whitespace; +svn:eol-style=native

git-svn-id: https://svn.apache.org/repos/asf/poi/trunk@1751744 13f79535-47bb-0310-9956-ffa450edef68

1 files changed, 1084 insertions, 1084 deletions

diff --git a/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java b/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java
index 6f1f199ba0..ce058f15a0 100644
--- a/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java
+++ b/src/ooxml/java/org/apache/poi/xslf/usermodel/XSLFSimpleShape.java
@@ -1,1090 +1,1090 @@
-/*

- *  ====================================================================

- *    Licensed to the Apache Software Foundation (ASF) under one or more

- *    contributor license agreements.  See the NOTICE file distributed with

- *    this work for additional information regarding copyright ownership.

- *    The ASF licenses this file to You under the Apache License, Version 2.0

- *    (the "License"); you may not use this file except in compliance with

- *    the License.  You may obtain a copy of the License at

- *

- *        http://www.apache.org/licenses/LICENSE-2.0

- *

- *    Unless required by applicable law or agreed to in writing, software

- *    distributed under the License is distributed on an "AS IS" BASIS,

- *    WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.

- *    See the License for the specific language governing permissions and

- *    limitations under the License.

- * ====================================================================

- */

-

-package org.apache.poi.xslf.usermodel;

-

-import java.awt.Color;

-import java.awt.geom.Rectangle2D;

-

-import javax.xml.stream.XMLStreamException;

-import javax.xml.stream.XMLStreamReader;

-

-import org.apache.poi.openxml4j.opc.PackagePart;

-import org.apache.poi.sl.draw.DrawPaint;

-import org.apache.poi.sl.draw.geom.CustomGeometry;

-import org.apache.poi.sl.draw.geom.Guide;

-import org.apache.poi.sl.draw.geom.PresetGeometries;

-import org.apache.poi.sl.usermodel.FillStyle;

-import org.apache.poi.sl.usermodel.LineDecoration;

-import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape;

-import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize;

-import org.apache.poi.sl.usermodel.PaintStyle;

-import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint;

-import org.apache.poi.sl.usermodel.Placeholder;

-import org.apache.poi.sl.usermodel.ShapeType;

-import org.apache.poi.sl.usermodel.SimpleShape;

-import org.apache.poi.sl.usermodel.StrokeStyle;

-import org.apache.poi.sl.usermodel.StrokeStyle.LineCap;

-import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound;

-import org.apache.poi.sl.usermodel.StrokeStyle.LineDash;

-import org.apache.poi.util.Beta;

-import org.apache.poi.util.POILogFactory;

-import org.apache.poi.util.POILogger;

-import org.apache.poi.util.Units;

-import org.apache.poi.xslf.model.PropertyFetcher;

-import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties;

-import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties;

-import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties;

-import org.apache.xmlbeans.XmlObject;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTBaseStyles;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTBlip;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTEffectStyleItem;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTGeomGuide;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTLineEndProperties;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTLineProperties;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTLineStyleList;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTNonVisualDrawingProps;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTOuterShadowEffect;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTPoint2D;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTPositiveSize2D;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetGeometry2D;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetLineDashProperties;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTSchemeColor;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeProperties;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeStyle;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTSolidColorFillProperties;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrix;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrixReference;

-import org.openxmlformats.schemas.drawingml.x2006.main.CTTransform2D;

-import org.openxmlformats.schemas.drawingml.x2006.main.STCompoundLine;

-import org.openxmlformats.schemas.drawingml.x2006.main.STLineCap;

-import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndLength;

-import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndType;

-import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndWidth;

-import org.openxmlformats.schemas.drawingml.x2006.main.STPresetLineDashVal;

-import org.openxmlformats.schemas.drawingml.x2006.main.STShapeType;

-import org.openxmlformats.schemas.presentationml.x2006.main.CTPlaceholder;

-

-/**

- * Represents a single (non-group) shape in a .pptx slide show

- */

-@Beta

-public abstract class XSLFSimpleShape extends XSLFShape

-    implements SimpleShape<XSLFShape,XSLFTextParagraph> {

-    private static CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance();

-    private static final POILogger LOG = POILogFactory.getLogger(XSLFSimpleShape.class);

-

-    /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) {

-        super(shape,sheet);

-    }

-

-    @Override

-    public void setShapeType(ShapeType type) {

-        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());

-        if (gp == null) {

-            return;

-        }

-        if (gp.isSetCustGeom()) {

-            gp.unsetCustGeom();

-        }

-        CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom();

-        prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId));

-    }

-

-    @Override

-    public ShapeType getShapeType(){

-        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());

-        if (gp != null && gp.isSetPrstGeom()) {

-            STShapeType.Enum geom = gp.getPrstGeom().getPrst();

-            if (geom != null) {

-                return ShapeType.forId(geom.intValue(), true);

-            }

-        }

-        return null;

-    }

-

-    protected CTTransform2D getXfrm(boolean create) {

-        PropertyFetcher<CTTransform2D> fetcher = new PropertyFetcher<CTTransform2D>() {

-            public boolean fetch(XSLFShape shape) {

-                XmlObject xo = shape.getShapeProperties();

-                if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) {

-                    setValue(((CTShapeProperties)xo).getXfrm());

-                    return true;

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-        

-        CTTransform2D xfrm = fetcher.getValue();

-        if (!create || xfrm != null) {

-            return xfrm;

-        } else {

-            XmlObject xo = getShapeProperties();

-            if (xo instanceof CTShapeProperties) {

-                return ((CTShapeProperties)xo).addNewXfrm();

-            } else {

-                // ... group shapes have their own getXfrm()

-                LOG.log(POILogger.WARN, getClass().toString()+" doesn't have xfrm element.");

-                return null;

-            }

-        }

-    }

-

-    @Override

-    public Rectangle2D getAnchor() {

-

-        CTTransform2D xfrm = getXfrm(false);

-        if (xfrm == null) {

-            return null;

-        }

-

-        CTPoint2D off = xfrm.getOff();

-        double x = Units.toPoints(off.getX());

-        double y = Units.toPoints(off.getY());

-        CTPositiveSize2D ext = xfrm.getExt();

-        double cx = Units.toPoints(ext.getCx());

-        double cy = Units.toPoints(ext.getCy());

-        return new Rectangle2D.Double(x, y, cx, cy);

-    }

-

-    @Override

-    public void setAnchor(Rectangle2D anchor) {

-        CTTransform2D xfrm = getXfrm(true);

-        if (xfrm == null) {

-            return;

-        }

-        CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff();

-        long x = Units.toEMU(anchor.getX());

-        long y = Units.toEMU(anchor.getY());

-        off.setX(x);

-        off.setY(y);

-        CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm

-                .addNewExt();

-        long cx = Units.toEMU(anchor.getWidth());

-        long cy = Units.toEMU(anchor.getHeight());

-        ext.setCx(cx);

-        ext.setCy(cy);

-    }

-

-    @Override

-    public void setRotation(double theta) {

-        CTTransform2D xfrm = getXfrm(true);

-        if (xfrm != null) {

-            xfrm.setRot((int) (theta * 60000));

-        }

-    }

-

-    @Override

-    public double getRotation() {

-        CTTransform2D xfrm = getXfrm(false);

-        return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d);

-    }

-

-    @Override

-    public void setFlipHorizontal(boolean flip) {

-        CTTransform2D xfrm = getXfrm(true);

-        if (xfrm != null) {

-            xfrm.setFlipH(flip);

-        }

-    }

-

-    @Override

-    public void setFlipVertical(boolean flip) {

-        CTTransform2D xfrm = getXfrm(true);

-        if (xfrm != null) {

-            xfrm.setFlipV(flip);

-        }

-    }

-

-    @Override

-    public boolean getFlipHorizontal() {

-        CTTransform2D xfrm = getXfrm(false);

-        return (xfrm == null || !xfrm.isSetFlipH()) ? false : xfrm.getFlipH();

-    }

-

-    @Override

-    public boolean getFlipVertical() {

-        CTTransform2D xfrm = getXfrm(false);

-        return (xfrm == null || !xfrm.isSetFlipV()) ? false : xfrm.getFlipV();

-    }

-

-

-    /**

-     * Get default line properties defined in the theme (if any).

-     * Used internally to resolve shape properties.

-     *

-     * @return line properties from the theme of null

-     */

-    CTLineProperties getDefaultLineProperties() {

-        CTShapeStyle style = getSpStyle();

-        if (style == null) return null;

-        CTStyleMatrixReference lnRef = style.getLnRef();

-        if (lnRef == null) return null;

-        // 1-based index of a line style within the style matrix

-        int idx = (int)lnRef.getIdx();

-

-        XSLFTheme theme = getSheet().getTheme();

-        if (theme == null) return null;

-        CTBaseStyles styles = theme.getXmlObject().getThemeElements();

-        if (styles == null) return null;

-        CTStyleMatrix styleMatrix = styles.getFmtScheme();

-        if (styleMatrix == null) return null;

-        CTLineStyleList lineStyles = styleMatrix.getLnStyleLst();

-        if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) return null;

-

-        return lineStyles.getLnArray(idx - 1);

-    }

-

-    /**

-    * @param color  the color to paint the shape outline.

-     * A <code>null</code> value turns off the shape outline.

-     */

-    public void setLineColor(Color color) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-

-        if (ln.isSetSolidFill()) {

-            ln.unsetSolidFill();

-        }

-        if (ln.isSetGradFill()) {

-            ln.unsetGradFill();

-        }

-        if (ln.isSetPattFill()) {

-            ln.unsetPattFill();

-        }

-        if (ln.isSetNoFill()) {

-            ln.unsetNoFill();

-        }

-

-        

-        if (color == null) {

-            ln.addNewNoFill();

-        } else {

-            CTSolidColorFillProperties fill = ln.addNewSolidFill();

-            XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr());

-            col.setColor(color);

-        }

-    }

-

-    /**

-     *

-     * @return the color of the shape outline or <code>null</code>

-     * if outline is turned off

-     */

-    public Color getLineColor() {

-        PaintStyle ps = getLinePaint();

-        if (ps instanceof SolidPaint) {

-            return ((SolidPaint)ps).getSolidColor().getColor();

-        }

-        return null;

-    }

-

-    protected PaintStyle getLinePaint() {

-        XSLFSheet sheet = getSheet();

-        final XSLFTheme theme = sheet.getTheme();

-        PropertyFetcher<PaintStyle> fetcher = new PropertyFetcher<PaintStyle>() {

-            public boolean fetch(XSLFShape shape) {

-                CTLineProperties spPr = getLn(shape, false);

-                XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr);

-                PackagePart pp = shape.getSheet().getPackagePart();

-                PaintStyle paint = selectPaint(fp, null, pp, theme);

-                if (paint != null) {

-                    setValue(paint);

-                    return true;

-                }

-

-                CTShapeStyle style = shape.getSpStyle();

-                if (style != null) {

-                    fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef());

-                    paint = selectPaint(fp, null, pp, theme);

-                }

-                if (paint != null) {

-                    setValue(paint);

-                    return true;

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        PaintStyle paint = fetcher.getValue();

-        if (paint != null) return paint;

-

-        // line color was not found, check if it is defined in the theme

-        CTShapeStyle style = getSpStyle();

-        if (style == null) return null;

-

-        // get a reference to a line style within the style matrix.

-        CTStyleMatrixReference lnRef = style.getLnRef();

-        int idx = (int)lnRef.getIdx();

-        CTSchemeColor phClr = lnRef.getSchemeClr();

-        if(idx > 0){

-            CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1);

-            XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props);

-            PackagePart pp = sheet.getPackagePart();

-            paint = selectPaint(fp, phClr, pp, theme);

-        }

-

-        return paint;

-    }

-

-    /**

-     *

-     * @param width line width in points. <code>0</code> means no line

-     */

-    public void setLineWidth(double width) {

-        CTLineProperties lnPr = getLn(this, true);

-        if (lnPr == null) {

-            return;

-        }

-        

-        if (width == 0.) {

-            if (lnPr.isSetW()) {

-                lnPr.unsetW();

-            }

-            if (!lnPr.isSetNoFill()) {

-                lnPr.addNewNoFill();

-            }

-            if (lnPr.isSetSolidFill()) {

-                lnPr.unsetSolidFill();

-            }

-            if (lnPr.isSetGradFill()) {

-                lnPr.unsetGradFill();

-            }

-            if (lnPr.isSetPattFill()) {

-                lnPr.unsetPattFill();

-            }

-        } else {

-            if (lnPr.isSetNoFill()) {

-                lnPr.unsetNoFill();

-            }

-

-            lnPr.setW(Units.toEMU(width));

-        }

-    }

-

-    /**

-     * @return line width in points. <code>0</code> means no line.

-     */

-    public double getLineWidth() {

-        PropertyFetcher<Double> fetcher = new PropertyFetcher<Double>() {

-            public boolean fetch(XSLFShape shape) {

-                CTLineProperties ln = getLn(shape, false);

-                if (ln != null) {

-                    if (ln.isSetNoFill()) {

-                        setValue(0.);

-                        return true;

-                    }

-

-                    if (ln.isSetW()) {

-                        setValue(Units.toPoints(ln.getW()));

-                        return true;

-                    }

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        double lineWidth = 0;

-        if (fetcher.getValue() == null) {

-            CTLineProperties defaultLn = getDefaultLineProperties();

-            if (defaultLn != null) {

-                if (defaultLn.isSetW()) lineWidth = Units.toPoints(defaultLn.getW());

-            }

-        } else {

-            lineWidth = fetcher.getValue();

-        }

-

-        return lineWidth;

-    }

-

-

-    /**

-     * @param compound set the line compound style

-     */

-    public void setLineCompound(LineCompound compound) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        if (compound == null) {

-            if (ln.isSetCmpd()) {

-                ln.unsetCmpd();

-            }

-        } else {

-            STCompoundLine.Enum xCmpd;

-            switch (compound) {

-                default:

-                case SINGLE:

-                    xCmpd = STCompoundLine.SNG;

-                    break;

-                case DOUBLE:

-                    xCmpd = STCompoundLine.DBL;

-                    break;

-                case THICK_THIN:

-                    xCmpd = STCompoundLine.THICK_THIN;

-                    break;

-                case THIN_THICK:

-                    xCmpd = STCompoundLine.THIN_THICK;

-                    break;

-                case TRIPLE:

-                    xCmpd = STCompoundLine.TRI;

-                    break;

-            }

-            ln.setCmpd(xCmpd);

-        }

-    }

-

-    /**

-     * @return the line compound

-     */

-    public LineCompound getLineCompound() {

-        PropertyFetcher<Integer> fetcher = new PropertyFetcher<Integer>() {

-            public boolean fetch(XSLFShape shape) {

-                CTLineProperties ln = getLn(shape, false);

-                if (ln != null) {

-                    STCompoundLine.Enum stCmpd = ln.getCmpd();

-                    if (stCmpd != null) {

-                        setValue(stCmpd.intValue());

-                        return true;

-                    }

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        Integer cmpd = fetcher.getValue();

-        if (cmpd == null) {

-            CTLineProperties defaultLn = getDefaultLineProperties();

-            if (defaultLn != null && defaultLn.isSetCmpd()) {

-                switch (defaultLn.getCmpd().intValue()) {

-                default:

-                case STCompoundLine.INT_SNG:

-                    return LineCompound.SINGLE;

-                case STCompoundLine.INT_DBL:

-                    return LineCompound.DOUBLE;

-                case STCompoundLine.INT_THICK_THIN:

-                    return LineCompound.THICK_THIN;

-                case STCompoundLine.INT_THIN_THICK:

-                    return LineCompound.THIN_THICK;

-                case STCompoundLine.INT_TRI:

-                    return LineCompound.TRIPLE;

-                }

-            }

-        }

-

-        return null;

-    }

-

-    /**

-     *

-     * @param dash a preset line dashing scheme to stroke thr shape outline

-     */

-    public void setLineDash(LineDash dash) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        if (dash == null) {

-            if (ln.isSetPrstDash()) {

-                ln.unsetPrstDash();

-            }

-        } else {

-            CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash();

-            ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId));

-        }

-    }

-

-    /**

-     * @return  a preset line dashing scheme to stroke the shape outline

-     */

-    public LineDash getLineDash() {

-

-        PropertyFetcher<LineDash> fetcher = new PropertyFetcher<LineDash>() {

-            public boolean fetch(XSLFShape shape) {

-                CTLineProperties ln = getLn(shape, false);

-                if (ln == null || !ln.isSetPrstDash()) {

-                    return false;

-                }

-

-                setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue()));

-                return true;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        LineDash dash = fetcher.getValue();

-        if (dash == null) {

-            CTLineProperties defaultLn = getDefaultLineProperties();

-            if (defaultLn != null && defaultLn.isSetPrstDash()) {

-                dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue());

-            }

-        }

-        return dash;

-    }

-

-    /**

-     *

-     * @param cap the line end cap style

-     */

-    public void setLineCap(LineCap cap) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        

-        if (cap == null) {

-            if (ln.isSetCap()) {

-                ln.unsetCap();

-            }

-        } else {

-            ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId));

-        }

-    }

-

-    /**

-     *

-     * @return the line end cap style

-     */

-    public LineCap getLineCap() {

-        PropertyFetcher<LineCap> fetcher = new PropertyFetcher<LineCap>() {

-            public boolean fetch(XSLFShape shape) {

-                CTLineProperties ln = getLn(shape, false);

-                if (ln != null && ln.isSetCap()) {

-                    setValue(LineCap.fromOoxmlId(ln.getCap().intValue()));

-                    return true;

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        LineCap cap = fetcher.getValue();

-        if (cap == null) {

-            CTLineProperties defaultLn = getDefaultLineProperties();

-            if (defaultLn != null && defaultLn.isSetCap()) {

-                cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue());

-            }

-        }

-        return cap;

-    }

-

-    @Override

-    public void setFillColor(Color color) {

-        XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties());

-        if (fp == null) {

-            return;

-        }

-        if (color == null) {

-            if (fp.isSetSolidFill()) {

-                fp.unsetSolidFill();

-            }

-            

-            if (fp.isSetGradFill()) {

-                fp.unsetGradFill();

-            }

-

-            if (fp.isSetPattFill()) {

-                fp.unsetGradFill();

-            }

-            

-            if (fp.isSetBlipFill()) {

-                fp.unsetBlipFill();

-            }

-            

-            if (!fp.isSetNoFill()) {

-                fp.addNewNoFill();

-            }

-        } else {

-            if (fp.isSetNoFill()) {

-                fp.unsetNoFill();

-            }

-

-            CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill();

-                    

-            XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr());

-            col.setColor(color);

-        }

-    }

-

-    @Override

-    public Color getFillColor() {

-        PaintStyle ps = getFillPaint();

-        if (ps instanceof SolidPaint) {

-            return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor());

-        }

-        return null;

-    }

-

-    /**

-     * @return shadow of this shape or null if shadow is disabled

-     */

-    public XSLFShadow getShadow() {

-        PropertyFetcher<CTOuterShadowEffect> fetcher = new PropertyFetcher<CTOuterShadowEffect>() {

-            public boolean fetch(XSLFShape shape) {

-                XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties());

-                if (ep != null && ep.isSetEffectLst()) {

-                    CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw();

-                    setValue(obj == null ? NO_SHADOW : obj);

-                    return true;

-                }

-                return false;

-            }

-        };

-        fetchShapeProperty(fetcher);

-

-        CTOuterShadowEffect obj = fetcher.getValue();

-        if (obj == null) {

-            // fill color was not found, check if it is defined in the theme

-            CTShapeStyle style = getSpStyle();

-            if (style != null && style.getEffectRef() != null) {

-                // 1-based index of a shadow style within the style matrix

-                int idx = (int) style.getEffectRef().getIdx();

-                if(idx != 0) {

-                    CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme();

-                    CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1);

-                    obj = ef.getEffectLst().getOuterShdw();

-                }

-            }

-        }

-        return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this);

-    }

-

-    /**

-     *

-     * @return definition of the shape geometry

-     */

-    public CustomGeometry getGeometry() {

-        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());

-        

-        if (gp == null) {

-            return null;

-        }

-        

-        CustomGeometry geom;

-        PresetGeometries dict = PresetGeometries.getInstance();

-        if(gp.isSetPrstGeom()){

-            String name = gp.getPrstGeom().getPrst().toString();

-            geom = dict.get(name);

-            if(geom == null) {

-                throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet());

-            }

-        } else if (gp.isSetCustGeom()){

-            XMLStreamReader staxReader = gp.getCustGeom().newXMLStreamReader();

-            geom = PresetGeometries.convertCustomGeometry(staxReader);

+/*
+ *  ====================================================================
+ *    Licensed to the Apache Software Foundation (ASF) under one or more
+ *    contributor license agreements.  See the NOTICE file distributed with
+ *    this work for additional information regarding copyright ownership.
+ *    The ASF licenses this file to You under the Apache License, Version 2.0
+ *    (the "License"); you may not use this file except in compliance with
+ *    the License.  You may obtain a copy of the License at
+ *
+ *        http://www.apache.org/licenses/LICENSE-2.0
+ *
+ *    Unless required by applicable law or agreed to in writing, software
+ *    distributed under the License is distributed on an "AS IS" BASIS,
+ *    WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ *    See the License for the specific language governing permissions and
+ *    limitations under the License.
+ * ====================================================================
+ */
+
+package org.apache.poi.xslf.usermodel;
+
+import java.awt.Color;
+import java.awt.geom.Rectangle2D;
+
+import javax.xml.stream.XMLStreamException;
+import javax.xml.stream.XMLStreamReader;
+
+import org.apache.poi.openxml4j.opc.PackagePart;
+import org.apache.poi.sl.draw.DrawPaint;
+import org.apache.poi.sl.draw.geom.CustomGeometry;
+import org.apache.poi.sl.draw.geom.Guide;
+import org.apache.poi.sl.draw.geom.PresetGeometries;
+import org.apache.poi.sl.usermodel.FillStyle;
+import org.apache.poi.sl.usermodel.LineDecoration;
+import org.apache.poi.sl.usermodel.LineDecoration.DecorationShape;
+import org.apache.poi.sl.usermodel.LineDecoration.DecorationSize;
+import org.apache.poi.sl.usermodel.PaintStyle;
+import org.apache.poi.sl.usermodel.PaintStyle.SolidPaint;
+import org.apache.poi.sl.usermodel.Placeholder;
+import org.apache.poi.sl.usermodel.ShapeType;
+import org.apache.poi.sl.usermodel.SimpleShape;
+import org.apache.poi.sl.usermodel.StrokeStyle;
+import org.apache.poi.sl.usermodel.StrokeStyle.LineCap;
+import org.apache.poi.sl.usermodel.StrokeStyle.LineCompound;
+import org.apache.poi.sl.usermodel.StrokeStyle.LineDash;
+import org.apache.poi.util.Beta;
+import org.apache.poi.util.POILogFactory;
+import org.apache.poi.util.POILogger;
+import org.apache.poi.util.Units;
+import org.apache.poi.xslf.model.PropertyFetcher;
+import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFEffectProperties;
+import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFFillProperties;
+import org.apache.poi.xslf.usermodel.XSLFPropertiesDelegate.XSLFGeometryProperties;
+import org.apache.xmlbeans.XmlObject;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTBaseStyles;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTBlip;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTEffectStyleItem;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTGeomGuide;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTLineEndProperties;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTLineProperties;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTLineStyleList;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTNonVisualDrawingProps;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTOuterShadowEffect;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTPoint2D;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTPositiveSize2D;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetGeometry2D;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTPresetLineDashProperties;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTSchemeColor;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeProperties;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTShapeStyle;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTSolidColorFillProperties;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrix;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTStyleMatrixReference;
+import org.openxmlformats.schemas.drawingml.x2006.main.CTTransform2D;
+import org.openxmlformats.schemas.drawingml.x2006.main.STCompoundLine;
+import org.openxmlformats.schemas.drawingml.x2006.main.STLineCap;
+import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndLength;
+import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndType;
+import org.openxmlformats.schemas.drawingml.x2006.main.STLineEndWidth;
+import org.openxmlformats.schemas.drawingml.x2006.main.STPresetLineDashVal;
+import org.openxmlformats.schemas.drawingml.x2006.main.STShapeType;
+import org.openxmlformats.schemas.presentationml.x2006.main.CTPlaceholder;
+
+/**
+ * Represents a single (non-group) shape in a .pptx slide show
+ */
+@Beta
+public abstract class XSLFSimpleShape extends XSLFShape
+    implements SimpleShape<XSLFShape,XSLFTextParagraph> {
+    private static CTOuterShadowEffect NO_SHADOW = CTOuterShadowEffect.Factory.newInstance();
+    private static final POILogger LOG = POILogFactory.getLogger(XSLFSimpleShape.class);
+
+    /* package */XSLFSimpleShape(XmlObject shape, XSLFSheet sheet) {
+        super(shape,sheet);
+    }
+
+    @Override
+    public void setShapeType(ShapeType type) {
+        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());
+        if (gp == null) {
+            return;
+        }
+        if (gp.isSetCustGeom()) {
+            gp.unsetCustGeom();
+        }
+        CTPresetGeometry2D prst = (gp.isSetPrstGeom()) ? gp.getPrstGeom() : gp.addNewPrstGeom();
+        prst.setPrst(STShapeType.Enum.forInt(type.ooxmlId));
+    }
+
+    @Override
+    public ShapeType getShapeType(){
+        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());
+        if (gp != null && gp.isSetPrstGeom()) {
+            STShapeType.Enum geom = gp.getPrstGeom().getPrst();
+            if (geom != null) {
+                return ShapeType.forId(geom.intValue(), true);
+            }
+        }
+        return null;
+    }
+
+    protected CTTransform2D getXfrm(boolean create) {
+        PropertyFetcher<CTTransform2D> fetcher = new PropertyFetcher<CTTransform2D>() {
+            public boolean fetch(XSLFShape shape) {
+                XmlObject xo = shape.getShapeProperties();
+                if (xo instanceof CTShapeProperties && ((CTShapeProperties)xo).isSetXfrm()) {
+                    setValue(((CTShapeProperties)xo).getXfrm());
+                    return true;
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+        
+        CTTransform2D xfrm = fetcher.getValue();
+        if (!create || xfrm != null) {
+            return xfrm;
+        } else {
+            XmlObject xo = getShapeProperties();
+            if (xo instanceof CTShapeProperties) {
+                return ((CTShapeProperties)xo).addNewXfrm();
+            } else {
+                // ... group shapes have their own getXfrm()
+                LOG.log(POILogger.WARN, getClass().toString()+" doesn't have xfrm element.");
+                return null;
+            }
+        }
+    }
+
+    @Override
+    public Rectangle2D getAnchor() {
+
+        CTTransform2D xfrm = getXfrm(false);
+        if (xfrm == null) {
+            return null;
+        }
+
+        CTPoint2D off = xfrm.getOff();
+        double x = Units.toPoints(off.getX());
+        double y = Units.toPoints(off.getY());
+        CTPositiveSize2D ext = xfrm.getExt();
+        double cx = Units.toPoints(ext.getCx());
+        double cy = Units.toPoints(ext.getCy());
+        return new Rectangle2D.Double(x, y, cx, cy);
+    }
+
+    @Override
+    public void setAnchor(Rectangle2D anchor) {
+        CTTransform2D xfrm = getXfrm(true);
+        if (xfrm == null) {
+            return;
+        }
+        CTPoint2D off = xfrm.isSetOff() ? xfrm.getOff() : xfrm.addNewOff();
+        long x = Units.toEMU(anchor.getX());
+        long y = Units.toEMU(anchor.getY());
+        off.setX(x);
+        off.setY(y);
+        CTPositiveSize2D ext = xfrm.isSetExt() ? xfrm.getExt() : xfrm
+                .addNewExt();
+        long cx = Units.toEMU(anchor.getWidth());
+        long cy = Units.toEMU(anchor.getHeight());
+        ext.setCx(cx);
+        ext.setCy(cy);
+    }
+
+    @Override
+    public void setRotation(double theta) {
+        CTTransform2D xfrm = getXfrm(true);
+        if (xfrm != null) {
+            xfrm.setRot((int) (theta * 60000));
+        }
+    }
+
+    @Override
+    public double getRotation() {
+        CTTransform2D xfrm = getXfrm(false);
+        return (xfrm == null || !xfrm.isSetRot()) ? 0 : (xfrm.getRot() / 60000.d);
+    }
+
+    @Override
+    public void setFlipHorizontal(boolean flip) {
+        CTTransform2D xfrm = getXfrm(true);
+        if (xfrm != null) {
+            xfrm.setFlipH(flip);
+        }
+    }
+
+    @Override
+    public void setFlipVertical(boolean flip) {
+        CTTransform2D xfrm = getXfrm(true);
+        if (xfrm != null) {
+            xfrm.setFlipV(flip);
+        }
+    }
+
+    @Override
+    public boolean getFlipHorizontal() {
+        CTTransform2D xfrm = getXfrm(false);
+        return (xfrm == null || !xfrm.isSetFlipH()) ? false : xfrm.getFlipH();
+    }
+
+    @Override
+    public boolean getFlipVertical() {
+        CTTransform2D xfrm = getXfrm(false);
+        return (xfrm == null || !xfrm.isSetFlipV()) ? false : xfrm.getFlipV();
+    }
+
+
+    /**
+     * Get default line properties defined in the theme (if any).
+     * Used internally to resolve shape properties.
+     *
+     * @return line properties from the theme of null
+     */
+    CTLineProperties getDefaultLineProperties() {
+        CTShapeStyle style = getSpStyle();
+        if (style == null) return null;
+        CTStyleMatrixReference lnRef = style.getLnRef();
+        if (lnRef == null) return null;
+        // 1-based index of a line style within the style matrix
+        int idx = (int)lnRef.getIdx();
+
+        XSLFTheme theme = getSheet().getTheme();
+        if (theme == null) return null;
+        CTBaseStyles styles = theme.getXmlObject().getThemeElements();
+        if (styles == null) return null;
+        CTStyleMatrix styleMatrix = styles.getFmtScheme();
+        if (styleMatrix == null) return null;
+        CTLineStyleList lineStyles = styleMatrix.getLnStyleLst();
+        if (lineStyles == null || lineStyles.sizeOfLnArray() < idx) return null;
+
+        return lineStyles.getLnArray(idx - 1);
+    }
+
+    /**
+    * @param color  the color to paint the shape outline.
+     * A <code>null</code> value turns off the shape outline.
+     */
+    public void setLineColor(Color color) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+
+        if (ln.isSetSolidFill()) {
+            ln.unsetSolidFill();
+        }
+        if (ln.isSetGradFill()) {
+            ln.unsetGradFill();
+        }
+        if (ln.isSetPattFill()) {
+            ln.unsetPattFill();
+        }
+        if (ln.isSetNoFill()) {
+            ln.unsetNoFill();
+        }
+
+        
+        if (color == null) {
+            ln.addNewNoFill();
+        } else {
+            CTSolidColorFillProperties fill = ln.addNewSolidFill();
+            XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr());
+            col.setColor(color);
+        }
+    }
+
+    /**
+     *
+     * @return the color of the shape outline or <code>null</code>
+     * if outline is turned off
+     */
+    public Color getLineColor() {
+        PaintStyle ps = getLinePaint();
+        if (ps instanceof SolidPaint) {
+            return ((SolidPaint)ps).getSolidColor().getColor();
+        }
+        return null;
+    }
+
+    protected PaintStyle getLinePaint() {
+        XSLFSheet sheet = getSheet();
+        final XSLFTheme theme = sheet.getTheme();
+        PropertyFetcher<PaintStyle> fetcher = new PropertyFetcher<PaintStyle>() {
+            public boolean fetch(XSLFShape shape) {
+                CTLineProperties spPr = getLn(shape, false);
+                XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(spPr);
+                PackagePart pp = shape.getSheet().getPackagePart();
+                PaintStyle paint = selectPaint(fp, null, pp, theme);
+                if (paint != null) {
+                    setValue(paint);
+                    return true;
+                }
+
+                CTShapeStyle style = shape.getSpStyle();
+                if (style != null) {
+                    fp = XSLFPropertiesDelegate.getFillDelegate(style.getLnRef());
+                    paint = selectPaint(fp, null, pp, theme);
+                }
+                if (paint != null) {
+                    setValue(paint);
+                    return true;
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        PaintStyle paint = fetcher.getValue();
+        if (paint != null) return paint;
+
+        // line color was not found, check if it is defined in the theme
+        CTShapeStyle style = getSpStyle();
+        if (style == null) return null;
+
+        // get a reference to a line style within the style matrix.
+        CTStyleMatrixReference lnRef = style.getLnRef();
+        int idx = (int)lnRef.getIdx();
+        CTSchemeColor phClr = lnRef.getSchemeClr();
+        if(idx > 0){
+            CTLineProperties props = theme.getXmlObject().getThemeElements().getFmtScheme().getLnStyleLst().getLnArray(idx - 1);
+            XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(props);
+            PackagePart pp = sheet.getPackagePart();
+            paint = selectPaint(fp, phClr, pp, theme);
+        }
+
+        return paint;
+    }
+
+    /**
+     *
+     * @param width line width in points. <code>0</code> means no line
+     */
+    public void setLineWidth(double width) {
+        CTLineProperties lnPr = getLn(this, true);
+        if (lnPr == null) {
+            return;
+        }
+        
+        if (width == 0.) {
+            if (lnPr.isSetW()) {
+                lnPr.unsetW();
+            }
+            if (!lnPr.isSetNoFill()) {
+                lnPr.addNewNoFill();
+            }
+            if (lnPr.isSetSolidFill()) {
+                lnPr.unsetSolidFill();
+            }
+            if (lnPr.isSetGradFill()) {
+                lnPr.unsetGradFill();
+            }
+            if (lnPr.isSetPattFill()) {
+                lnPr.unsetPattFill();
+            }
+        } else {
+            if (lnPr.isSetNoFill()) {
+                lnPr.unsetNoFill();
+            }
+
+            lnPr.setW(Units.toEMU(width));
+        }
+    }
+
+    /**
+     * @return line width in points. <code>0</code> means no line.
+     */
+    public double getLineWidth() {
+        PropertyFetcher<Double> fetcher = new PropertyFetcher<Double>() {
+            public boolean fetch(XSLFShape shape) {
+                CTLineProperties ln = getLn(shape, false);
+                if (ln != null) {
+                    if (ln.isSetNoFill()) {
+                        setValue(0.);
+                        return true;
+                    }
+
+                    if (ln.isSetW()) {
+                        setValue(Units.toPoints(ln.getW()));
+                        return true;
+                    }
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        double lineWidth = 0;
+        if (fetcher.getValue() == null) {
+            CTLineProperties defaultLn = getDefaultLineProperties();
+            if (defaultLn != null) {
+                if (defaultLn.isSetW()) lineWidth = Units.toPoints(defaultLn.getW());
+            }
+        } else {
+            lineWidth = fetcher.getValue();
+        }
+
+        return lineWidth;
+    }
+
+
+    /**
+     * @param compound set the line compound style
+     */
+    public void setLineCompound(LineCompound compound) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        if (compound == null) {
+            if (ln.isSetCmpd()) {
+                ln.unsetCmpd();
+            }
+        } else {
+            STCompoundLine.Enum xCmpd;
+            switch (compound) {
+                default:
+                case SINGLE:
+                    xCmpd = STCompoundLine.SNG;
+                    break;
+                case DOUBLE:
+                    xCmpd = STCompoundLine.DBL;
+                    break;
+                case THICK_THIN:
+                    xCmpd = STCompoundLine.THICK_THIN;
+                    break;
+                case THIN_THICK:
+                    xCmpd = STCompoundLine.THIN_THICK;
+                    break;
+                case TRIPLE:
+                    xCmpd = STCompoundLine.TRI;
+                    break;
+            }
+            ln.setCmpd(xCmpd);
+        }
+    }
+
+    /**
+     * @return the line compound
+     */
+    public LineCompound getLineCompound() {
+        PropertyFetcher<Integer> fetcher = new PropertyFetcher<Integer>() {
+            public boolean fetch(XSLFShape shape) {
+                CTLineProperties ln = getLn(shape, false);
+                if (ln != null) {
+                    STCompoundLine.Enum stCmpd = ln.getCmpd();
+                    if (stCmpd != null) {
+                        setValue(stCmpd.intValue());
+                        return true;
+                    }
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        Integer cmpd = fetcher.getValue();
+        if (cmpd == null) {
+            CTLineProperties defaultLn = getDefaultLineProperties();
+            if (defaultLn != null && defaultLn.isSetCmpd()) {
+                switch (defaultLn.getCmpd().intValue()) {
+                default:
+                case STCompoundLine.INT_SNG:
+                    return LineCompound.SINGLE;
+                case STCompoundLine.INT_DBL:
+                    return LineCompound.DOUBLE;
+                case STCompoundLine.INT_THICK_THIN:
+                    return LineCompound.THICK_THIN;
+                case STCompoundLine.INT_THIN_THICK:
+                    return LineCompound.THIN_THICK;
+                case STCompoundLine.INT_TRI:
+                    return LineCompound.TRIPLE;
+                }
+            }
+        }
+
+        return null;
+    }
+
+    /**
+     *
+     * @param dash a preset line dashing scheme to stroke thr shape outline
+     */
+    public void setLineDash(LineDash dash) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        if (dash == null) {
+            if (ln.isSetPrstDash()) {
+                ln.unsetPrstDash();
+            }
+        } else {
+            CTPresetLineDashProperties ldp = ln.isSetPrstDash() ? ln.getPrstDash() : ln.addNewPrstDash();
+            ldp.setVal(STPresetLineDashVal.Enum.forInt(dash.ooxmlId));
+        }
+    }
+
+    /**
+     * @return  a preset line dashing scheme to stroke the shape outline
+     */
+    public LineDash getLineDash() {
+
+        PropertyFetcher<LineDash> fetcher = new PropertyFetcher<LineDash>() {
+            public boolean fetch(XSLFShape shape) {
+                CTLineProperties ln = getLn(shape, false);
+                if (ln == null || !ln.isSetPrstDash()) {
+                    return false;
+                }
+
+                setValue(LineDash.fromOoxmlId(ln.getPrstDash().getVal().intValue()));
+                return true;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        LineDash dash = fetcher.getValue();
+        if (dash == null) {
+            CTLineProperties defaultLn = getDefaultLineProperties();
+            if (defaultLn != null && defaultLn.isSetPrstDash()) {
+                dash = LineDash.fromOoxmlId(defaultLn.getPrstDash().getVal().intValue());
+            }
+        }
+        return dash;
+    }
+
+    /**
+     *
+     * @param cap the line end cap style
+     */
+    public void setLineCap(LineCap cap) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        
+        if (cap == null) {
+            if (ln.isSetCap()) {
+                ln.unsetCap();
+            }
+        } else {
+            ln.setCap(STLineCap.Enum.forInt(cap.ooxmlId));
+        }
+    }
+
+    /**
+     *
+     * @return the line end cap style
+     */
+    public LineCap getLineCap() {
+        PropertyFetcher<LineCap> fetcher = new PropertyFetcher<LineCap>() {
+            public boolean fetch(XSLFShape shape) {
+                CTLineProperties ln = getLn(shape, false);
+                if (ln != null && ln.isSetCap()) {
+                    setValue(LineCap.fromOoxmlId(ln.getCap().intValue()));
+                    return true;
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        LineCap cap = fetcher.getValue();
+        if (cap == null) {
+            CTLineProperties defaultLn = getDefaultLineProperties();
+            if (defaultLn != null && defaultLn.isSetCap()) {
+                cap = LineCap.fromOoxmlId(defaultLn.getCap().intValue());
+            }
+        }
+        return cap;
+    }
+
+    @Override
+    public void setFillColor(Color color) {
+        XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties());
+        if (fp == null) {
+            return;
+        }
+        if (color == null) {
+            if (fp.isSetSolidFill()) {
+                fp.unsetSolidFill();
+            }
+            
+            if (fp.isSetGradFill()) {
+                fp.unsetGradFill();
+            }
+
+            if (fp.isSetPattFill()) {
+                fp.unsetGradFill();
+            }
+            
+            if (fp.isSetBlipFill()) {
+                fp.unsetBlipFill();
+            }
+            
+            if (!fp.isSetNoFill()) {
+                fp.addNewNoFill();
+            }
+        } else {
+            if (fp.isSetNoFill()) {
+                fp.unsetNoFill();
+            }
+
+            CTSolidColorFillProperties fill = fp.isSetSolidFill() ? fp.getSolidFill() : fp.addNewSolidFill();
+                    
+            XSLFColor col = new XSLFColor(fill, getSheet().getTheme(), fill.getSchemeClr());
+            col.setColor(color);
+        }
+    }
+
+    @Override
+    public Color getFillColor() {
+        PaintStyle ps = getFillPaint();
+        if (ps instanceof SolidPaint) {
+            return DrawPaint.applyColorTransform(((SolidPaint)ps).getSolidColor());
+        }
+        return null;
+    }
+
+    /**
+     * @return shadow of this shape or null if shadow is disabled
+     */
+    public XSLFShadow getShadow() {
+        PropertyFetcher<CTOuterShadowEffect> fetcher = new PropertyFetcher<CTOuterShadowEffect>() {
+            public boolean fetch(XSLFShape shape) {
+                XSLFEffectProperties ep = XSLFPropertiesDelegate.getEffectDelegate(shape.getShapeProperties());
+                if (ep != null && ep.isSetEffectLst()) {
+                    CTOuterShadowEffect obj = ep.getEffectLst().getOuterShdw();
+                    setValue(obj == null ? NO_SHADOW : obj);
+                    return true;
+                }
+                return false;
+            }
+        };
+        fetchShapeProperty(fetcher);
+
+        CTOuterShadowEffect obj = fetcher.getValue();
+        if (obj == null) {
+            // fill color was not found, check if it is defined in the theme
+            CTShapeStyle style = getSpStyle();
+            if (style != null && style.getEffectRef() != null) {
+                // 1-based index of a shadow style within the style matrix
+                int idx = (int) style.getEffectRef().getIdx();
+                if(idx != 0) {
+                    CTStyleMatrix styleMatrix = getSheet().getTheme().getXmlObject().getThemeElements().getFmtScheme();
+                    CTEffectStyleItem ef = styleMatrix.getEffectStyleLst().getEffectStyleArray(idx - 1);
+                    obj = ef.getEffectLst().getOuterShdw();
+                }
+            }
+        }
+        return (obj == null || obj == NO_SHADOW) ? null : new XSLFShadow(obj, this);
+    }
+
+    /**
+     *
+     * @return definition of the shape geometry
+     */
+    public CustomGeometry getGeometry() {
+        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());
+        
+        if (gp == null) {
+            return null;
+        }
+        
+        CustomGeometry geom;
+        PresetGeometries dict = PresetGeometries.getInstance();
+        if(gp.isSetPrstGeom()){
+            String name = gp.getPrstGeom().getPrst().toString();
+            geom = dict.get(name);
+            if(geom == null) {
+                throw new IllegalStateException("Unknown shape geometry: " + name + ", available geometries are: " + dict.keySet());
+            }
+        } else if (gp.isSetCustGeom()){
+            XMLStreamReader staxReader = gp.getCustGeom().newXMLStreamReader();
+            geom = PresetGeometries.convertCustomGeometry(staxReader);
             try {
                 staxReader.close();
-            }

+            }
             catch (XMLStreamException e) {
                 LOG.log(POILogger.WARN,
                         "An error occurred while closing a Custom Geometry XML Stream Reader: " + e.getMessage());
-            }

-        } else {

-            geom = dict.get("rect");

-        }

-        return geom;

-    }

-

-    @Override

-    void copy(XSLFShape sh){

-        super.copy(sh);

-

-        XSLFSimpleShape s = (XSLFSimpleShape)sh;

-

-        Color srsSolidFill = s.getFillColor();

-        Color tgtSoliFill = getFillColor();

-        if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){

-            setFillColor(srsSolidFill);

-        }

-

-        XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties());

-        if(fp != null && fp.isSetBlipFill()){

-            CTBlip blip = fp.getBlipFill().getBlip();

-            String blipId = blip.getEmbed();

-

-            String relId = getSheet().importBlip(blipId, s.getSheet().getPackagePart());

-            blip.setEmbed(relId);

-        }

-

-        Color srcLineColor = s.getLineColor();

-        Color tgtLineColor = getLineColor();

-        if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) {

-            setLineColor(srcLineColor);

-        }

-

-        double srcLineWidth = s.getLineWidth();

-        double tgtLineWidth = getLineWidth();

-        if(srcLineWidth != tgtLineWidth) {

-            setLineWidth(srcLineWidth);

-        }

-

-        LineDash srcLineDash = s.getLineDash();

-        LineDash tgtLineDash = getLineDash();

-        if(srcLineDash != null && srcLineDash != tgtLineDash) {

-            setLineDash(srcLineDash);

-        }

-

-        LineCap srcLineCap = s.getLineCap();

-        LineCap tgtLineCap = getLineCap();

-        if(srcLineCap != null && srcLineCap != tgtLineCap) {

-            setLineCap(srcLineCap);

-        }

-

-    }

-

-    /**

-     * Specifies the line end decoration, such as a triangle or arrowhead.

-     * 

-     * @param style the line end docoration style

-     */

-    public void setLineHeadDecoration(DecorationShape style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();

-        if (style == null) {

-            if (lnEnd.isSetType()) {

-                lnEnd.unsetType();

-            }

-        } else {

-            lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration shape

-     */

-    public DecorationShape getLineHeadDecoration() {

-        CTLineProperties ln = getLn(this, false);

-        DecorationShape ds = DecorationShape.NONE;

-        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) {

-            ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue());

-        }

-        return ds;

-    }

-

-    /**

-     * specifies decoration width of the head of a line.

-     * 

-     * @param style the decoration width 

-     */

-    public void setLineHeadWidth(DecorationSize style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();

-        if (style == null) {

-            if (lnEnd.isSetW()) {

-                lnEnd.unsetW();

-            }

-        } else {

-            lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration width

-     */

-    public DecorationSize getLineHeadWidth() {

-        CTLineProperties ln = getLn(this, false);

-        DecorationSize ds = DecorationSize.MEDIUM;

-        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) {

-            ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue());

-        }

-        return ds;

-    }

-

-    /**

-     * Specifies the line end width in relation to the line width.

-     */

-    public void setLineHeadLength(DecorationSize style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        

-        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();

-        if (style == null) {

-            if (lnEnd.isSetLen()) {

-                lnEnd.unsetLen();

-            }

-        } else {

-            lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration length

-     */

-    public DecorationSize getLineHeadLength() {

-        CTLineProperties ln = getLn(this, false);

-        

-        DecorationSize ds = DecorationSize.MEDIUM;

-        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) {

-            ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue());

-        }

-        return ds; 

-    }

-

-    /**

-     * Specifies the line end decoration, such as a triangle or arrowhead.

-     */

-    public void setLineTailDecoration(DecorationShape style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-

-        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();

-        if (style == null) {

-            if (lnEnd.isSetType()) {

-                lnEnd.unsetType();

-            }

-        } else {

-            lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration shape

-     */

-    public DecorationShape getLineTailDecoration() {

-        CTLineProperties ln = getLn(this, false);

-        

-        DecorationShape ds = DecorationShape.NONE;

-        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) {

-            ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue());

-        }

-        return ds;

-    }

-

-    /**

-     * specifies decorations which can be added to the tail of a line.

-     */

-    public void setLineTailWidth(DecorationSize style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        

-        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();

-        if (style == null) {

-            if (lnEnd.isSetW()) {

-                lnEnd.unsetW();

-            }

-        } else {

-            lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration width

-     */

-    public DecorationSize getLineTailWidth() {

-        CTLineProperties ln = getLn(this, false);

-        DecorationSize ds = DecorationSize.MEDIUM;

-        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) {

-            ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue());

-        }

-        return ds;

-    }

-

-    /**

-     * Specifies the line end width in relation to the line width.

-     */

-    public void setLineTailLength(DecorationSize style) {

-        CTLineProperties ln = getLn(this, true);

-        if (ln == null) {

-            return;

-        }

-        

-        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();

-        if (style == null) {

-            if (lnEnd.isSetLen()) {

-                lnEnd.unsetLen();

-            }

-        } else {

-            lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId));

-        }

-    }

-

-    /**

-     * @return the line end decoration length

-     */

-    public DecorationSize getLineTailLength() {

-        CTLineProperties ln = getLn(this, false);

-        

-        DecorationSize ds = DecorationSize.MEDIUM;

-        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) {

-            ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue());

-        }

-        return ds; 

-    }

-

-    public boolean isPlaceholder() {

-        CTPlaceholder ph = getCTPlaceholder();

-        return ph != null;

-    }

-

-    public Guide getAdjustValue(String name) {

-        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());

-        

-        if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) {

-            for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) {

-                if (g.getName().equals(name)) {

-                    return new Guide(g.getName(), g.getFmla());

-                }

-            }

-        }

-

-        return null;

-    }

-

-    public LineDecoration getLineDecoration() {

-        return new LineDecoration() {

-            public DecorationShape getHeadShape() {

-                return getLineHeadDecoration();

-            }

-

-            public DecorationSize getHeadWidth() {

-                return getLineHeadWidth();

-            }

-

-            public DecorationSize getHeadLength() {

-                return getLineHeadLength();

-            }

-

-            public DecorationShape getTailShape() {

-                return getLineTailDecoration();

-            }

-

-            public DecorationSize getTailWidth() {

-                return getLineTailWidth();

-            }

-

-            public DecorationSize getTailLength() {

-                return getLineTailLength();

-            }

-        };

-    }

-

-    /**

-     * fetch shape fill as a java.awt.Paint

-     *

-     * @return either Color or GradientPaint or TexturePaint or null

-     */

-    public FillStyle getFillStyle() {

-        return new FillStyle() {

-            public PaintStyle getPaint() {

-                return XSLFSimpleShape.this.getFillPaint();

-            }

-        };

-    }

-

-    public StrokeStyle getStrokeStyle() {

-        return new StrokeStyle() {

-            public PaintStyle getPaint() {

-                return XSLFSimpleShape.this.getLinePaint();

-            }

-

-            public LineCap getLineCap() {

-                return XSLFSimpleShape.this.getLineCap();

-            }

-

-            public LineDash getLineDash() {

-                return XSLFSimpleShape.this.getLineDash();

-            }

-

-            public double getLineWidth() {

-                return XSLFSimpleShape.this.getLineWidth();

-            }

-

-            public LineCompound getLineCompound() {

-                return XSLFSimpleShape.this.getLineCompound();

-            }

-

-        };

-    }

-

-    @Override

-    public void setStrokeStyle(Object... styles) {

-        if (styles.length == 0) {

-            // remove stroke

-            setLineColor(null);

-            return;

-        }

-        

-        // TODO: handle PaintStyle

-        for (Object st : styles) {

-            if (st instanceof Number) {

-                setLineWidth(((Number)st).doubleValue());

-            } else if (st instanceof LineCap) {

-                setLineCap((LineCap)st);

-            } else if (st instanceof LineDash) {

-                setLineDash((LineDash)st);

-            } else if (st instanceof LineCompound) {

-                setLineCompound((LineCompound)st);

-            } else if (st instanceof Color) {

-                setLineColor((Color)st);

-            }

-        }

-    }

-    

-    @Override

-    public void setPlaceholder(Placeholder placeholder) {

-        super.setPlaceholder(placeholder);

-    }

-    

-    @Override

-    public XSLFHyperlink getHyperlink() {

-        CTNonVisualDrawingProps cNvPr = getCNvPr();

-        if (!cNvPr.isSetHlinkClick()) {

-            return null;

-        }

-        return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet());

-    }

-    

-    @Override

-    public XSLFHyperlink createHyperlink() {

-        XSLFHyperlink hl = getHyperlink();

-        if (hl == null) {

-            CTNonVisualDrawingProps cNvPr = getCNvPr();

-            hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet());

-        }

-        return hl;

-    }

-

-    private static CTLineProperties getLn(XSLFShape shape, boolean create) {

-        XmlObject pr = shape.getShapeProperties();

-        if (!(pr instanceof CTShapeProperties)) {

-            LOG.log(POILogger.WARN, shape.getClass().toString()+" doesn't have line properties");

-            return null;

-        }

-        

-        CTShapeProperties spr = (CTShapeProperties)pr;

-        return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn();

-    }

+            }
+        } else {
+            geom = dict.get("rect");
+        }
+        return geom;
+    }
+
+    @Override
+    void copy(XSLFShape sh){
+        super.copy(sh);
+
+        XSLFSimpleShape s = (XSLFSimpleShape)sh;
+
+        Color srsSolidFill = s.getFillColor();
+        Color tgtSoliFill = getFillColor();
+        if(srsSolidFill != null && !srsSolidFill.equals(tgtSoliFill)){
+            setFillColor(srsSolidFill);
+        }
+
+        XSLFFillProperties fp = XSLFPropertiesDelegate.getFillDelegate(getShapeProperties());
+        if(fp != null && fp.isSetBlipFill()){
+            CTBlip blip = fp.getBlipFill().getBlip();
+            String blipId = blip.getEmbed();
+
+            String relId = getSheet().importBlip(blipId, s.getSheet().getPackagePart());
+            blip.setEmbed(relId);
+        }
+
+        Color srcLineColor = s.getLineColor();
+        Color tgtLineColor = getLineColor();
+        if(srcLineColor != null && !srcLineColor.equals(tgtLineColor)) {
+            setLineColor(srcLineColor);
+        }
+
+        double srcLineWidth = s.getLineWidth();
+        double tgtLineWidth = getLineWidth();
+        if(srcLineWidth != tgtLineWidth) {
+            setLineWidth(srcLineWidth);
+        }
+
+        LineDash srcLineDash = s.getLineDash();
+        LineDash tgtLineDash = getLineDash();
+        if(srcLineDash != null && srcLineDash != tgtLineDash) {
+            setLineDash(srcLineDash);
+        }
+
+        LineCap srcLineCap = s.getLineCap();
+        LineCap tgtLineCap = getLineCap();
+        if(srcLineCap != null && srcLineCap != tgtLineCap) {
+            setLineCap(srcLineCap);
+        }
+
+    }
+
+    /**
+     * Specifies the line end decoration, such as a triangle or arrowhead.
+     * 
+     * @param style the line end docoration style
+     */
+    public void setLineHeadDecoration(DecorationShape style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();
+        if (style == null) {
+            if (lnEnd.isSetType()) {
+                lnEnd.unsetType();
+            }
+        } else {
+            lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration shape
+     */
+    public DecorationShape getLineHeadDecoration() {
+        CTLineProperties ln = getLn(this, false);
+        DecorationShape ds = DecorationShape.NONE;
+        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetType()) {
+            ds = DecorationShape.fromOoxmlId(ln.getHeadEnd().getType().intValue());
+        }
+        return ds;
+    }
+
+    /**
+     * specifies decoration width of the head of a line.
+     * 
+     * @param style the decoration width 
+     */
+    public void setLineHeadWidth(DecorationSize style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();
+        if (style == null) {
+            if (lnEnd.isSetW()) {
+                lnEnd.unsetW();
+            }
+        } else {
+            lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration width
+     */
+    public DecorationSize getLineHeadWidth() {
+        CTLineProperties ln = getLn(this, false);
+        DecorationSize ds = DecorationSize.MEDIUM;
+        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetW()) {
+            ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getW().intValue());
+        }
+        return ds;
+    }
+
+    /**
+     * Specifies the line end width in relation to the line width.
+     */
+    public void setLineHeadLength(DecorationSize style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        
+        CTLineEndProperties lnEnd = ln.isSetHeadEnd() ? ln.getHeadEnd() : ln.addNewHeadEnd();
+        if (style == null) {
+            if (lnEnd.isSetLen()) {
+                lnEnd.unsetLen();
+            }
+        } else {
+            lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration length
+     */
+    public DecorationSize getLineHeadLength() {
+        CTLineProperties ln = getLn(this, false);
+        
+        DecorationSize ds = DecorationSize.MEDIUM;
+        if (ln != null && ln.isSetHeadEnd() && ln.getHeadEnd().isSetLen()) {
+            ds = DecorationSize.fromOoxmlId(ln.getHeadEnd().getLen().intValue());
+        }
+        return ds; 
+    }
+
+    /**
+     * Specifies the line end decoration, such as a triangle or arrowhead.
+     */
+    public void setLineTailDecoration(DecorationShape style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+
+        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();
+        if (style == null) {
+            if (lnEnd.isSetType()) {
+                lnEnd.unsetType();
+            }
+        } else {
+            lnEnd.setType(STLineEndType.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration shape
+     */
+    public DecorationShape getLineTailDecoration() {
+        CTLineProperties ln = getLn(this, false);
+        
+        DecorationShape ds = DecorationShape.NONE;
+        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetType()) {
+            ds = DecorationShape.fromOoxmlId(ln.getTailEnd().getType().intValue());
+        }
+        return ds;
+    }
+
+    /**
+     * specifies decorations which can be added to the tail of a line.
+     */
+    public void setLineTailWidth(DecorationSize style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        
+        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();
+        if (style == null) {
+            if (lnEnd.isSetW()) {
+                lnEnd.unsetW();
+            }
+        } else {
+            lnEnd.setW(STLineEndWidth.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration width
+     */
+    public DecorationSize getLineTailWidth() {
+        CTLineProperties ln = getLn(this, false);
+        DecorationSize ds = DecorationSize.MEDIUM;
+        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetW()) {
+            ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getW().intValue());
+        }
+        return ds;
+    }
+
+    /**
+     * Specifies the line end width in relation to the line width.
+     */
+    public void setLineTailLength(DecorationSize style) {
+        CTLineProperties ln = getLn(this, true);
+        if (ln == null) {
+            return;
+        }
+        
+        CTLineEndProperties lnEnd = ln.isSetTailEnd() ? ln.getTailEnd() : ln.addNewTailEnd();
+        if (style == null) {
+            if (lnEnd.isSetLen()) {
+                lnEnd.unsetLen();
+            }
+        } else {
+            lnEnd.setLen(STLineEndLength.Enum.forInt(style.ooxmlId));
+        }
+    }
+
+    /**
+     * @return the line end decoration length
+     */
+    public DecorationSize getLineTailLength() {
+        CTLineProperties ln = getLn(this, false);
+        
+        DecorationSize ds = DecorationSize.MEDIUM;
+        if (ln != null && ln.isSetTailEnd() && ln.getTailEnd().isSetLen()) {
+            ds = DecorationSize.fromOoxmlId(ln.getTailEnd().getLen().intValue());
+        }
+        return ds; 
+    }
+
+    public boolean isPlaceholder() {
+        CTPlaceholder ph = getCTPlaceholder();
+        return ph != null;
+    }
+
+    public Guide getAdjustValue(String name) {
+        XSLFGeometryProperties gp = XSLFPropertiesDelegate.getGeometryDelegate(getShapeProperties());
+        
+        if (gp != null && gp.isSetPrstGeom() && gp.getPrstGeom().isSetAvLst()) {
+            for (CTGeomGuide g : gp.getPrstGeom().getAvLst().getGdArray()) {
+                if (g.getName().equals(name)) {
+                    return new Guide(g.getName(), g.getFmla());
+                }
+            }
+        }
+
+        return null;
+    }
+
+    public LineDecoration getLineDecoration() {
+        return new LineDecoration() {
+            public DecorationShape getHeadShape() {
+                return getLineHeadDecoration();
+            }
+
+            public DecorationSize getHeadWidth() {
+                return getLineHeadWidth();
+            }
+
+            public DecorationSize getHeadLength() {
+                return getLineHeadLength();
+            }
+
+            public DecorationShape getTailShape() {
+                return getLineTailDecoration();
+            }
+
+            public DecorationSize getTailWidth() {
+                return getLineTailWidth();
+            }
+
+            public DecorationSize getTailLength() {
+                return getLineTailLength();
+            }
+        };
+    }
+
+    /**
+     * fetch shape fill as a java.awt.Paint
+     *
+     * @return either Color or GradientPaint or TexturePaint or null
+     */
+    public FillStyle getFillStyle() {
+        return new FillStyle() {
+            public PaintStyle getPaint() {
+                return XSLFSimpleShape.this.getFillPaint();
+            }
+        };
+    }
+
+    public StrokeStyle getStrokeStyle() {
+        return new StrokeStyle() {
+            public PaintStyle getPaint() {
+                return XSLFSimpleShape.this.getLinePaint();
+            }
+
+            public LineCap getLineCap() {
+                return XSLFSimpleShape.this.getLineCap();
+            }
+
+            public LineDash getLineDash() {
+                return XSLFSimpleShape.this.getLineDash();
+            }
+
+            public double getLineWidth() {
+                return XSLFSimpleShape.this.getLineWidth();
+            }
+
+            public LineCompound getLineCompound() {
+                return XSLFSimpleShape.this.getLineCompound();
+            }
+
+        };
+    }
+
+    @Override
+    public void setStrokeStyle(Object... styles) {
+        if (styles.length == 0) {
+            // remove stroke
+            setLineColor(null);
+            return;
+        }
+        
+        // TODO: handle PaintStyle
+        for (Object st : styles) {
+            if (st instanceof Number) {
+                setLineWidth(((Number)st).doubleValue());
+            } else if (st instanceof LineCap) {
+                setLineCap((LineCap)st);
+            } else if (st instanceof LineDash) {
+                setLineDash((LineDash)st);
+            } else if (st instanceof LineCompound) {
+                setLineCompound((LineCompound)st);
+            } else if (st instanceof Color) {
+                setLineColor((Color)st);
+            }
+        }
+    }
+    
+    @Override
+    public void setPlaceholder(Placeholder placeholder) {
+        super.setPlaceholder(placeholder);
+    }
+    
+    @Override
+    public XSLFHyperlink getHyperlink() {
+        CTNonVisualDrawingProps cNvPr = getCNvPr();
+        if (!cNvPr.isSetHlinkClick()) {
+            return null;
+        }
+        return new XSLFHyperlink(cNvPr.getHlinkClick(), getSheet());
+    }
+    
+    @Override
+    public XSLFHyperlink createHyperlink() {
+        XSLFHyperlink hl = getHyperlink();
+        if (hl == null) {
+            CTNonVisualDrawingProps cNvPr = getCNvPr();
+            hl = new XSLFHyperlink(cNvPr.addNewHlinkClick(), getSheet());
+        }
+        return hl;
+    }
+
+    private static CTLineProperties getLn(XSLFShape shape, boolean create) {
+        XmlObject pr = shape.getShapeProperties();
+        if (!(pr instanceof CTShapeProperties)) {
+            LOG.log(POILogger.WARN, shape.getClass().toString()+" doesn't have line properties");
+            return null;
+        }
+        
+        CTShapeProperties spr = (CTShapeProperties)pr;
+        return (spr.isSetLn() || !create) ? spr.getLn() : spr.addNewLn();
+    }
 }