + this._appendClass + "'>" + appendText + "</span>"); + input[isRTL ? "before" : "after"](inst.append); + } + + input.unbind("focus", this._showDatepicker); + + if (inst.trigger) { + inst.trigger.remove(); + } + + showOn = this._get(inst, "showOn"); + if (showOn === "focus" || showOn === "both") { // pop-up date picker when in the marked field + input.focus(this._showDatepicker); + } + if (showOn === "button" || showOn === "both") { // pop-up date picker when button clicked + buttonText = this._get(inst, "buttonText"); + buttonImage = this._get(inst, "buttonImage"); + inst.trigger = $(this._get(inst, "buttonImageOnly") ? + $("<img/>").addClass(this._triggerClass). + attr({ src: buttonImage, alt: buttonText, title: buttonText }) : + $("<button type='button'></button>").addClass(this._triggerClass). + html(!buttonImage ? buttonText : $("<img/>").attr( + { src:buttonImage, alt:buttonText, title:buttonText }))); + input[isRTL ? "before" : "after"](inst.trigger); + inst.trigger.click(function() { + if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) { + $.datepicker._hideDatepicker(); + } else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) { + $.datepicker._hideDatepicker(); + $.datepicker._showDatepicker(input[0]); + } else { + $.datepicker._showDatepicker(input[0]); + } + return false; + }); + } + }, + + /* Apply the maximum length for the date format. */ + _autoSize: function(inst) { + if (this._get(inst, "autoSize") && !inst.inline) { + var findMax, max, maxI, i, + date = new Date(2009, 12 - 1, 20), // Ensure double digits + dateFormat = this._get(inst, "dateFormat"); + + if (dateFormat.match(/[DM]/)) { + findMax = function(names) { + max = 0; + maxI = 0; + for (i = 0; i < names.length; i++) { + if (names[i].length > max) { + max = names[i].length; + maxI = i; + } + } + return maxI; + }; + date.setMonth(findMax(this._get(inst, (dateFormat.match(/MM/) ? + "monthNames" : "monthNamesShort")))); + date.setDate(findMax(this._get(inst, (dateFormat.match(/DD/) ? + "dayNames" : "dayNamesShort"))) + 20 - date.getDay()); + } + inst.input.attr("size", this._formatDate(inst, date).length); + } + }, + + /* Attach an inline date picker to a div. */ + _inlineDatepicker: function(target, inst) { + var divSpan = $(target); + if (divSpan.hasClass(this.markerClassName)) { + return; + } + divSpan.addClass(this.markerClassName).append(inst.dpDiv); + $.data(target, PROP_NAME, inst); + this._setDate(inst, this._getDefaultDate(inst), true); + this._updateDatepicker(inst); + this._updateAlternate(inst); + //If disabled option is true, disable the datepicker before showing it (see ticket #5665) + if( inst.settings.disabled ) { + this._disableDatepicker( target ); + } + // Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements + // http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height + inst.dpDiv.css( "display", "block" ); + }, + + /* Pop-up the date picker in a "dialog" box. + * @param input element - ignored + * @param date string or Date - the initial date to display + * @param onSelect function - the function to call when a date is selected + * @param settings object - update the dialog date picker instance's settings (anonymous object) + * @param pos int[2] - coordinates for the dialog's position within the screen or + * event - with x/y coordinates or + * leave empty for default (screen centre) + * @return the manager object + */ + _dialogDatepicker: function(input, date, onSelect, settings, pos) { + var id, browserWidth, browserHeight, scrollX, scrollY, + inst = this._dialogInst; // internal instance + + if (!inst) { + this.uuid += 1; + id = "dp" + this.uuid; + this._dialogInput = $("<input type='text' id='" + id + + "' style='position: absolute; top: -100px; width: 0px;'/>"); + this._dialogInput.keydown(this._doKeyDown); + $("body").append(this._dialogInput); + inst = this._dialogInst = this._newInst(this._dialogInput, false); + inst.settings = {}; + $.data(this._dialogInput[0], PROP_NAME, inst); + } + extendRemove(inst.settings, settings || {}); + date = (date && date.constructor === Date ? this._formatDate(inst, date) : date); + this._dialogInput.val(date); + + this._pos = (pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null); + if (!this._pos) { + browserWidth = document.documentElement.clientWidth; + browserHeight = document.documentElement.clientHeight; + scrollX = document.documentElement.scrollLeft || document.body.scrollLeft; + scrollY = document.documentElement.scrollTop || document.body.scrollTop; + this._pos = // should use actual width/height below + [(browserWidth / 2) - 100 + scrollX, (browserHeight / 2) - 150 + scrollY]; + } + + // move input on screen for focus, but hidden behind dialog + this._dialogInput.css("left", (this._pos[0] + 20) + "px").css("top", this._pos[1] + "px"); + inst.settings.onSelect = onSelect; + this._inDialog = true; + this.dpDiv.addClass(this._dialogClass); + this._showDatepicker(this._dialogInput[0]); + if ($.blockUI) { + $.blockUI(this.dpDiv); + } + $.data(this._dialogInput[0], PROP_NAME, inst); + return this; + }, + + /* Detach a datepicker from its control. + * @param target element - the target input field or division or span + */ + _destroyDatepicker: function(target) { + var nodeName, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + $.removeData(target, PROP_NAME); + if (nodeName === "input") { + inst.append.remove(); + inst.trigger.remove(); + $target.removeClass(this.markerClassName). + unbind("focus", this._showDatepicker). + unbind("keydown", this._doKeyDown). + unbind("keypress", this._doKeyPress). + unbind("keyup", this._doKeyUp); + } else if (nodeName === "div" || nodeName === "span") { + $target.removeClass(this.markerClassName).empty(); + } + }, + + /* Enable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _enableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = false; + inst.trigger.filter("button"). + each(function() { this.disabled = false; }).end(). + filter("img").css({opacity: "1.0", cursor: ""}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().removeClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", false); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + }, + + /* Disable the date picker to a jQuery selection. + * @param target element - the target input field or division or span + */ + _disableDatepicker: function(target) { + var nodeName, inline, + $target = $(target), + inst = $.data(target, PROP_NAME); + + if (!$target.hasClass(this.markerClassName)) { + return; + } + + nodeName = target.nodeName.toLowerCase(); + if (nodeName === "input") { + target.disabled = true; + inst.trigger.filter("button"). + each(function() { this.disabled = true; }).end(). + filter("img").css({opacity: "0.5", cursor: "default"}); + } else if (nodeName === "div" || nodeName === "span") { + inline = $target.children("." + this._inlineClass); + inline.children().addClass("ui-state-disabled"); + inline.find("select.ui-datepicker-month, select.ui-datepicker-year"). + prop("disabled", true); + } + this._disabledInputs = $.map(this._disabledInputs, + function(value) { return (value === target ? null : value); }); // delete entry + this._disabledInputs[this._disabledInputs.length] = target; + }, + + /* Is the first field in a jQuery collection disabled as a datepicker? + * @param target element - the target input field or division or span + * @return boolean - true if disabled, false if enabled + */ + _isDisabledDatepicker: function(target) { + if (!target) { + return false; + } + for (var i = 0; i < this._disabledInputs.length; i++) { + if (this._disabledInputs[i] === target) { + return true; + } + } + return false; + }, + + /* Retrieve the instance data for the target control. + * @param target element - the target input field or division or span + * @return object - the associated instance data + * @throws error if a jQuery problem getting data + */ + _getInst: function(target) { + try { + return $.data(target, PROP_NAME); + } + catch (err) { + throw "Missing instance data for this datepicker"; + } + }, + + /* Update or retrieve the settings for a date picker attached to an input field or division. + * @param target element - the target input field or division or span + * @param name object - the new settings to update or + * string - the name of the setting to change or retrieve, + * when retrieving also "all" for all instance settings or + * "defaults" for all global defaults + * @param value any - the new value for the setting + * (omit if above is an object or to retrieve a value) + */ + _optionDatepicker: function(target, name, value) { + var settings, date, minDate, maxDate, + inst = this._getInst(target); + + if (arguments.length === 2 && typeof name === "string") { + return (name === "defaults" ? $.extend({}, $.datepicker._defaults) : + (inst ? (name === "all" ? $.extend({}, inst.settings) : + this._get(inst, name)) : null)); + } + + settings = name || {}; + if (typeof name === "string") { + settings = {}; + settings[name] = value; + } + + if (inst) { + if (this._curInst === inst) { + this._hideDatepicker(); + } + + date = this._getDateDatepicker(target, true); + minDate = this._getMinMaxDate(inst, "min"); + maxDate = this._getMinMaxDate(inst, "max"); + extendRemove(inst.settings, settings); + // reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided + if (minDate !== null && settings.dateFormat !== undefined && settings.minDate === undefined) { + inst.settings.minDate = this._formatDate(inst, minDate); + } + if (maxDate !== null && settings.dateFormat !== undefined && settings.maxDate === undefined) { + inst.settings.maxDate = this._formatDate(inst, maxDate); + } + if ( "disabled" in settings ) { + if ( settings.disabled ) { + this._disableDatepicker(target); + } else { + this._enableDatepicker(target); + } + } + this._attachments($(target), inst); + this._autoSize(inst); + this._setDate(inst, date); + this._updateAlternate(inst); + this._updateDatepicker(inst); + } + }, + + // change method deprecated + _changeDatepicker: function(target, name, value) { + this._optionDatepicker(target, name, value); + }, + + /* Redraw the date picker attached to an input field or division. + * @param target element - the target input field or division or span + */ + _refreshDatepicker: function(target) { + var inst = this._getInst(target); + if (inst) { + this._updateDatepicker(inst); + } + }, + + /* Set the dates for a jQuery selection. + * @param target element - the target input field or division or span + * @param date Date - the new date + */ + _setDateDatepicker: function(target, date) { + var inst = this._getInst(target); + if (inst) { + this._setDate(inst, date); + this._updateDatepicker(inst); + this._updateAlternate(inst); + } + }, + + /* Get the date(s) for the first entry in a jQuery selection. + * @param target element - the target input field or division or span + * @param noDefault boolean - true if no default date is to be used + * @return Date - the current date + */ + _getDateDatepicker: function(target, noDefault) { + var inst = this._getInst(target); + if (inst && !inst.inline) { + this._setDateFromField(inst, noDefault); + } + return (inst ? this._getDate(inst) : null); + }, + + /* Handle keystrokes. */ + _doKeyDown: function(event) { + var onSelect, dateStr, sel, + inst = $.datepicker._getInst(event.target), + handled = true, + isRTL = inst.dpDiv.is(".ui-datepicker-rtl"); + + inst._keyEvent = true; + if ($.datepicker._datepickerShowing) { + switch (event.keyCode) { + case 9: $.datepicker._hideDatepicker(); + handled = false; + break; // hide on tab out + case 13: sel = $("td." + $.datepicker._dayOverClass + ":not(." + + $.datepicker._currentClass + ")", inst.dpDiv); + if (sel[0]) { + $.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0]); + } + + onSelect = $.datepicker._get(inst, "onSelect"); + if (onSelect) { + dateStr = $.datepicker._formatDate(inst); + + // trigger custom callback + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); + } else { + $.datepicker._hideDatepicker(); + } + + return false; // don't submit the form + case 27: $.datepicker._hideDatepicker(); + break; // hide on escape + case 33: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + break; // previous month/year on page up/+ ctrl + case 34: $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + break; // next month/year on page down/+ ctrl + case 35: if (event.ctrlKey || event.metaKey) { + $.datepicker._clearDate(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // clear on ctrl or command +end + case 36: if (event.ctrlKey || event.metaKey) { + $.datepicker._gotoToday(event.target); + } + handled = event.ctrlKey || event.metaKey; + break; // current on ctrl or command +home + case 37: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? +1 : -1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // -1 day on ctrl or command +left + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + -$.datepicker._get(inst, "stepBigMonths") : + -$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +left on Mac + break; + case 38: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, -7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // -1 week on ctrl or command +up + case 39: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, (isRTL ? -1 : +1), "D"); + } + handled = event.ctrlKey || event.metaKey; + // +1 day on ctrl or command +right + if (event.originalEvent.altKey) { + $.datepicker._adjustDate(event.target, (event.ctrlKey ? + +$.datepicker._get(inst, "stepBigMonths") : + +$.datepicker._get(inst, "stepMonths")), "M"); + } + // next month/year on alt +right + break; + case 40: if (event.ctrlKey || event.metaKey) { + $.datepicker._adjustDate(event.target, +7, "D"); + } + handled = event.ctrlKey || event.metaKey; + break; // +1 week on ctrl or command +down + default: handled = false; + } + } else if (event.keyCode === 36 && event.ctrlKey) { // display the date picker on ctrl+home + $.datepicker._showDatepicker(this); + } else { + handled = false; + } + + if (handled) { + event.preventDefault(); + event.stopPropagation(); + } + }, + + /* Filter entered characters - based on date format. */ + _doKeyPress: function(event) { + var chars, chr, + inst = $.datepicker._getInst(event.target); + + if ($.datepicker._get(inst, "constrainInput")) { + chars = $.datepicker._possibleChars($.datepicker._get(inst, "dateFormat")); + chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode); + return event.ctrlKey || event.metaKey || (chr < " " || !chars || chars.indexOf(chr) > -1); + } + }, + + /* Synchronise manual entry and field/alternate field. */ + _doKeyUp: function(event) { + var date, + inst = $.datepicker._getInst(event.target); + + if (inst.input.val() !== inst.lastVal) { + try { + date = $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + (inst.input ? inst.input.val() : null), + $.datepicker._getFormatConfig(inst)); + + if (date) { // only if valid + $.datepicker._setDateFromField(inst); + $.datepicker._updateAlternate(inst); + $.datepicker._updateDatepicker(inst); + } + } + catch (err) { + } + } + return true; + }, + + /* Pop-up the date picker for a given input field. + * If false returned from beforeShow event handler do not show. + * @param input element - the input field attached to the date picker or + * event - if triggered by focus + */ + _showDatepicker: function(input) { + input = input.target || input; + if (input.nodeName.toLowerCase() !== "input") { // find from button/image trigger + input = $("input", input.parentNode)[0]; + } + + if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) { // already here + return; + } + + var inst, beforeShow, beforeShowSettings, isFixed, + offset, showAnim, duration; + + inst = $.datepicker._getInst(input); + if ($.datepicker._curInst && $.datepicker._curInst !== inst) { + $.datepicker._curInst.dpDiv.stop(true, true); + if ( inst && $.datepicker._datepickerShowing ) { + $.datepicker._hideDatepicker( $.datepicker._curInst.input[0] ); + } + } + + beforeShow = $.datepicker._get(inst, "beforeShow"); + beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}; + if(beforeShowSettings === false){ + return; + } + extendRemove(inst.settings, beforeShowSettings); + + inst.lastVal = null; + $.datepicker._lastInput = input; + $.datepicker._setDateFromField(inst); + + if ($.datepicker._inDialog) { // hide cursor + input.value = ""; + } + if (!$.datepicker._pos) { // position below input + $.datepicker._pos = $.datepicker._findPos(input); + $.datepicker._pos[1] += input.offsetHeight; // add the height + } + + isFixed = false; + $(input).parents().each(function() { + isFixed |= $(this).css("position") === "fixed"; + return !isFixed; + }); + + offset = {left: $.datepicker._pos[0], top: $.datepicker._pos[1]}; + $.datepicker._pos = null; + //to avoid flashes on Firefox + inst.dpDiv.empty(); + // determine sizing offscreen + inst.dpDiv.css({position: "absolute", display: "block", top: "-1000px"}); + $.datepicker._updateDatepicker(inst); + // fix width for dynamic number of date pickers + // and adjust position before showing + offset = $.datepicker._checkOffset(inst, offset, isFixed); + inst.dpDiv.css({position: ($.datepicker._inDialog && $.blockUI ? + "static" : (isFixed ? "fixed" : "absolute")), display: "none", + left: offset.left + "px", top: offset.top + "px"}); + + if (!inst.inline) { + showAnim = $.datepicker._get(inst, "showAnim"); + duration = $.datepicker._get(inst, "duration"); + inst.dpDiv.zIndex($(input).zIndex()+1); + $.datepicker._datepickerShowing = true; + + if ( $.effects && $.effects.effect[ showAnim ] ) { + inst.dpDiv.show(showAnim, $.datepicker._get(inst, "showOptions"), duration); + } else { + inst.dpDiv[showAnim || "show"](showAnim ? duration : null); + } + + if (inst.input.is(":visible") && !inst.input.is(":disabled")) { + inst.input.focus(); + } + $.datepicker._curInst = inst; + } + }, + + /* Generate the date picker content. */ + _updateDatepicker: function(inst) { + this.maxRows = 4; //Reset the max number of rows being displayed (see #7043) + instActive = inst; // for delegate hover events + inst.dpDiv.empty().append(this._generateHTML(inst)); + this._attachHandlers(inst); + inst.dpDiv.find("." + this._dayOverClass + " a").mouseover(); + + var origyearshtml, + numMonths = this._getNumberOfMonths(inst), + cols = numMonths[1], + width = 17; + + inst.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width(""); + if (cols > 1) { + inst.dpDiv.addClass("ui-datepicker-multi-" + cols).css("width", (width * cols) + "em"); + } + inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? "add" : "remove") + + "Class"]("ui-datepicker-multi"); + inst.dpDiv[(this._get(inst, "isRTL") ? "add" : "remove") + + "Class"]("ui-datepicker-rtl"); + + // #6694 - don't focus the input if it's already focused + // this breaks the change event in IE + if (inst === $.datepicker._curInst && $.datepicker._datepickerShowing && inst.input && + inst.input.is(":visible") && !inst.input.is(":disabled") && inst.input[0] !== document.activeElement) { + inst.input.focus(); + } + + // deffered render of the years select (to avoid flashes on Firefox) + if( inst.yearshtml ){ + origyearshtml = inst.yearshtml; + setTimeout(function(){ + //assure that inst.yearshtml didn't change. + if( origyearshtml === inst.yearshtml && inst.yearshtml ){ + inst.dpDiv.find("select.ui-datepicker-year:first").replaceWith(inst.yearshtml); + } + origyearshtml = inst.yearshtml = null; + }, 0); + } + }, + + /* Retrieve the size of left and top borders for an element. + * @param elem (jQuery object) the element of interest + * @return (number[2]) the left and top borders + */ + _getBorders: function(elem) { + var convert = function(value) { + return {thin: 1, medium: 2, thick: 3}[value] || value; + }; + return [parseFloat(convert(elem.css("border-left-width"))), + parseFloat(convert(elem.css("border-top-width")))]; + }, + + /* Check positioning to remain on screen. */ + _checkOffset: function(inst, offset, isFixed) { + var dpWidth = inst.dpDiv.outerWidth(), + dpHeight = inst.dpDiv.outerHeight(), + inputWidth = inst.input ? inst.input.outerWidth() : 0, + inputHeight = inst.input ? inst.input.outerHeight() : 0, + viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()), + viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop()); + + offset.left -= (this._get(inst, "isRTL") ? (dpWidth - inputWidth) : 0); + offset.left -= (isFixed && offset.left === inst.input.offset().left) ? $(document).scrollLeft() : 0; + offset.top -= (isFixed && offset.top === (inst.input.offset().top + inputHeight)) ? $(document).scrollTop() : 0; + + // now check if datepicker is showing outside window viewport - move to a better place if so. + offset.left -= Math.min(offset.left, (offset.left + dpWidth > viewWidth && viewWidth > dpWidth) ? + Math.abs(offset.left + dpWidth - viewWidth) : 0); + offset.top -= Math.min(offset.top, (offset.top + dpHeight > viewHeight && viewHeight > dpHeight) ? + Math.abs(dpHeight + inputHeight) : 0); + + return offset; + }, + + /* Find an object's position on the screen. */ + _findPos: function(obj) { + var position, + inst = this._getInst(obj), + isRTL = this._get(inst, "isRTL"); + + while (obj && (obj.type === "hidden" || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) { + obj = obj[isRTL ? "previousSibling" : "nextSibling"]; + } + + position = $(obj).offset(); + return [position.left, position.top]; + }, + + /* Hide the date picker from view. + * @param input element - the input field attached to the date picker + */ + _hideDatepicker: function(input) { + var showAnim, duration, postProcess, onClose, + inst = this._curInst; + + if (!inst || (input && inst !== $.data(input, PROP_NAME))) { + return; + } + + if (this._datepickerShowing) { + showAnim = this._get(inst, "showAnim"); + duration = this._get(inst, "duration"); + postProcess = function() { + $.datepicker._tidyDialog(inst); + }; + + // DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed + if ( $.effects && ( $.effects.effect[ showAnim ] || $.effects[ showAnim ] ) ) { + inst.dpDiv.hide(showAnim, $.datepicker._get(inst, "showOptions"), duration, postProcess); + } else { + inst.dpDiv[(showAnim === "slideDown" ? "slideUp" : + (showAnim === "fadeIn" ? "fadeOut" : "hide"))]((showAnim ? duration : null), postProcess); + } + + if (!showAnim) { + postProcess(); + } + this._datepickerShowing = false; + + onClose = this._get(inst, "onClose"); + if (onClose) { + onClose.apply((inst.input ? inst.input[0] : null), [(inst.input ? inst.input.val() : ""), inst]); + } + + this._lastInput = null; + if (this._inDialog) { + this._dialogInput.css({ position: "absolute", left: "0", top: "-100px" }); + if ($.blockUI) { + $.unblockUI(); + $("body").append(this.dpDiv); + } + } + this._inDialog = false; + } + }, + + /* Tidy up after a dialog display. */ + _tidyDialog: function(inst) { + inst.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar"); + }, + + /* Close date picker if clicked elsewhere. */ + _checkExternalClick: function(event) { + if (!$.datepicker._curInst) { + return; + } + + var $target = $(event.target), + inst = $.datepicker._getInst($target[0]); + + if ( ( ( $target[0].id !== $.datepicker._mainDivId && + $target.parents("#" + $.datepicker._mainDivId).length === 0 && + !$target.hasClass($.datepicker.markerClassName) && + !$target.closest("." + $.datepicker._triggerClass).length && + $.datepicker._datepickerShowing && !($.datepicker._inDialog && $.blockUI) ) ) || + ( $target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst ) ) { + $.datepicker._hideDatepicker(); + } + }, + + /* Adjust one of the date sub-fields. */ + _adjustDate: function(id, offset, period) { + var target = $(id), + inst = this._getInst(target[0]); + + if (this._isDisabledDatepicker(target[0])) { + return; + } + this._adjustInstDate(inst, offset + + (period === "M" ? this._get(inst, "showCurrentAtPos") : 0), // undo positioning + period); + this._updateDatepicker(inst); + }, + + /* Action for current link. */ + _gotoToday: function(id) { + var date, + target = $(id), + inst = this._getInst(target[0]); + + if (this._get(inst, "gotoCurrent") && inst.currentDay) { + inst.selectedDay = inst.currentDay; + inst.drawMonth = inst.selectedMonth = inst.currentMonth; + inst.drawYear = inst.selectedYear = inst.currentYear; + } else { + date = new Date(); + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + } + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a new month/year. */ + _selectMonthYear: function(id, select, period) { + var target = $(id), + inst = this._getInst(target[0]); + + inst["selected" + (period === "M" ? "Month" : "Year")] = + inst["draw" + (period === "M" ? "Month" : "Year")] = + parseInt(select.options[select.selectedIndex].value,10); + + this._notifyChange(inst); + this._adjustDate(target); + }, + + /* Action for selecting a day. */ + _selectDay: function(id, month, year, td) { + var inst, + target = $(id); + + if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) { + return; + } + + inst = this._getInst(target[0]); + inst.selectedDay = inst.currentDay = $("a", td).html(); + inst.selectedMonth = inst.currentMonth = month; + inst.selectedYear = inst.currentYear = year; + this._selectDate(id, this._formatDate(inst, + inst.currentDay, inst.currentMonth, inst.currentYear)); + }, + + /* Erase the input field and hide the date picker. */ + _clearDate: function(id) { + var target = $(id); + this._selectDate(target, ""); + }, + + /* Update the input field with the selected date. */ + _selectDate: function(id, dateStr) { + var onSelect, + target = $(id), + inst = this._getInst(target[0]); + + dateStr = (dateStr != null ? dateStr : this._formatDate(inst)); + if (inst.input) { + inst.input.val(dateStr); + } + this._updateAlternate(inst); + + onSelect = this._get(inst, "onSelect"); + if (onSelect) { + onSelect.apply((inst.input ? inst.input[0] : null), [dateStr, inst]); // trigger custom callback + } else if (inst.input) { + inst.input.trigger("change"); // fire the change event + } + + if (inst.inline){ + this._updateDatepicker(inst); + } else { + this._hideDatepicker(); + this._lastInput = inst.input[0]; + if (typeof(inst.input[0]) !== "object") { + inst.input.focus(); // restore focus + } + this._lastInput = null; + } + }, + + /* Update any alternate field to synchronise with the main field. */ + _updateAlternate: function(inst) { + var altFormat, date, dateStr, + altField = this._get(inst, "altField"); + + if (altField) { // update alternate field too + altFormat = this._get(inst, "altFormat") || this._get(inst, "dateFormat"); + date = this._getDate(inst); + dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst)); + $(altField).each(function() { $(this).val(dateStr); }); + } + }, + + /* Set as beforeShowDay function to prevent selection of weekends. + * @param date Date - the date to customise + * @return [boolean, string] - is this date selectable?, what is its CSS class? + */ + noWeekends: function(date) { + var day = date.getDay(); + return [(day > 0 && day < 6), ""]; + }, + + /* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition. + * @param date Date - the date to get the week for + * @return number - the number of the week within the year that contains this date + */ + iso8601Week: function(date) { + var time, + checkDate = new Date(date.getTime()); + + // Find Thursday of this week starting on Monday + checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7)); + + time = checkDate.getTime(); + checkDate.setMonth(0); // Compare with Jan 1 + checkDate.setDate(1); + return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1; + }, + + /* Parse a string value into a date object. + * See formatDate below for the possible formats. + * + * @param format string - the expected format of the date + * @param value string - the date in the above format + * @param settings Object - attributes include: + * shortYearCutoff number - the cutoff year for determining the century (optional) + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return Date - the extracted date value or null if value is blank + */ + parseDate: function (format, value, settings) { + if (format == null || value == null) { + throw "Invalid arguments"; + } + + value = (typeof value === "object" ? value.toString() : value + ""); + if (value === "") { + return null; + } + + var iFormat, dim, extra, + iValue = 0, + shortYearCutoffTemp = (settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff, + shortYearCutoff = (typeof shortYearCutoffTemp !== "string" ? shortYearCutoffTemp : + new Date().getFullYear() % 100 + parseInt(shortYearCutoffTemp, 10)), + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + year = -1, + month = -1, + day = -1, + doy = -1, + literal = false, + date, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Extract a number from the string value + getNumber = function(match) { + var isDoubled = lookAhead(match), + size = (match === "@" ? 14 : (match === "!" ? 20 : + (match === "y" && isDoubled ? 4 : (match === "o" ? 3 : 2)))), + digits = new RegExp("^\\d{1," + size + "}"), + num = value.substring(iValue).match(digits); + if (!num) { + throw "Missing number at position " + iValue; + } + iValue += num[0].length; + return parseInt(num[0], 10); + }, + // Extract a name from the string value and convert to an index + getName = function(match, shortNames, longNames) { + var index = -1, + names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) { + return [ [k, v] ]; + }).sort(function (a, b) { + return -(a[1].length - b[1].length); + }); + + $.each(names, function (i, pair) { + var name = pair[1]; + if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) { + index = pair[0]; + iValue += name.length; + return false; + } + }); + if (index !== -1) { + return index + 1; + } else { + throw "Unknown name at position " + iValue; + } + }, + // Confirm that a literal character matches the string value + checkLiteral = function() { + if (value.charAt(iValue) !== format.charAt(iFormat)) { + throw "Unexpected literal at position " + iValue; + } + iValue++; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + checkLiteral(); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + day = getNumber("d"); + break; + case "D": + getName("D", dayNamesShort, dayNames); + break; + case "o": + doy = getNumber("o"); + break; + case "m": + month = getNumber("m"); + break; + case "M": + month = getName("M", monthNamesShort, monthNames); + break; + case "y": + year = getNumber("y"); + break; + case "@": + date = new Date(getNumber("@")); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "!": + date = new Date((getNumber("!") - this._ticksTo1970) / 10000); + year = date.getFullYear(); + month = date.getMonth() + 1; + day = date.getDate(); + break; + case "'": + if (lookAhead("'")){ + checkLiteral(); + } else { + literal = true; + } + break; + default: + checkLiteral(); + } + } + } + + if (iValue < value.length){ + extra = value.substr(iValue); + if (!/^\s+/.test(extra)) { + throw "Extra/unparsed characters found in date: " + extra; + } + } + + if (year === -1) { + year = new Date().getFullYear(); + } else if (year < 100) { + year += new Date().getFullYear() - new Date().getFullYear() % 100 + + (year <= shortYearCutoff ? 0 : -100); + } + + if (doy > -1) { + month = 1; + day = doy; + do { + dim = this._getDaysInMonth(year, month - 1); + if (day <= dim) { + break; + } + month++; + day -= dim; + } while (true); + } + + date = this._daylightSavingAdjust(new Date(year, month - 1, day)); + if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) { + throw "Invalid date"; // E.g. 31/02/00 + } + return date; + }, + + /* Standard date formats. */ + ATOM: "yy-mm-dd", // RFC 3339 (ISO 8601) + COOKIE: "D, dd M yy", + ISO_8601: "yy-mm-dd", + RFC_822: "D, d M y", + RFC_850: "DD, dd-M-y", + RFC_1036: "D, d M y", + RFC_1123: "D, d M yy", + RFC_2822: "D, d M yy", + RSS: "D, d M y", // RFC 822 + TICKS: "!", + TIMESTAMP: "@", + W3C: "yy-mm-dd", // ISO 8601 + + _ticksTo1970: (((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + + Math.floor(1970 / 400)) * 24 * 60 * 60 * 10000000), + + /* Format a date object into a string value. + * The format can be combinations of the following: + * d - day of month (no leading zero) + * dd - day of month (two digit) + * o - day of year (no leading zeros) + * oo - day of year (three digit) + * D - day name short + * DD - day name long + * m - month of year (no leading zero) + * mm - month of year (two digit) + * M - month name short + * MM - month name long + * y - year (two digit) + * yy - year (four digit) + * @ - Unix timestamp (ms since 01/01/1970) + * ! - Windows ticks (100ns since 01/01/0001) + * "..." - literal text + * '' - single quote + * + * @param format string - the desired format of the date + * @param date Date - the date value to format + * @param settings Object - attributes include: + * dayNamesShort string[7] - abbreviated names of the days from Sunday (optional) + * dayNames string[7] - names of the days from Sunday (optional) + * monthNamesShort string[12] - abbreviated names of the months (optional) + * monthNames string[12] - names of the months (optional) + * @return string - the date in the above format + */ + formatDate: function (format, date, settings) { + if (!date) { + return ""; + } + + var iFormat, + dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort, + dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames, + monthNamesShort = (settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort, + monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }, + // Format a number, with leading zero if necessary + formatNumber = function(match, value, len) { + var num = "" + value; + if (lookAhead(match)) { + while (num.length < len) { + num = "0" + num; + } + } + return num; + }, + // Format a name, short or long as requested + formatName = function(match, value, shortNames, longNames) { + return (lookAhead(match) ? longNames[value] : shortNames[value]); + }, + output = "", + literal = false; + + if (date) { + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + output += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": + output += formatNumber("d", date.getDate(), 2); + break; + case "D": + output += formatName("D", date.getDay(), dayNamesShort, dayNames); + break; + case "o": + output += formatNumber("o", + Math.round((new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() - new Date(date.getFullYear(), 0, 0).getTime()) / 86400000), 3); + break; + case "m": + output += formatNumber("m", date.getMonth() + 1, 2); + break; + case "M": + output += formatName("M", date.getMonth(), monthNamesShort, monthNames); + break; + case "y": + output += (lookAhead("y") ? date.getFullYear() : + (date.getYear() % 100 < 10 ? "0" : "") + date.getYear() % 100); + break; + case "@": + output += date.getTime(); + break; + case "!": + output += date.getTime() * 10000 + this._ticksTo1970; + break; + case "'": + if (lookAhead("'")) { + output += "'"; + } else { + literal = true; + } + break; + default: + output += format.charAt(iFormat); + } + } + } + } + return output; + }, + + /* Extract all possible characters from the date format. */ + _possibleChars: function (format) { + var iFormat, + chars = "", + literal = false, + // Check whether a format character is doubled + lookAhead = function(match) { + var matches = (iFormat + 1 < format.length && format.charAt(iFormat + 1) === match); + if (matches) { + iFormat++; + } + return matches; + }; + + for (iFormat = 0; iFormat < format.length; iFormat++) { + if (literal) { + if (format.charAt(iFormat) === "'" && !lookAhead("'")) { + literal = false; + } else { + chars += format.charAt(iFormat); + } + } else { + switch (format.charAt(iFormat)) { + case "d": case "m": case "y": case "@": + chars += "0123456789"; + break; + case "D": case "M": + return null; // Accept anything + case "'": + if (lookAhead("'")) { + chars += "'"; + } else { + literal = true; + } + break; + default: + chars += format.charAt(iFormat); + } + } + } + return chars; + }, + + /* Get a setting value, defaulting if necessary. */ + _get: function(inst, name) { + return inst.settings[name] !== undefined ? + inst.settings[name] : this._defaults[name]; + }, + + /* Parse existing date and initialise date picker. */ + _setDateFromField: function(inst, noDefault) { + if (inst.input.val() === inst.lastVal) { + return; + } + + var dateFormat = this._get(inst, "dateFormat"), + dates = inst.lastVal = inst.input ? inst.input.val() : null, + defaultDate = this._getDefaultDate(inst), + date = defaultDate, + settings = this._getFormatConfig(inst); + + try { + date = this.parseDate(dateFormat, dates, settings) || defaultDate; + } catch (event) { + dates = (noDefault ? "" : dates); + } + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + inst.currentDay = (dates ? date.getDate() : 0); + inst.currentMonth = (dates ? date.getMonth() : 0); + inst.currentYear = (dates ? date.getFullYear() : 0); + this._adjustInstDate(inst); + }, + + /* Retrieve the default date shown on opening. */ + _getDefaultDate: function(inst) { + return this._restrictMinMax(inst, + this._determineDate(inst, this._get(inst, "defaultDate"), new Date())); + }, + + /* A date may be specified as an exact value or a relative one. */ + _determineDate: function(inst, date, defaultDate) { + var offsetNumeric = function(offset) { + var date = new Date(); + date.setDate(date.getDate() + offset); + return date; + }, + offsetString = function(offset) { + try { + return $.datepicker.parseDate($.datepicker._get(inst, "dateFormat"), + offset, $.datepicker._getFormatConfig(inst)); + } + catch (e) { + // Ignore + } + + var date = (offset.toLowerCase().match(/^c/) ? + $.datepicker._getDate(inst) : null) || new Date(), + year = date.getFullYear(), + month = date.getMonth(), + day = date.getDate(), + pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g, + matches = pattern.exec(offset); + + while (matches) { + switch (matches[2] || "d") { + case "d" : case "D" : + day += parseInt(matches[1],10); break; + case "w" : case "W" : + day += parseInt(matches[1],10) * 7; break; + case "m" : case "M" : + month += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + case "y": case "Y" : + year += parseInt(matches[1],10); + day = Math.min(day, $.datepicker._getDaysInMonth(year, month)); + break; + } + matches = pattern.exec(offset); + } + return new Date(year, month, day); + }, + newDate = (date == null || date === "" ? defaultDate : (typeof date === "string" ? offsetString(date) : + (typeof date === "number" ? (isNaN(date) ? defaultDate : offsetNumeric(date)) : new Date(date.getTime())))); + + newDate = (newDate && newDate.toString() === "Invalid Date" ? defaultDate : newDate); + if (newDate) { + newDate.setHours(0); + newDate.setMinutes(0); + newDate.setSeconds(0); + newDate.setMilliseconds(0); + } + return this._daylightSavingAdjust(newDate); + }, + + /* Handle switch to/from daylight saving. + * Hours may be non-zero on daylight saving cut-over: + * > 12 when midnight changeover, but then cannot generate + * midnight datetime, so jump to 1AM, otherwise reset. + * @param date (Date) the date to check + * @return (Date) the corrected date + */ + _daylightSavingAdjust: function(date) { + if (!date) { + return null; + } + date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0); + return date; + }, + + /* Set the date(s) directly. */ + _setDate: function(inst, date, noChange) { + var clear = !date, + origMonth = inst.selectedMonth, + origYear = inst.selectedYear, + newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date())); + + inst.selectedDay = inst.currentDay = newDate.getDate(); + inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth(); + inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear(); + if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) { + this._notifyChange(inst); + } + this._adjustInstDate(inst); + if (inst.input) { + inst.input.val(clear ? "" : this._formatDate(inst)); + } + }, + + /* Retrieve the date(s) directly. */ + _getDate: function(inst) { + var startDate = (!inst.currentYear || (inst.input && inst.input.val() === "") ? null : + this._daylightSavingAdjust(new Date( + inst.currentYear, inst.currentMonth, inst.currentDay))); + return startDate; + }, + + /* Attach the onxxx handlers. These are declared statically so + * they work with static code transformers like Caja. + */ + _attachHandlers: function(inst) { + var stepMonths = this._get(inst, "stepMonths"), + id = "#" + inst.id.replace( /\\\\/g, "\\" ); + inst.dpDiv.find("[data-handler]").map(function () { + var handler = { + prev: function () { + window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, -stepMonths, "M"); + }, + next: function () { + window["DP_jQuery_" + dpuuid].datepicker._adjustDate(id, +stepMonths, "M"); + }, + hide: function () { + window["DP_jQuery_" + dpuuid].datepicker._hideDatepicker(); + }, + today: function () { + window["DP_jQuery_" + dpuuid].datepicker._gotoToday(id); + }, + selectDay: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectDay(id, +this.getAttribute("data-month"), +this.getAttribute("data-year"), this); + return false; + }, + selectMonth: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "M"); + return false; + }, + selectYear: function () { + window["DP_jQuery_" + dpuuid].datepicker._selectMonthYear(id, this, "Y"); + return false; + } + }; + $(this).bind(this.getAttribute("data-event"), handler[this.getAttribute("data-handler")]); + }); + }, + + /* Generate the HTML for the current state of the date picker. */ + _generateHTML: function(inst) { + var maxDraw, prevText, prev, nextText, next, currentText, gotoDate, + controls, buttonPanel, firstDay, showWeek, dayNames, dayNamesMin, + monthNames, monthNamesShort, beforeShowDay, showOtherMonths, + selectOtherMonths, defaultDate, html, dow, row, group, col, selectedDate, + cornerClass, calender, thead, day, daysInMonth, leadDays, curRows, numRows, + printDate, dRow, tbody, daySettings, otherMonth, unselectable, + tempDate = new Date(), + today = this._daylightSavingAdjust( + new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())), // clear time + isRTL = this._get(inst, "isRTL"), + showButtonPanel = this._get(inst, "showButtonPanel"), + hideIfNoPrevNext = this._get(inst, "hideIfNoPrevNext"), + navigationAsDateFormat = this._get(inst, "navigationAsDateFormat"), + numMonths = this._getNumberOfMonths(inst), + showCurrentAtPos = this._get(inst, "showCurrentAtPos"), + stepMonths = this._get(inst, "stepMonths"), + isMultiMonth = (numMonths[0] !== 1 || numMonths[1] !== 1), + currentDate = this._daylightSavingAdjust((!inst.currentDay ? new Date(9999, 9, 9) : + new Date(inst.currentYear, inst.currentMonth, inst.currentDay))), + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + drawMonth = inst.drawMonth - showCurrentAtPos, + drawYear = inst.drawYear; + + if (drawMonth < 0) { + drawMonth += 12; + drawYear--; + } + if (maxDate) { + maxDraw = this._daylightSavingAdjust(new Date(maxDate.getFullYear(), + maxDate.getMonth() - (numMonths[0] * numMonths[1]) + 1, maxDate.getDate())); + maxDraw = (minDate && maxDraw < minDate ? minDate : maxDraw); + while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) { + drawMonth--; + if (drawMonth < 0) { + drawMonth = 11; + drawYear--; + } + } + } + inst.drawMonth = drawMonth; + inst.drawYear = drawYear; + + prevText = this._get(inst, "prevText"); + prevText = (!navigationAsDateFormat ? prevText : this.formatDate(prevText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)), + this._getFormatConfig(inst))); + + prev = (this._canAdjustMonth(inst, -1, drawYear, drawMonth) ? + "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" + + " title='" + prevText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>" : + (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='"+ prevText +"'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "e" : "w") + "'>" + prevText + "</span></a>")); + + nextText = this._get(inst, "nextText"); + nextText = (!navigationAsDateFormat ? nextText : this.formatDate(nextText, + this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)), + this._getFormatConfig(inst))); + + next = (this._canAdjustMonth(inst, +1, drawYear, drawMonth) ? + "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" + + " title='" + nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>" : + (hideIfNoPrevNext ? "" : "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='"+ nextText + "'><span class='ui-icon ui-icon-circle-triangle-" + ( isRTL ? "w" : "e") + "'>" + nextText + "</span></a>")); + + currentText = this._get(inst, "currentText"); + gotoDate = (this._get(inst, "gotoCurrent") && inst.currentDay ? currentDate : today); + currentText = (!navigationAsDateFormat ? currentText : + this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))); + + controls = (!inst.inline ? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" + + this._get(inst, "closeText") + "</button>" : ""); + + buttonPanel = (showButtonPanel) ? "<div class='ui-datepicker-buttonpane ui-widget-content'>" + (isRTL ? controls : "") + + (this._isInRange(inst, gotoDate) ? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" + + ">" + currentText + "</button>" : "") + (isRTL ? "" : controls) + "</div>" : ""; + + firstDay = parseInt(this._get(inst, "firstDay"),10); + firstDay = (isNaN(firstDay) ? 0 : firstDay); + + showWeek = this._get(inst, "showWeek"); + dayNames = this._get(inst, "dayNames"); + dayNamesMin = this._get(inst, "dayNamesMin"); + monthNames = this._get(inst, "monthNames"); + monthNamesShort = this._get(inst, "monthNamesShort"); + beforeShowDay = this._get(inst, "beforeShowDay"); + showOtherMonths = this._get(inst, "showOtherMonths"); + selectOtherMonths = this._get(inst, "selectOtherMonths"); + defaultDate = this._getDefaultDate(inst); + html = ""; + dow; + for (row = 0; row < numMonths[0]; row++) { + group = ""; + this.maxRows = 4; + for (col = 0; col < numMonths[1]; col++) { + selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay)); + cornerClass = " ui-corner-all"; + calender = ""; + if (isMultiMonth) { + calender += "<div class='ui-datepicker-group"; + if (numMonths[1] > 1) { + switch (col) { + case 0: calender += " ui-datepicker-group-first"; + cornerClass = " ui-corner-" + (isRTL ? "right" : "left"); break; + case numMonths[1]-1: calender += " ui-datepicker-group-last"; + cornerClass = " ui-corner-" + (isRTL ? "left" : "right"); break; + default: calender += " ui-datepicker-group-middle"; cornerClass = ""; break; + } + } + calender += "'>"; + } + calender += "<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" + cornerClass + "'>" + + (/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : "") + + (/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : "") + + this._generateMonthYearHeader(inst, drawMonth, drawYear, minDate, maxDate, + row > 0 || col > 0, monthNames, monthNamesShort) + // draw month headers + "</div><table class='ui-datepicker-calendar'><thead>" + + "<tr>"; + thead = (showWeek ? "<th class='ui-datepicker-week-col'>" + this._get(inst, "weekHeader") + "</th>" : ""); + for (dow = 0; dow < 7; dow++) { // days of the week + day = (dow + firstDay) % 7; + thead += "<th" + ((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : "") + ">" + + "<span title='" + dayNames[day] + "'>" + dayNamesMin[day] + "</span></th>"; + } + calender += thead + "</tr></thead><tbody>"; + daysInMonth = this._getDaysInMonth(drawYear, drawMonth); + if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) { + inst.selectedDay = Math.min(inst.selectedDay, daysInMonth); + } + leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7; + curRows = Math.ceil((leadDays + daysInMonth) / 7); // calculate the number of rows to generate + numRows = (isMultiMonth ? this.maxRows > curRows ? this.maxRows : curRows : curRows); //If multiple months, use the higher number of rows (see #7043) + this.maxRows = numRows; + printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays)); + for (dRow = 0; dRow < numRows; dRow++) { // create date picker rows + calender += "<tr>"; + tbody = (!showWeek ? "" : "<td class='ui-datepicker-week-col'>" + + this._get(inst, "calculateWeek")(printDate) + "</td>"); + for (dow = 0; dow < 7; dow++) { // create date picker days + daySettings = (beforeShowDay ? + beforeShowDay.apply((inst.input ? inst.input[0] : null), [printDate]) : [true, ""]); + otherMonth = (printDate.getMonth() !== drawMonth); + unselectable = (otherMonth && !selectOtherMonths) || !daySettings[0] || + (minDate && printDate < minDate) || (maxDate && printDate > maxDate); + tbody += "<td class='" + + ((dow + firstDay + 6) % 7 >= 5 ? " ui-datepicker-week-end" : "") + // highlight weekends + (otherMonth ? " ui-datepicker-other-month" : "") + // highlight days from other months + ((printDate.getTime() === selectedDate.getTime() && drawMonth === inst.selectedMonth && inst._keyEvent) || // user pressed key + (defaultDate.getTime() === printDate.getTime() && defaultDate.getTime() === selectedDate.getTime()) ? + // or defaultDate is current printedDate and defaultDate is selectedDate + " " + this._dayOverClass : "") + // highlight selected day + (unselectable ? " " + this._unselectableClass + " ui-state-disabled": "") + // highlight unselectable days + (otherMonth && !showOtherMonths ? "" : " " + daySettings[1] + // highlight custom dates + (printDate.getTime() === currentDate.getTime() ? " " + this._currentClass : "") + // highlight selected day + (printDate.getTime() === today.getTime() ? " ui-datepicker-today" : "")) + "'" + // highlight today (if different) + ((!otherMonth || showOtherMonths) && daySettings[2] ? " title='" + daySettings[2] + "'" : "") + // cell title + (unselectable ? "" : " data-handler='selectDay' data-event='click' data-month='" + printDate.getMonth() + "' data-year='" + printDate.getFullYear() + "'") + ">" + // actions + (otherMonth && !showOtherMonths ? " " : // display for other months + (unselectable ? "<span class='ui-state-default'>" + printDate.getDate() + "</span>" : "<a class='ui-state-default" + + (printDate.getTime() === today.getTime() ? " ui-state-highlight" : "") + + (printDate.getTime() === currentDate.getTime() ? " ui-state-active" : "") + // highlight selected day + (otherMonth ? " ui-priority-secondary" : "") + // distinguish dates from other months + "' href='#'>" + printDate.getDate() + "</a>")) + "</td>"; // display selectable date + printDate.setDate(printDate.getDate() + 1); + printDate = this._daylightSavingAdjust(printDate); + } + calender += tbody + "</tr>"; + } + drawMonth++; + if (drawMonth > 11) { + drawMonth = 0; + drawYear++; + } + calender += "</tbody></table>" + (isMultiMonth ? "</div>" + + ((numMonths[0] > 0 && col === numMonths[1]-1) ? "<div class='ui-datepicker-row-break'></div>" : "") : ""); + group += calender; + } + html += group; + } + html += buttonPanel; + inst._keyEvent = false; + return html; + }, + + /* Generate the month and year header. */ + _generateMonthYearHeader: function(inst, drawMonth, drawYear, minDate, maxDate, + secondary, monthNames, monthNamesShort) { + + var inMinYear, inMaxYear, month, years, thisYear, determineYear, year, endYear, + changeMonth = this._get(inst, "changeMonth"), + changeYear = this._get(inst, "changeYear"), + showMonthAfterYear = this._get(inst, "showMonthAfterYear"), + html = "<div class='ui-datepicker-title'>", + monthHtml = ""; + + // month selection + if (secondary || !changeMonth) { + monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + "</span>"; + } else { + inMinYear = (minDate && minDate.getFullYear() === drawYear); + inMaxYear = (maxDate && maxDate.getFullYear() === drawYear); + monthHtml += "<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>"; + for ( month = 0; month < 12; month++) { + if ((!inMinYear || month >= minDate.getMonth()) && (!inMaxYear || month <= maxDate.getMonth())) { + monthHtml += "<option value='" + month + "'" + + (month === drawMonth ? " selected='selected'" : "") + + ">" + monthNamesShort[month] + "</option>"; + } + } + monthHtml += "</select>"; + } + + if (!showMonthAfterYear) { + html += monthHtml + (secondary || !(changeMonth && changeYear) ? " " : ""); + } + + // year selection + if ( !inst.yearshtml ) { + inst.yearshtml = ""; + if (secondary || !changeYear) { + html += "<span class='ui-datepicker-year'>" + drawYear + "</span>"; + } else { + // determine range of years to display + years = this._get(inst, "yearRange").split(":"); + thisYear = new Date().getFullYear(); + determineYear = function(value) { + var year = (value.match(/c[+\-].*/) ? drawYear + parseInt(value.substring(1), 10) : + (value.match(/[+\-].*/) ? thisYear + parseInt(value, 10) : + parseInt(value, 10))); + return (isNaN(year) ? thisYear : year); + }; + year = determineYear(years[0]); + endYear = Math.max(year, determineYear(years[1] || "")); + year = (minDate ? Math.max(year, minDate.getFullYear()) : year); + endYear = (maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear); + inst.yearshtml += "<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>"; + for (; year <= endYear; year++) { + inst.yearshtml += "<option value='" + year + "'" + + (year === drawYear ? " selected='selected'" : "") + + ">" + year + "</option>"; + } + inst.yearshtml += "</select>"; + + html += inst.yearshtml; + inst.yearshtml = null; + } + } + + html += this._get(inst, "yearSuffix"); + if (showMonthAfterYear) { + html += (secondary || !(changeMonth && changeYear) ? " " : "") + monthHtml; + } + html += "</div>"; // Close datepicker_header + return html; + }, + + /* Adjust one of the date sub-fields. */ + _adjustInstDate: function(inst, offset, period) { + var year = inst.drawYear + (period === "Y" ? offset : 0), + month = inst.drawMonth + (period === "M" ? offset : 0), + day = Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) + (period === "D" ? offset : 0), + date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day))); + + inst.selectedDay = date.getDate(); + inst.drawMonth = inst.selectedMonth = date.getMonth(); + inst.drawYear = inst.selectedYear = date.getFullYear(); + if (period === "M" || period === "Y") { + this._notifyChange(inst); + } + }, + + /* Ensure a date is within any min/max bounds. */ + _restrictMinMax: function(inst, date) { + var minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + newDate = (minDate && date < minDate ? minDate : date); + return (maxDate && newDate > maxDate ? maxDate : newDate); + }, + + /* Notify change of month/year. */ + _notifyChange: function(inst) { + var onChange = this._get(inst, "onChangeMonthYear"); + if (onChange) { + onChange.apply((inst.input ? inst.input[0] : null), + [inst.selectedYear, inst.selectedMonth + 1, inst]); + } + }, + + /* Determine the number of months to show. */ + _getNumberOfMonths: function(inst) { + var numMonths = this._get(inst, "numberOfMonths"); + return (numMonths == null ? [1, 1] : (typeof numMonths === "number" ? [1, numMonths] : numMonths)); + }, + + /* Determine the current maximum date - ensure no time components are set. */ + _getMinMaxDate: function(inst, minMax) { + return this._determineDate(inst, this._get(inst, minMax + "Date"), null); + }, + + /* Find the number of days in a given month. */ + _getDaysInMonth: function(year, month) { + return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate(); + }, + + /* Find the day of the week of the first of a month. */ + _getFirstDayOfMonth: function(year, month) { + return new Date(year, month, 1).getDay(); + }, + + /* Determines if we should allow a "next/prev" month display change. */ + _canAdjustMonth: function(inst, offset, curYear, curMonth) { + var numMonths = this._getNumberOfMonths(inst), + date = this._daylightSavingAdjust(new Date(curYear, + curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)); + + if (offset < 0) { + date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth())); + } + return this._isInRange(inst, date); + }, + + /* Is the given date in the accepted range? */ + _isInRange: function(inst, date) { + var yearSplit, currentYear, + minDate = this._getMinMaxDate(inst, "min"), + maxDate = this._getMinMaxDate(inst, "max"), + minYear = null, + maxYear = null, + years = this._get(inst, "yearRange"); + if (years){ + yearSplit = years.split(":"); + currentYear = new Date().getFullYear(); + minYear = parseInt(yearSplit[0], 10) + currentYear; + maxYear = parseInt(yearSplit[1], 10) + currentYear; + } + + return ((!minDate || date.getTime() >= minDate.getTime()) && + (!maxDate || date.getTime() <= maxDate.getTime()) && + (!minYear || date.getFullYear() >= minYear) && + (!maxYear || date.getFullYear() <= maxYear)); + }, + + /* Provide the configuration settings for formatting/parsing. */ + _getFormatConfig: function(inst) { + var shortYearCutoff = this._get(inst, "shortYearCutoff"); + shortYearCutoff = (typeof shortYearCutoff !== "string" ? shortYearCutoff : + new Date().getFullYear() % 100 + parseInt(shortYearCutoff, 10)); + return {shortYearCutoff: shortYearCutoff, + dayNamesShort: this._get(inst, "dayNamesShort"), dayNames: this._get(inst, "dayNames"), + monthNamesShort: this._get(inst, "monthNamesShort"), monthNames: this._get(inst, "monthNames")}; + }, + + /* Format the given date for display. */ + _formatDate: function(inst, day, month, year) { + if (!day) { + inst.currentDay = inst.selectedDay; + inst.currentMonth = inst.selectedMonth; + inst.currentYear = inst.selectedYear; + } + var date = (day ? (typeof day === "object" ? day : + this._daylightSavingAdjust(new Date(year, month, day))) : + this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))); + return this.formatDate(this._get(inst, "dateFormat"), date, this._getFormatConfig(inst)); + } +}); + +/* + * Bind hover events for datepicker elements. + * Done via delegate so the binding only occurs once in the lifetime of the parent div. + * Global instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker. + */ +function bindHover(dpDiv) { + var selector = "button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a"; + return dpDiv.delegate(selector, "mouseout", function() { + $(this).removeClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).removeClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).removeClass("ui-datepicker-next-hover"); + } + }) + .delegate(selector, "mouseover", function(){ + if (!$.datepicker._isDisabledDatepicker( instActive.inline ? dpDiv.parent()[0] : instActive.input[0])) { + $(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); + $(this).addClass("ui-state-hover"); + if (this.className.indexOf("ui-datepicker-prev") !== -1) { + $(this).addClass("ui-datepicker-prev-hover"); + } + if (this.className.indexOf("ui-datepicker-next") !== -1) { + $(this).addClass("ui-datepicker-next-hover"); + } + } + }); +} + +/* jQuery extend now ignores nulls! */ +function extendRemove(target, props) { + $.extend(target, props); + for (var name in props) { + if (props[name] == null) { + target[name] = props[name]; + } + } + return target; +} + +/* Invoke the datepicker functionality. + @param options string - a command, optionally followed by additional parameters or + Object - settings for attaching new datepicker functionality + @return jQuery object */ +$.fn.datepicker = function(options){ + + /* Verify an empty collection wasn't passed - Fixes #6976 */ + if ( !this.length ) { + return this; + } + + /* Initialise the date picker. */ + if (!$.datepicker.initialized) { + $(document).mousedown($.datepicker._checkExternalClick); + $.datepicker.initialized = true; + } + + /* Append datepicker main container to body if not exist. */ + if ($("#"+$.datepicker._mainDivId).length === 0) { + $("body").append($.datepicker.dpDiv); + } + + var otherArgs = Array.prototype.slice.call(arguments, 1); + if (typeof options === "string" && (options === "isDisabled" || options === "getDate" || options === "widget")) { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + if (options === "option" && arguments.length === 2 && typeof arguments[1] === "string") { + return $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this[0]].concat(otherArgs)); + } + return this.each(function() { + typeof options === "string" ? + $.datepicker["_" + options + "Datepicker"]. + apply($.datepicker, [this].concat(otherArgs)) : + $.datepicker._attachDatepicker(this, options); + }); +}; + +$.datepicker = new Datepicker(); // singleton instance +$.datepicker.initialized = false; +$.datepicker.uuid = new Date().getTime(); +$.datepicker.version = "1.10.0"; + +// Workaround for #4055 +// Add another global to avoid noConflict issues with inline event handlers +window["DP_jQuery_" + dpuuid] = $; + +})(jQuery); +(function( $, undefined ) { + +var sizeRelatedOptions = { + buttons: true, + height: true, + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true, + width: true + }, + resizableRelatedOptions = { + maxHeight: true, + maxWidth: true, + minHeight: true, + minWidth: true + }; + +$.widget( "ui.dialog", { + version: "1.10.0", + options: { + appendTo: "body", + autoOpen: true, + buttons: [], + closeOnEscape: true, + closeText: "close", + dialogClass: "", + draggable: true, + hide: null, + height: "auto", + maxHeight: null, + maxWidth: null, + minHeight: 150, + minWidth: 150, + modal: false, + position: { + my: "center", + at: "center", + of: window, + collision: "fit", + // Ensure the titlebar is always visible + using: function( pos ) { + var topOffset = $( this ).css( pos ).offset().top; + if ( topOffset < 0 ) { + $( this ).css( "top", pos.top - topOffset ); + } + } + }, + resizable: true, + show: null, + title: null, + width: 300, + + // callbacks + beforeClose: null, + close: null, + drag: null, + dragStart: null, + dragStop: null, + focus: null, + open: null, + resize: null, + resizeStart: null, + resizeStop: null + }, + + _create: function() { + this.originalCss = { + display: this.element[0].style.display, + width: this.element[0].style.width, + minHeight: this.element[0].style.minHeight, + maxHeight: this.element[0].style.maxHeight, + height: this.element[0].style.height + }; + this.originalPosition = { + parent: this.element.parent(), + index: this.element.parent().children().index( this.element ) + }; + this.originalTitle = this.element.attr("title"); + this.options.title = this.options.title || this.originalTitle; + + this._createWrapper(); + + this.element + .show() + .removeAttr("title") + .addClass("ui-dialog-content ui-widget-content") + .appendTo( this.uiDialog ); + + this._createTitlebar(); + this._createButtonPane(); + + if ( this.options.draggable && $.fn.draggable ) { + this._makeDraggable(); + } + if ( this.options.resizable && $.fn.resizable ) { + this._makeResizable(); + } + + this._isOpen = false; + }, + + _init: function() { + if ( this.options.autoOpen ) { + this.open(); + } + }, + + _appendTo: function() { + var element = this.options.appendTo; + if ( element && (element.jquery || element.nodeType) ) { + return $( element ); + } + return this.document.find( element || "body" ).eq( 0 ); + }, + + _destroy: function() { + var next, + originalPosition = this.originalPosition; + + this._destroyOverlay(); + + this.element + .removeUniqueId() + .removeClass("ui-dialog-content ui-widget-content") + .css( this.originalCss ) + // Without detaching first, the following becomes really slow + .detach(); + + this.uiDialog.stop( true, true ).remove(); + + if ( this.originalTitle ) { + this.element.attr( "title", this.originalTitle ); + } + + next = originalPosition.parent.children().eq( originalPosition.index ); + // Don't try to place the dialog next to itself (#8613) + if ( next.length && next[0] !== this.element[0] ) { + next.before( this.element ); + } else { + originalPosition.parent.append( this.element ); + } + }, + + widget: function() { + return this.uiDialog; + }, + + disable: $.noop, + enable: $.noop, + + close: function( event ) { + var that = this; + + if ( !this._isOpen || this._trigger( "beforeClose", event ) === false ) { + return; + } + + this._isOpen = false; + this._destroyOverlay(); + + if ( !this.opener.filter(":focusable").focus().length ) { + // Hiding a focused element doesn't trigger blur in WebKit + // so in case we have nothing to focus on, explicitly blur the active element + // https://bugs.webkit.org/show_bug.cgi?id=47182 + $( this.document[0].activeElement ).blur(); + } + + this._hide( this.uiDialog, this.options.hide, function() { + that._trigger( "close", event ); + }); + }, + + isOpen: function() { + return this._isOpen; + }, + + moveToTop: function() { + this._moveToTop(); + }, + + _moveToTop: function( event, silent ) { + var moved = !!this.uiDialog.nextAll(":visible").insertBefore( this.uiDialog ).length; + if ( moved && !silent ) { + this._trigger( "focus", event ); + } + return moved; + }, + + open: function() { + if ( this._isOpen ) { + if ( this._moveToTop() ) { + this._focusTabbable(); + } + return; + } + + this.opener = $( this.document[0].activeElement ); + + this._size(); + this._position(); + this._createOverlay(); + this._moveToTop( null, true ); + this._show( this.uiDialog, this.options.show ); + + this._focusTabbable(); + + this._isOpen = true; + this._trigger("open"); + this._trigger("focus"); + }, + + _focusTabbable: function() { + // Set focus to the first match: + // 1. First element inside the dialog matching [autofocus] + // 2. Tabbable element inside the content element + // 3. Tabbable element inside the buttonpane + // 4. The close button + // 5. The dialog itself + var hasFocus = this.element.find("[autofocus]"); + if ( !hasFocus.length ) { + hasFocus = this.element.find(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogButtonPane.find(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialogTitlebarClose.filter(":tabbable"); + } + if ( !hasFocus.length ) { + hasFocus = this.uiDialog; + } + hasFocus.eq( 0 ).focus(); + }, + + _keepFocus: function( event ) { + function checkFocus() { + var activeElement = this.document[0].activeElement, + isActive = this.uiDialog[0] === activeElement || + $.contains( this.uiDialog[0], activeElement ); + if ( !isActive ) { + this._focusTabbable(); + } + } + event.preventDefault(); + checkFocus.call( this ); + // support: IE + // IE <= 8 doesn't prevent moving focus even with event.preventDefault() + // so we check again later + this._delay( checkFocus ); + }, + + _createWrapper: function() { + this.uiDialog = $("<div>") + .addClass( "ui-dialog ui-widget ui-widget-content ui-corner-all ui-front " + + this.options.dialogClass ) + .hide() + .attr({ + // Setting tabIndex makes the div focusable + tabIndex: -1, + role: "dialog" + }) + .appendTo( this._appendTo() ); + + this._on( this.uiDialog, { + keydown: function( event ) { + if ( this.options.closeOnEscape && !event.isDefaultPrevented() && event.keyCode && + event.keyCode === $.ui.keyCode.ESCAPE ) { + event.preventDefault(); + this.close( event ); + return; + } + + // prevent tabbing out of dialogs + if ( event.keyCode !== $.ui.keyCode.TAB ) { + return; + } + var tabbables = this.uiDialog.find(":tabbable"), + first = tabbables.filter(":first"), + last = tabbables.filter(":last"); + + if ( ( event.target === last[0] || event.target === this.uiDialog[0] ) && !event.shiftKey ) { + first.focus( 1 ); + event.preventDefault(); + } else if ( ( event.target === first[0] || event.target === this.uiDialog[0] ) && event.shiftKey ) { + last.focus( 1 ); + event.preventDefault(); + } + }, + mousedown: function( event ) { + if ( this._moveToTop( event ) ) { + this._focusTabbable(); + } + } + }); + + // We assume that any existing aria-describedby attribute means + // that the dialog content is marked up properly + // otherwise we brute force the content as the description + if ( !this.element.find("[aria-describedby]").length ) { + this.uiDialog.attr({ + "aria-describedby": this.element.uniqueId().attr("id") + }); + } + }, + + _createTitlebar: function() { + var uiDialogTitle; + + this.uiDialogTitlebar = $("<div>") + .addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix") + .prependTo( this.uiDialog ); + this._on( this.uiDialogTitlebar, { + mousedown: function( event ) { + // Don't prevent click on close button (#8838) + // Focusing a dialog that is partially scrolled out of view + // causes the browser to scroll it into view, preventing the click event + if ( !$( event.target ).closest(".ui-dialog-titlebar-close") ) { + // Dialog isn't getting focus when dragging (#8063) + this.uiDialog.focus(); + } + } + }); + + this.uiDialogTitlebarClose = $("<button></button>") + .button({ + label: this.options.closeText, + icons: { + primary: "ui-icon-closethick" + }, + text: false + }) + .addClass("ui-dialog-titlebar-close") + .appendTo( this.uiDialogTitlebar ); + this._on( this.uiDialogTitlebarClose, { + click: function( event ) { + event.preventDefault(); + this.close( event ); + } + }); + + uiDialogTitle = $("<span>") + .uniqueId() + .addClass("ui-dialog-title") + .prependTo( this.uiDialogTitlebar ); + this._title( uiDialogTitle ); + + this.uiDialog.attr({ + "aria-labelledby": uiDialogTitle.attr("id") + }); + }, + + _title: function( title ) { + if ( !this.options.title ) { + title.html(" "); + } + title.text( this.options.title ); + }, + + _createButtonPane: function() { + this.uiDialogButtonPane = $("<div>") + .addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"); + + this.uiButtonSet = $("<div>") + .addClass("ui-dialog-buttonset") + .appendTo( this.uiDialogButtonPane ); + + this._createButtons(); + }, + + _createButtons: function() { + var that = this, + buttons = this.options.buttons; + + // if we already have a button pane, remove it + this.uiDialogButtonPane.remove(); + this.uiButtonSet.empty(); + + if ( $.isEmptyObject( buttons ) ) { + this.uiDialog.removeClass("ui-dialog-buttons"); + return; + } + + $.each( buttons, function( name, props ) { + var click, buttonOptions; + props = $.isFunction( props ) ? + { click: props, text: name } : + props; + // Default to a non-submitting button + props = $.extend( { type: "button" }, props ); + // Change the context for the click callback to be the main element + click = props.click; + props.click = function() { + click.apply( that.element[0], arguments ); + }; + buttonOptions = { + icons: props.icons, + text: props.showText + }; + delete props.icons; + delete props.showText; + $( "<button></button>", props ) + .button( buttonOptions ) + .appendTo( that.uiButtonSet ); + }); + this.uiDialog.addClass("ui-dialog-buttons"); + this.uiDialogButtonPane.appendTo( this.uiDialog ); + }, + + _makeDraggable: function() { + var that = this, + options = this.options; + + function filteredUi( ui ) { + return { + position: ui.position, + offset: ui.offset + }; + } + + this.uiDialog.draggable({ + cancel: ".ui-dialog-content, .ui-dialog-titlebar-close", + handle: ".ui-dialog-titlebar", + containment: "document", + start: function( event, ui ) { + $( this ).addClass("ui-dialog-dragging"); + that._trigger( "dragStart", event, filteredUi( ui ) ); + }, + drag: function( event, ui ) { + that._trigger( "drag", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.position = [ + ui.position.left - that.document.scrollLeft(), + ui.position.top - that.document.scrollTop() + ]; + $( this ).removeClass("ui-dialog-dragging"); + that._trigger( "dragStop", event, filteredUi( ui ) ); + } + }); + }, + + _makeResizable: function() { + var that = this, + options = this.options, + handles = options.resizable, + // .ui-resizable has position: relative defined in the stylesheet + // but dialogs have to use absolute or fixed positioning + position = this.uiDialog.css("position"), + resizeHandles = typeof handles === "string" ? + handles : + "n,e,s,w,se,sw,ne,nw"; + + function filteredUi( ui ) { + return { + originalPosition: ui.originalPosition, + originalSize: ui.originalSize, + position: ui.position, + size: ui.size + }; + } + + this.uiDialog.resizable({ + cancel: ".ui-dialog-content", + containment: "document", + alsoResize: this.element, + maxWidth: options.maxWidth, + maxHeight: options.maxHeight, + minWidth: options.minWidth, + minHeight: this._minHeight(), + handles: resizeHandles, + start: function( event, ui ) { + $( this ).addClass("ui-dialog-resizing"); + that._trigger( "resizeStart", event, filteredUi( ui ) ); + }, + resize: function( event, ui ) { + that._trigger( "resize", event, filteredUi( ui ) ); + }, + stop: function( event, ui ) { + options.height = $( this ).height(); + options.width = $( this ).width(); + $( this ).removeClass("ui-dialog-resizing"); + that._trigger( "resizeStop", event, filteredUi( ui ) ); + } + }) + .css( "position", position ); + }, + + _minHeight: function() { + var options = this.options; + + return options.height === "auto" ? + options.minHeight : + Math.min( options.minHeight, options.height ); + }, + + _position: function() { + // Need to show the dialog to get the actual offset in the position plugin + var isVisible = this.uiDialog.is(":visible"); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( this.options.position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + }, + + _setOptions: function( options ) { + var that = this, + resize = false, + resizableOptions = {}; + + $.each( options, function( key, value ) { + that._setOption( key, value ); + + if ( key in sizeRelatedOptions ) { + resize = true; + } + if ( key in resizableRelatedOptions ) { + resizableOptions[ key ] = value; + } + }); + + if ( resize ) { + this._size(); + this._position(); + } + if ( this.uiDialog.is(":data(ui-resizable)") ) { + this.uiDialog.resizable( "option", resizableOptions ); + } + }, + + _setOption: function( key, value ) { + /*jshint maxcomplexity:15*/ + var isDraggable, isResizable, + uiDialog = this.uiDialog; + + if ( key === "dialogClass" ) { + uiDialog + .removeClass( this.options.dialogClass ) + .addClass( value ); + } + + if ( key === "disabled" ) { + return; + } + + this._super( key, value ); + + if ( key === "appendTo" ) { + this.uiDialog.appendTo( this._appendTo() ); + } + + if ( key === "buttons" ) { + this._createButtons(); + } + + if ( key === "closeText" ) { + this.uiDialogTitlebarClose.button({ + // Ensure that we always pass a string + label: "" + value + }); + } + + if ( key === "draggable" ) { + isDraggable = uiDialog.is(":data(ui-draggable)"); + if ( isDraggable && !value ) { + uiDialog.draggable("destroy"); + } + + if ( !isDraggable && value ) { + this._makeDraggable(); + } + } + + if ( key === "position" ) { + this._position(); + } + + if ( key === "resizable" ) { + // currently resizable, becoming non-resizable + isResizable = uiDialog.is(":data(ui-resizable)"); + if ( isResizable && !value ) { + uiDialog.resizable("destroy"); + } + + // currently resizable, changing handles + if ( isResizable && typeof value === "string" ) { + uiDialog.resizable( "option", "handles", value ); + } + + // currently non-resizable, becoming resizable + if ( !isResizable && value !== false ) { + this._makeResizable(); + } + } + + if ( key === "title" ) { + this._title( this.uiDialogTitlebar.find(".ui-dialog-title") ); + } + }, + + _size: function() { + // If the user has resized the dialog, the .ui-dialog and .ui-dialog-content + // divs will both have width and height set, so we need to reset them + var nonContentHeight, minContentHeight, maxContentHeight, + options = this.options; + + // Reset content sizing + this.element.show().css({ + width: "auto", + minHeight: 0, + maxHeight: "none", + height: 0 + }); + + if ( options.minWidth > options.width ) { + options.width = options.minWidth; + } + + // reset wrapper sizing + // determine the height of all the non-content elements + nonContentHeight = this.uiDialog.css({ + height: "auto", + width: options.width + }) + .outerHeight(); + minContentHeight = Math.max( 0, options.minHeight - nonContentHeight ); + maxContentHeight = typeof options.maxHeight === "number" ? + Math.max( 0, options.maxHeight - nonContentHeight ) : + "none"; + + if ( options.height === "auto" ) { + this.element.css({ + minHeight: minContentHeight, + maxHeight: maxContentHeight, + height: "auto" + }); + } else { + this.element.height( Math.max( 0, options.height - nonContentHeight ) ); + } + + if (this.uiDialog.is(":data(ui-resizable)") ) { + this.uiDialog.resizable( "option", "minHeight", this._minHeight() ); + } + }, + + _createOverlay: function() { + if ( !this.options.modal ) { + return; + } + + if ( !$.ui.dialog.overlayInstances ) { + // Prevent use of anchors and inputs. + // We use a delay in case the overlay is created from an + // event that we're going to be cancelling. (#2804) + this._delay(function() { + // Handle .dialog().dialog("close") (#4065) + if ( $.ui.dialog.overlayInstances ) { + this._on( this.document, { + focusin: function( event ) { + if ( !$( event.target ).closest(".ui-dialog").length ) { + event.preventDefault(); + $(".ui-dialog:visible:last .ui-dialog-content") + .data("ui-dialog")._focusTabbable(); + } + } + }); + } + }); + } + + this.overlay = $("<div>") + .addClass("ui-widget-overlay ui-front") + .appendTo( this.document[0].body ); + this._on( this.overlay, { + mousedown: "_keepFocus" + }); + $.ui.dialog.overlayInstances++; + }, + + _destroyOverlay: function() { + if ( !this.options.modal ) { + return; + } + + $.ui.dialog.overlayInstances--; + if ( !$.ui.dialog.overlayInstances ) { + this._off( this.document, "focusin" ); + } + this.overlay.remove(); + } +}); + +$.ui.dialog.overlayInstances = 0; + +// DEPRECATED +if ( $.uiBackCompat !== false ) { + // position option with array notation + // just override with old implementation + $.widget( "ui.dialog", $.ui.dialog, { + _position: function() { + var position = this.options.position, + myAt = [], + offset = [ 0, 0 ], + isVisible; + + if ( position ) { + if ( typeof position === "string" || (typeof position === "object" && "0" in position ) ) { + myAt = position.split ? position.split(" ") : [ position[0], position[1] ]; + if ( myAt.length === 1 ) { + myAt[1] = myAt[0]; + } + + $.each( [ "left", "top" ], function( i, offsetPosition ) { + if ( +myAt[ i ] === myAt[ i ] ) { + offset[ i ] = myAt[ i ]; + myAt[ i ] = offsetPosition; + } + }); + + position = { + my: myAt[0] + (offset[0] < 0 ? offset[0] : "+" + offset[0]) + " " + + myAt[1] + (offset[1] < 0 ? offset[1] : "+" + offset[1]), + at: myAt.join(" ") + }; + } + + position = $.extend( {}, $.ui.dialog.prototype.options.position, position ); + } else { + position = $.ui.dialog.prototype.options.position; + } + + // need to show the dialog to get the actual offset in the position plugin + isVisible = this.uiDialog.is(":visible"); + if ( !isVisible ) { + this.uiDialog.show(); + } + this.uiDialog.position( position ); + if ( !isVisible ) { + this.uiDialog.hide(); + } + } + }); +} + +}( jQuery ) ); +(function( $, undefined ) { + +$.widget( "ui.menu", { + version: "1.10.0", + defaultElement: "<ul>", + delay: 300, + options: { + icons: { + submenu: "ui-icon-carat-1-e" + }, + menus: "ul", + position: { + my: "left top", + at: "right top" + }, + role: "menu", + + // callbacks + blur: null, + focus: null, + select: null + }, + + _create: function() { + this.activeMenu = this.element; + // flag used to prevent firing of the click handler + // as the event bubbles up through nested menus + this.mouseHandled = false; + this.element + .uniqueId() + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-menu-icons", !!this.element.find( ".ui-icon" ).length ) + .attr({ + role: this.options.role, + tabIndex: 0 + }) + // need to catch all clicks on disabled menu + // not possible through _on + .bind( "click" + this.eventNamespace, $.proxy(function( event ) { + if ( this.options.disabled ) { + event.preventDefault(); + } + }, this )); + + if ( this.options.disabled ) { + this.element + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } + + this._on({ + // Prevent focus from sticking to links inside menu after clicking + // them (focus should always stay on UL during navigation). + "mousedown .ui-menu-item > a": function( event ) { + event.preventDefault(); + }, + "click .ui-state-disabled > a": function( event ) { + event.preventDefault(); + }, + "click .ui-menu-item:has(a)": function( event ) { + var target = $( event.target ).closest( ".ui-menu-item" ); + if ( !this.mouseHandled && target.not( ".ui-state-disabled" ).length ) { + this.mouseHandled = true; + + this.select( event ); + // Open submenu on click + if ( target.has( ".ui-menu" ).length ) { + this.expand( event ); + } else if ( !this.element.is( ":focus" ) ) { + // Redirect focus to the menu + this.element.trigger( "focus", [ true ] ); + + // If the active item is on the top level, let it stay active. + // Otherwise, blur the active item since it is no longer visible. + if ( this.active && this.active.parents( ".ui-menu" ).length === 1 ) { + clearTimeout( this.timer ); + } + } + } + }, + "mouseenter .ui-menu-item": function( event ) { + var target = $( event.currentTarget ); + // Remove ui-state-active class from siblings of the newly focused menu item + // to avoid a jump caused by adjacent elements both having a class with a border + target.siblings().children( ".ui-state-active" ).removeClass( "ui-state-active" ); + this.focus( event, target ); + }, + mouseleave: "collapseAll", + "mouseleave .ui-menu": "collapseAll", + focus: function( event, keepActiveItem ) { + // If there's already an active item, keep it active + // If not, activate the first item + var item = this.active || this.element.children( ".ui-menu-item" ).eq( 0 ); + + if ( !keepActiveItem ) { + this.focus( event, item ); + } + }, + blur: function( event ) { + this._delay(function() { + if ( !$.contains( this.element[0], this.document[0].activeElement ) ) { + this.collapseAll( event ); + } + }); + }, + keydown: "_keydown" + }); + + this.refresh(); + + // Clicks outside of a menu collapse any open menus + this._on( this.document, { + click: function( event ) { + if ( !$( event.target ).closest( ".ui-menu" ).length ) { + this.collapseAll( event ); + } + + // Reset the mouseHandled flag + this.mouseHandled = false; + } + }); + }, + + _destroy: function() { + // Destroy (sub)menus + this.element + .removeAttr( "aria-activedescendant" ) + .find( ".ui-menu" ).addBack() + .removeClass( "ui-menu ui-widget ui-widget-content ui-corner-all ui-menu-icons" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-disabled" ) + .removeUniqueId() + .show(); + + // Destroy menu items + this.element.find( ".ui-menu-item" ) + .removeClass( "ui-menu-item" ) + .removeAttr( "role" ) + .removeAttr( "aria-disabled" ) + .children( "a" ) + .removeUniqueId() + .removeClass( "ui-corner-all ui-state-hover" ) + .removeAttr( "tabIndex" ) + .removeAttr( "role" ) + .removeAttr( "aria-haspopup" ) + .children().each( function() { + var elem = $( this ); + if ( elem.data( "ui-menu-submenu-carat" ) ) { + elem.remove(); + } + }); + + // Destroy menu dividers + this.element.find( ".ui-menu-divider" ).removeClass( "ui-menu-divider ui-widget-content" ); + }, + + _keydown: function( event ) { + /*jshint maxcomplexity:20*/ + var match, prev, character, skip, regex, + preventDefault = true; + + function escape( value ) { + return value.replace( /[\-\[\]{}()*+?.,\\\^$|#\s]/g, "\\$&" ); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.PAGE_UP: + this.previousPage( event ); + break; + case $.ui.keyCode.PAGE_DOWN: + this.nextPage( event ); + break; + case $.ui.keyCode.HOME: + this._move( "first", "first", event ); + break; + case $.ui.keyCode.END: + this._move( "last", "last", event ); + break; + case $.ui.keyCode.UP: + this.previous( event ); + break; + case $.ui.keyCode.DOWN: + this.next( event ); + break; + case $.ui.keyCode.LEFT: + this.collapse( event ); + break; + case $.ui.keyCode.RIGHT: + if ( this.active && !this.active.is( ".ui-state-disabled" ) ) { + this.expand( event ); + } + break; + case $.ui.keyCode.ENTER: + case $.ui.keyCode.SPACE: + this._activate( event ); + break; + case $.ui.keyCode.ESCAPE: + this.collapse( event ); + break; + default: + preventDefault = false; + prev = this.previousFilter || ""; + character = String.fromCharCode( event.keyCode ); + skip = false; + + clearTimeout( this.filterTimer ); + + if ( character === prev ) { + skip = true; + } else { + character = prev + character; + } + + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + match = skip && match.index( this.active.next() ) !== -1 ? + this.active.nextAll( ".ui-menu-item" ) : + match; + + // If no matches on the current filter, reset to the last character pressed + // to move down the menu to the first item that starts with that character + if ( !match.length ) { + character = String.fromCharCode( event.keyCode ); + regex = new RegExp( "^" + escape( character ), "i" ); + match = this.activeMenu.children( ".ui-menu-item" ).filter(function() { + return regex.test( $( this ).children( "a" ).text() ); + }); + } + + if ( match.length ) { + this.focus( event, match ); + if ( match.length > 1 ) { + this.previousFilter = character; + this.filterTimer = this._delay(function() { + delete this.previousFilter; + }, 1000 ); + } else { + delete this.previousFilter; + } + } else { + delete this.previousFilter; + } + } + + if ( preventDefault ) { + event.preventDefault(); + } + }, + + _activate: function( event ) { + if ( !this.active.is( ".ui-state-disabled" ) ) { + if ( this.active.children( "a[aria-haspopup='true']" ).length ) { + this.expand( event ); + } else { + this.select( event ); + } + } + }, + + refresh: function() { + var menus, + icon = this.options.icons.submenu, + submenus = this.element.find( this.options.menus ); + + // Initialize nested menus + submenus.filter( ":not(.ui-menu)" ) + .addClass( "ui-menu ui-widget ui-widget-content ui-corner-all" ) + .hide() + .attr({ + role: this.options.role, + "aria-hidden": "true", + "aria-expanded": "false" + }) + .each(function() { + var menu = $( this ), + item = menu.prev( "a" ), + submenuCarat = $( "<span>" ) + .addClass( "ui-menu-icon ui-icon " + icon ) + .data( "ui-menu-submenu-carat", true ); + + item + .attr( "aria-haspopup", "true" ) + .prepend( submenuCarat ); + menu.attr( "aria-labelledby", item.attr( "id" ) ); + }); + + menus = submenus.add( this.element ); + + // Don't refresh list items that are already adapted + menus.children( ":not(.ui-menu-item):has(a)" ) + .addClass( "ui-menu-item" ) + .attr( "role", "presentation" ) + .children( "a" ) + .uniqueId() + .addClass( "ui-corner-all" ) + .attr({ + tabIndex: -1, + role: this._itemRole() + }); + + // Initialize unlinked menu-items containing spaces and/or dashes only as dividers + menus.children( ":not(.ui-menu-item)" ).each(function() { + var item = $( this ); + // hyphen, em dash, en dash + if ( !/[^\-—–\s]/.test( item.text() ) ) { + item.addClass( "ui-widget-content ui-menu-divider" ); + } + }); + + // Add aria-disabled attribute to any disabled menu item + menus.children( ".ui-state-disabled" ).attr( "aria-disabled", "true" ); + + // If the active item has been removed, blur the menu + if ( this.active && !$.contains( this.element[ 0 ], this.active[ 0 ] ) ) { + this.blur(); + } + }, + + _itemRole: function() { + return { + menu: "menuitem", + listbox: "option" + }[ this.options.role ]; + }, + + _setOption: function( key, value ) { + if ( key === "icons" ) { + this.element.find( ".ui-menu-icon" ) + .removeClass( this.options.icons.submenu ) + .addClass( value.submenu ); + } + this._super( key, value ); + }, + + focus: function( event, item ) { + var nested, focused; + this.blur( event, event && event.type === "focus" ); + + this._scrollIntoView( item ); + + this.active = item.first(); + focused = this.active.children( "a" ).addClass( "ui-state-focus" ); + // Only update aria-activedescendant if there's a role + // otherwise we assume focus is managed elsewhere + if ( this.options.role ) { + this.element.attr( "aria-activedescendant", focused.attr( "id" ) ); + } + + // Highlight active parent menu item, if any + this.active + .parent() + .closest( ".ui-menu-item" ) + .children( "a:first" ) + .addClass( "ui-state-active" ); + + if ( event && event.type === "keydown" ) { + this._close(); + } else { + this.timer = this._delay(function() { + this._close(); + }, this.delay ); + } + + nested = item.children( ".ui-menu" ); + if ( nested.length && ( /^mouse/.test( event.type ) ) ) { + this._startOpening(nested); + } + this.activeMenu = item.parent(); + + this._trigger( "focus", event, { item: item } ); + }, + + _scrollIntoView: function( item ) { + var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight; + if ( this._hasScroll() ) { + borderTop = parseFloat( $.css( this.activeMenu[0], "borderTopWidth" ) ) || 0; + paddingTop = parseFloat( $.css( this.activeMenu[0], "paddingTop" ) ) || 0; + offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop; + scroll = this.activeMenu.scrollTop(); + elementHeight = this.activeMenu.height(); + itemHeight = item.height(); + + if ( offset < 0 ) { + this.activeMenu.scrollTop( scroll + offset ); + } else if ( offset + itemHeight > elementHeight ) { + this.activeMenu.scrollTop( scroll + offset - elementHeight + itemHeight ); + } + } + }, + + blur: function( event, fromFocus ) { + if ( !fromFocus ) { + clearTimeout( this.timer ); + } + + if ( !this.active ) { + return; + } + + this.active.children( "a" ).removeClass( "ui-state-focus" ); + this.active = null; + + this._trigger( "blur", event, { item: this.active } ); + }, + + _startOpening: function( submenu ) { + clearTimeout( this.timer ); + + // Don't open if already open fixes a Firefox bug that caused a .5 pixel + // shift in the submenu position when mousing over the carat icon + if ( submenu.attr( "aria-hidden" ) !== "true" ) { + return; + } + + this.timer = this._delay(function() { + this._close(); + this._open( submenu ); + }, this.delay ); + }, + + _open: function( submenu ) { + var position = $.extend({ + of: this.active + }, this.options.position ); + + clearTimeout( this.timer ); + this.element.find( ".ui-menu" ).not( submenu.parents( ".ui-menu" ) ) + .hide() + .attr( "aria-hidden", "true" ); + + submenu + .show() + .removeAttr( "aria-hidden" ) + .attr( "aria-expanded", "true" ) + .position( position ); + }, + + collapseAll: function( event, all ) { + clearTimeout( this.timer ); + this.timer = this._delay(function() { + // If we were passed an event, look for the submenu that contains the event + var currentMenu = all ? this.element : + $( event && event.target ).closest( this.element.find( ".ui-menu" ) ); + + // If we found no valid submenu ancestor, use the main menu to close all sub menus anyway + if ( !currentMenu.length ) { + currentMenu = this.element; + } + + this._close( currentMenu ); + + this.blur( event ); + this.activeMenu = currentMenu; + }, this.delay ); + }, + + // With no arguments, closes the currently active menu - if nothing is active + // it closes all menus. If passed an argument, it will search for menus BELOW + _close: function( startMenu ) { + if ( !startMenu ) { + startMenu = this.active ? this.active.parent() : this.element; + } + + startMenu + .find( ".ui-menu" ) + .hide() + .attr( "aria-hidden", "true" ) + .attr( "aria-expanded", "false" ) + .end() + .find( "a.ui-state-active" ) + .removeClass( "ui-state-active" ); + }, + + collapse: function( event ) { + var newItem = this.active && + this.active.parent().closest( ".ui-menu-item", this.element ); + if ( newItem && newItem.length ) { + this._close(); + this.focus( event, newItem ); + } + }, + + expand: function( event ) { + var newItem = this.active && + this.active + .children( ".ui-menu " ) + .children( ".ui-menu-item" ) + .first(); + + if ( newItem && newItem.length ) { + this._open( newItem.parent() ); + + // Delay so Firefox will not hide activedescendant change in expanding submenu from AT + this._delay(function() { + this.focus( event, newItem ); + }); + } + }, + + next: function( event ) { + this._move( "next", "first", event ); + }, + + previous: function( event ) { + this._move( "prev", "last", event ); + }, + + isFirstItem: function() { + return this.active && !this.active.prevAll( ".ui-menu-item" ).length; + }, + + isLastItem: function() { + return this.active && !this.active.nextAll( ".ui-menu-item" ).length; + }, + + _move: function( direction, filter, event ) { + var next; + if ( this.active ) { + if ( direction === "first" || direction === "last" ) { + next = this.active + [ direction === "first" ? "prevAll" : "nextAll" ]( ".ui-menu-item" ) + .eq( -1 ); + } else { + next = this.active + [ direction + "All" ]( ".ui-menu-item" ) + .eq( 0 ); + } + } + if ( !next || !next.length || !this.active ) { + next = this.activeMenu.children( ".ui-menu-item" )[ filter ](); + } + + this.focus( event, next ); + }, + + nextPage: function( event ) { + var item, base, height; + + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isLastItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.nextAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base - height < 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ) + [ !this.active ? "first" : "last" ]() ); + } + }, + + previousPage: function( event ) { + var item, base, height; + if ( !this.active ) { + this.next( event ); + return; + } + if ( this.isFirstItem() ) { + return; + } + if ( this._hasScroll() ) { + base = this.active.offset().top; + height = this.element.height(); + this.active.prevAll( ".ui-menu-item" ).each(function() { + item = $( this ); + return item.offset().top - base + height > 0; + }); + + this.focus( event, item ); + } else { + this.focus( event, this.activeMenu.children( ".ui-menu-item" ).first() ); + } + }, + + _hasScroll: function() { + return this.element.outerHeight() < this.element.prop( "scrollHeight" ); + }, + + select: function( event ) { + // TODO: It should never be possible to not have an active item at this + // point, but the tests don't trigger mouseenter before click. + this.active = this.active || $( event.target ).closest( ".ui-menu-item" ); + var ui = { item: this.active }; + if ( !this.active.has( ".ui-menu" ).length ) { + this.collapseAll( event, true ); + } + this._trigger( "select", event, ui ); + } +}); + +}( jQuery )); +(function( $, undefined ) { + +$.widget( "ui.progressbar", { + version: "1.10.0", + options: { + max: 100, + value: 0, + + change: null, + complete: null + }, + + min: 0, + + _create: function() { + // Constrain initial value + this.oldValue = this.options.value = this._constrainedValue(); + + this.element + .addClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .attr({ + // Only set static values, aria-valuenow and aria-valuemax are + // set inside _refreshValue() + role: "progressbar", + "aria-valuemin": this.min + }); + + this.valueDiv = $( "<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>" ) + .appendTo( this.element ); + + this._refreshValue(); + }, + + _destroy: function() { + this.element + .removeClass( "ui-progressbar ui-widget ui-widget-content ui-corner-all" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + + this.valueDiv.remove(); + }, + + value: function( newValue ) { + if ( newValue === undefined ) { + return this.options.value; + } + + this.options.value = this._constrainedValue( newValue ); + this._refreshValue(); + }, + + _constrainedValue: function( newValue ) { + if ( newValue === undefined ) { + newValue = this.options.value; + } + + this.indeterminate = newValue === false; + + // sanitize value + if ( typeof newValue !== "number" ) { + newValue = 0; + } + + return this.indeterminate ? false : + Math.min( this.options.max, Math.max( this.min, newValue ) ); + }, + + _setOptions: function( options ) { + // Ensure "value" option is set after other values (like max) + var value = options.value; + delete options.value; + + this._super( options ); + + this.options.value = this._constrainedValue( value ); + this._refreshValue(); + }, + + _setOption: function( key, value ) { + if ( key === "max" ) { + // Don't allow a max less than min + value = Math.max( this.min, value ); + } + + this._super( key, value ); + }, + + _percentage: function() { + return this.indeterminate ? 100 : 100 * ( this.options.value - this.min ) / ( this.options.max - this.min ); + }, + + _refreshValue: function() { + var value = this.options.value, + percentage = this._percentage(); + + this.valueDiv + .toggle( this.indeterminate || value > this.min ) + .toggleClass( "ui-corner-right", value === this.options.max ) + .width( percentage.toFixed(0) + "%" ); + + this.element.toggleClass( "ui-progressbar-indeterminate", this.indeterminate ); + + if ( this.indeterminate ) { + this.element.removeAttr( "aria-valuenow" ); + if ( !this.overlayDiv ) { + this.overlayDiv = $( "<div class='ui-progressbar-overlay'></div>" ).appendTo( this.valueDiv ); + } + } else { + this.element.attr({ + "aria-valuemax": this.options.max, + "aria-valuenow": value + }); + if ( this.overlayDiv ) { + this.overlayDiv.remove(); + this.overlayDiv = null; + } + } + + if ( this.oldValue !== value ) { + this.oldValue = value; + this._trigger( "change" ); + } + if ( value === this.options.max ) { + this._trigger( "complete" ); + } + } +}); + +})( jQuery ); +(function( $, undefined ) { + +// number of pages in a slider +// (how many times can you page up/down to go through the whole range) +var numPages = 5; + +$.widget( "ui.slider", $.ui.mouse, { + version: "1.10.0", + widgetEventPrefix: "slide", + + options: { + animate: false, + distance: 0, + max: 100, + min: 0, + orientation: "horizontal", + range: false, + step: 1, + value: 0, + values: null, + + // callbacks + change: null, + slide: null, + start: null, + stop: null + }, + + _create: function() { + var i, handleCount, + o = this.options, + existingHandles = this.element.find( ".ui-slider-handle" ).addClass( "ui-state-default ui-corner-all" ), + handle = "<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>", + handles = []; + + this._keySliding = false; + this._mouseSliding = false; + this._animateOff = true; + this._handleIndex = null; + this._detectOrientation(); + this._mouseInit(); + + this.element + .addClass( "ui-slider" + + " ui-slider-" + this.orientation + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all"); + + this.range = $([]); + + if ( o.range ) { + if ( o.range === true ) { + if ( !o.values ) { + o.values = [ this._valueMin(), this._valueMin() ]; + } else if ( o.values.length && o.values.length !== 2 ) { + o.values = [ o.values[0], o.values[0] ]; + } else if ( $.isArray( o.values ) ) { + o.values = o.values.slice(0); + } + } + + this.range = $( "<div></div>" ) + .appendTo( this.element ) + .addClass( "ui-slider-range" + + // note: this isn't the most fittingly semantic framework class for this element, + // but worked best visually with a variety of themes + " ui-widget-header" + + ( ( o.range === "min" || o.range === "max" ) ? " ui-slider-range-" + o.range : "" ) ); + } + + handleCount = ( o.values && o.values.length ) || 1; + + for ( i = existingHandles.length; i < handleCount; i++ ) { + handles.push( handle ); + } + + this.handles = existingHandles.add( $( handles.join( "" ) ).appendTo( this.element ) ); + + this.handle = this.handles.eq( 0 ); + + this.handles.add( this.range ).filter( "a" ) + .click(function( event ) { + event.preventDefault(); + }) + .mouseenter(function() { + if ( !o.disabled ) { + $( this ).addClass( "ui-state-hover" ); + } + }) + .mouseleave(function() { + $( this ).removeClass( "ui-state-hover" ); + }) + .focus(function() { + if ( !o.disabled ) { + $( ".ui-slider .ui-state-focus" ).removeClass( "ui-state-focus" ); + $( this ).addClass( "ui-state-focus" ); + } else { + $( this ).blur(); + } + }) + .blur(function() { + $( this ).removeClass( "ui-state-focus" ); + }); + + this.handles.each(function( i ) { + $( this ).data( "ui-slider-handle-index", i ); + }); + + this._setOption( "disabled", o.disabled ); + + this._on( this.handles, this._handleEvents ); + + this._refreshValue(); + + this._animateOff = false; + }, + + _destroy: function() { + this.handles.remove(); + this.range.remove(); + + this.element + .removeClass( "ui-slider" + + " ui-slider-horizontal" + + " ui-slider-vertical" + + " ui-widget" + + " ui-widget-content" + + " ui-corner-all" ); + + this._mouseDestroy(); + }, + + _mouseCapture: function( event ) { + var position, normValue, distance, closestHandle, index, allowed, offset, mouseOverHandle, + that = this, + o = this.options; + + if ( o.disabled ) { + return false; + } + + this.elementSize = { + width: this.element.outerWidth(), + height: this.element.outerHeight() + }; + this.elementOffset = this.element.offset(); + + position = { x: event.pageX, y: event.pageY }; + normValue = this._normValueFromMouse( position ); + distance = this._valueMax() - this._valueMin() + 1; + this.handles.each(function( i ) { + var thisDistance = Math.abs( normValue - that.values(i) ); + if (( distance > thisDistance ) || + ( distance === thisDistance && + (i === that._lastChangedValue || that.values(i) === o.min ))) { + distance = thisDistance; + closestHandle = $( this ); + index = i; + } + }); + + allowed = this._start( event, index ); + if ( allowed === false ) { + return false; + } + this._mouseSliding = true; + + this._handleIndex = index; + + closestHandle + .addClass( "ui-state-active" ) + .focus(); + + offset = closestHandle.offset(); + mouseOverHandle = !$( event.target ).parents().addBack().is( ".ui-slider-handle" ); + this._clickOffset = mouseOverHandle ? { left: 0, top: 0 } : { + left: event.pageX - offset.left - ( closestHandle.width() / 2 ), + top: event.pageY - offset.top - + ( closestHandle.height() / 2 ) - + ( parseInt( closestHandle.css("borderTopWidth"), 10 ) || 0 ) - + ( parseInt( closestHandle.css("borderBottomWidth"), 10 ) || 0) + + ( parseInt( closestHandle.css("marginTop"), 10 ) || 0) + }; + + if ( !this.handles.hasClass( "ui-state-hover" ) ) { + this._slide( event, index, normValue ); + } + this._animateOff = true; + return true; + }, + + _mouseStart: function() { + return true; + }, + + _mouseDrag: function( event ) { + var position = { x: event.pageX, y: event.pageY }, + normValue = this._normValueFromMouse( position ); + + this._slide( event, this._handleIndex, normValue ); + + return false; + }, + + _mouseStop: function( event ) { + this.handles.removeClass( "ui-state-active" ); + this._mouseSliding = false; + + this._stop( event, this._handleIndex ); + this._change( event, this._handleIndex ); + + this._handleIndex = null; + this._clickOffset = null; + this._animateOff = false; + + return false; + }, + + _detectOrientation: function() { + this.orientation = ( this.options.orientation === "vertical" ) ? "vertical" : "horizontal"; + }, + + _normValueFromMouse: function( position ) { + var pixelTotal, + pixelMouse, + percentMouse, + valueTotal, + valueMouse; + + if ( this.orientation === "horizontal" ) { + pixelTotal = this.elementSize.width; + pixelMouse = position.x - this.elementOffset.left - ( this._clickOffset ? this._clickOffset.left : 0 ); + } else { + pixelTotal = this.elementSize.height; + pixelMouse = position.y - this.elementOffset.top - ( this._clickOffset ? this._clickOffset.top : 0 ); + } + + percentMouse = ( pixelMouse / pixelTotal ); + if ( percentMouse > 1 ) { + percentMouse = 1; + } + if ( percentMouse < 0 ) { + percentMouse = 0; + } + if ( this.orientation === "vertical" ) { + percentMouse = 1 - percentMouse; + } + + valueTotal = this._valueMax() - this._valueMin(); + valueMouse = this._valueMin() + percentMouse * valueTotal; + + return this._trimAlignValue( valueMouse ); + }, + + _start: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + return this._trigger( "start", event, uiHash ); + }, + + _slide: function( event, index, newVal ) { + var otherVal, + newValues, + allowed; + + if ( this.options.values && this.options.values.length ) { + otherVal = this.values( index ? 0 : 1 ); + + if ( ( this.options.values.length === 2 && this.options.range === true ) && + ( ( index === 0 && newVal > otherVal) || ( index === 1 && newVal < otherVal ) ) + ) { + newVal = otherVal; + } + + if ( newVal !== this.values( index ) ) { + newValues = this.values(); + newValues[ index ] = newVal; + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal, + values: newValues + } ); + otherVal = this.values( index ? 0 : 1 ); + if ( allowed !== false ) { + this.values( index, newVal, true ); + } + } + } else { + if ( newVal !== this.value() ) { + // A slide can be canceled by returning false from the slide callback + allowed = this._trigger( "slide", event, { + handle: this.handles[ index ], + value: newVal + } ); + if ( allowed !== false ) { + this.value( newVal ); + } + } + } + }, + + _stop: function( event, index ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + this._trigger( "stop", event, uiHash ); + }, + + _change: function( event, index ) { + if ( !this._keySliding && !this._mouseSliding ) { + var uiHash = { + handle: this.handles[ index ], + value: this.value() + }; + if ( this.options.values && this.options.values.length ) { + uiHash.value = this.values( index ); + uiHash.values = this.values(); + } + + //store the last changed value index for reference when handles overlap + this._lastChangedValue = index; + + this._trigger( "change", event, uiHash ); + } + }, + + value: function( newValue ) { + if ( arguments.length ) { + this.options.value = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, 0 ); + return; + } + + return this._value(); + }, + + values: function( index, newValue ) { + var vals, + newValues, + i; + + if ( arguments.length > 1 ) { + this.options.values[ index ] = this._trimAlignValue( newValue ); + this._refreshValue(); + this._change( null, index ); + return; + } + + if ( arguments.length ) { + if ( $.isArray( arguments[ 0 ] ) ) { + vals = this.options.values; + newValues = arguments[ 0 ]; + for ( i = 0; i < vals.length; i += 1 ) { + vals[ i ] = this._trimAlignValue( newValues[ i ] ); + this._change( null, i ); + } + this._refreshValue(); + } else { + if ( this.options.values && this.options.values.length ) { + return this._values( index ); + } else { + return this.value(); + } + } + } else { + return this._values(); + } + }, + + _setOption: function( key, value ) { + var i, + valsLength = 0; + + if ( $.isArray( this.options.values ) ) { + valsLength = this.options.values.length; + } + + $.Widget.prototype._setOption.apply( this, arguments ); + + switch ( key ) { + case "disabled": + if ( value ) { + this.handles.filter( ".ui-state-focus" ).blur(); + this.handles.removeClass( "ui-state-hover" ); + this.handles.prop( "disabled", true ); + } else { + this.handles.prop( "disabled", false ); + } + break; + case "orientation": + this._detectOrientation(); + this.element + .removeClass( "ui-slider-horizontal ui-slider-vertical" ) + .addClass( "ui-slider-" + this.orientation ); + this._refreshValue(); + break; + case "value": + this._animateOff = true; + this._refreshValue(); + this._change( null, 0 ); + this._animateOff = false; + break; + case "values": + this._animateOff = true; + this._refreshValue(); + for ( i = 0; i < valsLength; i += 1 ) { + this._change( null, i ); + } + this._animateOff = false; + break; + case "min": + case "max": + this._animateOff = true; + this._refreshValue(); + this._animateOff = false; + break; + } + }, + + //internal value getter + // _value() returns value trimmed by min and max, aligned by step + _value: function() { + var val = this.options.value; + val = this._trimAlignValue( val ); + + return val; + }, + + //internal values getter + // _values() returns array of values trimmed by min and max, aligned by step + // _values( index ) returns single value trimmed by min and max, aligned by step + _values: function( index ) { + var val, + vals, + i; + + if ( arguments.length ) { + val = this.options.values[ index ]; + val = this._trimAlignValue( val ); + + return val; + } else { + // .slice() creates a copy of the array + // this copy gets trimmed by min and max and then returned + vals = this.options.values.slice(); + for ( i = 0; i < vals.length; i+= 1) { + vals[ i ] = this._trimAlignValue( vals[ i ] ); + } + + return vals; + } + }, + + // returns the step-aligned value that val is closest to, between (inclusive) min and max + _trimAlignValue: function( val ) { + if ( val <= this._valueMin() ) { + return this._valueMin(); + } + if ( val >= this._valueMax() ) { + return this._valueMax(); + } + var step = ( this.options.step > 0 ) ? this.options.step : 1, + valModStep = (val - this._valueMin()) % step, + alignValue = val - valModStep; + + if ( Math.abs(valModStep) * 2 >= step ) { + alignValue += ( valModStep > 0 ) ? step : ( -step ); + } + + // Since JavaScript has problems with large floats, round + // the final value to 5 digits after the decimal point (see #4124) + return parseFloat( alignValue.toFixed(5) ); + }, + + _valueMin: function() { + return this.options.min; + }, + + _valueMax: function() { + return this.options.max; + }, + + _refreshValue: function() { + var lastValPercent, valPercent, value, valueMin, valueMax, + oRange = this.options.range, + o = this.options, + that = this, + animate = ( !this._animateOff ) ? o.animate : false, + _set = {}; + + if ( this.options.values && this.options.values.length ) { + this.handles.each(function( i ) { + valPercent = ( that.values(i) - that._valueMin() ) / ( that._valueMax() - that._valueMin() ) * 100; + _set[ that.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + $( this ).stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + if ( that.options.range === true ) { + if ( that.orientation === "horizontal" ) { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { left: valPercent + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { width: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } else { + if ( i === 0 ) { + that.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { bottom: ( valPercent ) + "%" }, o.animate ); + } + if ( i === 1 ) { + that.range[ animate ? "animate" : "css" ]( { height: ( valPercent - lastValPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + } + lastValPercent = valPercent; + }); + } else { + value = this.value(); + valueMin = this._valueMin(); + valueMax = this._valueMax(); + valPercent = ( valueMax !== valueMin ) ? + ( value - valueMin ) / ( valueMax - valueMin ) * 100 : + 0; + _set[ this.orientation === "horizontal" ? "left" : "bottom" ] = valPercent + "%"; + this.handle.stop( 1, 1 )[ animate ? "animate" : "css" ]( _set, o.animate ); + + if ( oRange === "min" && this.orientation === "horizontal" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { width: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "horizontal" ) { + this.range[ animate ? "animate" : "css" ]( { width: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + if ( oRange === "min" && this.orientation === "vertical" ) { + this.range.stop( 1, 1 )[ animate ? "animate" : "css" ]( { height: valPercent + "%" }, o.animate ); + } + if ( oRange === "max" && this.orientation === "vertical" ) { + this.range[ animate ? "animate" : "css" ]( { height: ( 100 - valPercent ) + "%" }, { queue: false, duration: o.animate } ); + } + } + }, + + _handleEvents: { + keydown: function( event ) { + /*jshint maxcomplexity:25*/ + var allowed, curVal, newVal, step, + index = $( event.target ).data( "ui-slider-handle-index" ); + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + case $.ui.keyCode.END: + case $.ui.keyCode.PAGE_UP: + case $.ui.keyCode.PAGE_DOWN: + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + event.preventDefault(); + if ( !this._keySliding ) { + this._keySliding = true; + $( event.target ).addClass( "ui-state-active" ); + allowed = this._start( event, index ); + if ( allowed === false ) { + return; + } + } + break; + } + + step = this.options.step; + if ( this.options.values && this.options.values.length ) { + curVal = newVal = this.values( index ); + } else { + curVal = newVal = this.value(); + } + + switch ( event.keyCode ) { + case $.ui.keyCode.HOME: + newVal = this._valueMin(); + break; + case $.ui.keyCode.END: + newVal = this._valueMax(); + break; + case $.ui.keyCode.PAGE_UP: + newVal = this._trimAlignValue( curVal + ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.PAGE_DOWN: + newVal = this._trimAlignValue( curVal - ( (this._valueMax() - this._valueMin()) / numPages ) ); + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.RIGHT: + if ( curVal === this._valueMax() ) { + return; + } + newVal = this._trimAlignValue( curVal + step ); + break; + case $.ui.keyCode.DOWN: + case $.ui.keyCode.LEFT: + if ( curVal === this._valueMin() ) { + return; + } + newVal = this._trimAlignValue( curVal - step ); + break; + } + + this._slide( event, index, newVal ); + }, + keyup: function( event ) { + var index = $( event.target ).data( "ui-slider-handle-index" ); + + if ( this._keySliding ) { + this._keySliding = false; + this._stop( event, index ); + this._change( event, index ); + $( event.target ).removeClass( "ui-state-active" ); + } + } + } + +}); + +}(jQuery)); +(function( $ ) { + +function modifier( fn ) { + return function() { + var previous = this.element.val(); + fn.apply( this, arguments ); + this._refresh(); + if ( previous !== this.element.val() ) { + this._trigger( "change" ); + } + }; +} + +$.widget( "ui.spinner", { + version: "1.10.0", + defaultElement: "<input>", + widgetEventPrefix: "spin", + options: { + culture: null, + icons: { + down: "ui-icon-triangle-1-s", + up: "ui-icon-triangle-1-n" + }, + incremental: true, + max: null, + min: null, + numberFormat: null, + page: 10, + step: 1, + + change: null, + spin: null, + start: null, + stop: null + }, + + _create: function() { + // handle string values that need to be parsed + this._setOption( "max", this.options.max ); + this._setOption( "min", this.options.min ); + this._setOption( "step", this.options.step ); + + // format the value, but don't constrain + this._value( this.element.val(), true ); + + this._draw(); + this._on( this._events ); + this._refresh(); + + // turning off autocomplete prevents the browser from remembering the + // value when navigating through history, so we re-enable autocomplete + // if the page is unloaded before the widget is destroyed. #7790 + this._on( this.window, { + beforeunload: function() { + this.element.removeAttr( "autocomplete" ); + } + }); + }, + + _getCreateOptions: function() { + var options = {}, + element = this.element; + + $.each( [ "min", "max", "step" ], function( i, option ) { + var value = element.attr( option ); + if ( value !== undefined && value.length ) { + options[ option ] = value; + } + }); + + return options; + }, + + _events: { + keydown: function( event ) { + if ( this._start( event ) && this._keydown( event ) ) { + event.preventDefault(); + } + }, + keyup: "_stop", + focus: function() { + this.previous = this.element.val(); + }, + blur: function( event ) { + if ( this.cancelBlur ) { + delete this.cancelBlur; + return; + } + + this._refresh(); + if ( this.previous !== this.element.val() ) { + this._trigger( "change", event ); + } + }, + mousewheel: function( event, delta ) { + if ( !delta ) { + return; + } + if ( !this.spinning && !this._start( event ) ) { + return false; + } + + this._spin( (delta > 0 ? 1 : -1) * this.options.step, event ); + clearTimeout( this.mousewheelTimer ); + this.mousewheelTimer = this._delay(function() { + if ( this.spinning ) { + this._stop( event ); + } + }, 100 ); + event.preventDefault(); + }, + "mousedown .ui-spinner-button": function( event ) { + var previous; + + // We never want the buttons to have focus; whenever the user is + // interacting with the spinner, the focus should be on the input. + // If the input is focused then this.previous is properly set from + // when the input first received focus. If the input is not focused + // then we need to set this.previous based on the value before spinning. + previous = this.element[0] === this.document[0].activeElement ? + this.previous : this.element.val(); + function checkFocus() { + var isActive = this.element[0] === this.document[0].activeElement; + if ( !isActive ) { + this.element.focus(); + this.previous = previous; + // support: IE + // IE sets focus asynchronously, so we need to check if focus + // moved off of the input because the user clicked on the button. + this._delay(function() { + this.previous = previous; + }); + } + } + + // ensure focus is on (or stays on) the text field + event.preventDefault(); + checkFocus.call( this ); + + // support: IE + // IE doesn't prevent moving focus even with event.preventDefault() + // so we set a flag to know when we should ignore the blur event + // and check (again) if focus moved off of the input. + this.cancelBlur = true; + this._delay(function() { + delete this.cancelBlur; + checkFocus.call( this ); + }); + + if ( this._start( event ) === false ) { + return; + } + + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + "mouseup .ui-spinner-button": "_stop", + "mouseenter .ui-spinner-button": function( event ) { + // button will add ui-state-active if mouse was down while mouseleave and kept down + if ( !$( event.currentTarget ).hasClass( "ui-state-active" ) ) { + return; + } + + if ( this._start( event ) === false ) { + return false; + } + this._repeat( null, $( event.currentTarget ).hasClass( "ui-spinner-up" ) ? 1 : -1, event ); + }, + // TODO: do we really want to consider this a stop? + // shouldn't we just stop the repeater and wait until mouseup before + // we trigger the stop event? + "mouseleave .ui-spinner-button": "_stop" + }, + + _draw: function() { + var uiSpinner = this.uiSpinner = this.element + .addClass( "ui-spinner-input" ) + .attr( "autocomplete", "off" ) + .wrap( this._uiSpinnerHtml() ) + .parent() + // add buttons + .append( this._buttonHtml() ); + + this.element.attr( "role", "spinbutton" ); + + // button bindings + this.buttons = uiSpinner.find( ".ui-spinner-button" ) + .attr( "tabIndex", -1 ) + .button() + .removeClass( "ui-corner-all" ); + + // IE 6 doesn't understand height: 50% for the buttons + // unless the wrapper has an explicit height + if ( this.buttons.height() > Math.ceil( uiSpinner.height() * 0.5 ) && + uiSpinner.height() > 0 ) { + uiSpinner.height( uiSpinner.height() ); + } + + // disable spinner if element was already disabled + if ( this.options.disabled ) { + this.disable(); + } + }, + + _keydown: function( event ) { + var options = this.options, + keyCode = $.ui.keyCode; + + switch ( event.keyCode ) { + case keyCode.UP: + this._repeat( null, 1, event ); + return true; + case keyCode.DOWN: + this._repeat( null, -1, event ); + return true; + case keyCode.PAGE_UP: + this._repeat( null, options.page, event ); + return true; + case keyCode.PAGE_DOWN: + this._repeat( null, -options.page, event ); + return true; + } + + return false; + }, + + _uiSpinnerHtml: function() { + return "<span class='ui-spinner ui-widget ui-widget-content ui-corner-all'></span>"; + }, + + _buttonHtml: function() { + return "" + + "<a class='ui-spinner-button ui-spinner-up ui-corner-tr'>" + + "<span class='ui-icon " + this.options.icons.up + "'>▲</span>" + + "</a>" + + "<a class='ui-spinner-button ui-spinner-down ui-corner-br'>" + + "<span class='ui-icon " + this.options.icons.down + "'>▼</span>" + + "</a>"; + }, + + _start: function( event ) { + if ( !this.spinning && this._trigger( "start", event ) === false ) { + return false; + } + + if ( !this.counter ) { + this.counter = 1; + } + this.spinning = true; + return true; + }, + + _repeat: function( i, steps, event ) { + i = i || 500; + + clearTimeout( this.timer ); + this.timer = this._delay(function() { + this._repeat( 40, steps, event ); + }, i ); + + this._spin( steps * this.options.step, event ); + }, + + _spin: function( step, event ) { + var value = this.value() || 0; + + if ( !this.counter ) { + this.counter = 1; + } + + value = this._adjustValue( value + step * this._increment( this.counter ) ); + + if ( !this.spinning || this._trigger( "spin", event, { value: value } ) !== false) { + this._value( value ); + this.counter++; + } + }, + + _increment: function( i ) { + var incremental = this.options.incremental; + + if ( incremental ) { + return $.isFunction( incremental ) ? + incremental( i ) : + Math.floor( i*i*i/50000 - i*i/500 + 17*i/200 + 1 ); + } + + return 1; + }, + + _precision: function() { + var precision = this._precisionOf( this.options.step ); + if ( this.options.min !== null ) { + precision = Math.max( precision, this._precisionOf( this.options.min ) ); + } + return precision; + }, + + _precisionOf: function( num ) { + var str = num.toString(), + decimal = str.indexOf( "." ); + return decimal === -1 ? 0 : str.length - decimal - 1; + }, + + _adjustValue: function( value ) { + var base, aboveMin, + options = this.options; + + // make sure we're at a valid step + // - find out where we are relative to the base (min or 0) + base = options.min !== null ? options.min : 0; + aboveMin = value - base; + // - round to the nearest step + aboveMin = Math.round(aboveMin / options.step) * options.step; + // - rounding is based on 0, so adjust back to our base + value = base + aboveMin; + + // fix precision from bad JS floating point math + value = parseFloat( value.toFixed( this._precision() ) ); + + // clamp the value + if ( options.max !== null && value > options.max) { + return options.max; + } + if ( options.min !== null && value < options.min ) { + return options.min; + } + + return value; + }, + + _stop: function( event ) { + if ( !this.spinning ) { + return; + } + + clearTimeout( this.timer ); + clearTimeout( this.mousewheelTimer ); + this.counter = 0; + this.spinning = false; + this._trigger( "stop", event ); + }, + + _setOption: function( key, value ) { + if ( key === "culture" || key === "numberFormat" ) { + var prevValue = this._parse( this.element.val() ); + this.options[ key ] = value; + this.element.val( this._format( prevValue ) ); + return; + } + + if ( key === "max" || key === "min" || key === "step" ) { + if ( typeof value === "string" ) { + value = this._parse( value ); + } + } + if ( key === "icons" ) { + this.buttons.first().find( ".ui-icon" ) + .removeClass( this.options.icons.up ) + .addClass( value.up ); + this.buttons.last().find( ".ui-icon" ) + .removeClass( this.options.icons.down ) + .addClass( value.down ); + } + + this._super( key, value ); + + if ( key === "disabled" ) { + if ( value ) { + this.element.prop( "disabled", true ); + this.buttons.button( "disable" ); + } else { + this.element.prop( "disabled", false ); + this.buttons.button( "enable" ); + } + } + }, + + _setOptions: modifier(function( options ) { + this._super( options ); + this._value( this.element.val() ); + }), + + _parse: function( val ) { + if ( typeof val === "string" && val !== "" ) { + val = window.Globalize && this.options.numberFormat ? + Globalize.parseFloat( val, 10, this.options.culture ) : +val; + } + return val === "" || isNaN( val ) ? null : val; + }, + + _format: function( value ) { + if ( value === "" ) { + return ""; + } + return window.Globalize && this.options.numberFormat ? + Globalize.format( value, this.options.numberFormat, this.options.culture ) : + value; + }, + + _refresh: function() { + this.element.attr({ + "aria-valuemin": this.options.min, + "aria-valuemax": this.options.max, + // TODO: what should we do with values that can't be parsed? + "aria-valuenow": this._parse( this.element.val() ) + }); + }, + + // update the value without triggering change + _value: function( value, allowAny ) { + var parsed; + if ( value !== "" ) { + parsed = this._parse( value ); + if ( parsed !== null ) { + if ( !allowAny ) { + parsed = this._adjustValue( parsed ); + } + value = this._format( parsed ); + } + } + this.element.val( value ); + this._refresh(); + }, + + _destroy: function() { + this.element + .removeClass( "ui-spinner-input" ) + .prop( "disabled", false ) + .removeAttr( "autocomplete" ) + .removeAttr( "role" ) + .removeAttr( "aria-valuemin" ) + .removeAttr( "aria-valuemax" ) + .removeAttr( "aria-valuenow" ); + this.uiSpinner.replaceWith( this.element ); + }, + + stepUp: modifier(function( steps ) { + this._stepUp( steps ); + }), + _stepUp: function( steps ) { + if ( this._start() ) { + this._spin( (steps || 1) * this.options.step ); + this._stop(); + } + }, + + stepDown: modifier(function( steps ) { + this._stepDown( steps ); + }), + _stepDown: function( steps ) { + if ( this._start() ) { + this._spin( (steps || 1) * -this.options.step ); + this._stop(); + } + }, + + pageUp: modifier(function( pages ) { + this._stepUp( (pages || 1) * this.options.page ); + }), + + pageDown: modifier(function( pages ) { + this._stepDown( (pages || 1) * this.options.page ); + }), + + value: function( newVal ) { + if ( !arguments.length ) { + return this._parse( this.element.val() ); + } + modifier( this._value ).call( this, newVal ); + }, + + widget: function() { + return this.uiSpinner; + } +}); + +}( jQuery ) ); +(function( $, undefined ) { + +var tabId = 0, + rhash = /#.*$/; + +function getNextTabId() { + return ++tabId; +} + +function isLocal( anchor ) { + return anchor.hash.length > 1 && + decodeURIComponent( anchor.href.replace( rhash, "" ) ) === + decodeURIComponent( location.href.replace( rhash, "" ) ); +} + +$.widget( "ui.tabs", { + version: "1.10.0", + delay: 300, + options: { + active: null, + collapsible: false, + event: "click", + heightStyle: "content", + hide: null, + show: null, + + // callbacks + activate: null, + beforeActivate: null, + beforeLoad: null, + load: null + }, + + _create: function() { + var that = this, + options = this.options; + + this.running = false; + + this.element + .addClass( "ui-tabs ui-widget ui-widget-content ui-corner-all" ) + .toggleClass( "ui-tabs-collapsible", options.collapsible ) + // Prevent users from focusing disabled tabs via click + .delegate( ".ui-tabs-nav > li", "mousedown" + this.eventNamespace, function( event ) { + if ( $( this ).is( ".ui-state-disabled" ) ) { + event.preventDefault(); + } + }) + // support: IE <9 + // Preventing the default action in mousedown doesn't prevent IE + // from focusing the element, so if the anchor gets focused, blur. + // We don't have to worry about focusing the previously focused + // element since clicking on a non-focusable element should focus + // the body anyway. + .delegate( ".ui-tabs-anchor", "focus" + this.eventNamespace, function() { + if ( $( this ).closest( "li" ).is( ".ui-state-disabled" ) ) { + this.blur(); + } + }); + + this._processTabs(); + options.active = this._initialActive(); + + // Take disabling tabs via class attribute from HTML + // into account and update option properly. + if ( $.isArray( options.disabled ) ) { + options.disabled = $.unique( options.disabled.concat( + $.map( this.tabs.filter( ".ui-state-disabled" ), function( li ) { + return that.tabs.index( li ); + }) + ) ).sort(); + } + + // check for length avoids error when initializing empty list + if ( this.options.active !== false && this.anchors.length ) { + this.active = this._findActive( options.active ); + } else { + this.active = $(); + } + + this._refresh(); + + if ( this.active.length ) { + this.load( options.active ); + } + }, + + _initialActive: function() { + var active = this.options.active, + collapsible = this.options.collapsible, + locationHash = location.hash.substring( 1 ); + + if ( active === null ) { + // check the fragment identifier in the URL + if ( locationHash ) { + this.tabs.each(function( i, tab ) { + if ( $( tab ).attr( "aria-controls" ) === locationHash ) { + active = i; + return false; + } + }); + } + + // check for a tab marked active via a class + if ( active === null ) { + active = this.tabs.index( this.tabs.filter( ".ui-tabs-active" ) ); + } + + // no active tab, set to false + if ( active === null || active === -1 ) { + active = this.tabs.length ? 0 : false; + } + } + + // handle numbers: negative, out of range + if ( active !== false ) { + active = this.tabs.index( this.tabs.eq( active ) ); + if ( active === -1 ) { + active = collapsible ? false : 0; + } + } + + // don't allow collapsible: false and active: false + if ( !collapsible && active === false && this.anchors.length ) { + active = 0; + } + + return active; + }, + + _getCreateEventData: function() { + return { + tab: this.active, + panel: !this.active.length ? $() : this._getPanelForTab( this.active ) + }; + }, + + _tabKeydown: function( event ) { + /*jshint maxcomplexity:15*/ + var focusedTab = $( this.document[0].activeElement ).closest( "li" ), + selectedIndex = this.tabs.index( focusedTab ), + goingForward = true; + + if ( this._handlePageNav( event ) ) { + return; + } + + switch ( event.keyCode ) { + case $.ui.keyCode.RIGHT: + case $.ui.keyCode.DOWN: + selectedIndex++; + break; + case $.ui.keyCode.UP: + case $.ui.keyCode.LEFT: + goingForward = false; + selectedIndex--; + break; + case $.ui.keyCode.END: + selectedIndex = this.anchors.length - 1; + break; + case $.ui.keyCode.HOME: + selectedIndex = 0; + break; + case $.ui.keyCode.SPACE: + // Activate only, no collapsing + event.preventDefault(); + clearTimeout( this.activating ); + this._activate( selectedIndex ); + return; + case $.ui.keyCode.ENTER: + // Toggle (cancel delayed activation, allow collapsing) + event.preventDefault(); + clearTimeout( this.activating ); + // Determine if we should collapse or activate + this._activate( selectedIndex === this.options.active ? false : selectedIndex ); + return; + default: + return; + } + + // Focus the appropriate tab, based on which key was pressed + event.preventDefault(); + clearTimeout( this.activating ); + selectedIndex = this._focusNextTab( selectedIndex, goingForward ); + + // Navigating with control key will prevent automatic activation + if ( !event.ctrlKey ) { + // Update aria-selected immediately so that AT think the tab is already selected. + // Otherwise AT may confuse the user by stating that they need to activate the tab, + // but the tab will already be activated by the time the announcement finishes. + focusedTab.attr( "aria-selected", "false" ); + this.tabs.eq( selectedIndex ).attr( "aria-selected", "true" ); + + this.activating = this._delay(function() { + this.option( "active", selectedIndex ); + }, this.delay ); + } + }, + + _panelKeydown: function( event ) { + if ( this._handlePageNav( event ) ) { + return; + } + + // Ctrl+up moves focus to the current tab + if ( event.ctrlKey && event.keyCode === $.ui.keyCode.UP ) { + event.preventDefault(); + this.active.focus(); + } + }, + + // Alt+page up/down moves focus to the previous/next tab (and activates) + _handlePageNav: function( event ) { + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP ) { + this._activate( this._focusNextTab( this.options.active - 1, false ) ); + return true; + } + if ( event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN ) { + this._activate( this._focusNextTab( this.options.active + 1, true ) ); + return true; + } + }, + + _findNextTab: function( index, goingForward ) { + var lastTabIndex = this.tabs.length - 1; + + function constrain() { + if ( index > lastTabIndex ) { + index = 0; + } + if ( index < 0 ) { + index = lastTabIndex; + } + return index; + } + + while ( $.inArray( constrain(), this.options.disabled ) !== -1 ) { + index = goingForward ? index + 1 : index - 1; + } + + return index; + }, + + _focusNextTab: function( index, goingForward ) { + index = this._findNextTab( index, goingForward ); + this.tabs.eq( index ).focus(); + return index; + }, + + _setOption: function( key, value ) { + if ( key === "active" ) { + // _activate() will handle invalid values and update this.options + this._activate( value ); + return; + } + + if ( key === "disabled" ) { + // don't use the widget factory's disabled handling + this._setupDisabled( value ); + return; + } + + this._super( key, value); + + if ( key === "collapsible" ) { + this.element.toggleClass( "ui-tabs-collapsible", value ); + // Setting collapsible: false while collapsed; open first panel + if ( !value && this.options.active === false ) { + this._activate( 0 ); + } + } + + if ( key === "event" ) { + this._setupEvents( value ); + } + + if ( key === "heightStyle" ) { + this._setupHeightStyle( value ); + } + }, + + _tabId: function( tab ) { + return tab.attr( "aria-controls" ) || "ui-tabs-" + getNextTabId(); + }, + + _sanitizeSelector: function( hash ) { + return hash ? hash.replace( /[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, "\\$&" ) : ""; + }, + + refresh: function() { + var options = this.options, + lis = this.tablist.children( ":has(a[href])" ); + + // get disabled tabs from class attribute from HTML + // this will get converted to a boolean if needed in _refresh() + options.disabled = $.map( lis.filter( ".ui-state-disabled" ), function( tab ) { + return lis.index( tab ); + }); + + this._processTabs(); + + // was collapsed or no tabs + if ( options.active === false || !this.anchors.length ) { + options.active = false; + this.active = $(); + // was active, but active tab is gone + } else if ( this.active.length && !$.contains( this.tablist[ 0 ], this.active[ 0 ] ) ) { + // all remaining tabs are disabled + if ( this.tabs.length === options.disabled.length ) { + options.active = false; + this.active = $(); + // activate previous tab + } else { + this._activate( this._findNextTab( Math.max( 0, options.active - 1 ), false ) ); + } + // was active, active tab still exists + } else { + // make sure active index is correct + options.active = this.tabs.index( this.active ); + } + + this._refresh(); + }, + + _refresh: function() { + this._setupDisabled( this.options.disabled ); + this._setupEvents( this.options.event ); + this._setupHeightStyle( this.options.heightStyle ); + + this.tabs.not( this.active ).attr({ + "aria-selected": "false", + tabIndex: -1 + }); + this.panels.not( this._getPanelForTab( this.active ) ) + .hide() + .attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + + // Make sure one tab is in the tab order + if ( !this.active.length ) { + this.tabs.eq( 0 ).attr( "tabIndex", 0 ); + } else { + this.active + .addClass( "ui-tabs-active ui-state-active" ) + .attr({ + "aria-selected": "true", + tabIndex: 0 + }); + this._getPanelForTab( this.active ) + .show() + .attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + } + }, + + _processTabs: function() { + var that = this; + + this.tablist = this._getList() + .addClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .attr( "role", "tablist" ); + + this.tabs = this.tablist.find( "> li:has(a[href])" ) + .addClass( "ui-state-default ui-corner-top" ) + .attr({ + role: "tab", + tabIndex: -1 + }); + + this.anchors = this.tabs.map(function() { + return $( "a", this )[ 0 ]; + }) + .addClass( "ui-tabs-anchor" ) + .attr({ + role: "presentation", + tabIndex: -1 + }); + + this.panels = $(); + + this.anchors.each(function( i, anchor ) { + var selector, panel, panelId, + anchorId = $( anchor ).uniqueId().attr( "id" ), + tab = $( anchor ).closest( "li" ), + originalAriaControls = tab.attr( "aria-controls" ); + + // inline tab + if ( isLocal( anchor ) ) { + selector = anchor.hash; + panel = that.element.find( that._sanitizeSelector( selector ) ); + // remote tab + } else { + panelId = that._tabId( tab ); + selector = "#" + panelId; + panel = that.element.find( selector ); + if ( !panel.length ) { + panel = that._createPanel( panelId ); + panel.insertAfter( that.panels[ i - 1 ] || that.tablist ); + } + panel.attr( "aria-live", "polite" ); + } + + if ( panel.length) { + that.panels = that.panels.add( panel ); + } + if ( originalAriaControls ) { + tab.data( "ui-tabs-aria-controls", originalAriaControls ); + } + tab.attr({ + "aria-controls": selector.substring( 1 ), + "aria-labelledby": anchorId + }); + panel.attr( "aria-labelledby", anchorId ); + }); + + this.panels + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .attr( "role", "tabpanel" ); + }, + + // allow overriding how to find the list for rare usage scenarios (#7715) + _getList: function() { + return this.element.find( "ol,ul" ).eq( 0 ); + }, + + _createPanel: function( id ) { + return $( "<div>" ) + .attr( "id", id ) + .addClass( "ui-tabs-panel ui-widget-content ui-corner-bottom" ) + .data( "ui-tabs-destroy", true ); + }, + + _setupDisabled: function( disabled ) { + if ( $.isArray( disabled ) ) { + if ( !disabled.length ) { + disabled = false; + } else if ( disabled.length === this.anchors.length ) { + disabled = true; + } + } + + // disable tabs + for ( var i = 0, li; ( li = this.tabs[ i ] ); i++ ) { + if ( disabled === true || $.inArray( i, disabled ) !== -1 ) { + $( li ) + .addClass( "ui-state-disabled" ) + .attr( "aria-disabled", "true" ); + } else { + $( li ) + .removeClass( "ui-state-disabled" ) + .removeAttr( "aria-disabled" ); + } + } + + this.options.disabled = disabled; + }, + + _setupEvents: function( event ) { + var events = { + click: function( event ) { + event.preventDefault(); + } + }; + if ( event ) { + $.each( event.split(" "), function( index, eventName ) { + events[ eventName ] = "_eventHandler"; + }); + } + + this._off( this.anchors.add( this.tabs ).add( this.panels ) ); + this._on( this.anchors, events ); + this._on( this.tabs, { keydown: "_tabKeydown" } ); + this._on( this.panels, { keydown: "_panelKeydown" } ); + + this._focusable( this.tabs ); + this._hoverable( this.tabs ); + }, + + _setupHeightStyle: function( heightStyle ) { + var maxHeight, + parent = this.element.parent(); + + if ( heightStyle === "fill" ) { + maxHeight = parent.height(); + maxHeight -= this.element.outerHeight() - this.element.height(); + + this.element.siblings( ":visible" ).each(function() { + var elem = $( this ), + position = elem.css( "position" ); + + if ( position === "absolute" || position === "fixed" ) { + return; + } + maxHeight -= elem.outerHeight( true ); + }); + + this.element.children().not( this.panels ).each(function() { + maxHeight -= $( this ).outerHeight( true ); + }); + + this.panels.each(function() { + $( this ).height( Math.max( 0, maxHeight - + $( this ).innerHeight() + $( this ).height() ) ); + }) + .css( "overflow", "auto" ); + } else if ( heightStyle === "auto" ) { + maxHeight = 0; + this.panels.each(function() { + maxHeight = Math.max( maxHeight, $( this ).height( "" ).height() ); + }).height( maxHeight ); + } + }, + + _eventHandler: function( event ) { + var options = this.options, + active = this.active, + anchor = $( event.currentTarget ), + tab = anchor.closest( "li" ), + clickedIsActive = tab[ 0 ] === active[ 0 ], + collapsing = clickedIsActive && options.collapsible, + toShow = collapsing ? $() : this._getPanelForTab( tab ), + toHide = !active.length ? $() : this._getPanelForTab( active ), + eventData = { + oldTab: active, + oldPanel: toHide, + newTab: collapsing ? $() : tab, + newPanel: toShow + }; + + event.preventDefault(); + + if ( tab.hasClass( "ui-state-disabled" ) || + // tab is already loading + tab.hasClass( "ui-tabs-loading" ) || + // can't switch durning an animation + this.running || + // click on active header, but not collapsible + ( clickedIsActive && !options.collapsible ) || + // allow canceling activation + ( this._trigger( "beforeActivate", event, eventData ) === false ) ) { + return; + } + + options.active = collapsing ? false : this.tabs.index( tab ); + + this.active = clickedIsActive ? $() : tab; + if ( this.xhr ) { + this.xhr.abort(); + } + + if ( !toHide.length && !toShow.length ) { + $.error( "jQuery UI Tabs: Mismatching fragment identifier." ); + } + + if ( toShow.length ) { + this.load( this.tabs.index( tab ), event ); + } + this._toggle( event, eventData ); + }, + + // handles show/hide for selecting tabs + _toggle: function( event, eventData ) { + var that = this, + toShow = eventData.newPanel, + toHide = eventData.oldPanel; + + this.running = true; + + function complete() { + that.running = false; + that._trigger( "activate", event, eventData ); + } + + function show() { + eventData.newTab.closest( "li" ).addClass( "ui-tabs-active ui-state-active" ); + + if ( toShow.length && that.options.show ) { + that._show( toShow, that.options.show, complete ); + } else { + toShow.show(); + complete(); + } + } + + // start out by hiding, then showing, then completing + if ( toHide.length && this.options.hide ) { + this._hide( toHide, this.options.hide, function() { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + show(); + }); + } else { + eventData.oldTab.closest( "li" ).removeClass( "ui-tabs-active ui-state-active" ); + toHide.hide(); + show(); + } + + toHide.attr({ + "aria-expanded": "false", + "aria-hidden": "true" + }); + eventData.oldTab.attr( "aria-selected", "false" ); + // If we're switching tabs, remove the old tab from the tab order. + // If we're opening from collapsed state, remove the previous tab from the tab order. + // If we're collapsing, then keep the collapsing tab in the tab order. + if ( toShow.length && toHide.length ) { + eventData.oldTab.attr( "tabIndex", -1 ); + } else if ( toShow.length ) { + this.tabs.filter(function() { + return $( this ).attr( "tabIndex" ) === 0; + }) + .attr( "tabIndex", -1 ); + } + + toShow.attr({ + "aria-expanded": "true", + "aria-hidden": "false" + }); + eventData.newTab.attr({ + "aria-selected": "true", + tabIndex: 0 + }); + }, + + _activate: function( index ) { + var anchor, + active = this._findActive( index ); + + // trying to activate the already active panel + if ( active[ 0 ] === this.active[ 0 ] ) { + return; + } + + // trying to collapse, simulate a click on the current active header + if ( !active.length ) { + active = this.active; + } + + anchor = active.find( ".ui-tabs-anchor" )[ 0 ]; + this._eventHandler({ + target: anchor, + currentTarget: anchor, + preventDefault: $.noop + }); + }, + + _findActive: function( index ) { + return index === false ? $() : this.tabs.eq( index ); + }, + + _getIndex: function( index ) { + // meta-function to give users option to provide a href string instead of a numerical index. + if ( typeof index === "string" ) { + index = this.anchors.index( this.anchors.filter( "[href$='" + index + "']" ) ); + } + + return index; + }, + + _destroy: function() { + if ( this.xhr ) { + this.xhr.abort(); + } + + this.element.removeClass( "ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible" ); + + this.tablist + .removeClass( "ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all" ) + .removeAttr( "role" ); + + this.anchors + .removeClass( "ui-tabs-anchor" ) + .removeAttr( "role" ) + .removeAttr( "tabIndex" ) + .removeUniqueId(); + + this.tabs.add( this.panels ).each(function() { + if ( $.data( this, "ui-tabs-destroy" ) ) { + $( this ).remove(); + } else { + $( this ) + .removeClass( "ui-state-default ui-state-active ui-state-disabled " + + "ui-corner-top ui-corner-bottom ui-widget-content ui-tabs-active ui-tabs-panel" ) + .removeAttr( "tabIndex" ) + .removeAttr( "aria-live" ) + .removeAttr( "aria-busy" ) + .removeAttr( "aria-selected" ) + .removeAttr( "aria-labelledby" ) + .removeAttr( "aria-hidden" ) + .removeAttr( "aria-expanded" ) + .removeAttr( "role" ); + } + }); + + this.tabs.each(function() { + var li = $( this ), + prev = li.data( "ui-tabs-aria-controls" ); + if ( prev ) { + li + .attr( "aria-controls", prev ) + .removeData( "ui-tabs-aria-controls" ); + } else { + li.removeAttr( "aria-controls" ); + } + }); + + this.panels.show(); + + if ( this.options.heightStyle !== "content" ) { + this.panels.css( "height", "" ); + } + }, + + enable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === false ) { + return; + } + + if ( index === undefined ) { + disabled = false; + } else { + index = this._getIndex( index ); + if ( $.isArray( disabled ) ) { + disabled = $.map( disabled, function( num ) { + return num !== index ? num : null; + }); + } else { + disabled = $.map( this.tabs, function( li, num ) { + return num !== index ? num : null; + }); + } + } + this._setupDisabled( disabled ); + }, + + disable: function( index ) { + var disabled = this.options.disabled; + if ( disabled === true ) { + return; + } + + if ( index === undefined ) { + disabled = true; + } else { + index = this._getIndex( index ); + if ( $.inArray( index, disabled ) !== -1 ) { + return; + } + if ( $.isArray( disabled ) ) { + disabled = $.merge( [ index ], disabled ).sort(); + } else { + disabled = [ index ]; + } + } + this._setupDisabled( disabled ); + }, + + load: function( index, event ) { + index = this._getIndex( index ); + var that = this, + tab = this.tabs.eq( index ), + anchor = tab.find( ".ui-tabs-anchor" ), + panel = this._getPanelForTab( tab ), + eventData = { + tab: tab, + panel: panel + }; + + // not remote + if ( isLocal( anchor[ 0 ] ) ) { + return; + } + + this.xhr = $.ajax( this._ajaxSettings( anchor, event, eventData ) ); + + // support: jQuery <1.8 + // jQuery <1.8 returns false if the request is canceled in beforeSend, + // but as of 1.8, $.ajax() always returns a jqXHR object. + if ( this.xhr && this.xhr.statusText !== "canceled" ) { + tab.addClass( "ui-tabs-loading" ); + panel.attr( "aria-busy", "true" ); + + this.xhr + .success(function( response ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + panel.html( response ); + that._trigger( "load", event, eventData ); + }, 1 ); + }) + .complete(function( jqXHR, status ) { + // support: jQuery <1.8 + // http://bugs.jquery.com/ticket/11778 + setTimeout(function() { + if ( status === "abort" ) { + that.panels.stop( false, true ); + } + + tab.removeClass( "ui-tabs-loading" ); + panel.removeAttr( "aria-busy" ); + + if ( jqXHR === that.xhr ) { + delete that.xhr; + } + }, 1 ); + }); + } + }, + + _ajaxSettings: function( anchor, event, eventData ) { + var that = this; + return { + url: anchor.attr( "href" ), + beforeSend: function( jqXHR, settings ) { + return that._trigger( "beforeLoad", event, + $.extend( { jqXHR : jqXHR, ajaxSettings: settings }, eventData ) ); + } + }; + }, + + _getPanelForTab: function( tab ) { + var id = $( tab ).attr( "aria-controls" ); + return this.element.find( this._sanitizeSelector( "#" + id ) ); + } +}); + +})( jQuery ); +(function( $ ) { + +var increments = 0; + +function addDescribedBy( elem, id ) { + var describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ); + describedby.push( id ); + elem + .data( "ui-tooltip-id", id ) + .attr( "aria-describedby", $.trim( describedby.join( " " ) ) ); +} + +function removeDescribedBy( elem ) { + var id = elem.data( "ui-tooltip-id" ), + describedby = (elem.attr( "aria-describedby" ) || "").split( /\s+/ ), + index = $.inArray( id, describedby ); + if ( index !== -1 ) { + describedby.splice( index, 1 ); + } + + elem.removeData( "ui-tooltip-id" ); + describedby = $.trim( describedby.join( " " ) ); + if ( describedby ) { + elem.attr( "aria-describedby", describedby ); + } else { + elem.removeAttr( "aria-describedby" ); + } +} + +$.widget( "ui.tooltip", { + version: "1.10.0", + options: { + content: function() { + // support: IE<9, Opera in jQuery <1.7 + // .text() can't accept undefined, so coerce to a string + var title = $( this ).attr( "title" ) || ""; + // Escape title, since we're going from an attribute to raw HTML + return $( "<a>" ).text( title ).html(); + }, + hide: true, + // Disabled elements have inconsistent behavior across browsers (#8661) + items: "[title]:not([disabled])", + position: { + my: "left top+15", + at: "left bottom", + collision: "flipfit flip" + }, + show: true, + tooltipClass: null, + track: false, + + // callbacks + close: null, + open: null + }, + + _create: function() { + this._on({ + mouseover: "open", + focusin: "open" + }); + + // IDs of generated tooltips, needed for destroy + this.tooltips = {}; + // IDs of parent tooltips where we removed the title attribute + this.parents = {}; + + if ( this.options.disabled ) { + this._disable(); + } + }, + + _setOption: function( key, value ) { + var that = this; + + if ( key === "disabled" ) { + this[ value ? "_disable" : "_enable" ](); + this.options[ key ] = value; + // disable element style changes + return; + } + + this._super( key, value ); + + if ( key === "content" ) { + $.each( this.tooltips, function( id, element ) { + that._updateContent( element ); + }); + } + }, + + _disable: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + }); + + // remove title attributes to prevent native tooltips + this.element.find( this.options.items ).addBack().each(function() { + var element = $( this ); + if ( element.is( "[title]" ) ) { + element + .data( "ui-tooltip-title", element.attr( "title" ) ) + .attr( "title", "" ); + } + }); + }, + + _enable: function() { + // restore title attributes + this.element.find( this.options.items ).addBack().each(function() { + var element = $( this ); + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + } + }); + }, + + open: function( event ) { + var that = this, + target = $( event ? event.target : this.element ) + // we need closest here due to mouseover bubbling, + // but always pointing at the same event target + .closest( this.options.items ); + + // No element to show a tooltip for or the tooltip is already open + if ( !target.length || target.data( "ui-tooltip-id" ) ) { + return; + } + + if ( target.attr( "title" ) ) { + target.data( "ui-tooltip-title", target.attr( "title" ) ); + } + + target.data( "ui-tooltip-open", true ); + + // kill parent tooltips, custom or native, for hover + if ( event && event.type === "mouseover" ) { + target.parents().each(function() { + var parent = $( this ), + blurEvent; + if ( parent.data( "ui-tooltip-open" ) ) { + blurEvent = $.Event( "blur" ); + blurEvent.target = blurEvent.currentTarget = this; + that.close( blurEvent, true ); + } + if ( parent.attr( "title" ) ) { + parent.uniqueId(); + that.parents[ this.id ] = { + element: this, + title: parent.attr( "title" ) + }; + parent.attr( "title", "" ); + } + }); + } + + this._updateContent( target, event ); + }, + + _updateContent: function( target, event ) { + var content, + contentOption = this.options.content, + that = this, + eventType = event ? event.type : null; + + if ( typeof contentOption === "string" ) { + return this._open( event, target, contentOption ); + } + + content = contentOption.call( target[0], function( response ) { + // ignore async response if tooltip was closed already + if ( !target.data( "ui-tooltip-open" ) ) { + return; + } + // IE may instantly serve a cached response for ajax requests + // delay this call to _open so the other call to _open runs first + that._delay(function() { + // jQuery creates a special event for focusin when it doesn't + // exist natively. To improve performance, the native event + // object is reused and the type is changed. Therefore, we can't + // rely on the type being correct after the event finished + // bubbling, so we set it back to the previous value. (#8740) + if ( event ) { + event.type = eventType; + } + this._open( event, target, response ); + }); + }); + if ( content ) { + this._open( event, target, content ); + } + }, + + _open: function( event, target, content ) { + var tooltip, events, delayedShow, + positionOption = $.extend( {}, this.options.position ); + + if ( !content ) { + return; + } + + // Content can be updated multiple times. If the tooltip already + // exists, then just update the content and bail. + tooltip = this._find( target ); + if ( tooltip.length ) { + tooltip.find( ".ui-tooltip-content" ).html( content ); + return; + } + + // if we have a title, clear it to prevent the native tooltip + // we have to check first to avoid defining a title if none exists + // (we don't want to cause an element to start matching [title]) + // + // We use removeAttr only for key events, to allow IE to export the correct + // accessible attributes. For mouse events, set to empty string to avoid + // native tooltip showing up (happens only when removing inside mouseover). + if ( target.is( "[title]" ) ) { + if ( event && event.type === "mouseover" ) { + target.attr( "title", "" ); + } else { + target.removeAttr( "title" ); + } + } + + tooltip = this._tooltip( target ); + addDescribedBy( target, tooltip.attr( "id" ) ); + tooltip.find( ".ui-tooltip-content" ).html( content ); + + function position( event ) { + positionOption.of = event; + if ( tooltip.is( ":hidden" ) ) { + return; + } + tooltip.position( positionOption ); + } + if ( this.options.track && event && /^mouse/.test( event.type ) ) { + this._on( this.document, { + mousemove: position + }); + // trigger once to override element-relative positioning + position( event ); + } else { + tooltip.position( $.extend({ + of: target + }, this.options.position ) ); + } + + tooltip.hide(); + + this._show( tooltip, this.options.show ); + // Handle tracking tooltips that are shown with a delay (#8644). As soon + // as the tooltip is visible, position the tooltip using the most recent + // event. + if ( this.options.show && this.options.show.delay ) { + delayedShow = this.delayedShow = setInterval(function() { + if ( tooltip.is( ":visible" ) ) { + position( positionOption.of ); + clearInterval( delayedShow ); + } + }, $.fx.interval ); + } + + this._trigger( "open", event, { tooltip: tooltip } ); + + events = { + keyup: function( event ) { + if ( event.keyCode === $.ui.keyCode.ESCAPE ) { + var fakeEvent = $.Event(event); + fakeEvent.currentTarget = target[0]; + this.close( fakeEvent, true ); + } + }, + remove: function() { + this._removeTooltip( tooltip ); + } + }; + if ( !event || event.type === "mouseover" ) { + events.mouseleave = "close"; + } + if ( !event || event.type === "focusin" ) { + events.focusout = "close"; + } + this._on( true, target, events ); + }, + + close: function( event ) { + var that = this, + target = $( event ? event.currentTarget : this.element ), + tooltip = this._find( target ); + + // disabling closes the tooltip, so we need to track when we're closing + // to avoid an infinite loop in case the tooltip becomes disabled on close + if ( this.closing ) { + return; + } + + // Clear the interval for delayed tracking tooltips + clearInterval( this.delayedShow ); + + // only set title if we had one before (see comment in _open()) + if ( target.data( "ui-tooltip-title" ) ) { + target.attr( "title", target.data( "ui-tooltip-title" ) ); + } + + removeDescribedBy( target ); + + tooltip.stop( true ); + this._hide( tooltip, this.options.hide, function() { + that._removeTooltip( $( this ) ); + }); + + target.removeData( "ui-tooltip-open" ); + this._off( target, "mouseleave focusout keyup" ); + // Remove 'remove' binding only on delegated targets + if ( target[0] !== this.element[0] ) { + this._off( target, "remove" ); + } + this._off( this.document, "mousemove" ); + + if ( event && event.type === "mouseleave" ) { + $.each( this.parents, function( id, parent ) { + $( parent.element ).attr( "title", parent.title ); + delete that.parents[ id ]; + }); + } + + this.closing = true; + this._trigger( "close", event, { tooltip: tooltip } ); + this.closing = false; + }, + + _tooltip: function( element ) { + var id = "ui-tooltip-" + increments++, + tooltip = $( "<div>" ) + .attr({ + id: id, + role: "tooltip" + }) + .addClass( "ui-tooltip ui-widget ui-corner-all ui-widget-content " + + ( this.options.tooltipClass || "" ) ); + $( "<div>" ) + .addClass( "ui-tooltip-content" ) + .appendTo( tooltip ); + tooltip.appendTo( this.document[0].body ); + this.tooltips[ id ] = element; + return tooltip; + }, + + _find: function( target ) { + var id = target.data( "ui-tooltip-id" ); + return id ? $( "#" + id ) : $(); + }, + + _removeTooltip: function( tooltip ) { + tooltip.remove(); + delete this.tooltips[ tooltip.attr( "id" ) ]; + }, + + _destroy: function() { + var that = this; + + // close open tooltips + $.each( this.tooltips, function( id, element ) { + // Delegate to close method to handle common cleanup + var event = $.Event( "blur" ); + event.target = event.currentTarget = element[0]; + that.close( event, true ); + + // Remove immediately; destroying an open tooltip doesn't use the + // hide animation + $( "#" + id ).remove(); + + // Restore the title + if ( element.data( "ui-tooltip-title" ) ) { + element.attr( "title", element.data( "ui-tooltip-title" ) ); + element.removeData( "ui-tooltip-title" ); + } + }); + } +}); + +}( jQuery ) ); +;(jQuery.effects || (function($, undefined) { + +var dataSpace = "ui-effects-"; + +$.effects = { + effect: {} +}; + +/*! + * jQuery Color Animations v2.1.2 + * https://github.com/jquery/jquery-color + * + * Copyright 2013 jQuery Foundation and other contributors + * Released under the MIT license. + * http://jquery.org/license + * + * Date: Wed Jan 16 08:47:09 2013 -0600 + */ +(function( jQuery, undefined ) { + + var stepHooks = "backgroundColor borderBottomColor borderLeftColor borderRightColor borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor", + + // plusequals test for += 100 -= 100 + rplusequals = /^([\-+])=\s*(\d+\.?\d*)/, + // a set of RE's that can match strings and generate color tuples. + stringParsers = [{ + re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ], + execResult[ 3 ], + execResult[ 4 ] + ]; + } + }, { + re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + parse: function( execResult ) { + return [ + execResult[ 1 ] * 2.55, + execResult[ 2 ] * 2.55, + execResult[ 3 ] * 2.55, + execResult[ 4 ] + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ], 16 ) + ]; + } + }, { + // this regex ignores A-F because it's compared against an already lowercased string + re: /#([a-f0-9])([a-f0-9])([a-f0-9])/, + parse: function( execResult ) { + return [ + parseInt( execResult[ 1 ] + execResult[ 1 ], 16 ), + parseInt( execResult[ 2 ] + execResult[ 2 ], 16 ), + parseInt( execResult[ 3 ] + execResult[ 3 ], 16 ) + ]; + } + }, { + re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/, + space: "hsla", + parse: function( execResult ) { + return [ + execResult[ 1 ], + execResult[ 2 ] / 100, + execResult[ 3 ] / 100, + execResult[ 4 ] + ]; + } + }], + + // jQuery.Color( ) + color = jQuery.Color = function( color, green, blue, alpha ) { + return new jQuery.Color.fn.parse( color, green, blue, alpha ); + }, + spaces = { + rgba: { + props: { + red: { + idx: 0, + type: "byte" + }, + green: { + idx: 1, + type: "byte" + }, + blue: { + idx: 2, + type: "byte" + } + } + }, + + hsla: { + props: { + hue: { + idx: 0, + type: "degrees" + }, + saturation: { + idx: 1, + type: "percent" + }, + lightness: { + idx: 2, + type: "percent" + } + } + } + }, + propTypes = { + "byte": { + floor: true, + max: 255 + }, + "percent": { + max: 1 + }, + "degrees": { + mod: 360, + floor: true + } + }, + support = color.support = {}, + + // element for support tests + supportElem = jQuery( "<p>" )[ 0 ], + + // colors = jQuery.Color.names + colors, + + // local aliases of functions called often + each = jQuery.each; + +// determine rgba support immediately +supportElem.style.cssText = "background-color:rgba(1,1,1,.5)"; +support.rgba = supportElem.style.backgroundColor.indexOf( "rgba" ) > -1; + +// define cache name and alpha properties +// for rgba and hsla spaces +each( spaces, function( spaceName, space ) { + space.cache = "_" + spaceName; + space.props.alpha = { + idx: 3, + type: "percent", + def: 1 + }; +}); + +function clamp( value, prop, allowEmpty ) { + var type = propTypes[ prop.type ] || {}; + + if ( value == null ) { + return (allowEmpty || !prop.def) ? null : prop.def; + } + + // ~~ is an short way of doing floor for positive numbers + value = type.floor ? ~~value : parseFloat( value ); + + // IE will pass in empty strings as value for alpha, + // which will hit this case + if ( isNaN( value ) ) { + return prop.def; + } + + if ( type.mod ) { + // we add mod before modding to make sure that negatives values + // get converted properly: -10 -> 350 + return (value + type.mod) % type.mod; + } + + // for now all property types without mod have min and max + return 0 > value ? 0 : type.max < value ? type.max : value; +} + +function stringParse( string ) { + var inst = color(), + rgba = inst._rgba = []; + + string = string.toLowerCase(); + + each( stringParsers, function( i, parser ) { + var parsed, + match = parser.re.exec( string ), + values = match && parser.parse( match ), + spaceName = parser.space || "rgba"; + + if ( values ) { + parsed = inst[ spaceName ]( values ); + + // if this was an rgba parse the assignment might happen twice + // oh well.... + inst[ spaces[ spaceName ].cache ] = parsed[ spaces[ spaceName ].cache ]; + rgba = inst._rgba = parsed._rgba; + + // exit each( stringParsers ) here because we matched + return false; + } + }); + + // Found a stringParser that handled it + if ( rgba.length ) { + + // if this came from a parsed string, force "transparent" when alpha is 0 + // chrome, (and maybe others) return "transparent" as rgba(0,0,0,0) + if ( rgba.join() === "0,0,0,0" ) { + jQuery.extend( rgba, colors.transparent ); + } + return inst; + } + + // named colors + return colors[ string ]; +} + +color.fn = jQuery.extend( color.prototype, { + parse: function( red, green, blue, alpha ) { + if ( red === undefined ) { + this._rgba = [ null, null, null, null ]; + return this; + } + if ( red.jquery || red.nodeType ) { + red = jQuery( red ).css( green ); + green = undefined; + } + + var inst = this, + type = jQuery.type( red ), + rgba = this._rgba = []; + + // more than 1 argument specified - assume ( red, green, blue, alpha ) + if ( green !== undefined ) { + red = [ red, green, blue, alpha ]; + type = "array"; + } + + if ( type === "string" ) { + return this.parse( stringParse( red ) || colors._default ); + } + + if ( type === "array" ) { + each( spaces.rgba.props, function( key, prop ) { + rgba[ prop.idx ] = clamp( red[ prop.idx ], prop ); + }); + return this; + } + + if ( type === "object" ) { + if ( red instanceof color ) { + each( spaces, function( spaceName, space ) { + if ( red[ space.cache ] ) { + inst[ space.cache ] = red[ space.cache ].slice(); + } + }); + } else { + each( spaces, function( spaceName, space ) { + var cache = space.cache; + each( space.props, function( key, prop ) { + + // if the cache doesn't exist, and we know how to convert + if ( !inst[ cache ] && space.to ) { + + // if the value was null, we don't need to copy it + // if the key was alpha, we don't need to copy it either + if ( key === "alpha" || red[ key ] == null ) { + return; + } + inst[ cache ] = space.to( inst._rgba ); + } + + // this is the only case where we allow nulls for ALL properties. + // call clamp with alwaysAllowEmpty + inst[ cache ][ prop.idx ] = clamp( red[ key ], prop, true ); + }); + + // everything defined but alpha? + if ( inst[ cache ] && jQuery.inArray( null, inst[ cache ].slice( 0, 3 ) ) < 0 ) { + // use the default of 1 + inst[ cache ][ 3 ] = 1; + if ( space.from ) { + inst._rgba = space.from( inst[ cache ] ); + } + } + }); + } + return this; + } + }, + is: function( compare ) { + var is = color( compare ), + same = true, + inst = this; + + each( spaces, function( _, space ) { + var localCache, + isCache = is[ space.cache ]; + if (isCache) { + localCache = inst[ space.cache ] || space.to && space.to( inst._rgba ) || []; + each( space.props, function( _, prop ) { + if ( isCache[ prop.idx ] != null ) { + same = ( isCache[ prop.idx ] === localCache[ prop.idx ] ); + return same; + } + }); + } + return same; + }); + return same; + }, + _space: function() { + var used = [], + inst = this; + each( spaces, function( spaceName, space ) { + if ( inst[ space.cache ] ) { + used.push( spaceName ); + } + }); + return used.pop(); + }, + transition: function( other, distance ) { + var end = color( other ), + spaceName = end._space(), + space = spaces[ spaceName ], + startColor = this.alpha() === 0 ? color( "transparent" ) : this, + start = startColor[ space.cache ] || space.to( startColor._rgba ), + result = start.slice(); + + end = end[ space.cache ]; + each( space.props, function( key, prop ) { + var index = prop.idx, + startValue = start[ index ], + endValue = end[ index ], + type = propTypes[ prop.type ] || {}; + + // if null, don't override start value + if ( endValue === null ) { + return; + } + // if null - use end + if ( startValue === null ) { + result[ index ] = endValue; + } else { + if ( type.mod ) { + if ( endValue - startValue > type.mod / 2 ) { + startValue += type.mod; + } else if ( startValue - endValue > type.mod / 2 ) { + startValue -= type.mod; + } + } + result[ index ] = clamp( ( endValue - startValue ) * distance + startValue, prop ); + } + }); + return this[ spaceName ]( result ); + }, + blend: function( opaque ) { + // if we are already opaque - return ourself + if ( this._rgba[ 3 ] === 1 ) { + return this; + } + + var rgb = this._rgba.slice(), + a = rgb.pop(), + blend = color( opaque )._rgba; + + return color( jQuery.map( rgb, function( v, i ) { + return ( 1 - a ) * blend[ i ] + a * v; + })); + }, + toRgbaString: function() { + var prefix = "rgba(", + rgba = jQuery.map( this._rgba, function( v, i ) { + return v == null ? ( i > 2 ? 1 : 0 ) : v; + }); + + if ( rgba[ 3 ] === 1 ) { + rgba.pop(); + prefix = "rgb("; + } + + return prefix + rgba.join() + ")"; + }, + toHslaString: function() { + var prefix = "hsla(", + hsla = jQuery.map( this.hsla(), function( v, i ) { + if ( v == null ) { + v = i > 2 ? 1 : 0; + } + + // catch 1 and 2 + if ( i && i < 3 ) { + v = Math.round( v * 100 ) + "%"; + } + return v; + }); + + if ( hsla[ 3 ] === 1 ) { + hsla.pop(); + prefix = "hsl("; + } + return prefix + hsla.join() + ")"; + }, + toHexString: function( includeAlpha ) { + var rgba = this._rgba.slice(), + alpha = rgba.pop(); + + if ( includeAlpha ) { + rgba.push( ~~( alpha * 255 ) ); + } + + return "#" + jQuery.map( rgba, function( v ) { + + // default to 0 when nulls exist + v = ( v || 0 ).toString( 16 ); + return v.length === 1 ? "0" + v : v; + }).join(""); + }, + toString: function() { + return this._rgba[ 3 ] === 0 ? "transparent" : this.toRgbaString(); + } +}); +color.fn.parse.prototype = color.fn; + +// hsla conversions adapted from: +// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021 + +function hue2rgb( p, q, h ) { + h = ( h + 1 ) % 1; + if ( h * 6 < 1 ) { + return p + (q - p) * h * 6; + } + if ( h * 2 < 1) { + return q; + } + if ( h * 3 < 2 ) { + return p + (q - p) * ((2/3) - h) * 6; + } + return p; +} + +spaces.hsla.to = function ( rgba ) { + if ( rgba[ 0 ] == null || rgba[ 1 ] == null || rgba[ 2 ] == null ) { + return [ null, null, null, rgba[ 3 ] ]; + } + var r = rgba[ 0 ] / 255, + g = rgba[ 1 ] / 255, + b = rgba[ 2 ] / 255, + a = rgba[ 3 ], + max = Math.max( r, g, b ), + min = Math.min( r, g, b ), + diff = max - min, + add = max + min, + l = add * 0.5, + h, s; + + if ( min === max ) { + h = 0; + } else if ( r === max ) { + h = ( 60 * ( g - b ) / diff ) + 360; + } else if ( g === max ) { + h = ( 60 * ( b - r ) / diff ) + 120; + } else { + h = ( 60 * ( r - g ) / diff ) + 240; + } + + // chroma (diff) == 0 means greyscale which, by definition, saturation = 0% + // otherwise, saturation is based on the ratio of chroma (diff) to lightness (add) + if ( diff === 0 ) { + s = 0; + } else if ( l <= 0.5 ) { + s = diff / add; + } else { + s = diff / ( 2 - add ); + } + return [ Math.round(h) % 360, s, l, a == null ? 1 : a ]; +}; + +spaces.hsla.from = function ( hsla ) { + if ( hsla[ 0 ] == null || hsla[ 1 ] == null || hsla[ 2 ] == null ) { + return [ null, null, null, hsla[ 3 ] ]; + } + var h = hsla[ 0 ] / 360, + s = hsla[ 1 ], + l = hsla[ 2 ], + a = hsla[ 3 ], + q = l <= 0.5 ? l * ( 1 + s ) : l + s - l * s, + p = 2 * l - q; + + return [ + Math.round( hue2rgb( p, q, h + ( 1 / 3 ) ) * 255 ), + Math.round( hue2rgb( p, q, h ) * 255 ), + Math.round( hue2rgb( p, q, h - ( 1 / 3 ) ) * 255 ), + a + ]; +}; + + +each( spaces, function( spaceName, space ) { + var props = space.props, + cache = space.cache, + to = space.to, + from = space.from; + + // makes rgba() and hsla() + color.fn[ spaceName ] = function( value ) { + + // generate a cache for this space if it doesn't exist + if ( to && !this[ cache ] ) { + this[ cache ] = to( this._rgba ); + } + if ( value === undefined ) { + return this[ cache ].slice(); + } + + var ret, + type = jQuery.type( value ), + arr = ( type === "array" || type === "object" ) ? value : arguments, + local = this[ cache ].slice(); + + each( props, function( key, prop ) { + var val = arr[ type === "object" ? key : prop.idx ]; + if ( val == null ) { + val = local[ prop.idx ]; + } + local[ prop.idx ] = clamp( val, prop ); + }); + + if ( from ) { + ret = color( from( local ) ); + ret[ cache ] = local; + return ret; + } else { + return color( local ); + } + }; + + // makes red() green() blue() alpha() hue() saturation() lightness() + each( props, function( key, prop ) { + // alpha is included in more than one space + if ( color.fn[ key ] ) { + return; + } + color.fn[ key ] = function( value ) { + var vtype = jQuery.type( value ), + fn = ( key === "alpha" ? ( this._hsla ? "hsla" : "rgba" ) : spaceName ), + local = this[ fn ](), + cur = local[ prop.idx ], + match; + + if ( vtype === "undefined" ) { + return cur; + } + + if ( vtype === "function" ) { + value = value.call( this, cur ); + vtype = jQuery.type( value ); + } + if ( value == null && prop.empty ) { + return this; + } + if ( vtype === "string" ) { + match = rplusequals.exec( value ); + if ( match ) { + value = cur + parseFloat( match[ 2 ] ) * ( match[ 1 ] === "+" ? 1 : -1 ); + } + } + local[ prop.idx ] = value; + return this[ fn ]( local ); + }; + }); +}); + +// add cssHook and .fx.step function for each named hook. +// accept a space separated string of properties +color.hook = function( hook ) { + var hooks = hook.split( " " ); + each( hooks, function( i, hook ) { + jQuery.cssHooks[ hook ] = { + set: function( elem, value ) { + var parsed, curElem, + backgroundColor = ""; + + if ( value !== "transparent" && ( jQuery.type( value ) !== "string" || ( parsed = stringParse( value ) ) ) ) { + value = color( parsed || value ); + if ( !support.rgba && value._rgba[ 3 ] !== 1 ) { + curElem = hook === "backgroundColor" ? elem.parentNode : elem; + while ( + (backgroundColor === "" || backgroundColor === "transparent") && + curElem && curElem.style + ) { + try { + backgroundColor = jQuery.css( curElem, "backgroundColor" ); + curElem = curElem.parentNode; + } catch ( e ) { + } + } + + value = value.blend( backgroundColor && backgroundColor !== "transparent" ? + backgroundColor : + "_default" ); + } + + value = value.toRgbaString(); + } + try { + elem.style[ hook ] = value; + } catch( e ) { + // wrapped to prevent IE from throwing errors on "invalid" values like 'auto' or 'inherit' + } + } + }; + jQuery.fx.step[ hook ] = function( fx ) { + if ( !fx.colorInit ) { + fx.start = color( fx.elem, hook ); + fx.end = color( fx.end ); + fx.colorInit = true; + } + jQuery.cssHooks[ hook ].set( fx.elem, fx.start.transition( fx.end, fx.pos ) ); + }; + }); + +}; + +color.hook( stepHooks ); + +jQuery.cssHooks.borderColor = { + expand: function( value ) { + var expanded = {}; + + each( [ "Top", "Right", "Bottom", "Left" ], function( i, part ) { + expanded[ "border" + part + "Color" ] = value; + }); + return expanded; + } +}; + +// Basic color names only. +// Usage of any of the other color names requires adding yourself or including +// jquery.color.svg-names.js. +colors = jQuery.Color.names = { + // 4.1. Basic color keywords + aqua: "#00ffff", + black: "#000000", + blue: "#0000ff", + fuchsia: "#ff00ff", + gray: "#808080", + green: "#008000", + lime: "#00ff00", + maroon: "#800000", + navy: "#000080", + olive: "#808000", + purple: "#800080", + red: "#ff0000", + silver: "#c0c0c0", + teal: "#008080", + white: "#ffffff", + yellow: "#ffff00", + + // 4.2.3. "transparent" color keyword + transparent: [ null, null, null, 0 ], + + _default: "#ffffff" +}; + +})( jQuery ); + + +/******************************************************************************/ +/****************************** CLASS ANIMATIONS ******************************/ +/******************************************************************************/ +(function() { + +var classAnimationActions = [ "add", "remove", "toggle" ], + shorthandStyles = { + border: 1, + borderBottom: 1, + borderColor: 1, + borderLeft: 1, + borderRight: 1, + borderTop: 1, + borderWidth: 1, + margin: 1, + padding: 1 + }; + +$.each([ "borderLeftStyle", "borderRightStyle", "borderBottomStyle", "borderTopStyle" ], function( _, prop ) { + $.fx.step[ prop ] = function( fx ) { + if ( fx.end !== "none" && !fx.setAttr || fx.pos === 1 && !fx.setAttr ) { + jQuery.style( fx.elem, prop, fx.end ); + fx.setAttr = true; + } + }; +}); + +function getElementStyles( elem ) { + var key, len, + style = elem.ownerDocument.defaultView ? + elem.ownerDocument.defaultView.getComputedStyle( elem, null ) : + elem.currentStyle, + styles = {}; + + if ( style && style.length && style[ 0 ] && style[ style[ 0 ] ] ) { + len = style.length; + while ( len-- ) { + key = style[ len ]; + if ( typeof style[ key ] === "string" ) { + styles[ $.camelCase( key ) ] = style[ key ]; + } + } + // support: Opera, IE <9 + } else { + for ( key in style ) { + if ( typeof style[ key ] === "string" ) { + styles[ key ] = style[ key ]; + } + } + } + + return styles; +} + + +function styleDifference( oldStyle, newStyle ) { + var diff = {}, + name, value; + + for ( name in newStyle ) { + value = newStyle[ name ]; + if ( oldStyle[ name ] !== value ) { + if ( !shorthandStyles[ name ] ) { + if ( $.fx.step[ name ] || !isNaN( parseFloat( value ) ) ) { + diff[ name ] = value; + } + } + } + } + + return diff; +} + +// support: jQuery <1.8 +if ( !$.fn.addBack ) { + $.fn.addBack = function( selector ) { + return this.add( selector == null ? + this.prevObject : this.prevObject.filter( selector ) + ); + }; +} + +$.effects.animateClass = function( value, duration, easing, callback ) { + var o = $.speed( duration, easing, callback ); + + return this.queue( function() { + var animated = $( this ), + baseClass = animated.attr( "class" ) || "", + applyClassChange, + allAnimations = o.children ? animated.find( "*" ).addBack() : animated; + + // map the animated objects to store the original styles. + allAnimations = allAnimations.map(function() { + var el = $( this ); + return { + el: el, + start: getElementStyles( this ) + }; + }); + + // apply class change + applyClassChange = function() { + $.each( classAnimationActions, function(i, action) { + if ( value[ action ] ) { + animated[ action + "Class" ]( value[ action ] ); + } + }); + }; + applyClassChange(); + + // map all animated objects again - calculate new styles and diff + allAnimations = allAnimations.map(function() { + this.end = getElementStyles( this.el[ 0 ] ); + this.diff = styleDifference( this.start, this.end ); + return this; + }); + + // apply original class + animated.attr( "class", baseClass ); + + // map all animated objects again - this time collecting a promise + allAnimations = allAnimations.map(function() { + var styleInfo = this, + dfd = $.Deferred(), + opts = $.extend({}, o, { + queue: false, + complete: function() { + dfd.resolve( styleInfo ); + } + }); + + this.el.animate( this.diff, opts ); + return dfd.promise(); + }); + + // once all animations have completed: + $.when.apply( $, allAnimations.get() ).done(function() { + + // set the final class + applyClassChange(); + + // for each animated element, + // clear all css properties that were animated + $.each( arguments, function() { + var el = this.el; + $.each( this.diff, function(key) { + el.css( key, "" ); + }); + }); + + // this is guarnteed to be there if you use jQuery.speed() + // it also handles dequeuing the next anim... + o.complete.call( animated[ 0 ] ); + }); + }); +}; + +$.fn.extend({ + _addClass: $.fn.addClass, + addClass: function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { add: classNames }, speed, easing, callback ) : + this._addClass( classNames ); + }, + + _removeClass: $.fn.removeClass, + removeClass: function( classNames, speed, easing, callback ) { + return speed ? + $.effects.animateClass.call( this, + { remove: classNames }, speed, easing, callback ) : + this._removeClass( classNames ); + }, + + _toggleClass: $.fn.toggleClass, + toggleClass: function( classNames, force, speed, easing, callback ) { + if ( typeof force === "boolean" || force === undefined ) { + if ( !speed ) { + // without speed parameter + return this._toggleClass( classNames, force ); + } else { + return $.effects.animateClass.call( this, + (force ? { add: classNames } : { remove: classNames }), + speed, easing, callback ); + } + } else { + // without force parameter + return $.effects.animateClass.call( this, + { toggle: classNames }, force, speed, easing ); + } + }, + + switchClass: function( remove, add, speed, easing, callback) { + return $.effects.animateClass.call( this, { + add: add, + remove: remove + }, speed, easing, callback ); + } +}); + +})(); + +/******************************************************************************/ +/*********************************** EFFECTS **********************************/ +/******************************************************************************/ + +(function() { + +$.extend( $.effects, { + version: "1.10.0", + + // Saves a set of properties in a data storage + save: function( element, set ) { + for( var i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + element.data( dataSpace + set[ i ], element[ 0 ].style[ set[ i ] ] ); + } + } + }, + + // Restores a set of previously saved properties from a data storage + restore: function( element, set ) { + var val, i; + for( i=0; i < set.length; i++ ) { + if ( set[ i ] !== null ) { + val = element.data( dataSpace + set[ i ] ); + // support: jQuery 1.6.2 + // http://bugs.jquery.com/ticket/9917 + // jQuery 1.6.2 incorrectly returns undefined for any falsy value. + // We can't differentiate between "" and 0 here, so we just assume + // empty string since it's likely to be a more common value... + if ( val === undefined ) { + val = ""; + } + element.css( set[ i ], val ); + } + } + }, + + setMode: function( el, mode ) { + if (mode === "toggle") { + mode = el.is( ":hidden" ) ? "show" : "hide"; + } + return mode; + }, + + // Translates a [top,left] array into a baseline value + // this should be a little more flexible in the future to handle a string & hash + getBaseline: function( origin, original ) { + var y, x; + switch ( origin[ 0 ] ) { + case "top": y = 0; break; + case "middle": y = 0.5; break; + case "bottom": y = 1; break; + default: y = origin[ 0 ] / original.height; + } + switch ( origin[ 1 ] ) { + case "left": x = 0; break; + case "center": x = 0.5; break; + case "right": x = 1; break; + default: x = origin[ 1 ] / original.width; + } + return { + x: x, + y: y + }; + }, + + // Wraps the element around a wrapper that copies position properties + createWrapper: function( element ) { + + // if the element is already wrapped, return it + if ( element.parent().is( ".ui-effects-wrapper" )) { + return element.parent(); + } + + // wrap the element + var props = { + width: element.outerWidth(true), + height: element.outerHeight(true), + "float": element.css( "float" ) + }, + wrapper = $( "<div></div>" ) + .addClass( "ui-effects-wrapper" ) + .css({ + fontSize: "100%", + background: "transparent", + border: "none", + margin: 0, + padding: 0 + }), + // Store the size in case width/height are defined in % - Fixes #5245 + size = { + width: element.width(), + height: element.height() + }, + active = document.activeElement; + + // support: Firefox + // Firefox incorrectly exposes anonymous content + // https://bugzilla.mozilla.org/show_bug.cgi?id=561664 + try { + active.id; + } catch( e ) { + active = document.body; + } + + element.wrap( wrapper ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + + wrapper = element.parent(); //Hotfix for jQuery 1.4 since some change in wrap() seems to actually lose the reference to the wrapped element + + // transfer positioning properties to the wrapper + if ( element.css( "position" ) === "static" ) { + wrapper.css({ position: "relative" }); + element.css({ position: "relative" }); + } else { + $.extend( props, { + position: element.css( "position" ), + zIndex: element.css( "z-index" ) + }); + $.each([ "top", "left", "bottom", "right" ], function(i, pos) { + props[ pos ] = element.css( pos ); + if ( isNaN( parseInt( props[ pos ], 10 ) ) ) { + props[ pos ] = "auto"; + } + }); + element.css({ + position: "relative", + top: 0, + left: 0, + right: "auto", + bottom: "auto" + }); + } + element.css(size); + + return wrapper.css( props ).show(); + }, + + removeWrapper: function( element ) { + var active = document.activeElement; + + if ( element.parent().is( ".ui-effects-wrapper" ) ) { + element.parent().replaceWith( element ); + + // Fixes #7595 - Elements lose focus when wrapped. + if ( element[ 0 ] === active || $.contains( element[ 0 ], active ) ) { + $( active ).focus(); + } + } + + + return element; + }, + + setTransition: function( element, list, factor, value ) { + value = value || {}; + $.each( list, function( i, x ) { + var unit = element.cssUnit( x ); + if ( unit[ 0 ] > 0 ) { + value[ x ] = unit[ 0 ] * factor + unit[ 1 ]; + } + }); + return value; + } +}); + +// return an effect options object for the given parameters: +function _normalizeArguments( effect, options, speed, callback ) { + + // allow passing all options as the first parameter + if ( $.isPlainObject( effect ) ) { + options = effect; + effect = effect.effect; + } + + // convert to an object + effect = { effect: effect }; + + // catch (effect, null, ...) + if ( options == null ) { + options = {}; + } + + // catch (effect, callback) + if ( $.isFunction( options ) ) { + callback = options; + speed = null; + options = {}; + } + + // catch (effect, speed, ?) + if ( typeof options === "number" || $.fx.speeds[ options ] ) { + callback = speed; + speed = options; + options = {}; + } + + // catch (effect, options, callback) + if ( $.isFunction( speed ) ) { + callback = speed; + speed = null; + } + + // add options to effect + if ( options ) { + $.extend( effect, options ); + } + + speed = speed || options.duration; + effect.duration = $.fx.off ? 0 : + typeof speed === "number" ? speed : + speed in $.fx.speeds ? $.fx.speeds[ speed ] : + $.fx.speeds._default; + + effect.complete = callback || options.complete; + + return effect; +} + +function standardSpeed( speed ) { + // valid standard speeds + if ( !speed || typeof speed === "number" || $.fx.speeds[ speed ] ) { + return true; + } + + // invalid strings - treat as "normal" speed + return typeof speed === "string" && !$.effects.effect[ speed ]; +} + +$.fn.extend({ + effect: function( /* effect, options, speed, callback */ ) { + var args = _normalizeArguments.apply( this, arguments ), + mode = args.mode, + queue = args.queue, + effectMethod = $.effects.effect[ args.effect ]; + + if ( $.fx.off || !effectMethod ) { + // delegate to the original method (e.g., .show()) if possible + if ( mode ) { + return this[ mode ]( args.duration, args.complete ); + } else { + return this.each( function() { + if ( args.complete ) { + args.complete.call( this ); + } + }); + } + } + + function run( next ) { + var elem = $( this ), + complete = args.complete, + mode = args.mode; + + function done() { + if ( $.isFunction( complete ) ) { + complete.call( elem[0] ); + } + if ( $.isFunction( next ) ) { + next(); + } + } + + // if the element is hiddden and mode is hide, + // or element is visible and mode is show + if ( elem.is( ":hidden" ) ? mode === "hide" : mode === "show" ) { + done(); + } else { + effectMethod.call( elem[0], args, done ); + } + } + + return queue === false ? this.each( run ) : this.queue( queue || "fx", run ); + }, + + _show: $.fn.show, + show: function( speed ) { + if ( standardSpeed( speed ) ) { + return this._show.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "show"; + return this.effect.call( this, args ); + } + }, + + _hide: $.fn.hide, + hide: function( speed ) { + if ( standardSpeed( speed ) ) { + return this._hide.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "hide"; + return this.effect.call( this, args ); + } + }, + + // jQuery core overloads toggle and creates _toggle + __toggle: $.fn.toggle, + toggle: function( speed ) { + if ( standardSpeed( speed ) || typeof speed === "boolean" || $.isFunction( speed ) ) { + return this.__toggle.apply( this, arguments ); + } else { + var args = _normalizeArguments.apply( this, arguments ); + args.mode = "toggle"; + return this.effect.call( this, args ); + } + }, + + // helper functions + cssUnit: function(key) { + var style = this.css( key ), + val = []; + + $.each( [ "em", "px", "%", "pt" ], function( i, unit ) { + if ( style.indexOf( unit ) > 0 ) { + val = [ parseFloat( style ), unit ]; + } + }); + return val; + } +}); + +})(); + +/******************************************************************************/ +/*********************************** EASING ***********************************/ +/******************************************************************************/ + +(function() { + +// based on easing equations from Robert Penner (http://www.robertpenner.com/easing) + +var baseEasings = {}; + +$.each( [ "Quad", "Cubic", "Quart", "Quint", "Expo" ], function( i, name ) { + baseEasings[ name ] = function( p ) { + return Math.pow( p, i + 2 ); + }; +}); + +$.extend( baseEasings, { + Sine: function ( p ) { + return 1 - Math.cos( p * Math.PI / 2 ); + }, + Circ: function ( p ) { + return 1 - Math.sqrt( 1 - p * p ); + }, + Elastic: function( p ) { + return p === 0 || p === 1 ? p : + -Math.pow( 2, 8 * (p - 1) ) * Math.sin( ( (p - 1) * 80 - 7.5 ) * Math.PI / 15 ); + }, + Back: function( p ) { + return p * p * ( 3 * p - 2 ); + }, + Bounce: function ( p ) { + var pow2, + bounce = 4; + + while ( p < ( ( pow2 = Math.pow( 2, --bounce ) ) - 1 ) / 11 ) {} + return 1 / Math.pow( 4, 3 - bounce ) - 7.5625 * Math.pow( ( pow2 * 3 - 2 ) / 22 - p, 2 ); + } +}); + +$.each( baseEasings, function( name, easeIn ) { + $.easing[ "easeIn" + name ] = easeIn; + $.easing[ "easeOut" + name ] = function( p ) { + return 1 - easeIn( 1 - p ); + }; + $.easing[ "easeInOut" + name ] = function( p ) { + return p < 0.5 ? + easeIn( p * 2 ) / 2 : + 1 - easeIn( p * -2 + 2 ) / 2; + }; +}); + +})(); + +})(jQuery)); +(function( $, undefined ) { + +var rvertical = /up|down|vertical/, + rpositivemotion = /up|left|vertical|horizontal/; + +$.effects.effect.blind = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + direction = o.direction || "up", + vertical = rvertical.test( direction ), + ref = vertical ? "height" : "width", + ref2 = vertical ? "top" : "left", + motion = rpositivemotion.test( direction ), + animation = {}, + show = mode === "show", + wrapper, distance, margin; + + // if already wrapped, the wrapper's properties are my property. #6245 + if ( el.parent().is( ".ui-effects-wrapper" ) ) { + $.effects.save( el.parent(), props ); + } else { + $.effects.save( el, props ); + } + el.show(); + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + distance = wrapper[ ref ](); + margin = parseFloat( wrapper.css( ref2 ) ) || 0; + + animation[ ref ] = show ? distance : 0; + if ( !motion ) { + el + .css( vertical ? "bottom" : "right", 0 ) + .css( vertical ? "top" : "left", "auto" ) + .css({ position: "absolute" }); + + animation[ ref2 ] = show ? margin : distance + margin; + } + + // start at 0 if we are showing + if ( show ) { + wrapper.css( ref, 0 ); + if ( ! motion ) { + wrapper.css( ref2, margin + distance ); + } + } + + // Animate + wrapper.animate( animation, { + duration: o.duration, + easing: o.easing, + queue: false, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.bounce = function( o, done ) { + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + + // defaults: + mode = $.effects.setMode( el, o.mode || "effect" ), + hide = mode === "hide", + show = mode === "show", + direction = o.direction || "up", + distance = o.distance, + times = o.times || 5, + + // number of internal animations + anims = times * 2 + ( show || hide ? 1 : 0 ), + speed = o.duration / anims, + easing = o.easing, + + // utility: + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ), + i, + upAnim, + downAnim, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + // Avoid touching opacity to prevent clearType and PNG issues in IE + if ( show || hide ) { + props.push( "opacity" ); + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); // Create Wrapper + + // default distance for the BIGGEST bounce is the outer Distance / 3 + if ( !distance ) { + distance = el[ ref === "top" ? "outerHeight" : "outerWidth" ]() / 3; + } + + if ( show ) { + downAnim = { opacity: 1 }; + downAnim[ ref ] = 0; + + // if we are showing, force opacity 0 and set the initial position + // then do the "first" animation + el.css( "opacity", 0 ) + .css( ref, motion ? -distance * 2 : distance * 2 ) + .animate( downAnim, speed, easing ); + } + + // start at the smallest distance if we are hiding + if ( hide ) { + distance = distance / Math.pow( 2, times - 1 ); + } + + downAnim = {}; + downAnim[ ref ] = 0; + // Bounces up/down/left/right then back to 0 -- times * 2 animations happen here + for ( i = 0; i < times; i++ ) { + upAnim = {}; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ) + .animate( downAnim, speed, easing ); + + distance = hide ? distance * 2 : distance / 2; + } + + // Last Bounce when Hiding + if ( hide ) { + upAnim = { opacity: 0 }; + upAnim[ ref ] = ( motion ? "-=" : "+=" ) + distance; + + el.animate( upAnim, speed, easing ); + } + + el.queue(function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.clip = function( o, done ) { + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "vertical", + vert = direction === "vertical", + size = vert ? "height" : "width", + position = vert ? "top" : "left", + animation = {}, + wrapper, animate, distance; + + // Save & Show + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + animate = ( el[0].tagName === "IMG" ) ? wrapper : el; + distance = animate[ size ](); + + // Shift + if ( show ) { + animate.css( size, 0 ); + animate.css( position, distance / 2 ); + } + + // Create Animation Object: + animation[ size ] = show ? distance : 0; + animation[ position ] = show ? 0 : distance / 2; + + // Animate + animate.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( !show ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.drop = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "opacity", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + direction = o.direction || "left", + ref = ( direction === "up" || direction === "down" ) ? "top" : "left", + motion = ( direction === "up" || direction === "left" ) ? "pos" : "neg", + animation = { + opacity: show ? 1 : 0 + }, + distance; + + // Adjust + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + distance = o.distance || el[ ref === "top" ? "outerHeight": "outerWidth" ]( true ) / 2; + + if ( show ) { + el + .css( "opacity", 0 ) + .css( ref, motion === "pos" ? -distance : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( motion === "pos" ? "+=" : "-=" ) : + ( motion === "pos" ? "-=" : "+=" ) ) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.explode = function( o, done ) { + + var rows = o.pieces ? Math.round( Math.sqrt( o.pieces ) ) : 3, + cells = rows, + el = $( this ), + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + + // show and then visibility:hidden the element before calculating offset + offset = el.show().css( "visibility", "hidden" ).offset(), + + // width and height of a piece + width = Math.ceil( el.outerWidth() / cells ), + height = Math.ceil( el.outerHeight() / rows ), + pieces = [], + + // loop + i, j, left, top, mx, my; + + // children animate complete: + function childComplete() { + pieces.push( this ); + if ( pieces.length === rows * cells ) { + animComplete(); + } + } + + // clone the element for each row and cell. + for( i = 0; i < rows ; i++ ) { // ===> + top = offset.top + i * height; + my = i - ( rows - 1 ) / 2 ; + + for( j = 0; j < cells ; j++ ) { // ||| + left = offset.left + j * width; + mx = j - ( cells - 1 ) / 2 ; + + // Create a clone of the now hidden main element that will be absolute positioned + // within a wrapper div off the -left and -top equal to size of our pieces + el + .clone() + .appendTo( "body" ) + .wrap( "<div></div>" ) + .css({ + position: "absolute", + visibility: "visible", + left: -j * width, + top: -i * height + }) + + // select the wrapper - make it overflow: hidden and absolute positioned based on + // where the original was located +left and +top equal to the size of pieces + .parent() + .addClass( "ui-effects-explode" ) + .css({ + position: "absolute", + overflow: "hidden", + width: width, + height: height, + left: left + ( show ? mx * width : 0 ), + top: top + ( show ? my * height : 0 ), + opacity: show ? 0 : 1 + }).animate({ + left: left + ( show ? 0 : mx * width ), + top: top + ( show ? 0 : my * height ), + opacity: show ? 1 : 0 + }, o.duration || 500, o.easing, childComplete ); + } + } + + function animComplete() { + el.css({ + visibility: "visible" + }); + $( pieces ).remove(); + if ( !show ) { + el.hide(); + } + done(); + } +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.fade = function( o, done ) { + var el = $( this ), + mode = $.effects.setMode( el, o.mode || "toggle" ); + + el.animate({ + opacity: mode + }, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: done + }); +}; + +})( jQuery ); +(function( $, undefined ) { + +$.effects.effect.fold = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "hide" ), + show = mode === "show", + hide = mode === "hide", + size = o.size || 15, + percent = /([0-9]+)%/.exec( size ), + horizFirst = !!o.horizFirst, + widthFirst = show !== horizFirst, + ref = widthFirst ? [ "width", "height" ] : [ "height", "width" ], + duration = o.duration / 2, + wrapper, distance, + animation1 = {}, + animation2 = {}; + + $.effects.save( el, props ); + el.show(); + + // Create Wrapper + wrapper = $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + distance = widthFirst ? + [ wrapper.width(), wrapper.height() ] : + [ wrapper.height(), wrapper.width() ]; + + if ( percent ) { + size = parseInt( percent[ 1 ], 10 ) / 100 * distance[ hide ? 0 : 1 ]; + } + if ( show ) { + wrapper.css( horizFirst ? { + height: 0, + width: size + } : { + height: size, + width: 0 + }); + } + + // Animation + animation1[ ref[ 0 ] ] = show ? distance[ 0 ] : size; + animation2[ ref[ 1 ] ] = show ? distance[ 1 ] : 0; + + // Animate + wrapper + .animate( animation1, duration, o.easing ) + .animate( animation2, duration, o.easing, function() { + if ( hide ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.highlight = function( o, done ) { + var elem = $( this ), + props = [ "backgroundImage", "backgroundColor", "opacity" ], + mode = $.effects.setMode( elem, o.mode || "show" ), + animation = { + backgroundColor: elem.css( "backgroundColor" ) + }; + + if (mode === "hide") { + animation.opacity = 0; + } + + $.effects.save( elem, props ); + + elem + .show() + .css({ + backgroundImage: "none", + backgroundColor: o.color || "#ffff99" + }) + .animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + elem.hide(); + } + $.effects.restore( elem, props ); + done(); + } + }); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.pulsate = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "show" ), + show = mode === "show", + hide = mode === "hide", + showhide = ( show || mode === "hide" ), + + // showing or hiding leaves of the "last" animation + anims = ( ( o.times || 5 ) * 2 ) + ( showhide ? 1 : 0 ), + duration = o.duration / anims, + animateTo = 0, + queue = elem.queue(), + queuelen = queue.length, + i; + + if ( show || !elem.is(":visible")) { + elem.css( "opacity", 0 ).show(); + animateTo = 1; + } + + // anims - 1 opacity "toggles" + for ( i = 1; i < anims; i++ ) { + elem.animate({ + opacity: animateTo + }, duration, o.easing ); + animateTo = 1 - animateTo; + } + + elem.animate({ + opacity: animateTo + }, duration, o.easing); + + elem.queue(function() { + if ( hide ) { + elem.hide(); + } + done(); + }); + + // We just queued up "anims" animations, we need to put them next in the queue + if ( queuelen > 1 ) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + elem.dequeue(); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.puff = function( o, done ) { + var elem = $( this ), + mode = $.effects.setMode( elem, o.mode || "hide" ), + hide = mode === "hide", + percent = parseInt( o.percent, 10 ) || 150, + factor = percent / 100, + original = { + height: elem.height(), + width: elem.width(), + outerHeight: elem.outerHeight(), + outerWidth: elem.outerWidth() + }; + + $.extend( o, { + effect: "scale", + queue: false, + fade: true, + mode: mode, + complete: done, + percent: hide ? percent : 100, + from: hide ? + original : + { + height: original.height * factor, + width: original.width * factor, + outerHeight: original.outerHeight * factor, + outerWidth: original.outerWidth * factor + } + }); + + elem.effect( o ); +}; + +$.effects.effect.scale = function( o, done ) { + + // Create element + var el = $( this ), + options = $.extend( true, {}, o ), + mode = $.effects.setMode( el, o.mode || "effect" ), + percent = parseInt( o.percent, 10 ) || + ( parseInt( o.percent, 10 ) === 0 ? 0 : ( mode === "hide" ? 0 : 100 ) ), + direction = o.direction || "both", + origin = o.origin, + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }, + factor = { + y: direction !== "horizontal" ? (percent / 100) : 1, + x: direction !== "vertical" ? (percent / 100) : 1 + }; + + // We are going to pass this effect to the size effect: + options.effect = "size"; + options.queue = false; + options.complete = done; + + // Set default origin and restore for show/hide + if ( mode !== "effect" ) { + options.origin = origin || ["middle","center"]; + options.restore = true; + } + + options.from = o.from || ( mode === "show" ? { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + } : original ); + options.to = { + height: original.height * factor.y, + width: original.width * factor.x, + outerHeight: original.outerHeight * factor.y, + outerWidth: original.outerWidth * factor.x + }; + + // Fade option to support puff + if ( options.fade ) { + if ( mode === "show" ) { + options.from.opacity = 0; + options.to.opacity = 1; + } + if ( mode === "hide" ) { + options.from.opacity = 1; + options.to.opacity = 0; + } + } + + // Animate + el.effect( options ); + +}; + +$.effects.effect.size = function( o, done ) { + + // Create element + var original, baseline, factor, + el = $( this ), + props0 = [ "position", "top", "bottom", "left", "right", "width", "height", "overflow", "opacity" ], + + // Always restore + props1 = [ "position", "top", "bottom", "left", "right", "overflow", "opacity" ], + + // Copy for children + props2 = [ "width", "height", "overflow" ], + cProps = [ "fontSize" ], + vProps = [ "borderTopWidth", "borderBottomWidth", "paddingTop", "paddingBottom" ], + hProps = [ "borderLeftWidth", "borderRightWidth", "paddingLeft", "paddingRight" ], + + // Set options + mode = $.effects.setMode( el, o.mode || "effect" ), + restore = o.restore || mode !== "effect", + scale = o.scale || "both", + origin = o.origin || [ "middle", "center" ], + position = el.css( "position" ), + props = restore ? props0 : props1, + zero = { + height: 0, + width: 0, + outerHeight: 0, + outerWidth: 0 + }; + + if ( mode === "show" ) { + el.show(); + } + original = { + height: el.height(), + width: el.width(), + outerHeight: el.outerHeight(), + outerWidth: el.outerWidth() + }; + + if ( o.mode === "toggle" && mode === "show" ) { + el.from = o.to || zero; + el.to = o.from || original; + } else { + el.from = o.from || ( mode === "show" ? zero : original ); + el.to = o.to || ( mode === "hide" ? zero : original ); + } + + // Set scaling factor + factor = { + from: { + y: el.from.height / original.height, + x: el.from.width / original.width + }, + to: { + y: el.to.height / original.height, + x: el.to.width / original.width + } + }; + + // Scale the css box + if ( scale === "box" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( vProps ); + el.from = $.effects.setTransition( el, vProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, vProps, factor.to.y, el.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + props = props.concat( hProps ); + el.from = $.effects.setTransition( el, hProps, factor.from.x, el.from ); + el.to = $.effects.setTransition( el, hProps, factor.to.x, el.to ); + } + } + + // Scale the content + if ( scale === "content" || scale === "both" ) { + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + props = props.concat( cProps ).concat( props2 ); + el.from = $.effects.setTransition( el, cProps, factor.from.y, el.from ); + el.to = $.effects.setTransition( el, cProps, factor.to.y, el.to ); + } + } + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + el.css( "overflow", "hidden" ).css( el.from ); + + // Adjust + if (origin) { // Calculate baseline shifts + baseline = $.effects.getBaseline( origin, original ); + el.from.top = ( original.outerHeight - el.outerHeight() ) * baseline.y; + el.from.left = ( original.outerWidth - el.outerWidth() ) * baseline.x; + el.to.top = ( original.outerHeight - el.to.outerHeight ) * baseline.y; + el.to.left = ( original.outerWidth - el.to.outerWidth ) * baseline.x; + } + el.css( el.from ); // set top & left + + // Animate + if ( scale === "content" || scale === "both" ) { // Scale the children + + // Add margins/font-size + vProps = vProps.concat([ "marginTop", "marginBottom" ]).concat(cProps); + hProps = hProps.concat([ "marginLeft", "marginRight" ]); + props2 = props0.concat(vProps).concat(hProps); + + el.find( "*[width]" ).each( function(){ + var child = $( this ), + c_original = { + height: child.height(), + width: child.width(), + outerHeight: child.outerHeight(), + outerWidth: child.outerWidth() + }; + if (restore) { + $.effects.save(child, props2); + } + + child.from = { + height: c_original.height * factor.from.y, + width: c_original.width * factor.from.x, + outerHeight: c_original.outerHeight * factor.from.y, + outerWidth: c_original.outerWidth * factor.from.x + }; + child.to = { + height: c_original.height * factor.to.y, + width: c_original.width * factor.to.x, + outerHeight: c_original.height * factor.to.y, + outerWidth: c_original.width * factor.to.x + }; + + // Vertical props scaling + if ( factor.from.y !== factor.to.y ) { + child.from = $.effects.setTransition( child, vProps, factor.from.y, child.from ); + child.to = $.effects.setTransition( child, vProps, factor.to.y, child.to ); + } + + // Horizontal props scaling + if ( factor.from.x !== factor.to.x ) { + child.from = $.effects.setTransition( child, hProps, factor.from.x, child.from ); + child.to = $.effects.setTransition( child, hProps, factor.to.x, child.to ); + } + + // Animate children + child.css( child.from ); + child.animate( child.to, o.duration, o.easing, function() { + + // Restore children + if ( restore ) { + $.effects.restore( child, props2 ); + } + }); + }); + } + + // Animate + el.animate( el.to, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( el.to.opacity === 0 ) { + el.css( "opacity", el.from.opacity ); + } + if( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + if ( !restore ) { + + // we need to calculate our new positioning based on the scaling + if ( position === "static" ) { + el.css({ + position: "relative", + top: el.to.top, + left: el.to.left + }); + } else { + $.each([ "top", "left" ], function( idx, pos ) { + el.css( pos, function( _, str ) { + var val = parseInt( str, 10 ), + toRef = idx ? el.to.left : el.to.top; + + // if original was "auto", recalculate the new value from wrapper + if ( str === "auto" ) { + return toRef + "px"; + } + + return val + toRef + "px"; + }); + }); + } + } + + $.effects.removeWrapper( el ); + done(); + } + }); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.shake = function( o, done ) { + + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "height", "width" ], + mode = $.effects.setMode( el, o.mode || "effect" ), + direction = o.direction || "left", + distance = o.distance || 20, + times = o.times || 3, + anims = times * 2 + 1, + speed = Math.round(o.duration/anims), + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + animation = {}, + animation1 = {}, + animation2 = {}, + i, + + // we will need to re-assemble the queue to stack our animations in place + queue = el.queue(), + queuelen = queue.length; + + $.effects.save( el, props ); + el.show(); + $.effects.createWrapper( el ); + + // Animation + animation[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance; + animation1[ ref ] = ( positiveMotion ? "+=" : "-=" ) + distance * 2; + animation2[ ref ] = ( positiveMotion ? "-=" : "+=" ) + distance * 2; + + // Animate + el.animate( animation, speed, o.easing ); + + // Shakes + for ( i = 1; i < times; i++ ) { + el.animate( animation1, speed, o.easing ).animate( animation2, speed, o.easing ); + } + el + .animate( animation1, speed, o.easing ) + .animate( animation, speed / 2, o.easing ) + .queue(function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + }); + + // inject all the animations we just queued to be first in line (after "inprogress") + if ( queuelen > 1) { + queue.splice.apply( queue, + [ 1, 0 ].concat( queue.splice( queuelen, anims + 1 ) ) ); + } + el.dequeue(); + +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.slide = function( o, done ) { + + // Create element + var el = $( this ), + props = [ "position", "top", "bottom", "left", "right", "width", "height" ], + mode = $.effects.setMode( el, o.mode || "show" ), + show = mode === "show", + direction = o.direction || "left", + ref = (direction === "up" || direction === "down") ? "top" : "left", + positiveMotion = (direction === "up" || direction === "left"), + distance, + animation = {}; + + // Adjust + $.effects.save( el, props ); + el.show(); + distance = o.distance || el[ ref === "top" ? "outerHeight" : "outerWidth" ]( true ); + + $.effects.createWrapper( el ).css({ + overflow: "hidden" + }); + + if ( show ) { + el.css( ref, positiveMotion ? (isNaN(distance) ? "-" + distance : -distance) : distance ); + } + + // Animation + animation[ ref ] = ( show ? + ( positiveMotion ? "+=" : "-=") : + ( positiveMotion ? "-=" : "+=")) + + distance; + + // Animate + el.animate( animation, { + queue: false, + duration: o.duration, + easing: o.easing, + complete: function() { + if ( mode === "hide" ) { + el.hide(); + } + $.effects.restore( el, props ); + $.effects.removeWrapper( el ); + done(); + } + }); +}; + +})(jQuery); +(function( $, undefined ) { + +$.effects.effect.transfer = function( o, done ) { + var elem = $( this ), + target = $( o.to ), + targetFixed = target.css( "position" ) === "fixed", + body = $("body"), + fixTop = targetFixed ? body.scrollTop() : 0, + fixLeft = targetFixed ? body.scrollLeft() : 0, + endPosition = target.offset(), + animation = { + top: endPosition.top - fixTop , + left: endPosition.left - fixLeft , + height: target.innerHeight(), + width: target.innerWidth() + }, + startPosition = elem.offset(), + transfer = $( "<div class='ui-effects-transfer'></div>" ) + .appendTo( document.body ) + .addClass( o.className ) + .css({ + top: startPosition.top - fixTop , + left: startPosition.left - fixLeft , + height: elem.innerHeight(), + width: elem.innerWidth(), + position: targetFixed ? "fixed" : "absolute" + }) + .animate( animation, o.duration, o.easing, function() { + transfer.remove(); + done(); + }); +}; + +})(jQuery); diff --git a/core/js/jquery-ui-1.8.16.custom.min.js b/core/js/jquery-ui-1.8.16.custom.min.js deleted file mode 100644 index eefefa8579d..00000000000 --- a/core/js/jquery-ui-1.8.16.custom.min.js +++ /dev/null @@ -1,761 +0,0 @@ -/*! - * jQuery UI 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI - */ -(function(c,j){function k(a,b){var d=a.nodeName.toLowerCase();if("area"===d){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&l(a)}return(/input|select|textarea|button|object/.test(d)?!a.disabled:"a"==d?a.href||b:b)&&l(a)}function l(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.16", -keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({propAttr:c.fn.prop||c.fn.attr,_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d= -this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this, -"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart": -"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,m,n){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(m)g-=parseFloat(c.curCSS(f,"border"+this+"Width",true))||0;if(n)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight, -outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){return k(a,!isNaN(c.attr(a,"tabindex")))},tabbable:function(a){var b=c.attr(a, -"tabindex"),d=isNaN(b);return(d||b>=0)&&k(a,!d)}});c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&& -a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&&b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&& -c.ui.isOverAxis(b,e,i)}})}})(jQuery); -;/*! - * jQuery UI Widget 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Widget - */ -(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)try{b(d).triggerHandler("remove")}catch(e){}k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(d){}});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]= -function(h){return!!b.data(h,a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)): -d;if(e&&d.charAt(0)==="_")return h;e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options= -b.extend(true,{},this.options,this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+ -"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled", -c);return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); -;/*! - * jQuery UI Mouse 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Mouse - * - * Depends: - * jquery.ui.widget.js - */ -(function(b){var d=false;b(document).mouseup(function(){d=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(c){return a._mouseDown(c)}).bind("click."+this.widgetName,function(c){if(true===b.data(c.target,a.widgetName+".preventClickEvent")){b.removeData(c.target,a.widgetName+".preventClickEvent");c.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+ -this.widgetName)},_mouseDown:function(a){if(!d){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var c=this,f=a.which==1,g=typeof this.options.cancel=="string"&&a.target.nodeName?b(a.target).closest(this.options.cancel).length:false;if(!f||g||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){c.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted= -this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}true===b.data(a.target,this.widgetName+".preventClickEvent")&&b.removeData(a.target,this.widgetName+".preventClickEvent");this._mouseMoveDelegate=function(e){return c._mouseMove(e)};this._mouseUpDelegate=function(e){return c._mouseUp(e)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return d=true}},_mouseMove:function(a){if(b.browser.msie&& -!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted= -false;a.target==this._mouseDownEvent.target&&b.data(a.target,this.widgetName+".preventClickEvent",true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); -;/* - * jQuery UI Position 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Position - */ -(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, -left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= -k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= -m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= -d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= -a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), -g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); -;/* - * jQuery UI Draggable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Draggables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== -"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= -this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;if(b.iframeFix)d(b.iframeFix===true?"iframe":b.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")});return true},_mouseStart:function(a){var b=this.options; -this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()}); -this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);d.ui.ddmanager&&d.ui.ddmanager.dragStart(this,a);return true}, -_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b= -false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration, -10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},_mouseUp:function(a){this.options.iframeFix===true&&d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)});d.ui.ddmanager&&d.ui.ddmanager.dragStop(this,a);return d.ui.mouse.prototype._mouseUp.call(this,a)},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle|| -!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone().removeAttr("id"):this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&& -a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= -this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), -10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0,right:parseInt(this.element.css("marginRight"),10)||0,bottom:parseInt(this.element.css("marginBottom"), -10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[a.containment=="document"?0:d(window).scrollLeft()-this.offset.relative.left-this.offset.parent.left,a.containment=="document"?0:d(window).scrollTop()-this.offset.relative.top-this.offset.parent.top, -(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){a=d(a.containment);var b=a[0];if(b){a.offset();var c=d(b).css("overflow")!= -"hidden";this.containment=[(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0),(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0),(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left-this.margins.right,(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"), -10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top-this.margins.bottom];this.relative_container=a}}else if(a.containment.constructor==Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+ -this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&& -!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,h=a.pageY;if(this.originalPosition){var g;if(this.containment){if(this.relative_container){g=this.relative_container.offset();g=[this.containment[0]+g.left,this.containment[1]+g.top,this.containment[2]+g.left,this.containment[3]+g.top]}else g=this.containment;if(a.pageX-this.offset.click.left<g[0])e=g[0]+this.offset.click.left; -if(a.pageY-this.offset.click.top<g[1])h=g[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>g[2])e=g[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>g[3])h=g[3]+this.offset.click.top}if(b.grid){h=b.grid[1]?this.originalPageY+Math.round((h-this.originalPageY)/b.grid[1])*b.grid[1]:this.originalPageY;h=g?!(h-this.offset.click.top<g[1]||h-this.offset.click.top>g[3])?h:!(h-this.offset.click.top<g[1])?h-b.grid[1]:h+b.grid[1]:h;e=b.grid[0]?this.originalPageX+Math.round((e-this.originalPageX)/ -b.grid[0])*b.grid[0]:this.originalPageX;e=g?!(e-this.offset.click.left<g[0]||e-this.offset.click.left>g[2])?e:!(e-this.offset.click.left<g[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:h-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version< -526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!=this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b, -c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.16"});d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var h=d.data(this,"sortable");if(h&&!h.options.disabled){c.sortables.push({instance:h,shouldRevert:h.options.revert}); -h.refreshPositions();h._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver=0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval= -false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs=c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().removeAttr("id").appendTo(this.instance.element).data("sortable-item",true); -this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a,true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top; -c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver=0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&& -this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor=a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity= -a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!= -"x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop-c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left< -c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()- -c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable","snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this, -width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,h=b.offset.left,g=h+c.helperProportions.width,n=b.offset.top,o=n+c.helperProportions.height,i=c.snapElements.length-1;i>=0;i--){var j=c.snapElements[i].left,l=j+c.snapElements[i].width,k=c.snapElements[i].top,m=k+c.snapElements[i].height;if(j-e<h&&h<l+e&&k-e<n&&n<m+e||j-e<h&&h<l+e&&k-e<o&&o<m+e||j-e<g&&g<l+e&&k-e<n&&n<m+e||j-e<g&&g<l+e&&k-e<o&& -o<m+e){if(f.snapMode!="inner"){var p=Math.abs(k-o)<=e,q=Math.abs(m-n)<=e,r=Math.abs(j-g)<=e,s=Math.abs(l-h)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l}).left-c.margins.left}var t= -p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(k-n)<=e;q=Math.abs(m-o)<=e;r=Math.abs(j-h)<=e;s=Math.abs(l-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:k,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:m-c.helperProportions.height,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:j}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:l-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[i].snapping&& -(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=p||q||r||s||t}else{c.snapElements[i].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[i].item}));c.snapElements[i].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"), -10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); -;/* - * jQuery UI Droppable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Droppables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.mouse.js - * jquery.ui.draggable.js - */ -(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); -a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& -this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); -this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= -d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", -a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.16"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; -switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= -i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= -"none";if(c[f].visible){e=="mousedown"&&c[f]._activate.call(c[f],b);c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight}}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| -a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},dragStart:function(a,b){a.element.parents(":not(body,html)").bind("scroll.droppable",function(){a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)})},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance); -if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e=d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})},dragStop:function(a,b){a.element.parents(":not(body,html)").unbind("scroll.droppable"); -a.options.refreshPositions||d.ui.ddmanager.prepareOffsets(a,b)}}})(jQuery); -;/* - * jQuery UI Resizable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Resizables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, -_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), -top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= -this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", -nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== -String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),l=0;l=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,l);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); -this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){if(!a.disabled){e(this).removeClass("ui-resizable-autohide");b._handles.show()}},function(){if(!a.disabled)if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy(); -var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a= -false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"}); -this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff= -{width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis]; -if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);this._updateVirtualBoundaries(b.shiftKey);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false}, -_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f, -{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateVirtualBoundaries:function(b){var a=this.options,c,d,f;a={minWidth:k(a.minWidth)?a.minWidth:0,maxWidth:k(a.maxWidth)?a.maxWidth:Infinity,minHeight:k(a.minHeight)?a.minHeight:0,maxHeight:k(a.maxHeight)?a.maxHeight: -Infinity};if(this._aspectRatio||b){b=a.minHeight*this.aspectRatio;d=a.minWidth/this.aspectRatio;c=a.maxHeight*this.aspectRatio;f=a.maxWidth/this.aspectRatio;if(b>a.minWidth)a.minWidth=b;if(d>a.minHeight)a.minHeight=d;if(c<a.maxWidth)a.maxWidth=c;if(f<a.maxHeight)a.maxHeight=f}this._vBoundaries=a},_updateCache:function(b){this.offset=this.helper.offset();if(k(b.left))this.position.left=b.left;if(k(b.top))this.position.top=b.top;if(k(b.height))this.size.height=b.height;if(k(b.width))this.size.width= -b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(k(b.height))b.width=b.height*this.aspectRatio;else if(k(b.width))b.height=b.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this._vBoundaries,c=this.axis,d=k(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=k(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=k(b.width)&&a.minWidth&& -a.minWidth>b.width,h=k(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+this.size.height,l=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&l)b.left=i-a.minWidth;if(d&&l)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left= -null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d=[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)|| -0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b=this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+ -a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+ -c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]); -b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.16"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(), -10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top- -f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var l=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:l.parents(a.originalElement[0]).length?["width","height"]:["width","height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(l.css("position"))){c._revertToRelativePosition=true;l.css({position:"absolute",top:"auto",left:"auto"})}l.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType? -e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a= -e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing, -step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement= -e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset; -var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left: -a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top- -d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition, -f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25, -display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b= -e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height= -d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},k=function(b){return!isNaN(parseInt(b,10))}})(jQuery); -;/* - * jQuery UI Selectable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Selectables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), -selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, -c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", -c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= -this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); -a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& -!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= -e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Sortable 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Sortables - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){var a=this.options;this.containerCache={};this.element.addClass("ui-sortable"); -this.refresh();this.floating=this.items.length?a.axis==="x"||/left|right/.test(this.items[0].item.css("float"))||/inline|table-cell/.test(this.items[0].item.css("display")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a=== -"disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this,arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&& -!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem=c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top, -left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]}; -this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment();if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!= -document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start",a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a); -return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top< -b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()- -b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this, -a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0], -e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a,c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset(); -c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"): -this.currentItem.show();for(var b=this.containers.length-1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null, -dragging:false,reverting:false,_noFinalSort:null});this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")}, -toArray:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers|| -this.options.tolerance!="pointer"&&this.helperProportions[this.floating?"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection(); -var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating?c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)}, -_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top;return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith(); -if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h=d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"), -this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)});return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element), -this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g=d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&& -this.helper)this.offset.parent=this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b];if(!(c.instance!=this.currentContainer&&this.currentContainer&&c.item[0]!=this.currentItem[0])){var e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b= -this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top=e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f= -d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0];if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")|| -0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder);c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out", -a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length===1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h- -f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer=this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b= -this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])):b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width== -""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height==""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top= -this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a= -{top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"), -10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"? -document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), -10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b= -this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&& -this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset(); -var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g- -this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g- -this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0], -this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter=this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem.parent().length&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]= -"";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show();this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove", -f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0],this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this, -this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out",g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop", -a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b||this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()}, -_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position,originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Autocomplete 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Autocomplete - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.position.js - */ -(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",autoFocus:false,delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.propAttr("readOnly"))){g= -false;var f=d.ui.keyCode;switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!= -a.element.val()){a.selectedItem=null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)}; -this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo||"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&& -a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"),i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu"); -d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup");this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&& -b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source==="string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source= -this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)},_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close(); -this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!==this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label|| -b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position));this.options.autoFocus&&this.menu.next(new d.Event("mouseover"))},_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this; -d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b);else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, -"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); -(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", --1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.scrollTop(),c=this.element.height();if(b<0)this.element.scrollTop(g+b);else b>=c&&this.element.scrollTop(g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})},deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id"); -this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0);e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b, -this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e,g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first"));this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active|| -this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element[d.fn.prop?"prop":"attr"]("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); -;/* - * jQuery UI Button 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Button - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b){var h,i,j,g,l=function(){var a=b(this).find(":ui-button");setTimeout(function(){a.button("refresh")},1)},k=function(a){var c=a.name,e=a.form,f=b([]);if(c)f=e?b(e).find("[name='"+c+"']"):b("[name='"+c+"']",a.ownerDocument).filter(function(){return!this.form});return f};b.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button",l);if(typeof this.options.disabled!== -"boolean")this.options.disabled=this.element.propAttr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var a=this,c=this.options,e=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!e?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button",function(){if(!c.disabled){b(this).addClass("ui-state-hover"); -this===h&&b(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||b(this).removeClass(f)}).bind("click.button",function(d){if(c.disabled){d.preventDefault();d.stopImmediatePropagation()}});this.element.bind("focus.button",function(){a.buttonElement.addClass("ui-state-focus")}).bind("blur.button",function(){a.buttonElement.removeClass("ui-state-focus")});if(e){this.element.bind("change.button",function(){g||a.refresh()});this.buttonElement.bind("mousedown.button",function(d){if(!c.disabled){g= -false;i=d.pageX;j=d.pageY}}).bind("mouseup.button",function(d){if(!c.disabled)if(i!==d.pageX||j!==d.pageY)g=true})}if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).toggleClass("ui-state-active");a.buttonElement.attr("aria-pressed",a.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled||g)return false;b(this).addClass("ui-state-active");a.buttonElement.attr("aria-pressed","true"); -var d=a.element[0];k(d).not(d).map(function(){return b(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed","false")});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;b(this).addClass("ui-state-active");h=this;b(document).one("mouseup",function(){h=null})}).bind("mouseup.button",function(){if(c.disabled)return false;b(this).removeClass("ui-state-active")}).bind("keydown.button",function(d){if(c.disabled)return false;if(d.keyCode==b.ui.keyCode.SPACE|| -d.keyCode==b.ui.keyCode.ENTER)b(this).addClass("ui-state-active")}).bind("keyup.button",function(){b(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(d){d.keyCode===b.ui.keyCode.SPACE&&b(this).click()})}this._setOption("disabled",c.disabled);this._resetButton()},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type=== -"radio"){var a=this.element.parents().filter(":last"),c="label[for='"+this.element.attr("id")+"']";this.buttonElement=a.find(c);if(!this.buttonElement.length){a=a.length?a.siblings():this.element.siblings();this.buttonElement=a.filter(c);if(!this.buttonElement.length)this.buttonElement=a.find(c)}this.element.addClass("ui-helper-hidden-accessible");(a=this.element.is(":checked"))&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",a)}else this.buttonElement=this.element}, -widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle||this.buttonElement.removeAttr("title"); -b.Widget.prototype.destroy.call(this)},_setOption:function(a,c){b.Widget.prototype._setOption.apply(this,arguments);if(a==="disabled")c?this.element.propAttr("disabled",true):this.element.propAttr("disabled",false);else this._resetButton()},refresh:function(){var a=this.element.is(":disabled");a!==this.options.disabled&&this._setOption("disabled",a);if(this.type==="radio")k(this.element[0]).each(function(){b(this).is(":checked")?b(this).button("widget").addClass("ui-state-active").attr("aria-pressed", -"true"):b(this).button("widget").removeClass("ui-state-active").attr("aria-pressed","false")});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed","true"):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed","false")},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var a=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), -c=b("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(a.empty()).text(),e=this.options.icons,f=e.primary&&e.secondary,d=[];if(e.primary||e.secondary){if(this.options.text)d.push("ui-button-text-icon"+(f?"s":e.primary?"-primary":"-secondary"));e.primary&&a.prepend("<span class='ui-button-icon-primary ui-icon "+e.primary+"'></span>");e.secondary&&a.append("<span class='ui-button-icon-secondary ui-icon "+e.secondary+"'></span>");if(!this.options.text){d.push(f?"ui-button-icons-only": -"ui-button-icon-only");this.hasTitle||a.attr("title",c)}}else d.push("ui-button-text-only");a.addClass(d.join(" "))}}});b.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(a,c){a==="disabled"&&this.buttons.button("option",a,c);b.Widget.prototype._setOption.apply(this,arguments)},refresh:function(){var a=this.element.css("direction")=== -"ltr";this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass(a?"ui-corner-left":"ui-corner-right").end().filter(":last").addClass(a?"ui-corner-right":"ui-corner-left").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return b(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); -b.Widget.prototype.destroy.call(this)}})})(jQuery); -;/* - * jQuery UI Dialog 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Dialog - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - * jquery.ui.button.js - * jquery.ui.draggable.js - * jquery.ui.mouse.js - * jquery.ui.position.js - * jquery.ui.resizable.js - */ -(function(c,l){var m={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},n={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true},o=c.attrFn||{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true,click:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false, -position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+ -b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&!i.isDefaultPrevented()&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g), -h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role","button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id", -e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose=b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body"); -a.uiDialog.remove();a.originalTitle&&a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!== -b.uiDialog[0]){e=c(this).css("z-index");isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.scrollTop(),scrollLeft:d.element.scrollLeft()};c.ui.dialog.maxZ+=1; -d.uiDialog.css("z-index",c.ui.dialog.maxZ);d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target=== -f[0]&&e.shiftKey){g.focus(1);return false}}});c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a, -function(){return!(d=true)});if(d){c.each(a,function(f,h){h=c.isFunction(h)?{click:h,text:f}:h;var i=c('<button type="button"></button>').click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.each(h,function(j,k){if(j!=="click")j in o?i[j](k):i.attr(j,k)});c.fn.button&&i.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close", -handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g=d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition, -originalSize:f.originalSize,position:f.position,size:f.size}}a=a===l?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize", -f,b(h))},stop:function(f,h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "): -[a[0],a[1]];if(b.length===1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f); -if(g in m)e=true;if(g in n)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"): -e.removeClass("ui-dialog-disabled");break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a= -this.options,b,d,e=this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height- -b,0));this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.16",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "), -create:function(a){if(this.instances.length===0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&!d.isDefaultPrevented()&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()|| -c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&& -c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+ -"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances,function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); -;/* - * jQuery UI Slider 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Slider - * - * Depends: - * jquery.ui.core.js - * jquery.ui.mouse.js - * jquery.ui.widget.js - */ -(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var a=this,b=this.options,c=this.element.find(".ui-slider-handle").addClass("ui-state-default ui-corner-all"),f=b.values&&b.values.length||1,e=[];this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+ -this.orientation+" ui-widget ui-widget-content ui-corner-all"+(b.disabled?" ui-slider-disabled ui-disabled":""));this.range=d([]);if(b.range){if(b.range===true){if(!b.values)b.values=[this._valueMin(),this._valueMin()];if(b.values.length&&b.values.length!==2)b.values=[b.values[0],b.values[0]]}this.range=d("<div></div>").appendTo(this.element).addClass("ui-slider-range ui-widget-header"+(b.range==="min"||b.range==="max"?" ui-slider-range-"+b.range:""))}for(var j=c.length;j<f;j+=1)e.push("<a class='ui-slider-handle ui-state-default ui-corner-all' href='#'></a>"); -this.handles=c.add(d(e.join("")).appendTo(a.element));this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(g){g.preventDefault()}).hover(function(){b.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(b.disabled)d(this).blur();else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(g){d(this).data("index.ui-slider-handle", -g)});this.handles.keydown(function(g){var k=true,l=d(this).data("index.ui-slider-handle"),i,h,m;if(!a.options.disabled){switch(g.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:k=false;if(!a._keySliding){a._keySliding=true;d(this).addClass("ui-state-active");i=a._start(g,l);if(i===false)return}break}m=a.options.step;i=a.options.values&&a.options.values.length? -(h=a.values(l)):(h=a.value());switch(g.keyCode){case d.ui.keyCode.HOME:h=a._valueMin();break;case d.ui.keyCode.END:h=a._valueMax();break;case d.ui.keyCode.PAGE_UP:h=a._trimAlignValue(i+(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:h=a._trimAlignValue(i-(a._valueMax()-a._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(i===a._valueMax())return;h=a._trimAlignValue(i+m);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(i===a._valueMin())return;h=a._trimAlignValue(i- -m);break}a._slide(g,l,h);return k}}).keyup(function(g){var k=d(this).data("index.ui-slider-handle");if(a._keySliding){a._keySliding=false;a._stop(g,k);a._change(g,k);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider");this._mouseDestroy(); -return this},_mouseCapture:function(a){var b=this.options,c,f,e,j,g;if(b.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:a.pageX,y:a.pageY});f=this._valueMax()-this._valueMin()+1;j=this;this.handles.each(function(k){var l=Math.abs(c-j.values(k));if(f>l){f=l;e=d(this);g=k}});if(b.range===true&&this.values(1)===b.min){g+=1;e=d(this.handles[g])}if(this._start(a,g)===false)return false; -this._mouseSliding=true;j._handleIndex=g;e.addClass("ui-state-active").focus();b=e.offset();this._clickOffset=!d(a.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:a.pageX-b.left-e.width()/2,top:a.pageY-b.top-e.height()/2-(parseInt(e.css("borderTopWidth"),10)||0)-(parseInt(e.css("borderBottomWidth"),10)||0)+(parseInt(e.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(a,g,c);return this._animateOff=true},_mouseStart:function(){return true},_mouseDrag:function(a){var b= -this._normValueFromMouse({x:a.pageX,y:a.pageY});this._slide(a,this._handleIndex,b);return false},_mouseStop:function(a){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(a,this._handleIndex);this._change(a,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(a){var b;if(this.orientation==="horizontal"){b= -this.elementSize.width;a=a.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{b=this.elementSize.height;a=a.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}b=a/b;if(b>1)b=1;if(b<0)b=0;if(this.orientation==="vertical")b=1-b;a=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+b*a)},_start:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b); -c.values=this.values()}return this._trigger("start",a,c)},_slide:function(a,b,c){var f;if(this.options.values&&this.options.values.length){f=this.values(b?0:1);if(this.options.values.length===2&&this.options.range===true&&(b===0&&c>f||b===1&&c<f))c=f;if(c!==this.values(b)){f=this.values();f[b]=c;a=this._trigger("slide",a,{handle:this.handles[b],value:c,values:f});this.values(b?0:1);a!==false&&this.values(b,c,true)}}else if(c!==this.value()){a=this._trigger("slide",a,{handle:this.handles[b],value:c}); -a!==false&&this.value(c)}},_stop:function(a,b){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("stop",a,c)},_change:function(a,b){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[b],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(b);c.values=this.values()}this._trigger("change",a,c)}},value:function(a){if(arguments.length){this.options.value= -this._trimAlignValue(a);this._refreshValue();this._change(null,0)}else return this._value()},values:function(a,b){var c,f,e;if(arguments.length>1){this.options.values[a]=this._trimAlignValue(b);this._refreshValue();this._change(null,a)}else if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;f=arguments[0];for(e=0;e<c.length;e+=1){c[e]=this._trimAlignValue(f[e]);this._change(null,e)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(a): -this.value();else return this._values()},_setOption:function(a,b){var c,f=0;if(d.isArray(this.options.values))f=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(a){case "disabled":if(b){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.propAttr("disabled",true);this.element.addClass("ui-disabled")}else{this.handles.propAttr("disabled",false);this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); -this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<f;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var a=this.options.value;return a=this._trimAlignValue(a)},_values:function(a){var b,c;if(arguments.length){b=this.options.values[a]; -return b=this._trimAlignValue(b)}else{b=this.options.values.slice();for(c=0;c<b.length;c+=1)b[c]=this._trimAlignValue(b[c]);return b}},_trimAlignValue:function(a){if(a<=this._valueMin())return this._valueMin();if(a>=this._valueMax())return this._valueMax();var b=this.options.step>0?this.options.step:1,c=(a-this._valueMin())%b;a=a-c;if(Math.abs(c)*2>=b)a+=c>0?b:-b;return parseFloat(a.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max},_refreshValue:function(){var a= -this.options.range,b=this.options,c=this,f=!this._animateOff?b.animate:false,e,j={},g,k,l,i;if(this.options.values&&this.options.values.length)this.handles.each(function(h){e=(c.values(h)-c._valueMin())/(c._valueMax()-c._valueMin())*100;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";d(this).stop(1,1)[f?"animate":"css"](j,b.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(h===0)c.range.stop(1,1)[f?"animate":"css"]({left:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({width:e- -g+"%"},{queue:false,duration:b.animate})}else{if(h===0)c.range.stop(1,1)[f?"animate":"css"]({bottom:e+"%"},b.animate);if(h===1)c.range[f?"animate":"css"]({height:e-g+"%"},{queue:false,duration:b.animate})}g=e});else{k=this.value();l=this._valueMin();i=this._valueMax();e=i!==l?(k-l)/(i-l)*100:0;j[c.orientation==="horizontal"?"left":"bottom"]=e+"%";this.handle.stop(1,1)[f?"animate":"css"](j,b.animate);if(a==="min"&&this.orientation==="horizontal")this.range.stop(1,1)[f?"animate":"css"]({width:e+"%"}, -b.animate);if(a==="max"&&this.orientation==="horizontal")this.range[f?"animate":"css"]({width:100-e+"%"},{queue:false,duration:b.animate});if(a==="min"&&this.orientation==="vertical")this.range.stop(1,1)[f?"animate":"css"]({height:e+"%"},b.animate);if(a==="max"&&this.orientation==="vertical")this.range[f?"animate":"css"]({height:100-e+"%"},{queue:false,duration:b.animate})}}});d.extend(d.ui.slider,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Tabs 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Tabs - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& -e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= -d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| -(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); -this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= -this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); -if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); -this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ -g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", -function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; -this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= --1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; -d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= -d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, -e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); -j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); -if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, -this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, -load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, -"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, -url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.16"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& -a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); -;/* - * jQuery UI Datepicker 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Datepicker - * - * Depends: - * jquery.ui.core.js - */ -(function(d,C){function M(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= -"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", -"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", -minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false,disabled:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=N(d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}function N(a){return a.bind("mouseout", -function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");b.length&&b.removeClass("ui-state-hover ui-datepicker-prev-hover ui-datepicker-next-hover")}).bind("mouseover",function(b){b=d(b.target).closest("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a");if(!(d.datepicker._isDisabledDatepicker(J.inline?a.parent()[0]:J.input[0])||!b.length)){b.parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover"); -b.addClass("ui-state-hover");b.hasClass("ui-datepicker-prev")&&b.addClass("ui-datepicker-prev-hover");b.hasClass("ui-datepicker-next")&&b.addClass("ui-datepicker-next-hover")}})}function H(a,b){d.extend(a,b);for(var c in b)if(b[c]==null||b[c]==C)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.16"}});var B=(new Date).getTime(),J;d.extend(M.prototype,{markerClassName:"hasDatepicker",maxRows:4,log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv}, -setDefaults:function(a){H(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase();f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g, -"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:N(d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>'))}},_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker", -function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b);b.settings.disabled&&this._disableDatepicker(a)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&&b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c== -"focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f==""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker(): -d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a,c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a, -b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b),true);this._updateDatepicker(b);this._updateAlternate(b);b.settings.disabled&&this._disableDatepicker(a);b.dpDiv.css("display","block")}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+= -1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}H(a.settings,e||{});b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/ -2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass);this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b= -d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup",this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e= -a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().removeClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").removeAttr("disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a, -"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span"){b=b.children("."+this._inlineClass);b.children().addClass("ui-state-disabled");b.find("select.ui-datepicker-month, select.ui-datepicker-year").attr("disabled","disabled")}this._disabledInputs=d.map(this._disabledInputs,function(f){return f== -a?null:f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"? -d.extend({},e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true),i=this._getMinMaxDate(e,"min"),g=this._getMinMaxDate(e,"max");H(e.settings,f);if(i!==null&&f.dateFormat!==C&&f.minDate===C)e.settings.minDate=this._formatDate(e,i);if(g!==null&&f.dateFormat!==C&&f.maxDate===C)e.settings.maxDate=this._formatDate(e,g);this._attachments(d(a),e);this._autoSize(e);this._setDate(e,h);this._updateAlternate(e); -this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b);this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl"); -b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]&&d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]);if(a=d.datepicker._get(b,"onSelect")){c=d.datepicker._formatDate(b);a.apply(b.input?b.input[0]:null,[c,b])}else d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target, -a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey||a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c= -a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b, -"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b,"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==C?a.keyCode:a.charCode); -return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true},_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input", -a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);if(d.datepicker._curInst&&d.datepicker._curInst!=b){d.datepicker._datepickerShowing&&d.datepicker._triggerOnClose(d.datepicker._curInst);d.datepicker._curInst.dpDiv.stop(true,true)}var c=d.datepicker._get(b,"beforeShow");c=c?c.apply(a,[a,b]):{};if(c!==false){H(b.settings,c);b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value= -"";if(!d.datepicker._pos){d.datepicker._pos=d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b); -c=d.datepicker._checkOffset(b,c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.datepicker._datepickerShowing= -true;d.effects&&d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}}},_updateDatepicker:function(a){this.maxRows=4;var b=d.datepicker._getBorders(a.dpDiv);J=a;a.dpDiv.empty().append(this._generateHTML(a));var c=a.dpDiv.find("iframe.ui-datepicker-cover");c.length&&c.css({left:-b[0],top:-b[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()}); -a.dpDiv.find("."+this._dayOverClass+" a").mouseover();b=this._getNumberOfMonths(a);c=b[1];a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");c>1&&a.dpDiv.addClass("ui-datepicker-multi-"+c).css("width",17*c+"em");a.dpDiv[(b[0]!=1||b[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a,"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&& -!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var e=a.yearshtml;setTimeout(function(){e===a.yearshtml&&a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);e=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))),parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(), -h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left,b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b= -this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_triggerOnClose:function(a){var b=this._get(a,"onClose");if(b)b.apply(a.input?a.input[0]:null,[a.input?a.input.val():"",a])},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); -this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();d.datepicker._triggerOnClose(b);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, -_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): -0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e["selected"+(c=="M"? -"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay=d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a); -this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a);else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField"); -if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b=a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"? -b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort,g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=A+1<a.length&&a.charAt(A+1)==p)&&A++;return p},m=function(p){var D= -o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&D?4:p=="o"?3:2)+"}");p=b.substring(q).match(p);if(!p)throw"Missing number at position "+q;q+=p[0].length;return parseInt(p[0],10)},n=function(p,D,K){p=d.map(o(p)?K:D,function(w,x){return[[x,w]]}).sort(function(w,x){return-(w[1].length-x[1].length)});var E=-1;d.each(p,function(w,x){w=x[1];if(b.substr(q,w.length).toLowerCase()==w.toLowerCase()){E=x[0];q+=w.length;return false}});if(E!=-1)return E+1;else throw"Unknown name at position "+q;},s= -function(){if(b.charAt(q)!=a.charAt(A))throw"Unexpected literal at position "+q;q++},q=0,A=0;A<a.length;A++)if(k)if(a.charAt(A)=="'"&&!o("'"))k=false;else s();else switch(a.charAt(A)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var v=new Date(m("@"));c=v.getFullYear();j=v.getMonth()+1;l=v.getDate();break;case "!":v=new Date((m("!")-this._ticksTo1970)/1E4);c=v.getFullYear();j=v.getMonth()+ -1;l=v.getDate();break;case "'":if(o("'"))s();else k=true;break;default:s()}if(q<b.length)throw"Extra/unparsed characters found in date: "+b.substring(q);if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}v=this._daylightSavingAdjust(new Date(c,j-1,l));if(v.getFullYear()!=c||v.getMonth()+1!=j||v.getDate()!=l)throw"Invalid date";return v},ATOM:"yy-mm-dd", -COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y",RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames: -null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&&a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,s){return i(o)?s[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",Math.round(((new Date(b.getFullYear(),b.getMonth(),b.getDate())).getTime()- -(new Date(b.getFullYear(),0,0)).getTime())/864E5),3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M",b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f= -0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+="0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==C?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a); -var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth=f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date; -i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g=(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g= -Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j,l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()> -12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay=a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&& -a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(),b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay? -new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n=this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a)); -n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var s=this._get(a,"nextText");s=!h?s:this.formatDate(s,this._daylightSavingAdjust(new Date(m, -g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+B+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+s+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+s+"</span></a>";j=this._get(a,"currentText");s=this._get(a,"gotoCurrent")&& -a.currentDay?u:b;j=!h?j:this.formatDate(j,s,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+B+'.datepicker._hideDatepicker();">'+this._get(a,"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,s)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+ -B+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");s=this._get(a,"dayNames");this._get(a,"dayNamesShort");var q=this._get(a,"dayNamesMin"),A=this._get(a,"monthNames"),v=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),D=this._get(a,"showOtherMonths"),K=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var E=this._getDefaultDate(a),w="",x=0;x<i[0];x++){var O= -"";this.maxRows=4;for(var G=0;G<i[1];G++){var P=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",y="";if(l){y+='<div class="ui-datepicker-group';if(i[1]>1)switch(G){case 0:y+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]-1:y+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:y+=" ui-datepicker-group-middle";t="";break}y+='">'}y+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&& -x==0?c?f:n:"")+(/all|right/.test(t)&&x==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,x>0||G>0,A,v)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var z=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var r=(t+h)%7;z+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+s[r]+'">'+q[r]+"</span></th>"}y+=z+"</tr></thead><tbody>";z=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay, -z);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;z=Math.ceil((t+z)/7);this.maxRows=z=l?this.maxRows>z?this.maxRows:z:z;r=this._daylightSavingAdjust(new Date(m,g,1-t));for(var Q=0;Q<z;Q++){y+="<tr>";var R=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(r)+"</td>";for(t=0;t<7;t++){var I=p?p.apply(a.input?a.input[0]:null,[r]):[true,""],F=r.getMonth()!=g,L=F&&!K||!I[0]||k&&r<k||o&&r>o;R+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(F?" ui-datepicker-other-month":"")+(r.getTime()== -P.getTime()&&g==a.selectedMonth&&a._keyEvent||E.getTime()==r.getTime()&&E.getTime()==P.getTime()?" "+this._dayOverClass:"")+(L?" "+this._unselectableClass+" ui-state-disabled":"")+(F&&!D?"":" "+I[1]+(r.getTime()==u.getTime()?" "+this._currentClass:"")+(r.getTime()==b.getTime()?" ui-datepicker-today":""))+'"'+((!F||D)&&I[2]?' title="'+I[2]+'"':"")+(L?"":' onclick="DP_jQuery_'+B+".datepicker._selectDay('#"+a.id+"',"+r.getMonth()+","+r.getFullYear()+', this);return false;"')+">"+(F&&!D?" ":L?'<span class="ui-state-default">'+ -r.getDate()+"</span>":'<a class="ui-state-default'+(r.getTime()==b.getTime()?" ui-state-highlight":"")+(r.getTime()==u.getTime()?" ui-state-active":"")+(F?" ui-priority-secondary":"")+'" href="#">'+r.getDate()+"</a>")+"</td>";r.setDate(r.getDate()+1);r=this._daylightSavingAdjust(r)}y+=R+"</tr>"}g++;if(g>11){g=0;m++}y+="</tbody></table>"+(l?"</div>"+(i[0]>0&&G==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");O+=y}w+=O}w+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>': -"");a._keyEvent=false;return w},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">',o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" >";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&& -(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&&l)?" ":""));if(!a.yearshtml){a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var s=(new Date).getFullYear();i=function(q){q=q.match(/c[+-].*/)?c+parseInt(q.substring(1),10):q.match(/[+-].*/)?s+parseInt(q,10):parseInt(q,10);return isNaN(q)?s:q};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b, -e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+B+".datepicker._selectMonthYear('#"+a.id+"', this, 'Y');\" >";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e=a.drawYear+(c=="Y"?b:0),f=a.drawMonth+ -(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a,"onChangeMonthYear");if(b)b.apply(a.input? -a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a);c=this._daylightSavingAdjust(new Date(c, -e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a,"dayNamesShort"),dayNames:this._get(a, -"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker=function(a){if(!this.length)return this; -if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));return this.each(function(){typeof a== -"string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new M;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.16";window["DP_jQuery_"+B]=d})(jQuery); -;/* - * jQuery UI Progressbar 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Progressbar - * - * Depends: - * jquery.ui.core.js - * jquery.ui.widget.js - */ -(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); -this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* -this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggle(a>this.min).toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.16"})})(jQuery); -;/* - * jQuery UI Effects 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/ - */ -jQuery.effects||function(f,j){function m(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], -16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return n.transparent;return n[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return m(b)}function o(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, -a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function p(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= -a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function l(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", -"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=m(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var n={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, -0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, -211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},q=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, -d){if(f.isFunction(b)){d=b;b=null}return this.queue(function(){var e=f(this),g=e.attr("style")||" ",h=p(o.call(this)),r,v=e.attr("class");f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});r=p(o.call(this));e.attr("class",v);e.animate(u(h,r),{queue:false,duration:a,easing:b,complete:function(){f.each(q,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments);f.dequeue(this)}})})}; -f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c,a):f.effects.animateClass.apply(this, -[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.16",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c,a){var b;switch(c[0]){case "top":b= -0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",border:"none",margin:0,padding:0}), -d=document.activeElement;c.wrap(b);if(c[0]===d||f.contains(c[0],d))f(d).focus();b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(e,g){a[g]=c.css(g);if(isNaN(parseInt(a[g],10)))a[g]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){var a,b=document.activeElement; -if(c.parent().is(".ui-effects-wrapper")){a=c.parent().replaceWith(c);if(c[0]===b||f.contains(c[0],b))f(b).focus();return a}return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)}); -return d.call(this,b)},_show:f.fn.show,show:function(c){if(l(c))return this._show.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(l(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(l(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this, -arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/ -2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b, -d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c, -a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b, -d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g= -0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158; -if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c,a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c, -a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); -;/* - * jQuery UI Effects Blind 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Blind - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, -g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Bounce 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Bounce - * - * Depends: - * jquery.effects.core.js - */ -(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ -3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); -b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Clip 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Clip - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, -c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Drop 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Drop - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== -"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Explode 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Explode - * - * Depends: - * jquery.effects.core.js - */ -(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= -0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ -e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); -;/* - * jQuery UI Effects Fade 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fade - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Fold 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Fold - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], -10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); -;/* - * jQuery UI Effects Highlight 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Highlight - * - * Depends: - * jquery.effects.core.js - */ -(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& -this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Pulsate 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Pulsate - * - * Depends: - * jquery.effects.core.js - */ -(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, -a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Scale 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Scale - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, -b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= -1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], -p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; -if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); -a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); -child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, -n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Shake 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Shake - * - * Depends: - * jquery.effects.core.js - */ -(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= -(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); -;/* - * jQuery UI Effects Slide 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Slide - * - * Depends: - * jquery.effects.core.js - */ -(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); -var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); -;/* - * jQuery UI Effects Transfer 1.8.16 - * - * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) - * Dual licensed under the MIT or GPL Version 2 licenses. - * http://jquery.org/license - * - * http://docs.jquery.com/UI/Effects/Transfer - * - * Depends: - * jquery.effects.core.js - */ -(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); -b.dequeue()})})}})(jQuery); -;
\ No newline at end of file diff --git a/core/js/js.js b/core/js/js.js index 7d967321d93..01e47edf268 100644 --- a/core/js/js.js +++ b/core/js/js.js @@ -3,14 +3,15 @@ * Add * define('DEBUG', true); * To the end of config/config.php to enable debug mode. + * The undefined checks fix the broken ie8 console */ -if (oc_debug !== true) { +if (oc_debug !== true || typeof console === "undefined" || typeof console.log === "undefined") { if (!window.console) { window.console = {}; } var methods = ['log', 'debug', 'warn', 'info', 'error', 'assert']; for (var i = 0; i < methods.length; i++) { - console[methods[i]] = function () { }; + console[methods[i]] = function () { }; } } @@ -20,7 +21,6 @@ if (oc_debug !== true) { * @param text the string to translate * @return string */ - function t(app,text, vars){ if( !( t.cache[app] )){ $.ajax(OC.filePath('core','ajax','translations.php'),{ @@ -37,14 +37,14 @@ function t(app,text, vars){ t.cache[app] = []; } } - var _build = function(text, vars) { - return text.replace(/{([^{}]*)}/g, - function (a, b) { - var r = vars[b]; - return typeof r === 'string' || typeof r === 'number' ? r : a; - } - ); - } + var _build = function (text, vars) { + return text.replace(/{([^{}]*)}/g, + function (a, b) { + var r = vars[b]; + return typeof r === 'string' || typeof r === 'number' ? r : a; + } + ); + }; if( typeof( t.cache[app][text] ) !== 'undefined' ){ if(typeof vars === 'object') { return _build(t.cache[app][text], vars); @@ -88,7 +88,7 @@ var OC={ PERMISSION_DELETE:8, PERMISSION_SHARE:16, webroot:oc_webroot, - appswebroots:oc_appswebroots, + appswebroots:(typeof oc_appswebroots !== 'undefined') ? oc_appswebroots:false, currentUser:(typeof oc_current_user!=='undefined')?oc_current_user:false, coreApps:['', 'admin','log','search','settings','core','3rdparty'], /** @@ -101,6 +101,27 @@ var OC={ return OC.filePath(app,'',file); }, /** + * Creates an url for remote use + * @param string $service id + * @return string the url + * + * Returns a url to the given service. + */ + linkToRemoteBase:function(service) { + return OC.webroot + '/remote.php/' + service; + }, + /** + * @brief Creates an absolute url for remote use + * @param string $service id + * @param bool $add_slash + * @return string the url + * + * Returns a absolute url to the given service. + */ + linkToRemote:function(service) { + return window.location.protocol + '//' + window.location.host + OC.linkToRemoteBase(service); + }, + /** * get the absolute url for a file in an app * @param app the id of the app * @param type the type of the file to link to (e.g. css,img,ajax.template) @@ -247,7 +268,7 @@ var OC={ var popup = $('#appsettings_popup'); if(popup.length == 0) { $('body').prepend('<div class="popup hidden" id="appsettings_popup"></div>'); - popup = $('#appsettings_popup'); + popup = $('#appsettings_popup'); popup.addClass(settings.hasClass('topright') ? 'topright' : 'bottomleft'); } if(popup.is(':visible')) { @@ -289,6 +310,41 @@ OC.search.lastResults={}; OC.addStyle.loaded=[]; OC.addScript.loaded=[]; +OC.Notification={ + getDefaultNotificationFunction: null, + setDefault: function(callback) { + OC.Notification.getDefaultNotificationFunction = callback; + }, + hide: function(callback) { + $("#notification").text(''); + $('#notification').fadeOut('400', function(){ + if (OC.Notification.isHidden()) { + if (OC.Notification.getDefaultNotificationFunction) { + OC.Notification.getDefaultNotificationFunction.call(); + } + } + if (callback) { + callback.call(); + } + }); + }, + showHtml: function(html) { + var notification = $('#notification'); + notification.hide(); + notification.html(html); + notification.fadeIn().css("display","inline"); + }, + show: function(text) { + var notification = $('#notification'); + notification.hide(); + notification.text(text); + notification.fadeIn().css("display","inline"); + }, + isHidden: function() { + return ($("#notification").text() === ''); + } +}; + OC.Breadcrumb={ container:null, crumbs:[], @@ -343,8 +399,15 @@ if(typeof localStorage !=='undefined' && localStorage !== null){ return localStorage.setItem(OC.localStorage.namespace+name,JSON.stringify(item)); }, getItem:function(name){ - if(localStorage.getItem(OC.localStorage.namespace+name)===null){return null;} - return JSON.parse(localStorage.getItem(OC.localStorage.namespace+name)); + var item = localStorage.getItem(OC.localStorage.namespace+name); + if(item===null) { + return null; + } else if (typeof JSON === 'undefined') { + //fallback to jquery for IE6/7/8 + return $.parseJSON(item); + } else { + return JSON.parse(item); + } } }; }else{ @@ -497,6 +560,7 @@ function fillHeight(selector) { if(selector.outerHeight() > selector.height()){ selector.css('height', height-(selector.outerHeight()-selector.height()) + 'px'); } + console.warn("This function is deprecated! Use CSS instead"); } /** @@ -512,17 +576,11 @@ function fillWindow(selector) { if(selector.outerWidth() > selector.width()){ selector.css('width', width-(selector.outerWidth()-selector.width()) + 'px'); } + console.warn("This function is deprecated! Use CSS instead"); } $(document).ready(function(){ - $(window).resize(function () { - fillHeight($('#leftcontent')); - fillWindow($('#content')); - fillWindow($('#rightcontent')); - }); - $(window).trigger('resize'); - if(!SVGSupport()){ //replace all svg images with png images for browser that dont support svg replaceSVG(); }else{ @@ -615,7 +673,7 @@ $(document).ready(function(){ $('.jp-controls .jp-previous').tipsy({gravity:'nw', fade:true, live:true}); $('.jp-controls .jp-next').tipsy({gravity:'n', fade:true, live:true}); $('.password .action').tipsy({gravity:'se', fade:true, live:true}); - $('#upload a').tipsy({gravity:'w', fade:true}); + $('#upload').tipsy({gravity:'w', fade:true}); $('.selectedActions a').tipsy({gravity:'s', fade:true, live:true}); $('a.delete').tipsy({gravity: 'e', fade:true, live:true}); $('a.action').tipsy({gravity:'s', fade:true, live:true}); diff --git a/core/js/multiselect.js b/core/js/multiselect.js index c4fd74b0475..623c6e0f7e1 100644 --- a/core/js/multiselect.js +++ b/core/js/multiselect.js @@ -1,20 +1,44 @@ +/** + * @param 'createCallback' A function to be called when a new entry is created. Two arguments are supplied to this function: + * The select element used and the value of the option. If the function returns false addition will be cancelled. If it returns + * anything else it will be used as the value of the newly added option. + * @param 'createText' The placeholder text for the create action. + * @param 'title' The title to show if no options are selected. + * @param 'checked' An array containing values for options that should be checked. Any options which are already selected will be added to this array. + * @param 'labels' The corresponding labels to show for the checked items. + * @param 'oncheck' Callback function which will be called when a checkbox/radiobutton is selected. If the function returns false the input will be unchecked. + * @param 'onuncheck' @see 'oncheck'. + * @param 'singleSelect' If true radiobuttons will be used instead of checkboxes. + */ (function( $ ){ var multiSelectId=-1; - $.fn.multiSelect=function(options){ + $.fn.multiSelect=function(options) { multiSelectId++; var settings = { 'createCallback':false, 'createText':false, + 'singleSelect':false, + 'selectedFirst':false, + 'sort':true, 'title':this.attr('title'), 'checked':[], + 'labels':[], 'oncheck':false, 'onuncheck':false, 'minWidth': 'default;', }; + $(this).attr('data-msid', multiSelectId); $.extend(settings,options); - $.each(this.children(),function(i,option){ - if($(option).attr('selected') && settings.checked.indexOf($(option).val())==-1){ + $.each(this.children(),function(i,option) { + // If the option is selected, but not in the checked array, add it. + if($(option).attr('selected') && settings.checked.indexOf($(option).val()) === -1) { settings.checked.push($(option).val()); + settings.labels.push($(option).text().trim()); + } + // If the option is in the checked array but not selected, select it. + else if(settings.checked.indexOf($(option).val()) !== -1 && !$(option).attr('selected')) { + $(option).attr('selected', 'selected'); + settings.labels.push($(option).text().trim()); } }); var button=$('<div class="multiselect button"><span>'+settings.title+'</span><span>▾</span></div>'); @@ -24,24 +48,36 @@ button.selectedItems=[]; this.hide(); this.before(span); - if(settings.minWidth=='default'){ + if(settings.minWidth=='default') { settings.minWidth=button.width(); } button.css('min-width',settings.minWidth); settings.minOuterWidth=button.outerWidth()-2; button.data('settings',settings); - if(settings.checked.length>0){ - button.children('span').first().text(settings.checked.join(', ')); + + if(!settings.singleSelect && settings.checked.length>0) { + button.children('span').first().text(settings.labels.join(', ')); + } else if(settings.singleSelect) { + button.children('span').first().text(this.find(':selected').text()); } + var self = this; + self.menuDirection = 'down'; button.click(function(event){ var button=$(this); - if(button.parent().children('ul').length>0){ - button.parent().children('ul').slideUp(400,function(){ - button.parent().children('ul').remove(); - button.removeClass('active'); - }); + if(button.parent().children('ul').length>0) { + if(self.menuDirection === 'down') { + button.parent().children('ul').slideUp(400,function() { + button.parent().children('ul').remove(); + button.removeClass('active down'); + }); + } else { + button.parent().children('ul').fadeOut(400,function() { + button.parent().children('ul').remove(); + button.removeClass('active up'); + }); + } return; } var lists=$('ul.multiselectoptions'); @@ -54,49 +90,69 @@ event.stopPropagation(); var options=$(this).parent().next().children(); var list=$('<ul class="multiselectoptions"/>').hide().appendTo($(this).parent()); - function createItem(element,checked){ + var inputType = settings.singleSelect ? 'radio' : 'checkbox'; + function createItem(element, checked){ element=$(element); var item=element.val(); var id='ms'+multiSelectId+'-option-'+item; - var input=$('<input type="checkbox"/>'); + var input=$('<input type="' + inputType + '"/>'); input.attr('id',id); + if(settings.singleSelect) { + input.attr('name', 'ms'+multiSelectId+'-option'); + } var label=$('<label/>'); label.attr('for',id); - label.text(item); - if(settings.checked.indexOf(item)!=-1 || checked){ - input.attr('checked',true); + label.text(element.text() || item); + if(settings.checked.indexOf(item)!=-1 || checked) { + input.attr('checked', true); } if(checked){ - settings.checked.push(item); + if(settings.singleSelect) { + settings.checked = [item]; + settings.labels = [item]; + } else { + settings.checked.push(item); + settings.labels.push(item); + } } input.change(function(){ - var groupname=$(this).next().text(); - if($(this).is(':checked')){ + var value = $(this).attr('id').substring(String('ms'+multiSelectId+'-option').length+1); + var label = $(this).next().text().trim(); + if($(this).is(':checked')) { + if(settings.singleSelect) { + settings.checked = []; + settings.labels = []; + $.each(self.find('option'), function() { + $(this).removeAttr('selected'); + }); + } element.attr('selected','selected'); - if(settings.oncheck){ - if(settings.oncheck(groupname)===false){ + if(typeof settings.oncheck === 'function') { + if(settings.oncheck(value)===false) { $(this).attr('checked', false); return; } } - settings.checked.push(groupname); - }else{ - var index=settings.checked.indexOf(groupname); + settings.checked.push(value); + settings.labels.push(label); + $(this).parent().addClass('checked'); + } else { + var index=settings.checked.indexOf(value); element.attr('selected',null); - if(settings.onuncheck){ - if(settings.onuncheck(groupname)===false){ + if(typeof settings.onuncheck === 'function') { + if(settings.onuncheck(value)===false) { $(this).attr('checked',true); return; } } + $(this).parent().removeClass('checked'); settings.checked.splice(index,1); + settings.labels.splice(index,1); } var oldWidth=button.width(); - if(settings.checked.length>0){ - button.children('span').first().text(settings.checked.join(', ')); - }else{ - button.children('span').first().text(settings.title); - } + button.children('span').first().text(settings.labels.length > 0 + ? settings.labels.join(', ') + : settings.title); var newOuterWidth=Math.max((button.outerWidth()-2),settings.minOuterWidth)+'px'; var newWidth=Math.max(button.width(),settings.minWidth); var pos=button.position(); @@ -110,6 +166,9 @@ }); var li=$('<li></li>'); li.append(input).append(label); + if(input.is(':checked')) { + li.addClass('checked'); + } return li; } $.each(options,function(index,item){ @@ -117,13 +176,13 @@ }); button.parent().data('preventHide',false); if(settings.createText){ - var li=$('<li>+ <em>'+settings.createText+'<em></li>'); + var li=$('<li class="creator">+ <em>'+settings.createText+'<em></li>'); li.click(function(event){ li.empty(); var input=$('<input class="new">'); li.append(input); input.focus(); - input.css('width',button.width()); + input.css('width',button.innerWidth()); button.parent().data('preventHide',true); input.keypress(function(event) { if(event.keyCode == 13) { @@ -132,7 +191,7 @@ var value = $(this).val(); var exists = false; $.each(options,function(index, item) { - if ($(item).val() == value) { + if ($(item).val() == value || $(item).text() == value) { exists = true; return false; } @@ -141,22 +200,39 @@ return false; } var li=$(this).parent(); + var val = $(this).val() + var select=button.parent().next(); + if(typeof settings.createCallback === 'function') { + var response = settings.createCallback(select, val); + if(response === false) { + return false; + } else if(typeof response !== 'undefined') { + val = response; + } + } + if(settings.singleSelect) { + $.each(select.find('option:selected'), function() { + $(this).removeAttr('selected'); + }); + } $(this).remove(); li.text('+ '+settings.createText); li.before(createItem(this)); - var select=button.parent().next(); var option=$('<option selected="selected"/>'); - option.attr('value',value); - option.text($(this).val()); + option.text($(this).val()).val(val).attr('selected', 'selected'); select.append(option); - li.prev().children('input').trigger('click'); + li.prev().children('input').prop('checked', true).trigger('change'); button.parent().data('preventHide',false); - if(settings.createCallback){ - settings.createCallback($(this).val()); + button.children('span').first().text(settings.labels.length > 0 + ? settings.labels.join(', ') + : settings.title); + if(self.menuDirection === 'up') { + var list = li.parent(); + list.css('top', list.position().top-li.outerHeight()); } } }); - input.blur(function(){ + input.blur(function() { event.preventDefault(); event.stopPropagation(); $(this).remove(); @@ -168,21 +244,72 @@ }); list.append(li); } + + var doSort = function(list, selector) { + var rows = list.find('li'+selector).get(); + + if(settings.sort) { + rows.sort(function(a, b) { + return $(a).text().toUpperCase().localeCompare($(b).text().toUpperCase()); + }); + } + + $.each(rows, function(index, row) { + list.append(row); + }); + }; + if(settings.sort && settings.selectedFirst) { + doSort(list, '.checked'); + doSort(list, ':not(.checked)'); + } else if(settings.sort && !settings.selectedFirst) { + doSort(list, ''); + } + list.append(list.find('li.creator')); var pos=button.position(); - list.css('top',pos.top+button.outerHeight()-5); - list.css('left',pos.left+3); - list.css('width',(button.outerWidth()-2)+'px'); - list.slideDown(); - list.click(function(event){ + if($(document).height() > (button.offset().top+button.outerHeight() + list.children().length * button.height()) + || $(document).height()/2 > pos.top + ) { + list.css({ + top:pos.top+button.outerHeight()-5, + left:pos.left+3, + width:(button.outerWidth()-2)+'px', + 'max-height':($(document).height()-(button.offset().top+button.outerHeight()+10))+'px' + }); + list.addClass('down'); + button.addClass('down'); + list.slideDown(); + } else { + list.css('max-height', $(document).height()-($(document).height()-(pos.top)+50)+'px'); + list.css({ + top:pos.top - list.height(), + left:pos.left+3, + width:(button.outerWidth()-2)+'px' + + }); + list.detach().insertBefore($(this)); + list.addClass('up'); + button.addClass('up'); + list.fadeIn(); + self.menuDirection = 'up'; + } + list.click(function(event) { event.stopPropagation(); }); }); - $(window).click(function(){ - if(!button.parent().data('preventHide')){ - button.parent().children('ul').slideUp(400,function(){ - button.parent().children('ul').remove(); - button.removeClass('active'); - }); + $(window).click(function() { + if(!button.parent().data('preventHide')) { + // How can I save the effect in a var? + if(self.menuDirection === 'down') { + button.parent().children('ul').slideUp(400,function() { + button.parent().children('ul').remove(); + button.removeClass('active down'); + }); + } else { + button.parent().children('ul').fadeOut(400,function() { + button.parent().children('ul').remove(); + button.removeClass('active up'); + }); + } } }); diff --git a/core/js/oc-requesttoken.js b/core/js/oc-requesttoken.js new file mode 100644 index 00000000000..f4cf286b8aa --- /dev/null +++ b/core/js/oc-requesttoken.js @@ -0,0 +1,3 @@ +$(document).bind('ajaxSend', function(elm, xhr, s) { + xhr.setRequestHeader('requesttoken', oc_requesttoken); +});
\ No newline at end of file diff --git a/core/js/setup.js b/core/js/setup.js index 39fcf4a2715..9aded6591ca 100644 --- a/core/js/setup.js +++ b/core/js/setup.js @@ -52,11 +52,12 @@ $(document).ready(function() { // Save form parameters var post = $(this).serializeArray(); + // FIXME: This lines are breaking the installation // Disable inputs - $(':submit', this).attr('disabled','disabled').val('Finishing …'); - $('input', this).addClass('ui-state-disabled').attr('disabled','disabled'); - $('#selectDbType').button('disable'); - $('label.ui-button', this).addClass('ui-state-disabled').attr('aria-disabled', 'true').button('disable'); + // $(':submit', this).attr('disabled','disabled').val('Finishing …'); + // $('input', this).addClass('ui-state-disabled').attr('disabled','disabled'); + // $('#selectDbType').button('disable'); + // $('label.ui-button', this).addClass('ui-state-disabled').attr('aria-disabled', 'true').button('disable'); // Create the form var form = $('<form>'); diff --git a/core/js/visitortimezone.js b/core/js/visitortimezone.js new file mode 100644 index 00000000000..58a1e9ea355 --- /dev/null +++ b/core/js/visitortimezone.js @@ -0,0 +1,4 @@ +$(document).ready(function () { + var visitortimezone = (-new Date().getTimezoneOffset() / 60); + $('#timezone-offset').val(visitortimezone); +});
\ No newline at end of file diff --git a/core/l10n/ar.php b/core/l10n/ar.php index d33de577b3d..38450f8d54f 100644 --- a/core/l10n/ar.php +++ b/core/l10n/ar.php @@ -98,10 +98,6 @@ "Lost your password?" => "هل نسيت كلمة السر؟", "remember" => "تذكر", "Log in" => "أدخل", -"You are logged out." => "تم الخروج بنجاح.", "prev" => "السابق", -"next" => "التالي", -"Security Warning!" => "تحذير أمان!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "الرجاء التحقق من كلمة السر. <br/>من الممكن أحياناً أن نطلب منك إعادة إدخال كلمة السر مرة أخرى.", -"Verify" => "تحقيق" +"next" => "التالي" ); diff --git a/core/l10n/bg_BG.php b/core/l10n/bg_BG.php index 0033324cb1d..a7cba523be2 100644 --- a/core/l10n/bg_BG.php +++ b/core/l10n/bg_BG.php @@ -1,62 +1,19 @@ <?php $TRANSLATIONS = array( -"This category already exists: " => "Категорията вече съществува:", -"No categories selected for deletion." => "Няма избрани категории за изтриване", "Settings" => "Настройки", -"Cancel" => "Отказ", -"No" => "Не", -"Yes" => "Да", -"Ok" => "Добре", -"Error" => "Грешка", +"seconds ago" => "преди секунди", +"1 minute ago" => "преди 1 минута", +"1 hour ago" => "преди 1 час", +"today" => "днес", +"yesterday" => "вчера", +"last month" => "последният месец", +"last year" => "последната година", +"years ago" => "последните години", "Password" => "Парола", -"You will receive a link to reset your password via Email." => "Ще получите връзка за нулиране на паролата Ви.", -"Username" => "Потребител", -"Request reset" => "Нулиране на заявка", -"Your password was reset" => "Вашата парола е нулирана", -"New password" => "Нова парола", -"Reset password" => "Нулиране на парола", "Personal" => "Лични", "Users" => "Потребители", -"Apps" => "Програми", +"Apps" => "Приложения", "Admin" => "Админ", "Help" => "Помощ", -"Access forbidden" => "Достъпът е забранен", -"Cloud not found" => "облакът не намерен", -"Edit categories" => "Редактиране на категориите", "Add" => "Добавяне", -"Create an <strong>admin account</strong>" => "Създаване на <strong>админ профил</strong>", -"Advanced" => "Разширено", -"Data folder" => "Директория за данни", -"Configure the database" => "Конфигуриране на базата", -"will be used" => "ще се ползва", -"Database user" => "Потребител за базата", -"Database password" => "Парола за базата", -"Database name" => "Име на базата", -"Database host" => "Хост за базата", -"Finish setup" => "Завършване на настройките", -"Sunday" => "Неделя", -"Monday" => "Понеделник", -"Tuesday" => "Вторник", -"Wednesday" => "Сряда", -"Thursday" => "Четвъртък", -"Friday" => "Петък", -"Saturday" => "Събота", -"January" => "Януари", -"February" => "Февруари", -"March" => "Март", -"April" => "Април", -"May" => "Май", -"June" => "Юни", -"July" => "Юли", -"August" => "Август", -"September" => "Септември", -"October" => "Октомври", -"November" => "Ноември", -"December" => "Декември", -"Log out" => "Изход", -"Lost your password?" => "Забравена парола?", -"remember" => "запомни", -"Log in" => "Вход", -"You are logged out." => "Вие излязохте.", -"prev" => "пред.", -"next" => "следващо" +"web services under your control" => "уеб услуги под Ваш контрол" ); diff --git a/core/l10n/bn_BD.php b/core/l10n/bn_BD.php new file mode 100644 index 00000000000..333e4bf0be5 --- /dev/null +++ b/core/l10n/bn_BD.php @@ -0,0 +1,125 @@ +<?php $TRANSLATIONS = array( +"User %s shared a file with you" => "%s নামের ব্যবহারকারি আপনার সাথে একটা ফাইল ভাগাভাগি করেছেন", +"User %s shared a folder with you" => "%s নামের ব্যবহারকারি আপনার সাথে একটা ফোল্ডার ভাগাভাগি করেছেন", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "%s নামের ব্যবহারকারী \"%s\" ফাইলটি আপনার সাথে ভাগাভাগি করেছেন। এটি এখন এখানে ডাউনলোড করার জন্য সুলভঃ %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "%s নামের ব্যবহারকারী \"%s\" ফোল্ডারটি আপনার সাথে ভাগাভাগি করেছেন। এটি এখন এখানে ডাউনলোড করার জন্য সুলভঃ %s", +"Category type not provided." => "ক্যাটেগরির ধরণটি প্রদান করা হয় নি।", +"No category to add?" => "যোগ করার মত কোন ক্যাটেগরি নেই ?", +"This category already exists: " => "এই ক্যাটেগরিটি পূর্ব থেকেই বিদ্যমানঃ", +"Object type not provided." => "অবজেক্টের ধরণটি প্রদান করা হয় নি।", +"%s ID not provided." => "%s ID প্রদান করা হয় নি।", +"Error adding %s to favorites." => "প্রিয়তে %s যোগ করতে সমস্যা দেখা দিয়েছে।", +"No categories selected for deletion." => "মুছে ফেলার জন্য কোন ক্যাটেগরি নির্বাচন করা হয় নি ।", +"Error removing %s from favorites." => "প্রিয় থেকে %s সরিয়ে ফেলতে সমস্যা দেখা দিয়েছে।", +"Settings" => "নিয়ামকসমূহ", +"seconds ago" => "সেকেন্ড পূর্বে", +"1 minute ago" => "1 মিনিট পূর্বে", +"{minutes} minutes ago" => "{minutes} মিনিট পূর্বে", +"1 hour ago" => "1 ঘন্টা পূর্বে", +"{hours} hours ago" => "{hours} ঘন্টা পূর্বে", +"today" => "আজ", +"yesterday" => "গতকাল", +"{days} days ago" => "{days} দিন পূর্বে", +"last month" => "গতমাস", +"{months} months ago" => "{months} মাস পূর্বে", +"months ago" => "মাস পূর্বে", +"last year" => "গত বছর", +"years ago" => "বছর পূর্বে", +"Choose" => "বেছে নিন", +"Cancel" => "বাতির", +"No" => "না", +"Yes" => "হ্যাঁ", +"Ok" => "তথাস্তু", +"The object type is not specified." => "অবজেক্টের ধরণটি সুনির্দিষ্ট নয়।", +"Error" => "সমস্যা", +"The app name is not specified." => "অ্যাপের নামটি সুনির্দিষ্ট নয়।", +"The required file {file} is not installed!" => "আবশ্যিক {file} টি সংস্থাপিত নেই !", +"Error while sharing" => "ভাগাভাগি করতে সমস্যা দেখা দিয়েছে ", +"Error while unsharing" => "ভাগাভাগি বাতিল করতে সমস্যা দেখা দিয়েছে", +"Error while changing permissions" => "অনুমতিসমূহ পরিবর্তন করতে সমস্যা দেখা দিয়েছে", +"Shared with you and the group {group} by {owner}" => "{owner} আপনার এবং {group} গোষ্ঠীর সাথে ভাগাভাগি করেছেন", +"Shared with you by {owner}" => "{owner} আপনার সাথে ভাগাভাগি করেছেন", +"Share with" => "যাদের সাথে ভাগাভাগি করা হয়েছে", +"Share with link" => "লিংকের সাথে ভাগাভাগি কর", +"Password protect" => "কূটশব্দ সুরক্ষিত", +"Password" => "কূটশব্দ", +"Email link to person" => "ব্যক্তির সাথে ই-মেইল যুক্ত কর", +"Send" => "পাঠাও", +"Set expiration date" => "মেয়াদোত্তীর্ণ হওয়ার তারিখ নির্ধারণ করুন", +"Expiration date" => "মেয়াদোত্তীর্ণ হওয়ার তারিখ", +"Share via email:" => "ই-মেইলের মাধ্যমে ভাগাভাগি করুনঃ", +"No people found" => "কোন ব্যক্তি খুঁজে পাওয়া গেল না", +"Resharing is not allowed" => "পূনঃরায় ভাগাভাগি অনুমোদিত নয়", +"Shared in {item} with {user}" => "{user} এর সাথে {item} ভাগাভাগি করা হয়েছে", +"Unshare" => "ভাগাভাগি বাতিল কর", +"can edit" => "সম্পাদনা করতে পারবেন", +"access control" => "অধিগম্যতা নিয়ন্ত্রণ", +"create" => "তৈরী করুন", +"update" => "পরিবর্ধন কর", +"delete" => "মুছে ফেল", +"share" => "ভাগাভাগি কর", +"Password protected" => "কূটশব্দদ্বারা সুরক্ষিত", +"Error unsetting expiration date" => "মেয়াদোত্তীর্ণ হওয়ার তারিখ নির্ধারণ বাতিল করতে সমস্যা দেখা দিয়েছে", +"Error setting expiration date" => "মেয়াদোত্তীর্ণ হওয়ার তারিখ নির্ধারণ করতে সমস্যা দেখা দিয়েছে", +"Sending ..." => "পাঠানো হচ্ছে......", +"Email sent" => "ই-মেইল পাঠানো হয়েছে", +"ownCloud password reset" => "ownCloud কূটশব্দ পূনঃনির্ধারণ", +"Use the following link to reset your password: {link}" => "আপনার কূটশব্দটি পূনঃনির্ধারণ করার জন্য নিম্নোক্ত লিংকটি ব্যবহার করুনঃ {link}", +"You will receive a link to reset your password via Email." => "কূটশব্দ পূনঃনির্ধারণের জন্য একটি টূনঃনির্ধারণ লিংকটি আপনাকে ই-মেইলে পাঠানো হয়েছে ।", +"Reset email send." => "পূনঃনির্ধারণ ই-মেইল পাঠানো হয়েছে।", +"Request failed!" => "অনুরোধ ব্যর্থ !", +"Username" => "ব্যবহারকারী", +"Request reset" => "অনুরোধ পূনঃনির্ধারণ", +"Your password was reset" => "আপনার কূটশব্দটি পূনঃনির্ধারণ করা হয়েছে", +"To login page" => "প্রবেশ পৃষ্ঠায়", +"New password" => "নতুন কূটশব্দ", +"Reset password" => "কূটশব্দ পূনঃনির্ধারণ কর", +"Personal" => "ব্যক্তিগত", +"Users" => "ব্যবহারকারী", +"Apps" => "অ্যাপস", +"Admin" => "প্রশাসন", +"Help" => "সহায়িকা", +"Access forbidden" => "অধিগমনের অনুমতি নেই", +"Cloud not found" => "ক্লাউড খুঁজে পাওয়া গেল না", +"Edit categories" => "ক্যাটেগরি সম্পাদনা", +"Add" => "যোগ কর", +"Security Warning" => "নিরাপত্তাজনিত সতর্কতা", +"Create an <strong>admin account</strong>" => "<strong>প্রশাসক একাউন্ট</strong> তৈরী করুন", +"Advanced" => "সুচারু", +"Data folder" => "ডাটা ফোল্ডার ", +"Configure the database" => "ডাটাবেচ কনফিগার করুন", +"will be used" => "ব্যবহৃত হবে", +"Database user" => "ডাটাবেজ ব্যবহারকারী", +"Database password" => "ডাটাবেজ কূটশব্দ", +"Database name" => "ডাটাবেজের নাম", +"Database tablespace" => "ডাটাবেজ টেবলস্পেস", +"Database host" => "ডাটাবেজ হোস্ট", +"Finish setup" => "সেটআপ সুসম্পন্ন কর", +"Sunday" => "রবিবার", +"Monday" => "সোমবার", +"Tuesday" => "মঙ্গলবার", +"Wednesday" => "বুধবার", +"Thursday" => "বৃহষ্পতিবার", +"Friday" => "শুক্রবার", +"Saturday" => "শনিবার", +"January" => "জানুয়ারি", +"February" => "ফেব্রুয়ারি", +"March" => "মার্চ", +"April" => "এপ্রিল", +"May" => "মে", +"June" => "জুন", +"July" => "জুলাই", +"August" => "অগাষ্ট", +"September" => "সেপ্টেম্বর", +"October" => "অক্টোবর", +"November" => "নভেম্বর", +"December" => "ডিসেম্বর", +"web services under your control" => "ওয়েব সার্ভিসের নিয়ন্ত্রণ আপনার হাতের মুঠোয়", +"Log out" => "প্রস্থান", +"Lost your password?" => "কূটশব্দ হারিয়েছেন?", +"remember" => "মনে রাখ", +"Log in" => "প্রবেশ", +"prev" => "পূর্ববর্তী", +"next" => "পরবর্তী", +"Updating ownCloud to version %s, this may take a while." => "%s ভার্সনে ownCloud পরিবর্ধন করা হচ্ছে, এজন্য কিছু সময় প্রয়োজন।" +); diff --git a/core/l10n/ca.php b/core/l10n/ca.php index f98922f8f38..e66bad25e43 100644 --- a/core/l10n/ca.php +++ b/core/l10n/ca.php @@ -125,10 +125,7 @@ "Lost your password?" => "Heu perdut la contrasenya?", "remember" => "recorda'm", "Log in" => "Inici de sessió", -"You are logged out." => "Heu tancat la sessió.", "prev" => "anterior", "next" => "següent", -"Security Warning!" => "Avís de seguretat!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Comproveu la vostra contrasenya. <br/>Per raons de seguretat se us pot demanar escriure de nou la vostra contrasenya.", -"Verify" => "Comprova" +"Updating ownCloud to version %s, this may take a while." => "S'està actualitzant ownCloud a la versió %s, pot trigar una estona." ); diff --git a/core/l10n/cs_CZ.php b/core/l10n/cs_CZ.php index 96252ea8bba..7a766bd7176 100644 --- a/core/l10n/cs_CZ.php +++ b/core/l10n/cs_CZ.php @@ -125,10 +125,7 @@ "Lost your password?" => "Ztratili jste své heslo?", "remember" => "zapamatovat si", "Log in" => "Přihlásit", -"You are logged out." => "Jste odhlášeni.", "prev" => "předchozí", "next" => "následující", -"Security Warning!" => "Bezpečnostní upozornění.", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Ověřte, prosím, své heslo. <br/>Z bezpečnostních důvodů můžete být občas požádáni o jeho opětovné zadání.", -"Verify" => "Ověřit" +"Updating ownCloud to version %s, this may take a while." => "Aktualizuji ownCloud na verzi %s, bude to chvíli trvat." ); diff --git a/core/l10n/da.php b/core/l10n/da.php index a792e1d9bae..e8155c298c0 100644 --- a/core/l10n/da.php +++ b/core/l10n/da.php @@ -125,10 +125,6 @@ "Lost your password?" => "Mistet dit kodeord?", "remember" => "husk", "Log in" => "Log ind", -"You are logged out." => "Du er nu logget ud.", "prev" => "forrige", -"next" => "næste", -"Security Warning!" => "Sikkerhedsadvarsel!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Verificer din adgangskode.<br/>Af sikkerhedsårsager kan du lejlighedsvist blive bedt om at indtaste din adgangskode igen.", -"Verify" => "Verificer" +"next" => "næste" ); diff --git a/core/l10n/de.php b/core/l10n/de.php index c5867eda8c3..89846301a58 100644 --- a/core/l10n/de.php +++ b/core/l10n/de.php @@ -125,10 +125,7 @@ "Lost your password?" => "Passwort vergessen?", "remember" => "merken", "Log in" => "Einloggen", -"You are logged out." => "Du wurdest abgemeldet.", "prev" => "Zurück", "next" => "Weiter", -"Security Warning!" => "Sicherheitswarnung!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Bitte bestätige Dein Passwort. <br/> Aus Sicherheitsgründen wirst Du hierbei gebeten, Dein Passwort erneut einzugeben.", -"Verify" => "Bestätigen" +"Updating ownCloud to version %s, this may take a while." => "Aktualisiere ownCloud auf Version %s. Dies könnte eine Weile dauern." ); diff --git a/core/l10n/de_DE.php b/core/l10n/de_DE.php index ed0bc0e0ffb..d62b000c0ab 100644 --- a/core/l10n/de_DE.php +++ b/core/l10n/de_DE.php @@ -125,10 +125,7 @@ "Lost your password?" => "Passwort vergessen?", "remember" => "merken", "Log in" => "Einloggen", -"You are logged out." => "Sie wurden abgemeldet.", "prev" => "Zurück", "next" => "Weiter", -"Security Warning!" => "Sicherheitshinweis!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Bitte überprüfen Sie Ihr Passwort. <br/>Aus Sicherheitsgründen werden Sie gelegentlich aufgefordert, Ihr Passwort erneut einzugeben.", -"Verify" => "Überprüfen" +"Updating ownCloud to version %s, this may take a while." => "Aktualisiere ownCloud auf Version %s. Dies könnte eine Weile dauern." ); diff --git a/core/l10n/el.php b/core/l10n/el.php index d8a5d7aef51..c029b01fd9c 100644 --- a/core/l10n/el.php +++ b/core/l10n/el.php @@ -125,10 +125,7 @@ "Lost your password?" => "Ξεχάσατε το συνθηματικό σας;", "remember" => "απομνημόνευση", "Log in" => "Είσοδος", -"You are logged out." => "Έχετε αποσυνδεθεί.", "prev" => "προηγούμενο", "next" => "επόμενο", -"Security Warning!" => "Προειδοποίηση Ασφαλείας!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Παρακαλώ επιβεβαιώστε το συνθηματικό σας. <br/>Για λόγους ασφαλείας μπορεί να ερωτάστε να εισάγετε ξανά το συνθηματικό σας.", -"Verify" => "Επαλήθευση" +"Updating ownCloud to version %s, this may take a while." => "Ενημερώνοντας το ownCloud στην έκδοση %s,μπορεί να πάρει λίγο χρόνο." ); diff --git a/core/l10n/eo.php b/core/l10n/eo.php index a605b27ed80..0319eeef2d4 100644 --- a/core/l10n/eo.php +++ b/core/l10n/eo.php @@ -121,10 +121,6 @@ "Lost your password?" => "Ĉu vi perdis vian pasvorton?", "remember" => "memori", "Log in" => "Ensaluti", -"You are logged out." => "Vi estas elsalutita.", "prev" => "maljena", -"next" => "jena", -"Security Warning!" => "Sekureca averto!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Bonvolu kontroli vian pasvorton. <br/>Pro sekureco, oni okaze povas peti al vi enigi vian pasvorton ree.", -"Verify" => "Kontroli" +"next" => "jena" ); diff --git a/core/l10n/es.php b/core/l10n/es.php index 2a9f5682dfb..4f8f1936c7f 100644 --- a/core/l10n/es.php +++ b/core/l10n/es.php @@ -125,10 +125,7 @@ "Lost your password?" => "¿Has perdido tu contraseña?", "remember" => "recuérdame", "Log in" => "Entrar", -"You are logged out." => "Has cerrado la sesión.", "prev" => "anterior", "next" => "siguiente", -"Security Warning!" => "¡Advertencia de seguridad!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Por favor verifique su contraseña. <br/>Por razones de seguridad se le puede volver a preguntar ocasionalmente la contraseña.", -"Verify" => "Verificar" +"Updating ownCloud to version %s, this may take a while." => "Actualizando ownCloud a la versión %s, esto puede demorar un tiempo." ); diff --git a/core/l10n/es_AR.php b/core/l10n/es_AR.php index 2da7951b064..374a679260b 100644 --- a/core/l10n/es_AR.php +++ b/core/l10n/es_AR.php @@ -1,4 +1,8 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "El usurario %s compartió un archivo con vos.", +"User %s shared a folder with you" => "El usurario %s compartió una carpeta con vos.", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "El usuario %s compartió el archivo \"%s\" con vos. Está disponible para su descarga aquí: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "El usuario %s compartió el archivo \"%s\" con vos. Está disponible para su descarga aquí: %s", "Category type not provided." => "Tipo de categoría no provisto. ", "No category to add?" => "¿Ninguna categoría para añadir?", "This category already exists: " => "Esta categoría ya existe: ", @@ -39,6 +43,8 @@ "Share with link" => "Compartir con link", "Password protect" => "Proteger con contraseña ", "Password" => "Contraseña", +"Email link to person" => "Enviar el link por e-mail.", +"Send" => "Enviar", "Set expiration date" => "Asignar fecha de vencimiento", "Expiration date" => "Fecha de vencimiento", "Share via email:" => "compartido a través de e-mail:", @@ -55,6 +61,8 @@ "Password protected" => "Protegido por contraseña", "Error unsetting expiration date" => "Error al remover la fecha de caducidad", "Error setting expiration date" => "Error al asignar fecha de vencimiento", +"Sending ..." => "Enviando...", +"Email sent" => "Email enviado", "ownCloud password reset" => "Restablecer contraseña de ownCloud", "Use the following link to reset your password: {link}" => "Usá este enlace para restablecer tu contraseña: {link}", "You will receive a link to reset your password via Email." => "Vas a recibir un enlace por e-mail para restablecer tu contraseña", @@ -117,10 +125,7 @@ "Lost your password?" => "¿Perdiste tu contraseña?", "remember" => "recordame", "Log in" => "Entrar", -"You are logged out." => "Terminaste la sesión.", "prev" => "anterior", "next" => "siguiente", -"Security Warning!" => "¡Advertencia de seguridad!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Por favor, verificá tu contraseña. <br/>Por razones de seguridad, puede ser que que te pregunte ocasionalmente la contraseña.", -"Verify" => "Verificar" +"Updating ownCloud to version %s, this may take a while." => "Actualizando ownCloud a la versión %s, puede domorar un rato." ); diff --git a/core/l10n/et_EE.php b/core/l10n/et_EE.php index b67dd13dd69..b79dd4761e7 100644 --- a/core/l10n/et_EE.php +++ b/core/l10n/et_EE.php @@ -101,9 +101,6 @@ "Lost your password?" => "Kaotasid oma parooli?", "remember" => "pea meeles", "Log in" => "Logi sisse", -"You are logged out." => "Sa oled välja loginud", "prev" => "eelm", -"next" => "järgm", -"Security Warning!" => "turvahoiatus!", -"Verify" => "Kinnita" +"next" => "järgm" ); diff --git a/core/l10n/eu.php b/core/l10n/eu.php index 1a21ca34705..3f1a2909531 100644 --- a/core/l10n/eu.php +++ b/core/l10n/eu.php @@ -125,10 +125,7 @@ "Lost your password?" => "Galdu duzu pasahitza?", "remember" => "gogoratu", "Log in" => "Hasi saioa", -"You are logged out." => "Zure saioa bukatu da.", "prev" => "aurrekoa", "next" => "hurrengoa", -"Security Warning!" => "Segurtasun abisua", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Mesedez egiaztatu zure pasahitza. <br/>Segurtasun arrazoiengatik noizbehinka zure pasahitza berriz sartzea eska diezazukegu.", -"Verify" => "Egiaztatu" +"Updating ownCloud to version %s, this may take a while." => "ownCloud %s bertsiora eguneratzen, denbora har dezake." ); diff --git a/core/l10n/fa.php b/core/l10n/fa.php index 2f859dc31d2..ad5bafeb1a2 100644 --- a/core/l10n/fa.php +++ b/core/l10n/fa.php @@ -17,6 +17,7 @@ "Ok" => "قبول", "Error" => "خطا", "Password" => "گذرواژه", +"Unshare" => "لغو اشتراک", "create" => "ایجاد", "ownCloud password reset" => "پسورد ابرهای شما تغییرکرد", "Use the following link to reset your password: {link}" => "از لینک زیر جهت دوباره سازی پسورد استفاده کنید :\n{link}", @@ -71,7 +72,6 @@ "Lost your password?" => "آیا گذرواژه تان را به یاد نمی آورید؟", "remember" => "بیاد آوری", "Log in" => "ورود", -"You are logged out." => "شما خارج شدید", "prev" => "بازگشت", "next" => "بعدی" ); diff --git a/core/l10n/fi_FI.php b/core/l10n/fi_FI.php index 4b4a23b8c70..751293e1fd5 100644 --- a/core/l10n/fi_FI.php +++ b/core/l10n/fi_FI.php @@ -1,7 +1,13 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "Käyttäjä %s jakoi tiedoston kanssasi", +"User %s shared a folder with you" => "Käyttäjä %s jakoi kansion kanssasi", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "Käyttäjä %s jakoi tiedoston \"%s\" kanssasi. Se on ladattavissa täältä: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "Käyttäjä %s jakoi kansion \"%s\" kanssasi. Se on ladattavissa täältä: %s", "No category to add?" => "Ei lisättävää luokkaa?", "This category already exists: " => "Tämä luokka on jo olemassa: ", +"Error adding %s to favorites." => "Virhe lisätessä kohdetta %s suosikkeihin.", "No categories selected for deletion." => "Luokkia ei valittu poistettavaksi.", +"Error removing %s from favorites." => "Virhe poistaessa kohdetta %s suosikeista.", "Settings" => "Asetukset", "seconds ago" => "sekuntia sitten", "1 minute ago" => "1 minuutti sitten", @@ -27,6 +33,9 @@ "Error while sharing" => "Virhe jaettaessa", "Error while unsharing" => "Virhe jakoa peruttaessa", "Error while changing permissions" => "Virhe oikeuksia muuttaessa", +"Shared with you and the group {group} by {owner}" => "Jaettu sinun ja ryhmän {group} kanssa käyttäjän {owner} toimesta", +"Shared with you by {owner}" => "Jaettu kanssasi käyttäjän {owner} toimesta", +"Share with" => "Jaa", "Share with link" => "Jaa linkillä", "Password protect" => "Suojaa salasanalla", "Password" => "Salasana", @@ -52,6 +61,7 @@ "ownCloud password reset" => "ownCloud-salasanan nollaus", "Use the following link to reset your password: {link}" => "Voit palauttaa salasanasi seuraavassa osoitteessa: {link}", "You will receive a link to reset your password via Email." => "Saat sähköpostitse linkin nollataksesi salasanan.", +"Reset email send." => "Salasanan nollausviesti lähetetty.", "Request failed!" => "Pyyntö epäonnistui!", "Username" => "Käyttäjätunnus", "Request reset" => "Tilaus lähetetty", @@ -108,10 +118,7 @@ "Lost your password?" => "Unohditko salasanasi?", "remember" => "muista", "Log in" => "Kirjaudu sisään", -"You are logged out." => "Olet kirjautunut ulos.", "prev" => "edellinen", "next" => "seuraava", -"Security Warning!" => "Turvallisuusvaroitus!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Vahvista salasanasi. <br/>Turvallisuussyistä sinulta saatetaan ajoittain kysyä salasanasi uudelleen.", -"Verify" => "Vahvista" +"Updating ownCloud to version %s, this may take a while." => "Päivitetään ownCloud versioon %s, tämä saattaa kestää hetken." ); diff --git a/core/l10n/fr.php b/core/l10n/fr.php index 3d174b327a2..39269e43b5d 100644 --- a/core/l10n/fr.php +++ b/core/l10n/fr.php @@ -2,6 +2,7 @@ "User %s shared a file with you" => "L'utilisateur %s a partagé un fichier avec vous", "User %s shared a folder with you" => "L'utilsateur %s a partagé un dossier avec vous", "User %s shared the file \"%s\" with you. It is available for download here: %s" => "L'utilisateur %s a partagé le fichier \"%s\" avec vous. Vous pouvez le télécharger ici : %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "L'utilisateur %s a partagé le dossier \"%s\" avec vous. Il est disponible au téléchargement ici : %s", "Category type not provided." => "Type de catégorie non spécifié.", "No category to add?" => "Pas de catégorie à ajouter ?", "This category already exists: " => "Cette catégorie existe déjà : ", @@ -58,7 +59,7 @@ "delete" => "supprimer", "share" => "partager", "Password protected" => "Protégé par un mot de passe", -"Error unsetting expiration date" => "Un erreur est survenue pendant la suppression de la date d'expiration", +"Error unsetting expiration date" => "Une erreur est survenue pendant la suppression de la date d'expiration", "Error setting expiration date" => "Erreur lors de la spécification de la date d'expiration", "Sending ..." => "En cours d'envoi ...", "Email sent" => "Email envoyé", @@ -82,7 +83,7 @@ "Cloud not found" => "Introuvable", "Edit categories" => "Modifier les catégories", "Add" => "Ajouter", -"Security Warning" => "Avertissement de sécutité", +"Security Warning" => "Avertissement de sécurité", "No secure random number generator is available, please enable the PHP OpenSSL extension." => "Aucun générateur de nombre aléatoire sécurisé n'est disponible, veuillez activer l'extension PHP OpenSSL", "Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Sans générateur de nombre aléatoire sécurisé, un attaquant peut être en mesure de prédire les jetons de réinitialisation du mot de passe, et ainsi prendre le contrôle de votre compte utilisateur.", "Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "Votre dossier data et vos fichiers sont probablement accessibles depuis internet. Le fichier .htaccess fourni par ownCloud ne fonctionne pas. Nous vous recommandons vivement de configurer votre serveur web de manière à ce que le dossier data ne soit plus accessible ou bien de déplacer le dossier data en dehors du dossier racine des documents du serveur web.", @@ -124,10 +125,7 @@ "Lost your password?" => "Mot de passe perdu ?", "remember" => "se souvenir de moi", "Log in" => "Connexion", -"You are logged out." => "Vous êtes désormais déconnecté.", "prev" => "précédent", "next" => "suivant", -"Security Warning!" => "Alerte de sécurité !", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Veuillez vérifier votre mot de passe. <br/>Par sécurité il vous sera occasionnellement demandé d'entrer votre mot de passe de nouveau.", -"Verify" => "Vérification" +"Updating ownCloud to version %s, this may take a while." => "Mise à jour en cours d'ownCloud vers la version %s, cela peut prendre du temps." ); diff --git a/core/l10n/gl.php b/core/l10n/gl.php index 4cdc39896b5..2642debb288 100644 --- a/core/l10n/gl.php +++ b/core/l10n/gl.php @@ -1,23 +1,27 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "O usuario %s compartíu un ficheiro con vostede", +"User %s shared a folder with you" => "O usuario %s compartíu un cartafol con vostede", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "O usuario %s compartiu o ficheiro «%s» con vostede. Teno dispoñíbel en: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "O usuario %s compartiu o cartafol «%s» con vostede. Teno dispoñíbel en: %s", "Category type not provided." => "Non se indicou o tipo de categoría", "No category to add?" => "Sen categoría que engadir?", "This category already exists: " => "Esta categoría xa existe: ", "Object type not provided." => "Non se forneceu o tipo de obxecto.", -"%s ID not provided." => "Non se deu o ID %s.", -"Error adding %s to favorites." => "Erro ao engadir %s aos favoritos.", +"%s ID not provided." => "Non se forneceu o ID %s.", +"Error adding %s to favorites." => "Produciuse un erro ao engadir %s aos favoritos.", "No categories selected for deletion." => "Non hai categorías seleccionadas para eliminar.", -"Error removing %s from favorites." => "Erro ao eliminar %s dos favoritos.", +"Error removing %s from favorites." => "Produciuse un erro ao eliminar %s dos favoritos.", "Settings" => "Configuracións", "seconds ago" => "segundos atrás", "1 minute ago" => "hai 1 minuto", -"{minutes} minutes ago" => "{minutes} minutos atrás", +"{minutes} minutes ago" => "hai {minutes} minutos", "1 hour ago" => "hai 1 hora", -"{hours} hours ago" => "{hours} horas atrás", +"{hours} hours ago" => "hai {hours} horas", "today" => "hoxe", "yesterday" => "onte", -"{days} days ago" => "{days} días atrás", +"{days} days ago" => "hai {days} días", "last month" => "último mes", -"{months} months ago" => "{months} meses atrás", +"{months} months ago" => "hai {months} meses", "months ago" => "meses atrás", "last year" => "último ano", "years ago" => "anos atrás", @@ -30,42 +34,46 @@ "Error" => "Erro", "The app name is not specified." => "Non se especificou o nome do aplicativo.", "The required file {file} is not installed!" => "Non está instalado o ficheiro {file} que se precisa", -"Error while sharing" => "Erro compartindo", -"Error while unsharing" => "Erro ao deixar de compartir", -"Error while changing permissions" => "Erro ao cambiar os permisos", -"Shared with you and the group {group} by {owner}" => "Compartido contigo e co grupo {group} de {owner}", -"Shared with you by {owner}" => "Compartido contigo por {owner}", +"Error while sharing" => "Produciuse un erro ao compartir", +"Error while unsharing" => "Produciuse un erro ao deixar de compartir", +"Error while changing permissions" => "Produciuse un erro ao cambiar os permisos", +"Shared with you and the group {group} by {owner}" => "Compartido con vostede e co grupo {group} por {owner}", +"Shared with you by {owner}" => "Compartido con vostede por {owner}", "Share with" => "Compartir con", -"Share with link" => "Compartir ca ligazón", +"Share with link" => "Compartir coa ligazón", "Password protect" => "Protexido con contrasinais", "Password" => "Contrasinal", +"Email link to person" => "Enviar ligazón por correo", +"Send" => "Enviar", "Set expiration date" => "Definir a data de caducidade", "Expiration date" => "Data de caducidade", -"Share via email:" => "Compartir por correo electrónico:", +"Share via email:" => "Compartir por correo:", "No people found" => "Non se atopou xente", -"Resharing is not allowed" => "Non se acepta volver a compartir", +"Resharing is not allowed" => "Non se permite volver a compartir", "Shared in {item} with {user}" => "Compartido en {item} con {user}", "Unshare" => "Deixar de compartir", "can edit" => "pode editar", "access control" => "control de acceso", "create" => "crear", "update" => "actualizar", -"delete" => "borrar", +"delete" => "eliminar", "share" => "compartir", "Password protected" => "Protexido con contrasinal", -"Error unsetting expiration date" => "Erro ao quitar a data de caducidade", -"Error setting expiration date" => "Erro ao definir a data de caducidade", -"ownCloud password reset" => "Restablecer contrasinal de ownCloud", -"Use the following link to reset your password: {link}" => "Usa a seguinte ligazón para restablecer o contrasinal: {link}", -"You will receive a link to reset your password via Email." => "Recibirá unha ligazón por correo electrónico para restablecer o contrasinal", -"Reset email send." => "Restablecer o envío por correo.", -"Request failed!" => "Fallo na petición", +"Error unsetting expiration date" => "Produciuse un erro ao retirar a data de caducidade", +"Error setting expiration date" => "Produciuse un erro ao definir a data de caducidade", +"Sending ..." => "Enviando...", +"Email sent" => "Correo enviado", +"ownCloud password reset" => "Restabelecer o contrasinal de ownCloud", +"Use the following link to reset your password: {link}" => "Usa a seguinte ligazón para restabelecer o contrasinal: {link}", +"You will receive a link to reset your password via Email." => "Recibirá unha ligazón por correo para restabelecer o contrasinal", +"Reset email send." => "Restabelecer o envío por correo.", +"Request failed!" => "Non foi posíbel facer a petición", "Username" => "Nome de usuario", -"Request reset" => "Petición de restablecemento", -"Your password was reset" => "O contrasinal foi restablecido", +"Request reset" => "Petición de restabelecemento", +"Your password was reset" => "O contrasinal foi restabelecido", "To login page" => "A páxina de conexión", "New password" => "Novo contrasinal", -"Reset password" => "Restablecer contrasinal", +"Reset password" => "Restabelecer o contrasinal", "Personal" => "Persoal", "Users" => "Usuarios", "Apps" => "Aplicativos", @@ -75,15 +83,15 @@ "Cloud not found" => "Nube non atopada", "Edit categories" => "Editar categorías", "Add" => "Engadir", -"Security Warning" => "Aviso de seguridade", -"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Non hai un xerador de números aleatorios dispoñíbel. Activa o engadido de OpenSSL para PHP.", -"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Sen un xerador de números aleatorios seguro podería acontecer que predicindo as cadeas de texto de reinicio de contrasinais se afagan coa túa conta.", -"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "O teu cartafol de datos e os teus ficheiros son seguramente accesibles a través de internet. O ficheiro .htaccess que ownCloud fornece non está empregándose. Suxírese que configures o teu servidor web de tal maneira que o cartafol de datos non estea accesíbel ou movas o cartafol de datos fóra do root do directorio de datos do servidor web.", +"Security Warning" => "Aviso de seguranza", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Non hai un xerador de números ao chou dispoñíbel. Active o engadido de OpenSSL para PHP.", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Sen un xerador seguro de números ao chou podería acontecer que predicindo as cadeas de texto de reinicio de contrasinais se afagan coa súa conta.", +"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "O seu cartafol de datos e os seus ficheiros probabelmente sexan accesíbeis a través da Internet. O ficheiro .htaccess que fornece ownCloud non está a empregarse. Suxerimoslle que configure o seu servidor web de tal xeito que o cartafol de datos non estea accesíbel ou mova o cartafol de datos fora do directorio raíz de datos do servidor web.", "Create an <strong>admin account</strong>" => "Crear unha <strong>contra de administrador</strong>", "Advanced" => "Avanzado", "Data folder" => "Cartafol de datos", "Configure the database" => "Configurar a base de datos", -"will be used" => "será utilizado", +"will be used" => "vai ser utilizado", "Database user" => "Usuario da base de datos", "Database password" => "Contrasinal da base de datos", "Database name" => "Nome da base de datos", @@ -97,30 +105,27 @@ "Thursday" => "Xoves", "Friday" => "Venres", "Saturday" => "Sábado", -"January" => "Xaneiro", -"February" => "Febreiro", -"March" => "Marzo", -"April" => "Abril", -"May" => "Maio", -"June" => "Xuño", -"July" => "Xullo", -"August" => "Agosto", -"September" => "Setembro", -"October" => "Outubro", -"November" => "Novembro", -"December" => "Decembro", +"January" => "xaneiro", +"February" => "febreiro", +"March" => "marzo", +"April" => "abril", +"May" => "maio", +"June" => "xuño", +"July" => "xullo", +"August" => "agosto", +"September" => "setembro", +"October" => "outubro", +"November" => "novembro", +"December" => "decembro", "web services under your control" => "servizos web baixo o seu control", "Log out" => "Desconectar", "Automatic logon rejected!" => "Rexeitouse a entrada automática", -"If you did not change your password recently, your account may be compromised!" => "Se non fixeches cambios de contrasinal recentemente é posíbel que a túa conta estea comprometida!", -"Please change your password to secure your account again." => "Cambia de novo o teu contrasinal para asegurar a túa conta.", +"If you did not change your password recently, your account may be compromised!" => "Se non fixo recentemente cambios de contrasinal é posíbel que a súa conta estea comprometida!", +"Please change your password to secure your account again." => "Cambie de novo o seu contrasinal para asegurar a súa conta.", "Lost your password?" => "Perdeu o contrasinal?", "remember" => "lembrar", "Log in" => "Conectar", -"You are logged out." => "Está desconectado", "prev" => "anterior", "next" => "seguinte", -"Security Warning!" => "Advertencia de seguranza", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Verifica o teu contrasinal.<br/>Por motivos de seguridade pode que ocasionalmente se che pregunte de novo polo teu contrasinal.", -"Verify" => "Verificar" +"Updating ownCloud to version %s, this may take a while." => "Actualizando ownCloud a versión %s, esto pode levar un anaco." ); diff --git a/core/l10n/he.php b/core/l10n/he.php index 50addbd5278..59eb3ae14d4 100644 --- a/core/l10n/he.php +++ b/core/l10n/he.php @@ -125,10 +125,7 @@ "Lost your password?" => "שכחת את ססמתך?", "remember" => "שמירת הססמה", "Log in" => "כניסה", -"You are logged out." => "לא התחברת.", "prev" => "הקודם", "next" => "הבא", -"Security Warning!" => "אזהרת אבטחה!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "נא לאמת את הססמה שלך. <br/>מטעמי אבטחה יתכן שתופיע בקשה להזין את הססמה שוב.", -"Verify" => "אימות" +"Updating ownCloud to version %s, this may take a while." => "מעדכן את ownCloud אל גרסא %s, זה עלול לקחת זמן מה." ); diff --git a/core/l10n/hi.php b/core/l10n/hi.php index 0e4f18c6cd8..d7f9fd150b0 100644 --- a/core/l10n/hi.php +++ b/core/l10n/hi.php @@ -12,7 +12,6 @@ "Database user" => "डेटाबेस उपयोगकर्ता", "Database password" => "डेटाबेस पासवर्ड", "Finish setup" => "सेटअप समाप्त करे", -"You are logged out." => "आप लोग आउट कर दिए गए हैं.", "prev" => "पिछला", "next" => "अगला" ); diff --git a/core/l10n/hr.php b/core/l10n/hr.php index 69bdd3a4f83..43dbbe51ae0 100644 --- a/core/l10n/hr.php +++ b/core/l10n/hr.php @@ -91,7 +91,6 @@ "Lost your password?" => "Izgubili ste lozinku?", "remember" => "zapamtiti", "Log in" => "Prijava", -"You are logged out." => "Odjavljeni ste.", "prev" => "prethodan", "next" => "sljedeći" ); diff --git a/core/l10n/hu_HU.php b/core/l10n/hu_HU.php index d1bfb303e6f..e03c6af27f5 100644 --- a/core/l10n/hu_HU.php +++ b/core/l10n/hu_HU.php @@ -1,27 +1,92 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "%s felhasználó megosztott Önnel egy fájlt", +"User %s shared a folder with you" => "%s felhasználó megosztott Önnel egy mappát", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "%s felhasználó megosztotta ezt az állományt Önnel: %s. A fájl innen tölthető le: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "%s felhasználó megosztotta ezt a mappát Önnel: %s. A mappa innen tölthető le: %s", +"Category type not provided." => "Nincs megadva a kategória típusa.", "No category to add?" => "Nincs hozzáadandó kategória?", -"This category already exists: " => "Ez a kategória már létezik", +"This category already exists: " => "Ez a kategória már létezik: ", +"Object type not provided." => "Az objektum típusa nincs megadva.", +"%s ID not provided." => "%s ID nincs megadva.", +"Error adding %s to favorites." => "Nem sikerült a kedvencekhez adni ezt: %s", "No categories selected for deletion." => "Nincs törlésre jelölt kategória", +"Error removing %s from favorites." => "Nem sikerült a kedvencekből törölni ezt: %s", +"Sunday" => "vasárnap", +"Monday" => "hétfő", +"Tuesday" => "kedd", +"Wednesday" => "szerda", +"Thursday" => "csütörtök", +"Friday" => "péntek", +"Saturday" => "szombat", +"January" => "január", +"February" => "február", +"March" => "március", +"April" => "április", +"May" => "május", +"June" => "június", +"July" => "július", +"August" => "augusztus", +"September" => "szeptember", +"October" => "október", +"November" => "november", +"December" => "december", "Settings" => "Beállítások", -"seconds ago" => "másodperccel ezelőtt", -"1 minute ago" => "1 perccel ezelőtt", +"seconds ago" => "pár másodperce", +"1 minute ago" => "1 perce", +"{minutes} minutes ago" => "{minutes} perce", +"1 hour ago" => "1 órája", +"{hours} hours ago" => "{hours} órája", "today" => "ma", "yesterday" => "tegnap", +"{days} days ago" => "{days} napja", "last month" => "múlt hónapban", -"months ago" => "hónappal ezelőtt", +"{months} months ago" => "{months} hónapja", +"months ago" => "több hónapja", "last year" => "tavaly", -"years ago" => "évvel ezelőtt", +"years ago" => "több éve", +"Choose" => "Válasszon", "Cancel" => "Mégse", "No" => "Nem", "Yes" => "Igen", "Ok" => "Ok", +"The object type is not specified." => "Az objektum típusa nincs megadva.", "Error" => "Hiba", +"The app name is not specified." => "Az alkalmazás neve nincs megadva.", +"The required file {file} is not installed!" => "A szükséges fájl: {file} nincs telepítve!", +"Error while sharing" => "Nem sikerült létrehozni a megosztást", +"Error while unsharing" => "Nem sikerült visszavonni a megosztást", +"Error while changing permissions" => "Nem sikerült módosítani a jogosultságokat", +"Shared with you and the group {group} by {owner}" => "Megosztotta Önnel és a(z) {group} csoporttal: {owner}", +"Shared with you by {owner}" => "Megosztotta Önnel: {owner}", +"Share with" => "Kivel osztom meg", +"Share with link" => "Link megadásával osztom meg", +"Password protect" => "Jelszóval is védem", "Password" => "Jelszó", -"Unshare" => "Nem oszt meg", -"create" => "létrehozás", +"Email link to person" => "Email címre küldjük el", +"Send" => "Küldjük el", +"Set expiration date" => "Legyen lejárati idő", +"Expiration date" => "A lejárati idő", +"Share via email:" => "Megosztás emaillel:", +"No people found" => "Nincs találat", +"Resharing is not allowed" => "Ezt az állományt csak a tulajdonosa oszthatja meg másokkal", +"Shared in {item} with {user}" => "Megosztva {item}-ben {user}-rel", +"Unshare" => "A megosztás visszavonása", +"can edit" => "módosíthat", +"access control" => "jogosultság", +"create" => "létrehoz", +"update" => "szerkeszt", +"delete" => "töröl", +"share" => "megoszt", +"Password protected" => "Jelszóval van védve", +"Error unsetting expiration date" => "Nem sikerült a lejárati időt törölni", +"Error setting expiration date" => "Nem sikerült a lejárati időt beállítani", +"Sending ..." => "Küldés ...", +"Email sent" => "Az emailt elküldtük", "ownCloud password reset" => "ownCloud jelszó-visszaállítás", -"Use the following link to reset your password: {link}" => "Használja az alábbi linket a jelszó-visszaállításhoz: {link}", -"You will receive a link to reset your password via Email." => "Egy e-mailben kap értesítést a jelszóváltoztatás módjáról.", +"Use the following link to reset your password: {link}" => "Használja ezt a linket a jelszó ismételt beállításához: {link}", +"You will receive a link to reset your password via Email." => "Egy emailben fog értesítést kapni a jelszóbeállítás módjáról.", +"Reset email send." => "Elküldtük az emailt a jelszó ismételt beállításához.", +"Request failed!" => "Nem sikerült a kérést teljesíteni!", "Username" => "Felhasználónév", "Request reset" => "Visszaállítás igénylése", "Your password was reset" => "Jelszó megváltoztatva", @@ -31,48 +96,36 @@ "Personal" => "Személyes", "Users" => "Felhasználók", "Apps" => "Alkalmazások", -"Admin" => "Admin", +"Admin" => "Adminisztráció", "Help" => "Súgó", -"Access forbidden" => "Hozzáférés tiltva", +"Access forbidden" => "A hozzáférés nem engedélyezett", "Cloud not found" => "A felhő nem található", "Edit categories" => "Kategóriák szerkesztése", "Add" => "Hozzáadás", "Security Warning" => "Biztonsági figyelmeztetés", -"Create an <strong>admin account</strong>" => "<strong>Rendszergazdafiók</strong> létrehozása", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Nem érhető el megfelelő véletlenszám-generátor, telepíteni kellene a PHP OpenSSL kiegészítését.", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Megfelelő véletlenszám-generátor hiányában egy támadó szándékú idegen képes lehet megjósolni a jelszóvisszaállító tokent, és Ön helyett belépni.", +"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "Az adatkönytára és az itt levő fájlok valószínűleg elérhetők az internetről. Az ownCloud által beillesztett .htaccess fájl nem működik. Nagyon fontos, hogy a webszervert úgy konfigurálja, hogy az adatkönyvtár nem legyen közvetlenül kívülről elérhető, vagy az adatkönyvtárt tegye a webszerver dokumentumfáján kívülre.", +"Create an <strong>admin account</strong>" => "<strong>Rendszergazdai belépés</strong> létrehozása", "Advanced" => "Haladó", "Data folder" => "Adatkönyvtár", "Configure the database" => "Adatbázis konfigurálása", -"will be used" => "használva lesz", +"will be used" => "adatbázist fogunk használni", "Database user" => "Adatbázis felhasználónév", "Database password" => "Adatbázis jelszó", -"Database name" => "Adatbázis név", +"Database name" => "Az adatbázis neve", +"Database tablespace" => "Az adatbázis táblázattér (tablespace)", "Database host" => "Adatbázis szerver", -"Finish setup" => "Beállítás befejezése", -"Sunday" => "Vasárnap", -"Monday" => "Hétfő", -"Tuesday" => "Kedd", -"Wednesday" => "Szerda", -"Thursday" => "Csütörtök", -"Friday" => "Péntek", -"Saturday" => "Szombat", -"January" => "Január", -"February" => "Február", -"March" => "Március", -"April" => "Április", -"May" => "Május", -"June" => "Június", -"July" => "Július", -"August" => "Augusztus", -"September" => "Szeptember", -"October" => "Október", -"November" => "November", -"December" => "December", -"web services under your control" => "webszolgáltatások az irányításod alatt", +"Finish setup" => "A beállítások befejezése", +"web services under your control" => "webszolgáltatások saját kézben", "Log out" => "Kilépés", -"Lost your password?" => "Elfelejtett jelszó?", +"Automatic logon rejected!" => "Az automatikus bejelentkezés sikertelen!", +"If you did not change your password recently, your account may be compromised!" => "Ha mostanában nem módosította a jelszavát, akkor lehetséges, hogy idegenek jutottak be a rendszerbe az Ön nevében!", +"Please change your password to secure your account again." => "A biztonsága érdekében változtassa meg a jelszavát!", +"Lost your password?" => "Elfelejtette a jelszavát?", "remember" => "emlékezzen", "Log in" => "Bejelentkezés", -"You are logged out." => "Kilépett.", -"prev" => "Előző", -"next" => "Következő" +"prev" => "előző", +"next" => "következő", +"Updating ownCloud to version %s, this may take a while." => "Owncloud frissítés a %s verzióra folyamatban. Kis türelmet." ); diff --git a/core/l10n/ia.php b/core/l10n/ia.php index 07cc118f0e6..d614f8381af 100644 --- a/core/l10n/ia.php +++ b/core/l10n/ia.php @@ -52,7 +52,6 @@ "Lost your password?" => "Tu perdeva le contrasigno?", "remember" => "memora", "Log in" => "Aperir session", -"You are logged out." => "Tu session ha essite claudite.", "prev" => "prev", "next" => "prox" ); diff --git a/core/l10n/id.php b/core/l10n/id.php index 99df16332f5..ee5fad95217 100644 --- a/core/l10n/id.php +++ b/core/l10n/id.php @@ -100,10 +100,6 @@ "Lost your password?" => "Lupa password anda?", "remember" => "selalu login", "Log in" => "Masuk", -"You are logged out." => "Anda telah keluar.", "prev" => "sebelum", -"next" => "selanjutnya", -"Security Warning!" => "peringatan keamanan!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "mohon periksa kembali kata kunci anda. <br/>untuk alasan keamanan,anda akan sesekali diminta untuk memasukan kata kunci lagi.", -"Verify" => "periksa kembali" +"next" => "selanjutnya" ); diff --git a/core/l10n/is.php b/core/l10n/is.php index 23117cddf8b..e810eb359fd 100644 --- a/core/l10n/is.php +++ b/core/l10n/is.php @@ -1,24 +1,110 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "Notandinn %s deildi skrá með þér", +"User %s shared a folder with you" => "Notandinn %s deildi möppu með þér", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "Notandinn %s deildi skránni \"%s\" með þér. Hægt er að hlaða henni niður hér: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "Notandinn %s deildi möppunni \"%s\" með þér. Hægt er að hlaða henni niður hér: %s", "Category type not provided." => "Flokkur ekki gefin", +"No category to add?" => "Enginn flokkur til að bæta við?", +"This category already exists: " => "Þessi flokkur er þegar til:", +"Object type not provided." => "Tegund ekki í boði.", +"%s ID not provided." => "%s ID ekki í boði.", +"Error adding %s to favorites." => "Villa við að bæta %s við eftirlæti.", +"No categories selected for deletion." => "Enginn flokkur valinn til eyðingar.", +"Error removing %s from favorites." => "Villa við að fjarlægja %s úr eftirlæti.", +"Settings" => "Stillingar", "seconds ago" => "sek síðan", "1 minute ago" => "1 min síðan", "{minutes} minutes ago" => "{minutes} min síðan", +"1 hour ago" => "Fyrir 1 klst.", +"{hours} hours ago" => "fyrir {hours} klst.", "today" => "í dag", "yesterday" => "í gær", "{days} days ago" => "{days} dagar síðan", "last month" => "síðasta mánuði", +"{months} months ago" => "fyrir {months} mánuðum", "months ago" => "mánuðir síðan", "last year" => "síðasta ári", "years ago" => "árum síðan", +"Choose" => "Veldu", +"Cancel" => "Hætta við", +"No" => "Nei", +"Yes" => "Já", +"Ok" => "Í lagi", +"The object type is not specified." => "Tegund ekki tilgreind", +"Error" => "Villa", +"The app name is not specified." => "Nafn forrits ekki tilgreint", +"The required file {file} is not installed!" => "Umbeðina skráin {file} ekki tiltæk!", +"Error while sharing" => "Villa við deilingu", +"Error while unsharing" => "Villa við að hætta deilingu", +"Error while changing permissions" => "Villa við að breyta aðgangsheimildum", +"Shared with you and the group {group} by {owner}" => "Deilt með þér og hópnum {group} af {owner}", +"Shared with you by {owner}" => "Deilt með þér af {owner}", +"Share with" => "Deila með", +"Share with link" => "Deila með veftengli", +"Password protect" => "Verja með lykilorði", "Password" => "Lykilorð", +"Email link to person" => "Senda vefhlekk í tölvupóstu til notenda", +"Send" => "Senda", +"Set expiration date" => "Setja gildistíma", +"Expiration date" => "Gildir til", +"Share via email:" => "Deila með tölvupósti:", +"No people found" => "Engir notendur fundust", +"Resharing is not allowed" => "Endurdeiling er ekki leyfð", +"Shared in {item} with {user}" => "Deilt með {item} ásamt {user}", +"Unshare" => "Hætta deilingu", +"can edit" => "getur breytt", +"access control" => "aðgangsstýring", +"create" => "mynda", +"update" => "uppfæra", +"delete" => "eyða", +"share" => "deila", +"Password protected" => "Verja með lykilorði", +"Error unsetting expiration date" => "Villa við að aftengja gildistíma", +"Error setting expiration date" => "Villa við að setja gildistíma", +"Sending ..." => "Sendi ...", +"Email sent" => "Tölvupóstur sendur", +"ownCloud password reset" => "endursetja ownCloud lykilorð", +"Use the following link to reset your password: {link}" => "Notað eftirfarandi veftengil til að endursetja lykilorðið þitt: {link}", +"You will receive a link to reset your password via Email." => "Þú munt fá veftengil í tölvupósti til að endursetja lykilorðið.", +"Reset email send." => "Beiðni um endursetningu send.", +"Request failed!" => "Beiðni mistókst!", "Username" => "Notendanafn", +"Request reset" => "Endursetja lykilorð", +"Your password was reset" => "Lykilorðið þitt hefur verið endursett.", +"To login page" => "Fara á innskráningarsíðu", +"New password" => "Nýtt lykilorð", +"Reset password" => "Endursetja lykilorð", "Personal" => "Persónustillingar", +"Users" => "Notendur", +"Apps" => "Forrit", "Admin" => "Vefstjórn", -"Help" => "Help", -"Cloud not found" => "Skýið finnst eigi", +"Help" => "Hjálp", +"Access forbidden" => "Aðgangur bannaður", +"Cloud not found" => "Ský finnst ekki", "Edit categories" => "Breyta flokkum", "Add" => "Bæta", +"Security Warning" => "Öryggis aðvörun", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Enginn traustur slembitölugjafi í boði, vinsamlegast virkjaðu PHP OpenSSL viðbótina.", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Án öruggs slembitölugjafa er mögulegt að sjá fyrir öryggis auðkenni til að endursetja lykilorð og komast inn á aðganginn þinn.", +"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "Gagnamappan þín er að öllum líkindum aðgengileg frá internetinu. Skráin .htaccess sem fylgir með ownCloud er ekki að virka. Við mælum eindregið með því að þú stillir vefþjóninn þannig að gagnamappan verði ekki aðgengileg frá internetinu eða færir hana út fyrir vefrótina.", "Create an <strong>admin account</strong>" => "Útbúa <strong>vefstjóra aðgang</strong>", +"Advanced" => "Ítarlegt", +"Data folder" => "Gagnamappa", +"Configure the database" => "Stilla gagnagrunn", +"will be used" => "verður notað", +"Database user" => "Gagnagrunns notandi", +"Database password" => "Gagnagrunns lykilorð", +"Database name" => "Nafn gagnagrunns", +"Database tablespace" => "Töflusvæði gagnagrunns", +"Database host" => "Netþjónn gagnagrunns", +"Finish setup" => "Virkja uppsetningu", +"Sunday" => "Sunnudagur", +"Monday" => "Mánudagur", +"Tuesday" => "Þriðjudagur", +"Wednesday" => "Miðvikudagur", +"Thursday" => "Fimmtudagur", +"Friday" => "Föstudagur", +"Saturday" => "Laugardagur", "January" => "Janúar", "February" => "Febrúar", "March" => "Mars", @@ -29,8 +115,17 @@ "August" => "Ágúst", "September" => "September", "October" => "Október", +"November" => "Nóvember", +"December" => "Desember", +"web services under your control" => "vefþjónusta undir þinni stjórn", "Log out" => "Útskrá", -"You are logged out." => "Þú ert útskráð(ur).", +"Automatic logon rejected!" => "Sjálfvirkri innskráningu hafnað!", +"If you did not change your password recently, your account may be compromised!" => "Ef þú breyttir ekki lykilorðinu þínu fyrir skömmu, er mögulegt að einhver annar hafi komist inn á aðganginn þinn.", +"Please change your password to secure your account again." => "Vinsamlegast breyttu lykilorðinu þínu til að tryggja öryggi þitt.", +"Lost your password?" => "Týndir þú lykilorðinu?", +"remember" => "muna eftir mér", +"Log in" => "<strong>Skrá inn</strong>", "prev" => "fyrra", -"next" => "næsta" +"next" => "næsta", +"Updating ownCloud to version %s, this may take a while." => "Uppfæri ownCloud í útgáfu %s, það gæti tekið smá stund." ); diff --git a/core/l10n/it.php b/core/l10n/it.php index e97deb9fb5f..89b6a7952a9 100644 --- a/core/l10n/it.php +++ b/core/l10n/it.php @@ -125,10 +125,7 @@ "Lost your password?" => "Hai perso la password?", "remember" => "ricorda", "Log in" => "Accedi", -"You are logged out." => "Sei uscito.", "prev" => "precedente", "next" => "successivo", -"Security Warning!" => "Avviso di sicurezza", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Verifica la tua password.<br/>Per motivi di sicurezza, potresti ricevere una richiesta di digitare nuovamente la password.", -"Verify" => "Verifica" +"Updating ownCloud to version %s, this may take a while." => "Aggiornamento di ownCloud alla versione %s in corso, potrebbe richiedere del tempo." ); diff --git a/core/l10n/ja_JP.php b/core/l10n/ja_JP.php index 72615d36f62..7d4baf94583 100644 --- a/core/l10n/ja_JP.php +++ b/core/l10n/ja_JP.php @@ -125,10 +125,7 @@ "Lost your password?" => "パスワードを忘れましたか？", "remember" => "パスワードを記憶する", "Log in" => "ログイン", -"You are logged out." => "ログアウトしました。", "prev" => "前", "next" => "次", -"Security Warning!" => "セキュリティ警告！", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "パスワードの確認<br/>セキュリティ上の理由によりパスワードの再入力をお願いします。", -"Verify" => "確認" +"Updating ownCloud to version %s, this may take a while." => "ownCloud をバージョン %s に更新しています、しばらくお待ち下さい。" ); diff --git a/core/l10n/ka_GE.php b/core/l10n/ka_GE.php index efb3998a77e..aafdacab4c6 100644 --- a/core/l10n/ka_GE.php +++ b/core/l10n/ka_GE.php @@ -98,9 +98,6 @@ "Lost your password?" => "დაგავიწყდათ პაროლი?", "remember" => "დამახსოვრება", "Log in" => "შესვლა", -"You are logged out." => "თქვენ გამოხვედით სისტემიდან", "prev" => "წინა", -"next" => "შემდეგი", -"Security Warning!" => "უსაფრთხოების გაფრთხილება!", -"Verify" => "შემოწმება" +"next" => "შემდეგი" ); diff --git a/core/l10n/ko.php b/core/l10n/ko.php index 3846dff796b..3db5a501173 100644 --- a/core/l10n/ko.php +++ b/core/l10n/ko.php @@ -1,4 +1,8 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "User %s 가 당신과 파일을 공유하였습니다.", +"User %s shared a folder with you" => "User %s 가 당신과 폴더를 공유하였습니다.", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "User %s 가 파일 \"%s\"를 당신과 공유하였습니다. 다운로드는 여기서 %s 할 수 있습니다.", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "User %s 가 폴더 \"%s\"를 당신과 공유하였습니다. 다운로드는 여기서 %s 할 수 있습니다.", "Category type not provided." => "분류 형식이 제공되지 않았습니다.", "No category to add?" => "추가할 분류가 없습니까?", "This category already exists: " => "이 분류는 이미 존재합니다:", @@ -39,6 +43,8 @@ "Share with link" => "URL 링크로 공유", "Password protect" => "암호 보호", "Password" => "암호", +"Email link to person" => "이메일 주소", +"Send" => "전송", "Set expiration date" => "만료 날짜 설정", "Expiration date" => "만료 날짜", "Share via email:" => "이메일로 공유:", @@ -55,6 +61,8 @@ "Password protected" => "암호로 보호됨", "Error unsetting expiration date" => "만료 날짜 해제 오류", "Error setting expiration date" => "만료 날짜 설정 오류", +"Sending ..." => "전송 중...", +"Email sent" => "이메일 발송됨", "ownCloud password reset" => "ownCloud 암호 재설정", "Use the following link to reset your password: {link}" => "다음 링크를 사용하여 암호를 재설정할 수 있습니다: {link}", "You will receive a link to reset your password via Email." => "이메일로 암호 재설정 링크를 보냈습니다.", @@ -117,10 +125,7 @@ "Lost your password?" => "암호를 잊으셨습니까?", "remember" => "기억하기", "Log in" => "로그인", -"You are logged out." => "로그아웃되었습니다.", "prev" => "이전", "next" => "다음", -"Security Warning!" => "보안 경고!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "암호를 확인해 주십시오.<br/>보안상의 이유로 종종 암호를 물어볼 것입니다.", -"Verify" => "확인" +"Updating ownCloud to version %s, this may take a while." => "ownCloud 를 버젼 %s로 업데이트 하는 중, 시간이 소요됩니다." ); diff --git a/core/l10n/lb.php b/core/l10n/lb.php index 7a1c462ffd1..407b8093a27 100644 --- a/core/l10n/lb.php +++ b/core/l10n/lb.php @@ -64,7 +64,6 @@ "Lost your password?" => "Passwuert vergiess?", "remember" => "verhalen", "Log in" => "Log dech an", -"You are logged out." => "Du bass ausgeloggt.", "prev" => "zeréck", "next" => "weider" ); diff --git a/core/l10n/lt_LT.php b/core/l10n/lt_LT.php index 9c5c8f90c5e..ec15c646191 100644 --- a/core/l10n/lt_LT.php +++ b/core/l10n/lt_LT.php @@ -104,10 +104,6 @@ "Lost your password?" => "Pamiršote slaptažodį?", "remember" => "prisiminti", "Log in" => "Prisijungti", -"You are logged out." => "Jūs atsijungėte.", "prev" => "atgal", -"next" => "kitas", -"Security Warning!" => "Saugumo pranešimas!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Prašome patvirtinti savo vartotoją.<br/>Dėl saugumo, slaptažodžio patvirtinimas bus reikalaujamas įvesti kas kiek laiko.", -"Verify" => "Patvirtinti" +"next" => "kitas" ); diff --git a/core/l10n/lv.php b/core/l10n/lv.php index 5543c7a56d6..8a6dc033de6 100644 --- a/core/l10n/lv.php +++ b/core/l10n/lv.php @@ -30,7 +30,6 @@ "Lost your password?" => "Aizmirsāt paroli?", "remember" => "atcerēties", "Log in" => "Ielogoties", -"You are logged out." => "Jūs esat veiksmīgi izlogojies.", "prev" => "iepriekšējā", "next" => "nākamā" ); diff --git a/core/l10n/mk.php b/core/l10n/mk.php index 401baf6efa0..d8fa16d44f3 100644 --- a/core/l10n/mk.php +++ b/core/l10n/mk.php @@ -125,10 +125,6 @@ "Lost your password?" => "Ја заборавивте лозинката?", "remember" => "запамти", "Log in" => "Најава", -"You are logged out." => "Одјавени сте.", "prev" => "претходно", -"next" => "следно", -"Security Warning!" => "Безбедносно предупредување.", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Ве молам потврдете ја вашата лозинка. <br />Од безбедносни причини од време на време може да биде побарано да ја внесете вашата лозинка повторно.", -"Verify" => "Потврди" +"next" => "следно" ); diff --git a/core/l10n/ms_MY.php b/core/l10n/ms_MY.php index 56a79572ef7..b08ccecf616 100644 --- a/core/l10n/ms_MY.php +++ b/core/l10n/ms_MY.php @@ -62,7 +62,6 @@ "Lost your password?" => "Hilang kata laluan?", "remember" => "ingat", "Log in" => "Log masuk", -"You are logged out." => "Anda telah log keluar.", "prev" => "sebelum", "next" => "seterus" ); diff --git a/core/l10n/nb_NO.php b/core/l10n/nb_NO.php index 7382a1e8398..d985e454b7c 100644 --- a/core/l10n/nb_NO.php +++ b/core/l10n/nb_NO.php @@ -6,10 +6,13 @@ "seconds ago" => "sekunder siden", "1 minute ago" => "1 minutt siden", "{minutes} minutes ago" => "{minutes} minutter siden", +"1 hour ago" => "1 time siden", +"{hours} hours ago" => "{hours} timer siden", "today" => "i dag", "yesterday" => "i går", "{days} days ago" => "{days} dager siden", "last month" => "forrige måned", +"{months} months ago" => "{months} måneder siden", "months ago" => "måneder siden", "last year" => "forrige år", "years ago" => "år siden", @@ -24,6 +27,7 @@ "Share with link" => "Del med link", "Password protect" => "Passordbeskyttet", "Password" => "Passord", +"Send" => "Send", "Set expiration date" => "Set utløpsdato", "Expiration date" => "Utløpsdato", "Share via email:" => "Del på epost", @@ -37,6 +41,8 @@ "share" => "del", "Password protected" => "Passordbeskyttet", "Error setting expiration date" => "Kan ikke sette utløpsdato", +"Sending ..." => "Sender...", +"Email sent" => "E-post sendt", "ownCloud password reset" => "Tilbakestill ownCloud passord", "Use the following link to reset your password: {link}" => "Bruk følgende lenke for å tilbakestille passordet ditt: {link}", "You will receive a link to reset your password via Email." => "Du burde motta detaljer om å tilbakestille passordet ditt via epost.", @@ -94,9 +100,6 @@ "Lost your password?" => "Mistet passordet ditt?", "remember" => "husk", "Log in" => "Logg inn", -"You are logged out." => "Du er logget ut", "prev" => "forrige", -"next" => "neste", -"Security Warning!" => "Sikkerhetsadvarsel!", -"Verify" => "Verifiser" +"next" => "neste" ); diff --git a/core/l10n/nl.php b/core/l10n/nl.php index c3f5c887658..739d8181d6f 100644 --- a/core/l10n/nl.php +++ b/core/l10n/nl.php @@ -125,10 +125,7 @@ "Lost your password?" => "Uw wachtwoord vergeten?", "remember" => "onthoud gegevens", "Log in" => "Meld je aan", -"You are logged out." => "U bent afgemeld.", "prev" => "vorige", "next" => "volgende", -"Security Warning!" => "Beveiligingswaarschuwing!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Verifieer uw wachtwoord!<br/>Om veiligheidsredenen wordt u regelmatig gevraagd uw wachtwoord in te geven.", -"Verify" => "Verifieer" +"Updating ownCloud to version %s, this may take a while." => "Updaten ownCloud naar versie %s, dit kan even duren." ); diff --git a/core/l10n/nn_NO.php b/core/l10n/nn_NO.php index e62e0dea730..8aaf0b705c8 100644 --- a/core/l10n/nn_NO.php +++ b/core/l10n/nn_NO.php @@ -52,7 +52,6 @@ "Lost your password?" => "Gløymt passordet?", "remember" => "hugs", "Log in" => "Logg inn", -"You are logged out." => "Du er logga ut.", "prev" => "førre", "next" => "neste" ); diff --git a/core/l10n/oc.php b/core/l10n/oc.php index 1ae67063572..be6d5aec285 100644 --- a/core/l10n/oc.php +++ b/core/l10n/oc.php @@ -93,7 +93,6 @@ "Lost your password?" => "L'as perdut lo senhal ?", "remember" => "bremba-te", "Log in" => "Dintrada", -"You are logged out." => "Sias pas dintra (t/ada)", "prev" => "dariièr", "next" => "venent" ); diff --git a/core/l10n/pl.php b/core/l10n/pl.php index 1208aec5a53..3324040209b 100644 --- a/core/l10n/pl.php +++ b/core/l10n/pl.php @@ -125,10 +125,7 @@ "Lost your password?" => "Nie pamiętasz hasła?", "remember" => "Zapamiętanie", "Log in" => "Zaloguj", -"You are logged out." => "Wylogowano użytkownika.", "prev" => "wstecz", "next" => "naprzód", -"Security Warning!" => "Ostrzeżenie o zabezpieczeniach!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Sprawdź swoje hasło.<br/>Ze względów bezpieczeństwa możesz zostać czasami poproszony o wprowadzenie hasła ponownie.", -"Verify" => "Zweryfikowane" +"Updating ownCloud to version %s, this may take a while." => "Aktualizowanie ownCloud do wersji %s, może to potrwać chwilę." ); diff --git a/core/l10n/pt_BR.php b/core/l10n/pt_BR.php index f28b0035995..3b119650268 100644 --- a/core/l10n/pt_BR.php +++ b/core/l10n/pt_BR.php @@ -117,10 +117,6 @@ "Lost your password?" => "Esqueçeu sua senha?", "remember" => "lembrete", "Log in" => "Log in", -"You are logged out." => "Você está desconectado.", "prev" => "anterior", -"next" => "próximo", -"Security Warning!" => "Aviso de Segurança!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Por favor, verifique a sua senha.<br />Por motivos de segurança, você deverá ser solicitado a muda-la ocasionalmente.", -"Verify" => "Verificar" +"next" => "próximo" ); diff --git a/core/l10n/pt_PT.php b/core/l10n/pt_PT.php index a2bfcf4f882..6e3a558986c 100644 --- a/core/l10n/pt_PT.php +++ b/core/l10n/pt_PT.php @@ -125,10 +125,7 @@ "Lost your password?" => "Esqueceu a sua password?", "remember" => "lembrar", "Log in" => "Entrar", -"You are logged out." => "Estás desconetado.", "prev" => "anterior", "next" => "seguinte", -"Security Warning!" => "Aviso de Segurança!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Por favor verifique a sua palavra-passe. <br/>Por razões de segurança, pode ser-lhe perguntada, ocasionalmente, a sua palavra-passe de novo.", -"Verify" => "Verificar" +"Updating ownCloud to version %s, this may take a while." => "A Actualizar o ownCloud para a versão %s, esta operação pode demorar." ); diff --git a/core/l10n/ro.php b/core/l10n/ro.php index 560ef5b9fc8..5e2c812925e 100644 --- a/core/l10n/ro.php +++ b/core/l10n/ro.php @@ -1,13 +1,43 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "Utilizatorul %s a partajat un fișier cu tine", +"Category type not provided." => "Tipul de categorie nu este prevazut", "No category to add?" => "Nici o categorie de adăugat?", "This category already exists: " => "Această categorie deja există:", +"Object type not provided." => "Tipul obiectului nu este prevazut", +"%s ID not provided." => "ID-ul %s nu a fost introdus", +"Error adding %s to favorites." => "Eroare la adăugarea %s la favorite", "No categories selected for deletion." => "Nici o categorie selectată pentru ștergere.", +"Error removing %s from favorites." => "Eroare la ștergerea %s din favorite", +"Sunday" => "Duminică", +"Monday" => "Luni", +"Tuesday" => "Marți", +"Wednesday" => "Miercuri", +"Thursday" => "Joi", +"Friday" => "Vineri", +"Saturday" => "Sâmbătă", +"January" => "Ianuarie", +"February" => "Februarie", +"March" => "Martie", +"April" => "Aprilie", +"May" => "Mai", +"June" => "Iunie", +"July" => "Iulie", +"August" => "August", +"September" => "Septembrie", +"October" => "Octombrie", +"November" => "Noiembrie", +"December" => "Decembrie", "Settings" => "Configurări", "seconds ago" => "secunde în urmă", "1 minute ago" => "1 minut în urmă", +"{minutes} minutes ago" => "{minutes} minute in urma", +"1 hour ago" => "Acum o ora", +"{hours} hours ago" => "{hours} ore în urmă", "today" => "astăzi", "yesterday" => "ieri", +"{days} days ago" => "{days} zile in urma", "last month" => "ultima lună", +"{months} months ago" => "{months} luni în urmă", "months ago" => "luni în urmă", "last year" => "ultimul an", "years ago" => "ani în urmă", @@ -16,18 +46,25 @@ "No" => "Nu", "Yes" => "Da", "Ok" => "Ok", +"The object type is not specified." => "Tipul obiectului nu a fost specificat", "Error" => "Eroare", +"The app name is not specified." => "Numele aplicației nu a fost specificat", +"The required file {file} is not installed!" => "Fișierul obligatoriu {file} nu este instalat!", "Error while sharing" => "Eroare la partajare", "Error while unsharing" => "Eroare la anularea partajării", "Error while changing permissions" => "Eroare la modificarea permisiunilor", +"Shared with you and the group {group} by {owner}" => "Distribuie cu tine si grupul {group} de {owner}", +"Shared with you by {owner}" => "Distribuie cu tine de {owner}", "Share with" => "Partajat cu", "Share with link" => "Partajare cu legătură", "Password protect" => "Protejare cu parolă", "Password" => "Parola", "Set expiration date" => "Specifică data expirării", "Expiration date" => "Data expirării", +"Share via email:" => "Distribuie prin email:", "No people found" => "Nici o persoană găsită", "Resharing is not allowed" => "Repartajarea nu este permisă", +"Shared in {item} with {user}" => "Distribuie in {item} si {user}", "Unshare" => "Anulare partajare", "can edit" => "poate edita", "access control" => "control acces", @@ -41,6 +78,8 @@ "ownCloud password reset" => "Resetarea parolei ownCloud ", "Use the following link to reset your password: {link}" => "Folosește următorul link pentru a reseta parola: {link}", "You will receive a link to reset your password via Email." => "Vei primi un mesaj prin care vei putea reseta parola via email", +"Reset email send." => "Resetarea emailu-lui trimisa.", +"Request failed!" => "Solicitarea nu a reusit", "Username" => "Utilizator", "Request reset" => "Cerere trimisă", "Your password was reset" => "Parola a fost resetată", @@ -57,6 +96,8 @@ "Edit categories" => "Editează categoriile", "Add" => "Adaugă", "Security Warning" => "Avertisment de securitate", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Generatorul de numere pentru securitate nu este disponibil, va rog activati extensia PHP OpenSSL", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Fara generatorul pentru numere de securitate , un atacator poate afla parola si reseta contul tau", "Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "Directorul tău de date și fișierele tale probabil sunt accesibile prin internet. Fișierul .htaccess oferit de ownCloud nu funcționează. Îți recomandăm să configurezi server-ul tău web într-un mod în care directorul de date să nu mai fie accesibil sau mută directorul de date în afara directorului root al server-ului web.", "Create an <strong>admin account</strong>" => "Crează un <strong>cont de administrator</strong>", "Advanced" => "Avansat", @@ -69,31 +110,14 @@ "Database tablespace" => "Tabela de spațiu a bazei de date", "Database host" => "Bază date", "Finish setup" => "Finalizează instalarea", -"Sunday" => "Duminică", -"Monday" => "Luni", -"Tuesday" => "Marți", -"Wednesday" => "Miercuri", -"Thursday" => "Joi", -"Friday" => "Vineri", -"Saturday" => "Sâmbătă", -"January" => "Ianuarie", -"February" => "Februarie", -"March" => "Martie", -"April" => "Aprilie", -"May" => "Mai", -"June" => "Iunie", -"July" => "Iulie", -"August" => "August", -"September" => "Septembrie", -"October" => "Octombrie", -"November" => "Noiembrie", -"December" => "Decembrie", "web services under your control" => "servicii web controlate de tine", "Log out" => "Ieșire", +"Automatic logon rejected!" => "Logare automata respinsa", +"If you did not change your password recently, your account may be compromised!" => "Daca nu schimbi parola cand de curand , contul tau poate fi conpromis", +"Please change your password to secure your account again." => "Te rog schimba parola pentru ca, contul tau sa fie securizat din nou.", "Lost your password?" => "Ai uitat parola?", "remember" => "amintește", "Log in" => "Autentificare", -"You are logged out." => "Ai ieșit", "prev" => "precedentul", "next" => "următorul" ); diff --git a/core/l10n/ru.php b/core/l10n/ru.php index 4db2a2f06fd..7434d6af7f8 100644 --- a/core/l10n/ru.php +++ b/core/l10n/ru.php @@ -125,10 +125,7 @@ "Lost your password?" => "Забыли пароль?", "remember" => "запомнить", "Log in" => "Войти", -"You are logged out." => "Вы вышли.", "prev" => "пред", "next" => "след", -"Security Warning!" => "Предупреждение безопасности!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Пожалуйста, проверьте свой пароль. <br/>По соображениям безопасности, Вам иногда придется вводить свой пароль снова.", -"Verify" => "Подтвердить" +"Updating ownCloud to version %s, this may take a while." => "Производится обновление ownCloud до версии %s. Это может занять некоторое время." ); diff --git a/core/l10n/ru_RU.php b/core/l10n/ru_RU.php index c18fe245c9e..84bd8f93156 100644 --- a/core/l10n/ru_RU.php +++ b/core/l10n/ru_RU.php @@ -125,10 +125,6 @@ "Lost your password?" => "Забыли пароль?", "remember" => "запомнить", "Log in" => "Войти", -"You are logged out." => "Вы вышли из системы.", "prev" => "предыдущий", -"next" => "следующий", -"Security Warning!" => "Предупреждение системы безопасности!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Пожалуйста, проверьте свой пароль. <br/>По соображениям безопасности Вам может быть иногда предложено ввести пароль еще раз.", -"Verify" => "Проверить" +"next" => "следующий" ); diff --git a/core/l10n/si_LK.php b/core/l10n/si_LK.php index 35b0df3188c..a6aeb484ed7 100644 --- a/core/l10n/si_LK.php +++ b/core/l10n/si_LK.php @@ -85,7 +85,6 @@ "Lost your password?" => "මුරපදය අමතකද?", "remember" => "මතක තබාගන්න", "Log in" => "ප්රවේශවන්න", -"You are logged out." => "ඔබ නික්මී ඇත.", "prev" => "පෙර", "next" => "ඊළඟ" ); diff --git a/core/l10n/sk_SK.php b/core/l10n/sk_SK.php index 162d94e8242..286642ace7a 100644 --- a/core/l10n/sk_SK.php +++ b/core/l10n/sk_SK.php @@ -1,4 +1,8 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "Používateľ %s zdieľa s Vami súbor", +"User %s shared a folder with you" => "Používateľ %s zdieľa s Vami adresár", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "Používateľ %s zdieľa s Vami súbor \"%s\". Môžete si ho stiahnuť tu: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "Používateľ %s zdieľa s Vami adresár \"%s\". Môžete si ho stiahnuť tu: %s", "Category type not provided." => "Neposkytnutý kategorický typ.", "No category to add?" => "Žiadna kategória pre pridanie?", "This category already exists: " => "Táto kategória už existuje:", @@ -39,6 +43,8 @@ "Share with link" => "Zdieľať cez odkaz", "Password protect" => "Chrániť heslom", "Password" => "Heslo", +"Email link to person" => "Odoslať odkaz osobe e-mailom", +"Send" => "Odoslať", "Set expiration date" => "Nastaviť dátum expirácie", "Expiration date" => "Dátum expirácie", "Share via email:" => "Zdieľať cez e-mail:", @@ -55,6 +61,8 @@ "Password protected" => "Chránené heslom", "Error unsetting expiration date" => "Chyba pri odstraňovaní dátumu vypršania platnosti", "Error setting expiration date" => "Chyba pri nastavení dátumu vypršania platnosti", +"Sending ..." => "Odosielam ...", +"Email sent" => "Email odoslaný", "ownCloud password reset" => "Obnovenie hesla pre ownCloud", "Use the following link to reset your password: {link}" => "Použite nasledujúci odkaz pre obnovenie vášho hesla: {link}", "You will receive a link to reset your password via Email." => "Odkaz pre obnovenie hesla obdržíte e-mailom.", @@ -117,10 +125,7 @@ "Lost your password?" => "Zabudli ste heslo?", "remember" => "zapamätať", "Log in" => "Prihlásiť sa", -"You are logged out." => "Ste odhlásený.", "prev" => "späť", "next" => "ďalej", -"Security Warning!" => "Bezpečnostné varovanie!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Prosím, overte svoje heslo. <br />Z bezpečnostných dôvodov môžete byť občas požiadaný o jeho opätovné zadanie.", -"Verify" => "Overenie" +"Updating ownCloud to version %s, this may take a while." => "Aktualizujem ownCloud na verziu %s, môže to chvíľu trvať." ); diff --git a/core/l10n/sl.php b/core/l10n/sl.php index 0ee2eb03b3c..b2c924d412e 100644 --- a/core/l10n/sl.php +++ b/core/l10n/sl.php @@ -125,10 +125,6 @@ "Lost your password?" => "Ali ste pozabili geslo?", "remember" => "Zapomni si me", "Log in" => "Prijava", -"You are logged out." => "Sta odjavljeni.", "prev" => "nazaj", -"next" => "naprej", -"Security Warning!" => "Varnostno opozorilo!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Prosimo, če preverite vaše geslo. Iz varnostnih razlogov vas lahko občasno prosimo, da ga ponovno vnesete.", -"Verify" => "Preveri" +"next" => "naprej" ); diff --git a/core/l10n/sr.php b/core/l10n/sr.php index 406b92ff83f..e55ad9250ab 100644 --- a/core/l10n/sr.php +++ b/core/l10n/sr.php @@ -1,4 +1,6 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "Корисник %s дели са вама датотеку", +"User %s shared a folder with you" => "Корисник %s дели са вама директоријум", "Category type not provided." => "Врста категорије није унет.", "No category to add?" => "Додати још неку категорију?", "This category already exists: " => "Категорија већ постоји:", @@ -39,6 +41,7 @@ "Share with link" => "Подели линк", "Password protect" => "Заштићено лозинком", "Password" => "Лозинка", +"Send" => "Пошаљи", "Set expiration date" => "Постави датум истека", "Expiration date" => "Датум истека", "Share via email:" => "Подели поштом:", @@ -55,6 +58,8 @@ "Password protected" => "Заштићено лозинком", "Error unsetting expiration date" => "Грешка код поништавања датума истека", "Error setting expiration date" => "Грешка код постављања датума истека", +"Sending ..." => "Шаљем...", +"Email sent" => "Порука је послата", "ownCloud password reset" => "Поништавање лозинке за ownCloud", "Use the following link to reset your password: {link}" => "Овом везом ресетујте своју лозинку: {link}", "You will receive a link to reset your password via Email." => "Добићете везу за ресетовање лозинке путем е-поште.", @@ -117,10 +122,7 @@ "Lost your password?" => "Изгубили сте лозинку?", "remember" => "упамти", "Log in" => "Пријава", -"You are logged out." => "Одјављени сте.", "prev" => "претходно", "next" => "следеће", -"Security Warning!" => "Сигурносно упозорење!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Потврдите лозинку. <br />Из сигурносних разлога затрежићемо вам да два пута унесете лозинку.", -"Verify" => "Потврди" +"Updating ownCloud to version %s, this may take a while." => "Надоградња ownCloud-а на верзију %s, сачекајте тренутак." ); diff --git a/core/l10n/sr@latin.php b/core/l10n/sr@latin.php index af48a845720..efcb7c10f01 100644 --- a/core/l10n/sr@latin.php +++ b/core/l10n/sr@latin.php @@ -46,7 +46,6 @@ "Log out" => "Odjava", "Lost your password?" => "Izgubili ste lozinku?", "remember" => "upamti", -"You are logged out." => "Odjavljeni ste.", "prev" => "prethodno", "next" => "sledeće" ); diff --git a/core/l10n/sv.php b/core/l10n/sv.php index a7698fb30ce..70a9871be26 100644 --- a/core/l10n/sv.php +++ b/core/l10n/sv.php @@ -125,10 +125,7 @@ "Lost your password?" => "Glömt ditt lösenord?", "remember" => "kom ihåg", "Log in" => "Logga in", -"You are logged out." => "Du är utloggad.", "prev" => "föregående", "next" => "nästa", -"Security Warning!" => "Säkerhetsvarning!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Bekräfta ditt lösenord. <br/>Av säkerhetsskäl kan du ibland bli ombedd att ange ditt lösenord igen.", -"Verify" => "Verifiera" +"Updating ownCloud to version %s, this may take a while." => "Uppdaterar ownCloud till version %s, detta kan ta en stund." ); diff --git a/core/l10n/ta_LK.php b/core/l10n/ta_LK.php index 9a432d11c9b..65cfbbf965d 100644 --- a/core/l10n/ta_LK.php +++ b/core/l10n/ta_LK.php @@ -117,10 +117,6 @@ "Lost your password?" => "உங்கள் கடவுச்சொல்லை தொலைத்துவிட்டீர்களா?", "remember" => "ஞாபகப்படுத்துக", "Log in" => "புகுபதிகை", -"You are logged out." => "நீங்கள் விடுபதிகை செய்துவிட்டீர்கள்.", "prev" => "முந்தைய", -"next" => "அடுத்து", -"Security Warning!" => "பாதுகாப்பு எச்சரிக்கை!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "உங்களுடைய கடவுச்சொல்லை உறுதிப்படுத்துக. <br/> பாதுகாப்பு காரணங்களுக்காக நீங்கள் எப்போதாவது உங்களுடைய கடவுச்சொல்லை மீண்டும் நுழைக்க கேட்கப்படுவீர்கள்.", -"Verify" => "உறுதிப்படுத்தல்" +"next" => "அடுத்து" ); diff --git a/core/l10n/th_TH.php b/core/l10n/th_TH.php index e254ccf259f..bcbd70d03e6 100644 --- a/core/l10n/th_TH.php +++ b/core/l10n/th_TH.php @@ -1,4 +1,8 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "ผู้ใช้งาน %s ได้แชร์ไฟล์ให้กับคุณ", +"User %s shared a folder with you" => "ผู้ใช้งาน %s ได้แชร์โฟลเดอร์ให้กับคุณ", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "ผู้ใช้งาน %s ได้แชร์ไฟล์ \"%s\" ให้กับคุณ และคุณสามารถสามารถดาวน์โหลดไฟล์ดังกล่าวได้จากที่นี่: %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "ผู้ใช้งาน %s ได้แชร์โฟลเดอร์ \"%s\" ให้กับคุณ และคุณสามารถดาวน์โหลดโฟลเดอร์ดังกล่าวได้จากที่นี่: %s", "Category type not provided." => "ยังไม่ได้ระบุชนิดของหมวดหมู่", "No category to add?" => "ไม่มีหมวดหมู่ที่ต้องการเพิ่ม?", "This category already exists: " => "หมวดหมู่นี้มีอยู่แล้ว: ", @@ -39,6 +43,8 @@ "Share with link" => "แชร์ด้วยลิงก์", "Password protect" => "ใส่รหัสผ่านไว้", "Password" => "รหัสผ่าน", +"Email link to person" => "ส่งลิงก์ให้ทางอีเมล", +"Send" => "ส่ง", "Set expiration date" => "กำหนดวันที่หมดอายุ", "Expiration date" => "วันที่หมดอายุ", "Share via email:" => "แชร์ผ่านทางอีเมล", @@ -55,6 +61,8 @@ "Password protected" => "ใส่รหัสผ่านไว้", "Error unsetting expiration date" => "เกิดข้อผิดพลาดในการยกเลิกการตั้งค่าวันที่หมดอายุ", "Error setting expiration date" => "เกิดข้อผิดพลาดในการตั้งค่าวันที่หมดอายุ", +"Sending ..." => "กำลังส่ง...", +"Email sent" => "ส่งอีเมล์แล้ว", "ownCloud password reset" => "รีเซ็ตรหัสผ่าน ownCloud", "Use the following link to reset your password: {link}" => "ใช้ลิงค์ต่อไปนี้เพื่อเปลี่ยนรหัสผ่านของคุณใหม่: {link}", "You will receive a link to reset your password via Email." => "คุณจะได้รับลิงค์เพื่อกำหนดรหัสผ่านใหม่ทางอีเมล์", @@ -117,10 +125,7 @@ "Lost your password?" => "ลืมรหัสผ่าน?", "remember" => "จำรหัสผ่าน", "Log in" => "เข้าสู่ระบบ", -"You are logged out." => "คุณออกจากระบบเรียบร้อยแล้ว", "prev" => "ก่อนหน้า", "next" => "ถัดไป", -"Security Warning!" => "คำเตือนเพื่อความปลอดภัย!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "กรุณายืนยันรหัสผ่านของคุณ <br/> เพื่อความปลอดภัย คุณจะถูกขอให้กรอกรหัสผ่านอีกครั้ง", -"Verify" => "ยืนยัน" +"Updating ownCloud to version %s, this may take a while." => "กำลังอัพเดท ownCloud ไปเป็นรุ่น %s, กรุณารอสักครู่" ); diff --git a/core/l10n/tr.php b/core/l10n/tr.php index cb0df023993..58e28a9b3b9 100644 --- a/core/l10n/tr.php +++ b/core/l10n/tr.php @@ -1,25 +1,73 @@ <?php $TRANSLATIONS = array( +"User %s shared a file with you" => "%s kullanıcısı sizinle bir dosyayı paylaştı", +"User %s shared a folder with you" => "%s kullanıcısı sizinle bir dizini paylaştı", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "%s kullanıcısı \"%s\" dosyasını sizinle paylaştı. %s adresinden indirilebilir", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "%s kullanıcısı \"%s\" dizinini sizinle paylaştı. %s adresinden indirilebilir", +"Category type not provided." => "Kategori türü desteklenmemektedir.", "No category to add?" => "Eklenecek kategori yok?", "This category already exists: " => "Bu kategori zaten mevcut: ", +"Object type not provided." => "Nesne türü desteklenmemektedir.", +"%s ID not provided." => "%s ID belirtilmedi.", +"Error adding %s to favorites." => "%s favorilere eklenirken hata oluştu", "No categories selected for deletion." => "Silmek için bir kategori seçilmedi", +"Error removing %s from favorites." => "%s favorilere çıkarılırken hata oluştu", "Settings" => "Ayarlar", +"seconds ago" => "saniye önce", +"1 minute ago" => "1 dakika önce", +"{minutes} minutes ago" => "{minutes} dakika önce", +"1 hour ago" => "1 saat önce", +"{hours} hours ago" => "{hours} saat önce", +"today" => "bugün", +"yesterday" => "dün", +"{days} days ago" => "{days} gün önce", +"last month" => "geçen ay", +"{months} months ago" => "{months} ay önce", +"months ago" => "ay önce", +"last year" => "geçen yıl", +"years ago" => "yıl önce", "Choose" => "seç", "Cancel" => "İptal", "No" => "Hayır", "Yes" => "Evet", "Ok" => "Tamam", +"The object type is not specified." => "Nesne türü belirtilmemiş.", "Error" => "Hata", +"The app name is not specified." => "uygulama adı belirtilmedi.", +"The required file {file} is not installed!" => "İhtiyaç duyulan {file} dosyası kurulu değil.", "Error while sharing" => "Paylaşım sırasında hata ", +"Error while unsharing" => "Paylaşım iptal ediliyorken hata", +"Error while changing permissions" => "İzinleri değiştirirken hata oluştu", +"Shared with you and the group {group} by {owner}" => " {owner} tarafından sizinle ve {group} ile paylaştırılmış", +"Shared with you by {owner}" => "{owner} trafından sizinle paylaştırıldı", "Share with" => "ile Paylaş", "Share with link" => "Bağlantı ile paylaş", "Password protect" => "Şifre korunması", "Password" => "Parola", +"Email link to person" => "Kişiye e-posta linki", +"Send" => "Gönder", "Set expiration date" => "Son kullanma tarihini ayarla", +"Expiration date" => "Son kullanım tarihi", +"Share via email:" => "Eposta ile paylaş", +"No people found" => "Kişi bulunamadı", +"Resharing is not allowed" => "Tekrar paylaşmaya izin verilmiyor", +"Shared in {item} with {user}" => " {item} içinde {user} ile paylaşılanlarlar", "Unshare" => "Paylaşılmayan", +"can edit" => "düzenleyebilir", +"access control" => "erişim kontrolü", "create" => "oluştur", +"update" => "güncelle", +"delete" => "sil", +"share" => "paylaş", +"Password protected" => "Paralo korumalı", +"Error unsetting expiration date" => "Geçerlilik tarihi tanımlama kaldırma hatası", +"Error setting expiration date" => "Geçerlilik tarihi tanımlama hatası", +"Sending ..." => "Gönderiliyor...", +"Email sent" => "Eposta gönderildi", "ownCloud password reset" => "ownCloud parola sıfırlama", "Use the following link to reset your password: {link}" => "Bu bağlantıyı kullanarak parolanızı sıfırlayın: {link}", "You will receive a link to reset your password via Email." => "Parolanızı sıfırlamak için bir bağlantı Eposta olarak gönderilecek.", +"Reset email send." => "Sıfırlama epostası gönderildi.", +"Request failed!" => "İstek reddedildi!", "Username" => "Kullanıcı adı", "Request reset" => "Sıfırlama iste", "Your password was reset" => "Parolanız sıfırlandı", @@ -36,6 +84,9 @@ "Edit categories" => "Kategorileri düzenle", "Add" => "Ekle", "Security Warning" => "Güvenlik Uyarisi", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "Güvenli rasgele sayı üreticisi bulunamadı. Lütfen PHP OpenSSL eklentisini etkinleştirin.", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "Güvenli rasgele sayı üreticisi olmadan saldırganlar parola sıfırlama simgelerini tahmin edip hesabınızı ele geçirebilir.", +"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "data dizininiz ve dosyalarınız büyük ihtimalle internet üzerinden erişilebilir. Owncloud tarafından sağlanan .htaccess dosyası çalışmıyor. Web sunucunuzu yapılandırarak data dizinine erişimi kapatmanızı veya data dizinini web sunucu döküman dizini dışına almanızı şiddetle tavsiye ederiz.", "Create an <strong>admin account</strong>" => "Bir <strong>yönetici hesabı</strong> oluşturun", "Advanced" => "Gelişmiş", "Data folder" => "Veri klasörü", @@ -68,10 +119,13 @@ "December" => "Aralık", "web services under your control" => "kontrolünüzdeki web servisleri", "Log out" => "Çıkış yap", +"Automatic logon rejected!" => "Otomatik oturum açma reddedildi!", +"If you did not change your password recently, your account may be compromised!" => "Yakın zamanda parolanızı değiştirmedi iseniz hesabınız riske girebilir.", +"Please change your password to secure your account again." => "Hesabınızı korumak için lütfen parolanızı değiştirin.", "Lost your password?" => "Parolanızı mı unuttunuz?", "remember" => "hatırla", "Log in" => "Giriş yap", -"You are logged out." => "Çıkış yaptınız.", "prev" => "önceki", -"next" => "sonraki" +"next" => "sonraki", +"Updating ownCloud to version %s, this may take a while." => "Owncloud %s versiyonuna güncelleniyor. Biraz zaman alabilir." ); diff --git a/core/l10n/uk.php b/core/l10n/uk.php index 180d2a5c6bd..88e18d3eb28 100644 --- a/core/l10n/uk.php +++ b/core/l10n/uk.php @@ -125,10 +125,7 @@ "Lost your password?" => "Забули пароль?", "remember" => "запам'ятати", "Log in" => "Вхід", -"You are logged out." => "Ви вийшли з системи.", "prev" => "попередній", "next" => "наступний", -"Security Warning!" => "Попередження про небезпеку!", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Будь ласка, повторно введіть свій пароль. <br/>З питань безпеки, Вам інколи доведеться повторно вводити свій пароль.", -"Verify" => "Підтвердити" +"Updating ownCloud to version %s, this may take a while." => "Оновлення ownCloud до версії %s, це може зайняти деякий час." ); diff --git a/core/l10n/vi.php b/core/l10n/vi.php index 38e909d3f4e..c827dc038e6 100644 --- a/core/l10n/vi.php +++ b/core/l10n/vi.php @@ -117,10 +117,6 @@ "Lost your password?" => "Bạn quên mật khẩu ?", "remember" => "ghi nhớ", "Log in" => "Đăng nhập", -"You are logged out." => "Bạn đã đăng xuất.", "prev" => "Lùi lại", -"next" => "Kế tiếp", -"Security Warning!" => "Cảnh báo bảo mật !", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "Vui lòng xác nhận mật khẩu của bạn. <br/> Vì lý do bảo mật thỉnh thoảng bạn có thể được yêu cầu nhập lại mật khẩu.", -"Verify" => "Kiểm tra" +"next" => "Kế tiếp" ); diff --git a/core/l10n/zh_CN.GB2312.php b/core/l10n/zh_CN.GB2312.php index a785a36afcc..74dd9ad8a3f 100644 --- a/core/l10n/zh_CN.GB2312.php +++ b/core/l10n/zh_CN.GB2312.php @@ -106,10 +106,6 @@ "Lost your password?" => "忘记密码?", "remember" => "备忘", "Log in" => "登陆", -"You are logged out." => "你已经注销了", "prev" => "后退", -"next" => "前进", -"Security Warning!" => "安全警告！", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "请确认您的密码。<br/>处于安全原因你偶尔也会被要求再次输入您的密码。", -"Verify" => "确认" +"next" => "前进" ); diff --git a/core/l10n/zh_CN.php b/core/l10n/zh_CN.php index 64b108ca1dd..626ede4cc70 100644 --- a/core/l10n/zh_CN.php +++ b/core/l10n/zh_CN.php @@ -43,6 +43,7 @@ "Share with link" => "共享链接", "Password protect" => "密码保护", "Password" => "密码", +"Email link to person" => "发送链接到个人", "Send" => "发送", "Set expiration date" => "设置过期日期", "Expiration date" => "过期日期", @@ -124,10 +125,7 @@ "Lost your password?" => "忘记密码？", "remember" => "记住", "Log in" => "登录", -"You are logged out." => "您已注销。", "prev" => "上一页", "next" => "下一页", -"Security Warning!" => "安全警告！", -"Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again." => "请验证您的密码。 <br/>出于安全考虑，你可能偶尔会被要求再次输入密码。", -"Verify" => "验证" +"Updating ownCloud to version %s, this may take a while." => "更新 ownCloud 到版本 %s，这可能需要一些时间。" ); diff --git a/core/l10n/zh_TW.php b/core/l10n/zh_TW.php index 45c7596e609..7537c764451 100644 --- a/core/l10n/zh_TW.php +++ b/core/l10n/zh_TW.php @@ -1,14 +1,22 @@ <?php $TRANSLATIONS = array( -"No category to add?" => "無分類添加?", -"This category already exists: " => "此分類已經存在:", +"User %s shared a file with you" => "用戶 %s 與您分享了一個檔案", +"User %s shared a folder with you" => "用戶 %s 與您分享了一個資料夾", +"User %s shared the file \"%s\" with you. It is available for download here: %s" => "用戶 %s 與您分享了檔案 \"%s\" ，您可以從這裡下載它： %s", +"User %s shared the folder \"%s\" with you. It is available for download here: %s" => "用戶 %s 與您分享了資料夾 \"%s\" ，您可以從這裡下載它： %s", +"Category type not provided." => "未提供分類類型。", +"No category to add?" => "沒有可增加的分類？", +"This category already exists: " => "此分類已經存在：", "Object type not provided." => "不支援的物件類型", -"No categories selected for deletion." => "沒選擇要刪除的分類", +"%s ID not provided." => "未提供 %s ID 。", +"Error adding %s to favorites." => "加入 %s 到最愛時發生錯誤。", +"No categories selected for deletion." => "沒有選擇要刪除的分類。", +"Error removing %s from favorites." => "從最愛移除 %s 時發生錯誤。", "Settings" => "設定", "seconds ago" => "幾秒前", "1 minute ago" => "1 分鐘前", "{minutes} minutes ago" => "{minutes} 分鐘前", "1 hour ago" => "1 個小時前", -"{hours} hours ago" => "{hours} 個小時前", +"{hours} hours ago" => "{hours} 小時前", "today" => "今天", "yesterday" => "昨天", "{days} days ago" => "{days} 天前", @@ -22,18 +30,26 @@ "No" => "No", "Yes" => "Yes", "Ok" => "Ok", +"The object type is not specified." => "未指定物件類型。", "Error" => "錯誤", -"The app name is not specified." => "沒有詳述APP名稱.", +"The app name is not specified." => "沒有指定 app 名稱。", +"The required file {file} is not installed!" => "沒有安裝所需的檔案 {file} ！", "Error while sharing" => "分享時發生錯誤", "Error while unsharing" => "取消分享時發生錯誤", +"Error while changing permissions" => "修改權限時發生錯誤", +"Shared with you and the group {group} by {owner}" => "由 {owner} 分享給您和 {group}", "Shared with you by {owner}" => "{owner} 已經和您分享", -"Share with" => "與分享", +"Share with" => "與...分享", "Share with link" => "使用連結分享", "Password protect" => "密碼保護", "Password" => "密碼", +"Email link to person" => "將連結 email 給別人", +"Send" => "寄出", "Set expiration date" => "設置到期日", "Expiration date" => "到期日", -"Share via email:" => "透過email分享:", +"Share via email:" => "透過 email 分享：", +"No people found" => "沒有找到任何人", +"Resharing is not allowed" => "不允許重新分享", "Shared in {item} with {user}" => "已和 {user} 分享 {item}", "Unshare" => "取消共享", "can edit" => "可編輯", @@ -42,15 +58,18 @@ "update" => "更新", "delete" => "刪除", "share" => "分享", -"Password protected" => "密碼保護", +"Password protected" => "受密碼保護", +"Error unsetting expiration date" => "解除過期日設定失敗", "Error setting expiration date" => "錯誤的到期日設定", +"Sending ..." => "正在寄出...", +"Email sent" => "Email 已寄出", "ownCloud password reset" => "ownCloud 密碼重設", -"Use the following link to reset your password: {link}" => "請循以下聯結重設你的密碼: （聯結） ", -"You will receive a link to reset your password via Email." => "重設密碼的連結將會寄到你的電子郵件信箱", -"Reset email send." => "重設郵件已送出.", -"Request failed!" => "請求失敗!", +"Use the following link to reset your password: {link}" => "請循以下聯結重設你的密碼： {link}", +"You will receive a link to reset your password via Email." => "重設密碼的連結將會寄到你的電子郵件信箱。", +"Reset email send." => "重設郵件已送出。", +"Request failed!" => "請求失敗！", "Username" => "使用者名稱", -"Request reset" => "要求重設", +"Request reset" => "請求重設", "Your password was reset" => "你的密碼已重設", "To login page" => "至登入頁面", "New password" => "新密碼", @@ -60,12 +79,14 @@ "Apps" => "應用程式", "Admin" => "管理者", "Help" => "幫助", -"Access forbidden" => "禁止存取", +"Access forbidden" => "存取被拒", "Cloud not found" => "未發現雲", "Edit categories" => "編輯分類", -"Add" => "添加", +"Add" => "增加", "Security Warning" => "安全性警告", -"No secure random number generator is available, please enable the PHP OpenSSL extension." => "沒有可用的隨機數字產生器, 請啟用 PHP 中 OpenSSL 擴充功能.", +"No secure random number generator is available, please enable the PHP OpenSSL extension." => "沒有可用的亂數產生器，請啟用 PHP 中的 OpenSSL 擴充功能。", +"Without a secure random number generator an attacker may be able to predict password reset tokens and take over your account." => "若沒有安全的亂數產生器，攻擊者可能可以預測密碼重設信物，然後控制您的帳戶。", +"Your data directory and your files are probably accessible from the internet. The .htaccess file that ownCloud provides is not working. We strongly suggest that you configure your webserver in a way that the data directory is no longer accessible or you move the data directory outside the webserver document root." => "您的資料目錄 (Data Directory) 和檔案可能可以由網際網路上面公開存取。Owncloud 所提供的 .htaccess 設定檔並未生效，我們強烈建議您設定您的網頁伺服器以防止資料目錄被公開存取，或將您的資料目錄移出網頁伺服器的 document root 。", "Create an <strong>admin account</strong>" => "建立一個<strong>管理者帳號</strong>", "Advanced" => "進階", "Data folder" => "資料夾", @@ -96,14 +117,15 @@ "October" => "十月", "November" => "十一月", "December" => "十二月", -"web services under your control" => "網路服務已在你控制", +"web services under your control" => "網路服務在您控制之下", "Log out" => "登出", -"Lost your password?" => "忘記密碼?", +"Automatic logon rejected!" => "自動登入被拒！", +"If you did not change your password recently, your account may be compromised!" => "如果您最近並未更改密碼，您的帳號可能已經遭到入侵！", +"Please change your password to secure your account again." => "請更改您的密碼以再次取得您的帳戶的控制權。", +"Lost your password?" => "忘記密碼？", "remember" => "記住", "Log in" => "登入", -"You are logged out." => "你已登出", "prev" => "上一頁", "next" => "下一頁", -"Security Warning!" => "安全性警告!", -"Verify" => "驗證" +"Updating ownCloud to version %s, this may take a while." => "正在將 Owncloud 升級至版本 %s ，這可能需要一點時間。" ); diff --git a/core/lostpassword/controller.php b/core/lostpassword/controller.php index e64b16d3b83..3ef8eaf71aa 100644 --- a/core/lostpassword/controller.php +++ b/core/lostpassword/controller.php @@ -45,8 +45,6 @@ class OC_Core_LostPassword_Controller { $l = OC_L10N::get('core'); $from = OCP\Util::getDefaultEmailAddress('lostpassword-noreply'); OC_Mail::send($email, $_POST['user'], $l->t('ownCloud password reset'), $msg, $from, 'ownCloud'); - echo('Mailsent'); - self::displayLostPasswordPage(false, true); } else { self::displayLostPasswordPage(true, false); diff --git a/core/routes.php b/core/routes.php index fc511d403d8..7408858b107 100644 --- a/core/routes.php +++ b/core/routes.php @@ -32,6 +32,9 @@ $this->create('core_ajax_vcategories_favorites', '/core/ajax/vcategories/favorit ->actionInclude('core/ajax/vcategories/favorites.php'); $this->create('core_ajax_vcategories_edit', '/core/ajax/vcategories/edit.php') ->actionInclude('core/ajax/vcategories/edit.php'); +// oC JS config +$this->create('js_config', '/core/js/config.js') + ->actionInclude('core/js/config.php'); // Routing $this->create('core_ajax_routes', '/core/routes.json') ->action('OC_Router', 'JSRoutes'); diff --git a/core/templates/exception.php b/core/templates/exception.php index 4b951fca51b..47792225557 100644 --- a/core/templates/exception.php +++ b/core/templates/exception.php @@ -5,7 +5,7 @@ <p class="exception"> <?php if($_['showsysinfo'] == true) { - echo 'If you would like to support ownCloud\'s developers and report this error in our <a href="http://bugs.owncloud.org">Bugtracker</a>, please copy the following informations into the description. <br><br><textarea readonly>'; + echo 'If you would like to support ownCloud\'s developers and report this error in our <a href="https://github.com/owncloud/core">bug tracker</a>, please copy the following informations into the description. <br><br><textarea readonly>'; echo 'Message: ' . $_['message'] . "\n"; echo 'Error Code: ' . $_['code'] . "\n"; echo 'File: ' . $_['file'] . "\n"; diff --git a/core/templates/installation.php b/core/templates/installation.php index 28fbf29b540..03c580c9b0b 100644 --- a/core/templates/installation.php +++ b/core/templates/installation.php @@ -1,7 +1,7 @@ -<input type='hidden' id='hasMySQL' value='<?php echo $_['hasMySQL'] ?>'></input> -<input type='hidden' id='hasSQLite' value='<?php echo $_['hasSQLite'] ?>'></input> -<input type='hidden' id='hasPostgreSQL' value='<?php echo $_['hasPostgreSQL'] ?>'></input> -<input type='hidden' id='hasOracle' value='<?php echo $_['hasOracle'] ?>'></input> +<input type='hidden' id='hasMySQL' value='<?php echo $_['hasMySQL'] ?>'> +<input type='hidden' id='hasSQLite' value='<?php echo $_['hasSQLite'] ?>'> +<input type='hidden' id='hasPostgreSQL' value='<?php echo $_['hasPostgreSQL'] ?>'> +<input type='hidden' id='hasOracle' value='<?php echo $_['hasOracle'] ?>'> <form action="index.php" method="post"> <input type="hidden" name="install" value="true" /> <?php if(count($_['errors']) > 0): ?> @@ -113,7 +113,7 @@ </p> <p class="infield groupmiddle"> <label for="dbname" class="infield"><?php echo $l->t( 'Database name' ); ?></label> - <input type="text" name="dbname" id="dbname" value="<?php print OC_Helper::init_var('dbname'); ?>" autocomplete="off" pattern="[0-9a-zA-Z$_]+" /> + <input type="text" name="dbname" id="dbname" value="<?php print OC_Helper::init_var('dbname'); ?>" autocomplete="off" pattern="[0-9a-zA-Z$_-]+" /> </p> </div> <?php endif; ?> diff --git a/core/templates/layout.base.php b/core/templates/layout.base.php index 47f4b423b3e..47fb75612cf 100644 --- a/core/templates/layout.base.php +++ b/core/templates/layout.base.php @@ -7,12 +7,7 @@ <?php foreach ($_['cssfiles'] as $cssfile): ?> <link rel="stylesheet" href="<?php echo $cssfile; ?>" type="text/css" media="screen" /> <?php endforeach; ?> - <script type="text/javascript"> - var oc_debug = <?php echo (defined('DEBUG') && DEBUG) ? 'true' : 'false'; ?>; - var oc_webroot = '<?php echo OC::$WEBROOT; ?>'; - var oc_appswebroots = <?php echo $_['apps_paths'] ?>; - var oc_requesttoken = '<?php echo $_['requesttoken']; ?>'; - </script> + <script type="text/javascript" src="<?php echo OC_Helper::linkToRoute('js_config');?>"></script> <?php foreach ($_['jsfiles'] as $jsfile): ?> <script type="text/javascript" src="<?php echo $jsfile; ?>"></script> <?php endforeach; ?> diff --git a/core/templates/layout.guest.php b/core/templates/layout.guest.php index 8395426e4e4..9aabc08acec 100644 --- a/core/templates/layout.guest.php +++ b/core/templates/layout.guest.php @@ -3,20 +3,12 @@ <head> <title>ownCloud</title> <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> + <meta name="apple-itunes-app" content="app-id=543672169"> <link rel="shortcut icon" href="<?php echo image_path('', 'favicon.png'); ?>" /><link rel="apple-touch-icon-precomposed" href="<?php echo image_path('', 'favicon-touch.png'); ?>" /> <?php foreach($_['cssfiles'] as $cssfile): ?> <link rel="stylesheet" href="<?php echo $cssfile; ?>" type="text/css" media="screen" /> <?php endforeach; ?> - <script type="text/javascript"> - var oc_debug = <?php echo (defined('DEBUG') && DEBUG) ? 'true' : 'false'; ?>; - var oc_webroot = '<?php echo OC::$WEBROOT; ?>'; - var oc_appswebroots = <?php echo $_['apps_paths'] ?>; - var oc_requesttoken = '<?php echo $_['requesttoken']; ?>'; - var datepickerFormatDate = <?php echo json_encode($l->l('jsdate', 'jsdate')) ?>; - var dayNames = <?php echo json_encode(array((string)$l->t('Sunday'), (string)$l->t('Monday'), (string)$l->t('Tuesday'), (string)$l->t('Wednesday'), (string)$l->t('Thursday'), (string)$l->t('Friday'), (string)$l->t('Saturday'))) ?>; - var monthNames = <?php echo json_encode(array((string)$l->t('January'), (string)$l->t('February'), (string)$l->t('March'), (string)$l->t('April'), (string)$l->t('May'), (string)$l->t('June'), (string)$l->t('July'), (string)$l->t('August'), (string)$l->t('September'), (string)$l->t('October'), (string)$l->t('November'), (string)$l->t('December'))) ?>; - var firstDay = <?php echo json_encode($l->l('firstday', 'firstday')) ?>; - </script> + <script type="text/javascript" src="<?php echo OC_Helper::linkToRoute('js_config');?>"></script> <?php foreach($_['jsfiles'] as $jsfile): ?> <script type="text/javascript" src="<?php echo $jsfile; ?>"></script> <?php endforeach; ?> diff --git a/core/templates/layout.user.php b/core/templates/layout.user.php index ba5053edecf..18291e0f84e 100644 --- a/core/templates/layout.user.php +++ b/core/templates/layout.user.php @@ -3,31 +3,15 @@ <head> <title><?php echo isset($_['application']) && !empty($_['application'])?$_['application'].' | ':'' ?>ownCloud <?php echo OC_User::getUser()?' ('.OC_User::getUser().') ':'' ?></title> <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> + <meta name="apple-itunes-app" content="app-id=543672169"> <link rel="shortcut icon" href="<?php echo image_path('', 'favicon.png'); ?>" /><link rel="apple-touch-icon-precomposed" href="<?php echo image_path('', 'favicon-touch.png'); ?>" /> <?php foreach($_['cssfiles'] as $cssfile): ?> <link rel="stylesheet" href="<?php echo $cssfile; ?>" type="text/css" media="screen" /> <?php endforeach; ?> - <script type="text/javascript"> - var oc_debug = <?php echo (defined('DEBUG') && DEBUG) ? 'true' : 'false'; ?>; - var oc_webroot = '<?php echo OC::$WEBROOT; ?>'; - var oc_appswebroots = <?php echo $_['apps_paths'] ?>; - var oc_current_user = '<?php echo OC_User::getUser() ?>'; - var oc_requesttoken = '<?php echo $_['requesttoken']; ?>'; - var datepickerFormatDate = <?php echo json_encode($l->l('jsdate', 'jsdate')) ?>; - var dayNames = <?php echo json_encode(array((string)$l->t('Sunday'), (string)$l->t('Monday'), (string)$l->t('Tuesday'), (string)$l->t('Wednesday'), (string)$l->t('Thursday'), (string)$l->t('Friday'), (string)$l->t('Saturday'))) ?>; - var monthNames = <?php echo json_encode(array((string)$l->t('January'), (string)$l->t('February'), (string)$l->t('March'), (string)$l->t('April'), (string)$l->t('May'), (string)$l->t('June'), (string)$l->t('July'), (string)$l->t('August'), (string)$l->t('September'), (string)$l->t('October'), (string)$l->t('November'), (string)$l->t('December'))) ?>; - var firstDay = <?php echo json_encode($l->l('firstday', 'firstday')) ?>; - </script> + <script type="text/javascript" src="<?php echo OC_Helper::linkToRoute('js_config');?>"></script> <?php foreach($_['jsfiles'] as $jsfile): ?> <script type="text/javascript" src="<?php echo $jsfile; ?>"></script> <?php endforeach; ?> - <script type="text/javascript"> - requesttoken = '<?php echo $_['requesttoken']; ?>'; - OC.EventSource.requesttoken=requesttoken; - $(document).bind('ajaxSend', function(elm, xhr, s) { - xhr.setRequestHeader('requesttoken', requesttoken); - }); - </script> <?php foreach($_['headers'] as $header): ?> <?php echo '<'.$header['tag'].' '; @@ -40,7 +24,10 @@ </head> <body id="<?php echo $_['bodyid'];?>"> - <header><div id="header"> + <div id="notification-container"> + <div id="notification"></div> + </div> + <header><div id="header"> <a href="<?php echo link_to('', 'index.php'); ?>" title="" id="owncloud"><img class="svg" src="<?php echo image_path('', 'logo-wide.svg'); ?>" alt="ownCloud" /></a> <a class="header-right header-action" id="logout" href="<?php echo link_to('', 'index.php'); ?>?logout=true"><img class="svg" alt="<?php echo $l->t('Log out');?>" title="<?php echo $l->t('Log out'); echo OC_User::getUser()?' ('.OC_User::getUser().') ':'' ?>" src="<?php echo image_path('', 'actions/logout.svg'); ?>" /></a> <form class="searchbox header-right" action="#" method="post"> @@ -67,8 +54,10 @@ </ul> </div></nav> - <div id="content"> - <?php echo $_['content']; ?> + <div id="content-wrapper"> + <div id="content"> + <?php echo $_['content']; ?> + </div> </div> </body> </html> diff --git a/core/templates/login.php b/core/templates/login.php index 10093baabf7..c82d2cafa2e 100644 --- a/core/templates/login.php +++ b/core/templates/login.php @@ -1,50 +1,45 @@ <!--[if IE 8]><style>input[type="checkbox"]{padding:0;}</style><![endif]--> <form method="post"> - <fieldset> - <?php if (!empty($_['redirect_url'])) { - echo '<input type="hidden" name="redirect_url" value="' . $_['redirect_url'] . '" />'; - } ?> - <ul> - <?php if (isset($_['invalidcookie']) && ($_['invalidcookie'])): ?> - <li class="errors"> - <?php echo $l->t('Automatic logon rejected!'); ?><br> - <small><?php echo $l->t('If you did not change your password recently, your account may be compromised!'); ?></small> - <br> - <small><?php echo $l->t('Please change your password to secure your account again.'); ?></small> - </li> - <?php endif; ?> - <?php if (isset($_['invalidpassword']) && ($_['invalidpassword'])): ?> - <a href="<?php echo OC_Helper::linkToRoute('core_lostpassword_index') ?>"> - <li class="errors"> - <?php echo $l->t('Lost your password?'); ?> - </li> - </a> - <?php endif; ?> - </ul> - <p class="infield grouptop"> - <input type="text" name="user" id="user" - value="<?php echo $_['username']; ?>"<?php echo $_['user_autofocus'] ? ' autofocus' : ''; ?> - autocomplete="on" required/> - <label for="user" class="infield"><?php echo $l->t('Username'); ?></label> - <img class="svg" src="<?php echo image_path('', 'actions/user.svg'); ?>" alt=""/> - </p> + <fieldset> + <?php if (!empty($_['redirect_url'])) { + echo '<input type="hidden" name="redirect_url" value="' . $_['redirect_url'] . '" />'; + } ?> + <ul> + <?php if (isset($_['invalidcookie']) && ($_['invalidcookie'])): ?> + <li class="errors"> + <?php echo $l->t('Automatic logon rejected!'); ?><br> + <small><?php echo $l->t('If you did not change your password recently, your account may be compromised!'); ?></small> + <br> + <small><?php echo $l->t('Please change your password to secure your account again.'); ?></small> + </li> + <?php endif; ?> + <?php if (isset($_['invalidpassword']) && ($_['invalidpassword'])): ?> + <a href="<?php echo OC_Helper::linkToRoute('core_lostpassword_index') ?>"> + <li class="errors"> + <?php echo $l->t('Lost your password?'); ?> + </li> + </a> + <?php endif; ?> + </ul> + <p class="infield grouptop"> + <input type="text" name="user" id="user" + value="<?php echo $_['username']; ?>"<?php echo $_['user_autofocus'] ? ' autofocus' : ''; ?> + autocomplete="on" required/> + <label for="user" class="infield"><?php echo $l->t('Username'); ?></label> + <img class="svg" src="<?php echo image_path('', 'actions/user.svg'); ?>" alt=""/> + </p> - <p class="infield groupbottom"> - <input type="password" name="password" id="password" value="" - required<?php echo $_['user_autofocus'] ? '' : ' autofocus'; ?> /> - <label for="password" class="infield"><?php echo $l->t('Password'); ?></label> - <img class="svg" src="<?php echo image_path('', 'actions/password.svg'); ?>" alt=""/> - </p> - <input type="checkbox" name="remember_login" value="1" id="remember_login"/><label - for="remember_login"><?php echo $l->t('remember'); ?></label> - <input type="hidden" name="timezone-offset" id="timezone-offset"/> - <input type="submit" id="submit" class="login primary" value="<?php echo $l->t('Log in'); ?>"/> - </fieldset> + <p class="infield groupbottom"> + <input type="password" name="password" id="password" value="" + required<?php echo $_['user_autofocus'] ? '' : ' autofocus'; ?> /> + <label for="password" class="infield"><?php echo $l->t('Password'); ?></label> + <img class="svg" src="<?php echo image_path('', 'actions/password.svg'); ?>" alt=""/> + </p> + <input type="checkbox" name="remember_login" value="1" id="remember_login"/><label + for="remember_login"><?php echo $l->t('remember'); ?></label> + <input type="hidden" name="timezone-offset" id="timezone-offset"/> + <input type="submit" id="submit" class="login primary" value="<?php echo $l->t('Log in'); ?>"/> + </fieldset> </form> -<script> - $(document).ready(function () { - var visitortimezone = (-new Date().getTimezoneOffset() / 60); - $('#timezone-offset').val(visitortimezone); - }); +<?php OCP\Util::addscript('core', 'visitortimezone'); ?> -</script> diff --git a/core/templates/logout.php b/core/templates/logout.php deleted file mode 100644 index 2247ed8e70f..00000000000 --- a/core/templates/logout.php +++ /dev/null @@ -1 +0,0 @@ -<?php echo $l->t( 'You are logged out.' ); diff --git a/core/templates/update.php b/core/templates/update.php new file mode 100644 index 00000000000..c9f3144f257 --- /dev/null +++ b/core/templates/update.php @@ -0,0 +1,31 @@ +<ul> + <li class='update'> + <?php echo $l->t('Updating ownCloud to version %s, this may take a while.', array($_['version'])); ?><br /><br /> + </li> +</ul> +<script> + $(document).ready(function () { + OC.EventSource.requesttoken = oc_requesttoken; + var updateEventSource = new OC.EventSource(OC.webroot+'/core/ajax/update.php'); + updateEventSource.listen('success', function(message) { + $('<span>').append(message).append('<br />').appendTo($('.update')); + }); + updateEventSource.listen('error', function(message) { + $('<span>').addClass('error').append(message).append('<br />').appendTo($('.update')); + }); + updateEventSource.listen('failure', function(message) { + $('<span>').addClass('error').append(message).append('<br />').appendTo($('.update')); + $('<span>') + .addClass('error bold') + .append('<br />') + .append(t('core', 'The update was unsuccessful. Please report this issue to the <a href="https://github.com/owncloud/core/issues" target="_blank">ownCloud community</a>.')) + .appendTo($('.update')); + }); + updateEventSource.listen('done', function(message) { + $('<span>').addClass('bold').append('<br />').append(t('core', 'The update was successful. Redirecting you to ownCloud now.')).appendTo($('.update')); + setTimeout(function () { + window.location.href = OC.webroot; + }, 3000); + }); + }); +</script>
\ No newline at end of file diff --git a/core/templates/verify.php b/core/templates/verify.php deleted file mode 100644 index 600eaca05b7..00000000000 --- a/core/templates/verify.php +++ /dev/null @@ -1,18 +0,0 @@ -<form method="post"> - <fieldset> - <ul> - <li class="errors"> - <?php echo $l->t('Security Warning!'); ?><br> - <small><?php echo $l->t("Please verify your password. <br/>For security reasons you may be occasionally asked to enter your password again."); ?></small> - </li> - </ul> - <p class="infield"> - <input type="text" value="<?php echo $_['username']; ?>" disabled="disabled" /> - </p> - <p class="infield"> - <label for="password" class="infield"><?php echo $l->t( 'Password' ); ?></label> - <input type="password" name="password" id="password" value="" required /> - </p> - <input type="submit" id="submit" class="login" value="<?php echo $l->t( 'Verify' ); ?>" /> - </fieldset> -</form> |
