/* * ==================================================================== * Licensed to the Apache Software Foundation (ASF) under one or more * contributor license agreements. See the NOTICE file distributed with * this work for additional information regarding copyright ownership. * The ASF licenses this file to You under the Apache License, Version 2.0 * (the "License"); you may not use this file except in compliance with * the License. You may obtain a copy of the License at * * http://www.apache.org/licenses/LICENSE-2.0 * * Unless required by applicable law or agreed to in writing, software * distributed under the License is distributed on an "AS IS" BASIS, * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. * See the License for the specific language governing permissions and * limitations under the License. * ==================================================================== */ package org.apache.poi.xslf.usermodel; import java.awt.Color; import java.awt.geom.Rectangle2D; import org.apache.logging.log4j.Logger; import org.apache.poi.logging.PoiLogManager; import org.apache.poi.ooxml.util.POIXMLUnits; import org.apache.poi.openxml4j.opc.PackagePart; import org.apache.poi.sl.draw.DrawPaint; import org.apache.poi.sl.draw.geom.CustomGeometry; import org.apache.poi.sl.draw.geom.Guide; import org.apache.poi.sl.draw.geom.PresetGeometries; import org.apache.poi.sl.usermodel.FillStyle; import org.apache.poi.sl.usermodel.LineDecoration; import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape; import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize; import org.apache.poi.sl.usermodel.PaintStyle; import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint; import org.apache.poi.sl.usermodel.ShapeType; import org.apache.poi.sl.usermodel.SimpleShape; import org.apache.poi.sl.usermodel.StrokeStyle; import org.apache.poi.sl.usermodel.StrokeStyle.LineCap; import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound; import org.apache.poi.sl.usermodel.StrokeStyle.LineDash; import org.apache.poi.util.Beta; import org.apache.poi.util.Units; import org.apache.poi.xslf.draw.geom.XSLFCustomGeometry; import org.apache.poi.xslf.model.PropertyFetcher; import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties; import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties; import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties; import org.apache.xmlbeans.XmlObject; import org.openxmlformats.schemas.drawingml.x2006.main.*; /** * Represents a single (non-group) shape in a .pptx slide show */ @Beta public abstract class XSLFSimpleShape extends XSLFShape implements SimpleShape { private static final CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance(); private static final Logger LOG = PoiLogManager.getLogger(XSLFSimpleShape.class); /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) { super(shape,sheet); } @Override public void setShapeType(ShapeType type) { XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); if (gp == null) { return; } if (gp.isSetCustGeom()) { gp.unsetCustGeom(); } CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom(); prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId)); } @Override public ShapeType getShapeType(){ XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); if (gp != null && gp.isSetPrstGeom()) { STShapeType.Enum geom = gp.getPrstGeom().getPrst(); if (geom != null) { return ShapeType.forId(geom.intValue(), true); } } return null; } protected CTTransform2D getXfrm(boolean create) { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { XmlObject xo = shape.getShapeProperties(); if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) { setValue(((CTShapeProperties)xo).getXfrm()); return true; } return false; } }; fetchShapeProperty(fetcher); CTTransform2D xfrm = fetcher.getValue(); if (!create || xfrm != null) { return xfrm; } else { XmlObject xo = getShapeProperties(); if (xo instanceof CTShapeProperties) { return ((CTShapeProperties)xo).addNewXfrm(); } else { // ... group shapes have their own getXfrm() LOG.atWarn().log("{} doesn't have xfrm element.", getClass()); return null; } } } @Override public Rectangle2D getAnchor() { CTTransform2D xfrm = getXfrm(false); if (xfrm == null || !xfrm.isSetOff()) { return null; } CTPoint2D off = xfrm.getOff(); double x = Units.toPoints(POIXMLUnits.parseLength(off.xgetX())); double y = Units.toPoints(POIXMLUnits.parseLength(off.xgetY())); CTPositiveSize2D ext = xfrm.getExt(); double cx = Units.toPoints(ext.getCx()); double cy = Units.toPoints(ext.getCy()); return new Rectangle2D.Double(x, y, cx, cy); } @Override public void setAnchor(Rectangle2D anchor) { CTTransform2D xfrm = getXfrm(true); if (xfrm == null) { return; } CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff(); long x = Units.toEMU(anchor.getX()); long y = Units.toEMU(anchor.getY()); off.setX(x); off.setY(y); CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm .addNewExt(); long cx = Units.toEMU(anchor.getWidth()); long cy = Units.toEMU(anchor.getHeight()); ext.setCx(cx); ext.setCy(cy); } @Override public void setRotation(double theta) { CTTransform2D xfrm = getXfrm(true); if (xfrm != null) { xfrm.setRot((int) (theta * 60000)); } } @Override public double getRotation() { CTTransform2D xfrm = getXfrm(false); return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d); } @Override public void setFlipHorizontal(boolean flip) { CTTransform2D xfrm = getXfrm(true); if (xfrm != null) { xfrm.setFlipH(flip); } } @Override public void setFlipVertical(boolean flip) { CTTransform2D xfrm = getXfrm(true); if (xfrm != null) { xfrm.setFlipV(flip); } } @Override public boolean getFlipHorizontal() { CTTransform2D xfrm = getXfrm(false); return (xfrm != null && xfrm.isSetFlipH()) && xfrm.getFlipH(); } @Override public boolean getFlipVertical() { CTTransform2D xfrm = getXfrm(false); return (xfrm != null && xfrm.isSetFlipV()) && xfrm.getFlipV(); } /** * Get default line properties defined in the theme (if any). * Used internally to resolve shape properties. * * @return line properties from the theme of null */ private CTLineProperties getDefaultLineProperties() { CTShapeStyle style = getSpStyle(); if (style == null) { return null; } CTStyleMatrixReference lnRef = style.getLnRef(); if (lnRef == null) { return null; } // 1-based index of a line style within the style matrix int idx = Math.toIntExact(lnRef.getIdx()); XSLFTheme theme = getSheet().getTheme(); if (theme == null) { return null; } CTBaseStyles styles = theme.getXmlObject().getThemeElements(); if (styles == null) { return null; } CTStyleMatrix styleMatrix = styles.getFmtScheme(); if (styleMatrix == null) { return null; } CTLineStyleList lineStyles = styleMatrix.getLnStyleLst(); if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) { return null; } return lineStyles.getLnArray(idx - 1); } /** * @param color the color to paint the shape outline. * A {@code null} value turns off the shape outline. */ public void setLineColor(Color color) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } if (ln.isSetSolidFill()) { ln.unsetSolidFill(); } if (ln.isSetGradFill()) { ln.unsetGradFill(); } if (ln.isSetPattFill()) { ln.unsetPattFill(); } if (ln.isSetNoFill()) { ln.unsetNoFill(); } if (color == null) { ln.addNewNoFill(); } else { CTSolidColorFillProperties fill = ln.addNewSolidFill(); XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr(), getSheet()); col.setColor(color); } } /** * * @return the color of the shape outline or {@code null} * if outline is turned off */ @SuppressWarnings("WeakerAccess") public Color getLineColor() { PaintStyle ps = getLinePaint(); if (ps instanceof SolidPaint) { return ((SolidPaint)ps).getSolidColor().getColor(); } return null; } @SuppressWarnings("WeakerAccess") protected PaintStyle getLinePaint() { XSLFSheet sheet = getSheet(); final XSLFTheme theme = sheet.getTheme(); final boolean hasPlaceholder = getPlaceholder() != null; PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { CTLineProperties spPr = getLn(shape, false); XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr); if (fp != null && fp.isSetNoFill()) { setValue(null); return true; } PackagePart pp = shape.getSheet().getPackagePart(); PaintStyle paint = selectPaint(fp, null, pp, theme, hasPlaceholder); if (paint != null) { setValue(paint); return true; } CTShapeStyle style = shape.getSpStyle(); if (style != null) { fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef()); paint = selectPaint(fp, null, pp, theme, hasPlaceholder); // line color was not found, check if it is defined in the theme if (paint == null) { paint = getThemePaint(style, pp); } } if (paint != null) { setValue(paint); return true; } return false; } PaintStyle getThemePaint(CTShapeStyle style, PackagePart pp) { // get a reference to a line style within the style matrix. CTStyleMatrixReference lnRef = style.getLnRef(); if (lnRef == null) { return null; } int idx = Math.toIntExact(lnRef.getIdx()); CTSchemeColor phClr = lnRef.getSchemeClr(); if(idx <= 0){ return null; } CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1); XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props); return selectPaint(fp, phClr, pp, theme, hasPlaceholder); } }; fetchShapeProperty(fetcher); return fetcher.getValue(); } /** * * @param width line width in points. {@code 0} means no line */ @SuppressWarnings("WeakerAccess") public void setLineWidth(double width) { CTLineProperties lnPr = getLn(this, true); if (lnPr == null) { return; } if (width == 0.) { if (lnPr.isSetW()) { lnPr.unsetW(); } if (!lnPr.isSetNoFill()) { lnPr.addNewNoFill(); } if (lnPr.isSetSolidFill()) { lnPr.unsetSolidFill(); } if (lnPr.isSetGradFill()) { lnPr.unsetGradFill(); } if (lnPr.isSetPattFill()) { lnPr.unsetPattFill(); } } else { if (lnPr.isSetNoFill()) { lnPr.unsetNoFill(); } lnPr.setW(Units.toEMU(width)); } } /** * @return line width in points. {@code 0} means no line. */ @SuppressWarnings("WeakerAccess") public double getLineWidth() { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { CTLineProperties ln = getLn(shape, false); if (ln != null) { if (ln.isSetNoFill()) { setValue(0.); return true; } if (ln.isSetW()) { setValue(Units.toPoints(ln.getW())); return true; } } return false; } }; fetchShapeProperty(fetcher); double lineWidth = 0; if (fetcher.getValue() == null) { CTLineProperties defaultLn = getDefaultLineProperties(); if (defaultLn != null) { if (defaultLn.isSetW()) { lineWidth = Units.toPoints(defaultLn.getW()); } } } else { lineWidth = fetcher.getValue(); } return lineWidth; } /** * @param compound set the line compound style */ @SuppressWarnings("WeakerAccess") public void setLineCompound(LineCompound compound) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } if (compound == null) { if (ln.isSetCmpd()) { ln.unsetCmpd(); } } else { STCompoundLine.Enum xCmpd; switch (compound) { default: case SINGLE: xCmpd = STCompoundLine.SNG; break; case DOUBLE: xCmpd = STCompoundLine.DBL; break; case THICK_THIN: xCmpd = STCompoundLine.THICK_THIN; break; case THIN_THICK: xCmpd = STCompoundLine.THIN_THICK; break; case TRIPLE: xCmpd = STCompoundLine.TRI; break; } ln.setCmpd(xCmpd); } } /** * @return the line compound */ @SuppressWarnings("WeakerAccess") public LineCompound getLineCompound() { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { CTLineProperties ln = getLn(shape, false); if (ln != null) { STCompoundLine.Enum stCmpd = ln.getCmpd(); if (stCmpd != null) { setValue(stCmpd.intValue()); return true; } } return false; } }; fetchShapeProperty(fetcher); Integer cmpd = fetcher.getValue(); if (cmpd == null) { CTLineProperties defaultLn = getDefaultLineProperties(); if (defaultLn != null && defaultLn.isSetCmpd()) { switch (defaultLn.getCmpd().intValue()) { default: case STCompoundLine.INT_SNG: return LineCompound.SINGLE; case STCompoundLine.INT_DBL: return LineCompound.DOUBLE; case STCompoundLine.INT_THICK_THIN: return LineCompound.THICK_THIN; case STCompoundLine.INT_THIN_THICK: return LineCompound.THIN_THICK; case STCompoundLine.INT_TRI: return LineCompound.TRIPLE; } } } return null; } /** * * @param dash a preset line dashing scheme to stroke thr shape outline */ @SuppressWarnings("WeakerAccess") public void setLineDash(LineDash dash) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } if (dash == null) { if (ln.isSetPrstDash()) { ln.unsetPrstDash(); } } else { CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash(); ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId)); } } /** * @return a preset line dashing scheme to stroke the shape outline */ @SuppressWarnings("WeakerAccess") public LineDash getLineDash() { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { CTLineProperties ln = getLn(shape, false); if (ln == null || !ln.isSetPrstDash()) { return false; } setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue())); return true; } }; fetchShapeProperty(fetcher); LineDash dash = fetcher.getValue(); if (dash == null) { CTLineProperties defaultLn = getDefaultLineProperties(); if (defaultLn != null && defaultLn.isSetPrstDash()) { dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue()); } } return dash; } /** * * @param cap the line end cap style */ @SuppressWarnings("WeakerAccess") public void setLineCap(LineCap cap) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } if (cap == null) { if (ln.isSetCap()) { ln.unsetCap(); } } else { ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId)); } } /** * * @return the line end cap style */ @SuppressWarnings("WeakerAccess") public LineCap getLineCap() { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { CTLineProperties ln = getLn(shape, false); if (ln != null && ln.isSetCap()) { setValue(LineCap.fromOoxmlId(ln.getCap().intValue())); return true; } return false; } }; fetchShapeProperty(fetcher); LineCap cap = fetcher.getValue(); if (cap == null) { CTLineProperties defaultLn = getDefaultLineProperties(); if (defaultLn != null && defaultLn.isSetCap()) { cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue()); } } return cap; } @Override public void setFillColor(Color color) { XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); if (fp == null) { return; } if (color == null) { if (fp.isSetSolidFill()) { fp.unsetSolidFill(); } if (fp.isSetGradFill()) { fp.unsetGradFill(); } if (fp.isSetPattFill()) { fp.unsetGradFill(); } if (fp.isSetBlipFill()) { fp.unsetBlipFill(); } if (!fp.isSetNoFill()) { fp.addNewNoFill(); } } else { if (fp.isSetNoFill()) { fp.unsetNoFill(); } CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill(); XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr(), getSheet()); col.setColor(color); } } @Override public Color getFillColor() { PaintStyle ps = getFillPaint(); if (ps instanceof SolidPaint) { return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor()); } return null; } /** * @return shadow of this shape or null if shadow is disabled */ @Override public XSLFShadow getShadow() { PropertyFetcher fetcher = new PropertyFetcher() { @Override public boolean fetch(XSLFShape shape) { XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties()); if (ep != null && ep.isSetEffectLst()) { CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw(); setValue(obj == null ? NO_SHADOW : obj); return true; } return false; } }; fetchShapeProperty(fetcher); CTOuterShadowEffect obj = fetcher.getValue(); if (obj == null) { // fill color was not found, check if it is defined in the theme CTShapeStyle style = getSpStyle(); if (style != null && style.getEffectRef() != null) { // 1-based index of a shadow style within the style matrix int idx = (int) style.getEffectRef().getIdx(); if(idx != 0) { CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme(); CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1); obj = ef.getEffectLst().getOuterShdw(); } } } return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this); } /** * @return definition of the shape geometry */ @Override public CustomGeometry getGeometry() { XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); if (gp == null) { return null; } CustomGeometry geom; PresetGeometries dict = PresetGeometries.getInstance(); if(gp.isSetPrstGeom()){ String name = gp.getPrstGeom().getPrst().toString(); geom = dict.get(name); if(geom == null) { throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet()); } } else if (gp.isSetCustGeom()){ geom = XSLFCustomGeometry.convertCustomGeometry(gp.getCustGeom()); } else { geom = dict.get("rect"); } return geom; } @Override void copy(XSLFShape sh){ super.copy(sh); XSLFSimpleShape s = (XSLFSimpleShape)sh; Color srsSolidFill = s.getFillColor(); Color tgtSoliFill = getFillColor(); if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){ setFillColor(srsSolidFill); } XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties()); if(fp != null && fp.isSetBlipFill()){ CTBlip blip = fp.getBlipFill().getBlip(); String blipId = blip.getEmbed(); String relId = getSheet().importBlip(blipId, s.getSheet()); blip.setEmbed(relId); } Color srcLineColor = s.getLineColor(); Color tgtLineColor = getLineColor(); if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) { setLineColor(srcLineColor); } double srcLineWidth = s.getLineWidth(); double tgtLineWidth = getLineWidth(); if(srcLineWidth != tgtLineWidth) { setLineWidth(srcLineWidth); } LineDash srcLineDash = s.getLineDash(); LineDash tgtLineDash = getLineDash(); if(srcLineDash != null && srcLineDash != tgtLineDash) { setLineDash(srcLineDash); } LineCap srcLineCap = s.getLineCap(); LineCap tgtLineCap = getLineCap(); if(srcLineCap != null && srcLineCap != tgtLineCap) { setLineCap(srcLineCap); } } /** * Specifies the line end decoration, such as a triangle or arrowhead. * * @param style the line end decoration style */ @SuppressWarnings("WeakerAccess") public void setLineHeadDecoration(DecorationShape style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); if (style == null) { if (lnEnd.isSetType()) { lnEnd.unsetType(); } } else { lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration shape */ @SuppressWarnings("WeakerAccess") public DecorationShape getLineHeadDecoration() { CTLineProperties ln = getLn(this, false); DecorationShape ds = DecorationShape.NONE; if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) { ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue()); } return ds; } /** * specifies decoration width of the head of a line. * * @param style the decoration width */ @SuppressWarnings("WeakerAccess") public void setLineHeadWidth(DecorationSize style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); if (style == null) { if (lnEnd.isSetW()) { lnEnd.unsetW(); } } else { lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration width */ @SuppressWarnings("WeakerAccess") public DecorationSize getLineHeadWidth() { CTLineProperties ln = getLn(this, false); DecorationSize ds = DecorationSize.MEDIUM; if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) { ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue()); } return ds; } /** * Specifies the line end width in relation to the line width. */ @SuppressWarnings("WeakerAccess") public void setLineHeadLength(DecorationSize style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd(); if (style == null) { if (lnEnd.isSetLen()) { lnEnd.unsetLen(); } } else { lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration length */ @SuppressWarnings("WeakerAccess") public DecorationSize getLineHeadLength() { CTLineProperties ln = getLn(this, false); DecorationSize ds = DecorationSize.MEDIUM; if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) { ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue()); } return ds; } /** * Specifies the line end decoration, such as a triangle or arrowhead. */ @SuppressWarnings("WeakerAccess") public void setLineTailDecoration(DecorationShape style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); if (style == null) { if (lnEnd.isSetType()) { lnEnd.unsetType(); } } else { lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration shape */ @SuppressWarnings("WeakerAccess") public DecorationShape getLineTailDecoration() { CTLineProperties ln = getLn(this, false); DecorationShape ds = DecorationShape.NONE; if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) { ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue()); } return ds; } /** * specifies decorations which can be added to the tail of a line. */ @SuppressWarnings("WeakerAccess") public void setLineTailWidth(DecorationSize style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); if (style == null) { if (lnEnd.isSetW()) { lnEnd.unsetW(); } } else { lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration width */ @SuppressWarnings("WeakerAccess") public DecorationSize getLineTailWidth() { CTLineProperties ln = getLn(this, false); DecorationSize ds = DecorationSize.MEDIUM; if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) { ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue()); } return ds; } /** * Specifies the line end width in relation to the line width. */ @SuppressWarnings("WeakerAccess") public void setLineTailLength(DecorationSize style) { CTLineProperties ln = getLn(this, true); if (ln == null) { return; } CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd(); if (style == null) { if (lnEnd.isSetLen()) { lnEnd.unsetLen(); } } else { lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId)); } } /** * @return the line end decoration length */ @SuppressWarnings("WeakerAccess") public DecorationSize getLineTailLength() { CTLineProperties ln = getLn(this, false); DecorationSize ds = DecorationSize.MEDIUM; if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) { ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue()); } return ds; } @Override public Guide getAdjustValue(String name) { XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties()); if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) { for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) { if (g.getName().equals(name)) { Guide gd = new Guide(); gd.setName(g.getName()); gd.setFmla(g.getFmla()); return gd; } } } return null; } @Override public LineDecoration getLineDecoration() { return new LineDecoration() { @Override public DecorationShape getHeadShape() { return getLineHeadDecoration(); } @Override public DecorationSize getHeadWidth() { return getLineHeadWidth(); } @Override public DecorationSize getHeadLength() { return getLineHeadLength(); } @Override public DecorationShape getTailShape() { return getLineTailDecoration(); } @Override public DecorationSize getTailWidth() { return getLineTailWidth(); } @Override public DecorationSize getTailLength() { return getLineTailLength(); } }; } /** * fetch shape fill as a java.awt.Paint * * @return either Color or GradientPaint or TexturePaint or null */ @Override public FillStyle getFillStyle() { return XSLFSimpleShape.this::getFillPaint; } @Override public StrokeStyle getStrokeStyle() { return new StrokeStyle() { @Override public PaintStyle getPaint() { return XSLFSimpleShape.this.getLinePaint(); } @Override public LineCap getLineCap() { return XSLFSimpleShape.this.getLineCap(); } @Override public LineDash getLineDash() { return XSLFSimpleShape.this.getLineDash(); } @Override public double getLineWidth() { return XSLFSimpleShape.this.getLineWidth(); } @Override public LineCompound getLineCompound() { return XSLFSimpleShape.this.getLineCompound(); } }; } @Override public void setStrokeStyle(Object... styles) { if (styles.length == 0) { // remove stroke setLineColor(null); return; } // TODO: handle PaintStyle for (Object st : styles) { if (st instanceof Number) { setLineWidth(((Number)st).doubleValue()); } else if (st instanceof LineCap) { setLineCap((LineCap)st); } else if (st instanceof LineDash) { setLineDash((LineDash)st); } else if (st instanceof LineCompound) { setLineCompound((LineCompound)st); } else if (st instanceof Color) { setLineColor((Color)st); } } } @Override public XSLFHyperlink getHyperlink() { CTNonVisualDrawingProps cNvPr = getCNvPr(); if (!cNvPr.isSetHlinkClick()) { return null; } return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet()); } @Override public XSLFHyperlink createHyperlink() { XSLFHyperlink hl = getHyperlink(); if (hl == null) { CTNonVisualDrawingProps cNvPr = getCNvPr(); hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet()); } return hl; } private static CTLineProperties getLn(XSLFShape shape, boolean create) { XmlObject pr = shape.getShapeProperties(); if (!(pr instanceof CTShapeProperties)) { LOG.atWarn().log("{} doesn't have line properties", shape.getClass()); return null; } CTShapeProperties spr = (CTShapeProperties)pr; return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn(); } }